![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | -datasheet---mini-rail--portrait-installations---1-.pdf | 2024-01-03 15:02 | 10M | |
![[ ]](/icons/layout.gif) | -datasheet--end-clamp.pdf | 2024-07-18 16:06 | 2.5M | |
![[ ]](/icons/layout.gif) | -datasheet--mid-clamp.pdf | 2024-07-18 16:04 | 2.3M | |
![[ ]](/icons/layout.gif) | -datasheet--mini-rail-landscape-installation-.pdf | 2024-01-03 15:03 | 12M | |
![[ ]](/icons/layout.gif) | -datasheet--plastic-tray--1-.pdf | 2022-11-04 14:41 | 1.4M | |
![[ ]](/icons/layout.gif) | -datasheet-fastensol-plastic-tray-flat-roof-mount---ground-mount.pdf | 2022-11-28 10:28 | 2.2M | |
![[ ]](/icons/layout.gif) | -datasheet0101--a-slate.pdf | 2023-09-28 09:35 | 1.5M | |
![[ ]](/icons/layout.gif) | -datasheet2017--universal-clamp.pdf | 2023-12-21 09:41 | 1.8M | |
![[ ]](/icons/layout.gif) | -datasheet202211---plastic-tray-flat-roof-mount----ground-mount-removed.pdf | 2023-02-08 17:01 | 1.6M | |
![[ ]](/icons/layout.gif) | -datasheet202211--plastic-tray-flat-roof-mount---ground-mount.pdf | 2022-12-14 09:57 | 3.9M | |
![[ ]](/icons/layout.gif) | -en--manual-ecoflow-wave2-20230419.pdf | 2023-08-27 12:19 | 2.6M | |
![[ ]](/icons/layout.gif) | -english--limited-warranty-for-longi-pv-modules--he-single-glass-series--en-20220530.pdf | 2023-07-24 15:35 | 2.6M | |
![[ ]](/icons/layout.gif) | -fronius-primo-5.0-1-EN50438.pdf | 2019-05-20 15:30 | 131K | |
![[ ]](/icons/layout.gif) | -irl-fronius-eco-27.0-3-en50438.pdf | 2019-05-22 15:11 | 188K | |
![[ ]](/icons/layout.gif) | -primo-3.5-1-EN50438.pdf | 2019-05-20 15:27 | 131K | |
![[ ]](/icons/layout.gif) | -tdb--ehs-mono-ht-quiet-for-europe--r32--50hz--hp--ver.2.1-221005.pdf | 2023-01-12 10:34 | 14M | |
![[ ]](/icons/layout.gif) | 0-252fd-252f1-252f4-252f0d14bb8ff42ff9b98d269a1c3dce5a14c51bc2ea-db-iva-se-bi-eu3p-home-backup-interface-enhyv0boqpxn5fh.pdf | 2022-06-16 12:49 | 727K | |
![[ ]](/icons/layout.gif) | 0e21172a7201fc69aa8860b5d5bba92e9.pdf | 2022-10-28 14:14 | 312K | |
![[ ]](/icons/layout.gif) | 01-000615-20200622-longi-solar-data-sheet-lr4-72-hih-420-455w-draft-v01-dg-version-lowres-en.pdf | 2022-06-02 16:08 | 2.1M | |
![[ ]](/icons/layout.gif) | 01-100-101608-main-en.pdf | 2021-09-03 15:28 | 208K | |
![[ ]](/icons/layout.gif) | 01-ev-data-sheet-tower--1-.pdf | 2022-03-25 16:45 | 338K | |
![[ ]](/icons/layout.gif) | 01-ev-data-sheet-tower.pdf | 2022-03-04 12:03 | 338K | |
![[ ]](/icons/layout.gif) | 0389-a1-solshare-wi-fi-faqs.pdf | 2022-11-09 14:52 | 109K | |
![[ ]](/icons/layout.gif) | 04-q.peak-duo-xl-g9.3-440-460-2020-04-rev01-en--1-.pdf | 2021-06-29 14:10 | 1.2M | |
![[ ]](/icons/layout.gif) | 0412-a4-allume-solshare-installation-manual-uk.pdf | 2022-11-09 14:45 | 2.4M | |
![[ ]](/icons/layout.gif) | 0413-a4-allume-solshare35-datasheet-uk.pdf | 2022-11-09 13:52 | 425K | |
![[ ]](/icons/layout.gif) | 0414-e3-allume-solshare-design-installation-guide-uk.pdf | 2022-11-09 14:51 | 469K | |
![[ ]](/icons/layout.gif) | 044.0054307-sph3-6k.pdf | 2023-07-17 10:28 | 6.5M | |
![[ ]](/icons/layout.gif) | 0538-d1-allume-solshare-wiring-schematic-single-neutral-three-pole-uk.pdf | 2022-11-09 14:51 | 194K | |
![[ ]](/icons/layout.gif) | 0822-a1-solshare-warranty-uk--1---1-.pdf | 2024-03-11 11:50 | 136K | |
![[ ]](/icons/layout.gif) | 1-3kw-en50438.pdf | 2019-07-15 08:46 | 167K | |
![[ ]](/icons/layout.gif) | 1-3kw-uk-report-g98.pdf | 2019-09-06 09:16 | 2.9M | |
![[ ]](/icons/layout.gif) | 1-4-th------v1.3--1-.pdf | 2024-03-20 10:29 | 1.1M | |
![[ ]](/icons/layout.gif) | 1-how-to-setup-station-via-app.pdf | 2019-12-17 15:49 | 1.4M | |
![[ ]](/icons/layout.gif) | 1.2mwh-sample-schematic.pdf | 2024-03-13 17:06 | 51K | |
![[ ]](/icons/unknown.gif) | 1st-luna-install-ireland-.docx | 2021-07-20 11:53 | 28K | |
![[ ]](/icons/layout.gif) | 2--soluna-brochure-hv-pack-lfp-10k-15k--2022.pdf | 2022-07-18 16:57 | 2.6M | |
![[ ]](/icons/layout.gif) | 2.--soluna-brochure-eos-5k-battery-2021-2022.pdf | 2021-11-17 10:20 | 3.6M | |
![[ ]](/icons/layout.gif) | 3-6kw-en50438.pdf | 2019-07-15 08:47 | 158K | |
![[ ]](/icons/layout.gif) | 3-phase-hybrid-inverter-20kw-datasheet.pdf | 2024-07-03 10:02 | 249K | |
![[ ]](/icons/layout.gif) | 3.0-6.0kw-en50438-certificate.pdf | 2019-04-15 10:57 | 643K | |
![[ ]](/icons/layout.gif) | 3.1.e650-s650-s4-nmi-eu-type-exam.-certificate-t11132r5.pdf | 2023-07-04 12:48 | 1.6M | |
![[ ]](/icons/layout.gif) | 3d-file-lynx-shunt.pdf | 2020-05-12 12:50 | 266K | |
![[ ]](/icons/layout.gif) | 3ph-riello-mcs.pdf | 2023-11-20 12:31 | 113K | |
![[ ]](/icons/unknown.gif) | 3ph-terminator-install-guide | 2024-02-27 15:42 | 271K | |
![[ ]](/icons/layout.gif) | 4-16kw-technical-data-manual-1-dhw--2-.pdf | 2023-11-17 10:24 | 906K | |
![[ ]](/icons/layout.gif) | 4mm_cable.pdf | 2016-09-12 11:31 | 51K | |
![[ ]](/icons/layout.gif) | 4sqmm-solar-cable.pdf | 2016-09-12 11:31 | 135K | |
![[ ]](/icons/layout.gif) | 5-core-cy-cable.pdf | 2023-09-27 12:16 | 533K | |
![[ ]](/icons/layout.gif) | 5p-battery-only-install---tips.pdf | 2024-04-23 15:01 | 1.2M | |
![[ ]](/icons/layout.gif) | 7-10.5ktlm-g3-datasheet--202106-v1-20210608.pdf | 2022-08-10 14:20 | 4.9M | |
![[ ]](/icons/layout.gif) | 7.5ktlm--g59.pdf | 2018-12-06 10:02 | 252K | |
![[ ]](/icons/layout.gif) | 7.5ktlm-g99-coc.pdf | 2019-04-23 10:58 | 226K | |
![[ ]](/icons/layout.gif) | 10-203-00113-01-wifi3.0-english-installation-guide.pdf | 2024-06-28 11:49 | 3.7M | |
![[ ]](/icons/layout.gif) | 10-203-00128-01-4g-english-installation-guide.pdf | 2024-06-28 11:59 | 517K | |
![[ ]](/icons/layout.gif) | 10-203-00134-00-lan-english-installation-guide.pdf | 2024-06-28 11:55 | 575K | |
![[ ]](/icons/layout.gif) | 10-203-00172-04-h3ac3-english-installation-guide.pdf | 2024-07-12 10:20 | 2.0M | |
![[ ]](/icons/layout.gif) | 10-500-10061-00-h1ac1-english-user-manual.pdf | 2024-06-10 14:17 | 6.3M | |
![[ ]](/icons/layout.gif) | 10-opzv1000-green-2V-tubular-plate-gel.pdf | 2020-03-27 15:04 | 1.0M | |
![[ ]](/icons/layout.gif) | 12-25ktl-m5-certificate-tuv-en50549-1.pdf | 2024-05-22 10:02 | 260K | |
![[ ]](/icons/layout.gif) | 12-25ktl-m5-certificatetuv-g99-1-6.pdf | 2023-03-07 14:55 | 259K | |
![[ ]](/icons/layout.gif) | 13--cyrix--2-.pdf | 2021-07-27 15:40 | 313K | |
![[ ]](/icons/layout.gif) | 15-a-staubli-fuse-datasheet.pdf | 2024-02-09 14:32 | 1.8M | |
![[ ]](/icons/unknown.gif) | 15a-12v-24v-dual-mppt-regulator | 2018-02-14 17:04 | 17K | |
![[ ]](/icons/layout.gif) | 20-33ktl-g2-user-manual.pdf | 2020-03-05 13:10 | 12M | |
![[ ]](/icons/layout.gif) | 20-100w-pole-mounts-intallation-manual.pdf | 2019-12-19 13:43 | 388K | |
![[ ]](/icons/layout.gif) | 20-l-gi-le-pm-t-pmd-059-f130-lr-5-54-hth-415-435-m-30-30-and-15-frame-explorer-dg-v17-2ccb21ba87.pdf | 2023-06-21 11:14 | 6.7M | |
![[ ]](/icons/layout.gif) | 25---home-battery-bat-05k48m0b-01-solaredge-home-battery---low-voltage--ds-000141-eng.pdf | 2022-06-16 12:22 | 734K | |
![[ ]](/icons/layout.gif) | 25l-stainless-steel-buffer---4-x-28mm-connections.pdf | 2022-07-08 15:44 | 402K | |
![[ ]](/icons/layout.gif) | 27tmx-trojan-12V-105Ah-datasheet.pdf | 2018-02-12 13:06 | 914K | |
![[ ]](/icons/layout.gif) | 30kw-g99-panel-model-combined.pdf | 2023-12-19 09:46 | 419K | |
![[ ]](/icons/layout.gif) | 42-0410-2037.pdf | 2024-02-29 11:27 | 8.8M | |
![[ ]](/icons/layout.gif) | 42-0410-2497.pdf | 2024-03-01 15:03 | 856K | |
![[ ]](/icons/layout.gif) | 42-0410-2690--1-.pdf | 2024-05-13 09:53 | 3.5M | |
![[ ]](/icons/layout.gif) | 42-0410-2690.pdf | 2024-02-28 16:48 | 3.5M | |
![[ ]](/icons/layout.gif) | 42-0410-2945.pdf | 2024-04-24 12:16 | 2.1M | |
![[ ]](/icons/layout.gif) | 42-0426-0204-en--1-.pdf | 2024-05-13 09:32 | 3.7M | |
![[ ]](/icons/layout.gif) | 42-0426-0204-en--2-.pdf | 2024-02-28 16:56 | 3.7M | |
![[ ]](/icons/layout.gif) | 42-0426-0204-en.pdf | 2024-02-28 14:42 | 3.7M | |
![[ ]](/icons/layout.gif) | 42-0426-0307-en-compressed-compressed.pdf | 2024-03-01 14:41 | 11M | |
![[ ]](/icons/layout.gif) | 42-0426-0350-en--1-.pdf | 2024-02-21 10:07 | 1.2M | |
![[ ]](/icons/layout.gif) | 42-0426-0350-en.pdf | 2024-03-01 15:03 | 1.2M | |
![[ ]](/icons/layout.gif) | 48V-Victron-Energy-Easysolar-wiring-diagram-with-Pylon-Lithium.pdf | 2020-04-24 12:42 | 2.9M | |
![[ ]](/icons/unknown.gif) | 48V5000VAEasySolar | 2020-04-23 16:49 | 2.9M | |
![[ ]](/icons/layout.gif) | 50kw-g99-panel-midsummer-model.pdf | 2023-12-19 09:48 | 289K | |
![[ ]](/icons/layout.gif) | 50l-inline-volumiser.pdf | 2022-02-18 15:30 | 385K | |
![[ ]](/icons/layout.gif) | 60.-system-ehs-extended-warranty-request-sheet.doc.pdf | 2023-12-19 11:54 | 168K | |
![[ ]](/icons/layout.gif) | 62cb37e0921c0c7e5ec48c29-jinko-solar-warranty-disclosure.pdf | 2023-05-25 09:44 | 678K | |
![[ ]](/icons/layout.gif) | 63eb1d38f03250be5ca594b2-002-00131-00-rev1.0-tigo-ts4-warranty---as-of-2023.02.03---en.pdf | 2023-08-14 16:50 | 127K | |
![[ ]](/icons/layout.gif) | 65-4097i-v1.pdf | 2022-02-14 15:36 | 2.3M | |
![[ ]](/icons/layout.gif) | 80a-fuse.pdf | 2019-07-29 09:20 | 839K | |
![[ ]](/icons/layout.gif) | 100-30-100-50-mppt-solar-charger-manual-pdf-en.pdf | 2022-12-13 17:22 | 6.8M | |
![[ ]](/icons/layout.gif) | 100W-etfe-flexi-solar-panel.pdf | 2017-09-25 10:00 | 740K | |
![[ ]](/icons/layout.gif) | 100W-folding-lightweight-MPPT-solar-panel-Kit-lvp-2x50w-a.pdf | 2020-11-03 13:06 | 186K | |
![[ ]](/icons/layout.gif) | 100kw-g99-panel-midsummer-model.pdf | 2023-12-19 09:48 | 364K | |
![[ ]](/icons/layout.gif) | 100msbuff---midsummer-drawing.pdf | 2022-01-26 15:08 | 366K | |
![[ ]](/icons/layout.gif) | 109-5-robokit-compact-ds-09-17.pdf | 2021-04-06 11:35 | 247K | |
![[ ]](/icons/layout.gif) | 124_600%20cst%20filter%20ball%20valve_ds_10_18.pdf | 2021-08-25 10:56 | 358K | |
![[ ]](/icons/layout.gif) | 125a-isolator-datasheet.pdf | 2020-08-21 16:16 | 507K | |
![[IMG]](/icons/image2.gif) | 130mm-solar-spike-data-sheet.png | 2024-06-26 10:02 | 2.9M | |
![[ ]](/icons/layout.gif) | 150-170l-slimline-pre-plumbed.pdf | 2023-01-27 11:57 | 644K | |
![[ ]](/icons/layout.gif) | 150-210l-small-standard-pre-plumbed.pdf | 2023-01-27 11:58 | 692K | |
![[ ]](/icons/layout.gif) | 150W-flexible-solar-panel-sunpower-solar-cells-new.pdf | 2018-02-12 11:23 | 197K | |
![[ ]](/icons/layout.gif) | 170-50hp-prep-riello--1-.pdf | 2023-10-05 10:40 | 142K | |
![[ ]](/icons/layout.gif) | 170-50hp-prep-riello--2-.pdf | 2024-01-10 16:05 | 122K | |
![[ ]](/icons/layout.gif) | 180-210-250-technical-manual-compressed.pdf | 2024-04-18 13:01 | 10M | |
![[ ]](/icons/layout.gif) | 200-50hp-prep-riello.pdf | 2024-01-10 16:06 | 122K | |
![[ ]](/icons/layout.gif) | 200-50hp-sl-prep-riello.pdf | 2024-01-10 16:07 | 123K | |
![[ ]](/icons/layout.gif) | 200l-packaged-cylinder.pdf | 2023-01-27 12:34 | 766K | |
![[ ]](/icons/layout.gif) | 210-300l-large-std-pre-plumbed.pdf | 2023-01-27 12:34 | 672K | |
![[ ]](/icons/layout.gif) | 224-catalouge.pdf | 2024-04-22 14:39 | 9.9M | |
![[ ]](/icons/layout.gif) | 250-50hp-prep-riello.pdf | 2024-01-10 16:06 | 122K | |
![[ ]](/icons/layout.gif) | 250-50hp-prep-telford.pdf | 2024-05-14 11:11 | 398K | |
![[ ]](/icons/layout.gif) | 300-50hp-prep-riello.pdf | 2024-01-10 16:07 | 122K | |
![[ ]](/icons/unknown.gif) | 350w-datasheet | 2020-06-05 15:30 | 912K | |
![[ ]](/icons/layout.gif) | 400w-datasheet-vertex-de09-en-2020-pa3-web.pdf | 2020-12-15 10:24 | 638K | |
![[ ]](/icons/layout.gif) | 430-p2254-01--1-.pdf | 2024-03-12 11:55 | 405K | |
![[ ]](/icons/layout.gif) | 614.00346.02-x1-ac-user-manual-en.pdf | 2022-08-30 16:01 | 6.4M | |
![[ ]](/icons/layout.gif) | 614.00392.05-x1-boost-g3-user-manual.pdf | 2022-08-09 13:35 | 4.1M | |
![[ ]](/icons/layout.gif) | 614.00393.03-x1-boost-g3-quick-installation-guide.pdf | 2022-08-09 13:36 | 1.7M | |
![[ ]](/icons/layout.gif) | 614.00898.00-x3-hybrid-g4.3-installation-guide-20220704-en--1-.pdf | 2023-03-10 10:10 | 10M | |
![[ ]](/icons/layout.gif) | 646bec4fb6e7b9e55aaaf869-ts4-a-o-15a-datasheet-002-00143-00-rev1.1-20230518.pdf | 2024-02-07 12:13 | 527K | |
![[ ]](/icons/layout.gif) | 1000v-isolator-data-sheet.pdf | 2021-05-19 12:18 | 1.1M | |
![[ ]](/icons/layout.gif) | 1100-3000-en30438-certificate.pdf | 2019-04-12 16:28 | 331K | |
![[ ]](/icons/layout.gif) | 1201-0315-datasheet-longi-solar-lr4-60hpb-345-370m.pdf | 2022-04-06 11:17 | 2.1M | |
![[ ]](/icons/layout.gif) | 2020-trina-325-datasheet.pdf | 2020-07-30 09:44 | 899K | |
![[ ]](/icons/layout.gif) | 2021-sungrow-manufacturer-warranty-distribution-en--1-.pdf | 2023-08-21 13:38 | 399K | |
![[ ]](/icons/layout.gif) | 2021-sungrow-manufacturer-warranty-distribution-en.pdf | 2023-08-16 13:33 | 399K | |
![[ ]](/icons/layout.gif) | 2023-24-solarport-company-brochure.pdf | 2023-11-14 16:59 | 12M | |
![[ ]](/icons/layout.gif) | 2024-04-26-6473d722-bea2-4949-a99e-d0448e1d8062.pdf | 2024-06-17 10:31 | 16M | |
![[ ]](/icons/layout.gif) | 2024-solax-warranty-terms-conditions.pdf | 2024-03-19 11:59 | 1.7M | |
![[ ]](/icons/layout.gif) | 2110-nujd-540-hc-mono-datasheet-en.pdf | 2023-05-08 13:55 | 500K | |
![[ ]](/icons/layout.gif) | 2202-nujc-400b-hc-mono-datasheet-en.pdf | 2022-04-28 14:46 | 542K | |
![[ ]](/icons/layout.gif) | 2208-nujd-545-550-hc-mono-datasheet-en--1-.pdf | 2023-04-11 14:50 | 462K | |
![[ ]](/icons/layout.gif) | 2500mtls-3600mtls-g98.pdf | 2019-04-03 09:44 | 166K | |
![[ ]](/icons/layout.gif) | 3000-tl3s-10000-tl3s-g98.pdf | 2019-04-03 09:50 | 209K | |
![[ ]](/icons/layout.gif) | 3400i-indoor-unit-installation-manual.pdf | 2024-04-16 14:59 | 7.5M | |
![[ ]](/icons/layout.gif) | 4000TL-datasheet.pdf | 2017-05-19 17:23 | 216K | |
![[ ]](/icons/layout.gif) | 4200mtls-5500mtls-g99.pdf | 2019-04-03 09:42 | 403K | |
![[ ]](/icons/layout.gif) | 5213-merchant-tmv-data-sheet.pdf | 2024-04-02 14:24 | 551K | |
![[ ]](/icons/layout.gif) | 6095f0d7da877.pdf | 2021-12-07 12:40 | 397K | |
![[ ]](/icons/layout.gif) | 6381y.pdf | 2022-01-26 13:10 | 428K | |
![[ ]](/icons/layout.gif) | 6410e5fa0e9dad25e1610514-tigo-ts4-a-installation-manual-en-2.0-20230210.pdf | 2024-05-17 10:06 | 515K | |
![[ ]](/icons/layout.gif) | 7001i-aw-installation-manual.pdf | 2022-12-20 11:38 | 5.9M | |
![[ ]](/icons/layout.gif) | 7400i-aw-installation-manual.pdf | 2022-12-20 14:12 | 5.5M | |
![[ ]](/icons/layout.gif) | 9172-manual-bmv-and-smartshunt-pdf-en.pdf | 2023-07-28 13:50 | 6.0M | |
![[ ]](/icons/layout.gif) | 11000-tl3s-15000-tl3s-g99.pdf | 2019-04-03 09:52 | 445K | |
![[ ]](/icons/layout.gif) | 13860-smartsolar-mppt-rs-pdf-en.pdf | 2023-08-30 17:21 | 4.1M | |
![[ ]](/icons/layout.gif) | 14810-ba-t030-nh-sicherungslasttrennschalter-groesse-00-aufbaumontage.pdf | 2019-07-25 16:27 | 4.0M | |
![[ ]](/icons/layout.gif) | 29694-mppt-solar-charger-manual-pdf-en.pdf | 2024-01-16 16:41 | 12M | |
![[ ]](/icons/layout.gif) | 32424-multiplus-ii---quattro-ii-120v-230v-pdf-en.pdf | 2024-04-15 13:19 | 8.5M | |
![[ ]](/icons/layout.gif) | 51845---new-speedflash-instruction-booklet---26-01-24-final.pdf | 2024-02-02 12:59 | 3.2M | |
![[ ]](/icons/layout.gif) | 51845---new-speedflash-instruction-booklet---proof.pdf | 2024-01-18 13:26 | 3.2M | |
![[ ]](/icons/layout.gif) | 64664fa9519eb784b340bdfb-002-00147-00-1.1-qsg-ts4-a-cca-tap-20230515.pdf | 2023-05-26 09:12 | 1.3M | |
![[ ]](/icons/layout.gif) | 113406-energy-meters-pdf-en--3---1-.pdf | 2023-12-12 16:37 | 12M | |
![[ ]](/icons/layout.gif) | 124067-orion-xs-12-12-50a-dc-dc-battery-charger-pdf-en--1-.pdf | 2024-01-25 11:40 | 6.3M | |
![[ ]](/icons/layout.gif) | 124067-orion-xs-12-12-50a-dc-dc-battery-charger-pdf-en.pdf | 2024-01-24 15:39 | 6.3M | |
![[ ]](/icons/layout.gif) | 150810-soloiii-ii-summeroffer.pdf | 2017-05-19 17:23 | 480K | |
![[ ]](/icons/layout.gif) | 172104-172105-172106---lr5-54hpb-390-410wp--all-black-182mm-en.pdf | 2022-07-21 10:34 | 2.0M | |
![[ ]](/icons/layout.gif) | 210715-byd-battery-box-premium-lvl--2021--datasheet-v2.0-en.pdf | 2022-06-24 13:24 | 123K | |
![[ ]](/icons/layout.gif) | 220125-nujc400b-installation-manual-en-sim02e-011a.pdf | 2022-05-03 09:59 | 1.3M | |
![[ ]](/icons/layout.gif) | 220406-datasheet-vertex-s--neg9.28-en-2022-ansicht-final.pdf | 2022-06-06 10:10 | 1.8M | |
![[ ]](/icons/layout.gif) | 240418-byd-battery-box-premium-hvs-hvm-datasheet-v1.9-en-6625be7b46537.pdf | 2024-07-11 08:34 | 145K | |
![[ ]](/icons/layout.gif) | 317211-43443-9650_sbb_301-501_wp_sol_gb_en.pdf | 2022-01-27 11:38 | 2.4M | |
![[ ]](/icons/layout.gif) | 317211-44188-9734-sbb-301-501-wp-sol-gb-en.pdf | 2023-12-04 13:32 | 2.4M | |
![[ ]](/icons/layout.gif) | 324276-43222-9639_wpm_4_bedienung_de_en_fr_it.pdf | 2022-01-27 11:42 | 4.9M | |
![[ ]](/icons/layout.gif) | 327124-43399-9648_hsbc_200_s_(gb)_en.pdf | 2022-01-27 10:55 | 15M | |
![[ ]](/icons/layout.gif) | 342153-43824-9670_wpl-a_05-07_h(k)_230_premium_en.pdf | 2022-01-24 11:56 | 14M | |
![[ ]](/icons/layout.gif) | 348204-43999-9728_sth_210-720-1_plus_de_en_fr_nl_it_es_cs_sk_pl_hu_lt.pdf | 2022-01-24 15:17 | 13M | |
![[ ]](/icons/layout.gif) | 350429-43479-9671_hsbc_300_cool_de_en_fr_nl_it.pdf | 2022-01-27 11:54 | 76M | |
![[ ]](/icons/layout.gif) | 350588-43153-9655_hsbc_180_s_plus_(gb)_en.pdf | 2022-01-27 11:11 | 13M | |
![[ ]](/icons/layout.gif) | 420006-datasheet.pdf | 2021-09-24 15:54 | 186K | |
![[ ]](/icons/layout.gif) | 609516b2c9349.pdf | 2022-01-07 09:45 | 704K | |
![[ ]](/icons/layout.gif) | 742521-info.pdf | 2024-01-15 16:19 | 77K | |
![[ ]](/icons/layout.gif) | 742547-info.pdf | 2024-01-15 16:18 | 97K | |
![[ ]](/icons/layout.gif) | 1000125-en-md22.pdf | 2023-05-08 15:52 | 58K | |
![[ ]](/icons/layout.gif) | 1001164-en-md22.pdf | 2024-05-03 08:56 | 83K | |
![[ ]](/icons/layout.gif) | 1003558-en-md22.pdf | 2024-05-03 08:55 | 58K | |
![[ ]](/icons/layout.gif) | 1003571-en-md22.pdf | 2024-05-03 08:57 | 48K | |
![[ ]](/icons/layout.gif) | 2001881-terragrif-k2sz.pdf | 2023-11-29 18:03 | 128K | |
![[ ]](/icons/layout.gif) | 2002300-en-md22.pdf | 2023-07-24 10:20 | 56K | |
![[ ]](/icons/layout.gif) | 2002546-en-md22.pdf | 2023-07-24 11:27 | 41K | |
![[ ]](/icons/layout.gif) | 2002609-en-md22.pdf | 2023-07-24 10:27 | 52K | |
![[ ]](/icons/layout.gif) | 2002610-en-md22.pdf | 2023-07-24 10:26 | 51K | |
![[ ]](/icons/layout.gif) | 2003150-en-md22.pdf | 2023-07-24 10:23 | 65K | |
![[ ]](/icons/layout.gif) | 2003191-en-md22.pdf | 2023-04-13 16:13 | 62K | |
![[ ]](/icons/layout.gif) | 2003215-crosshook-3s.pdf | 2023-06-02 10:03 | 80K | |
![[ ]](/icons/layout.gif) | 2003249-en-md22.pdf | 2023-07-24 11:08 | 67K | |
![[ ]](/icons/layout.gif) | 2004057-en-md22.pdf | 2024-06-26 11:28 | 58K | |
![[ ]](/icons/layout.gif) | 2004095-en-md22.pdf | 2023-07-24 10:16 | 91K | |
![[ ]](/icons/layout.gif) | 2004096-en-md22.pdf | 2023-07-24 10:19 | 87K | |
![[ ]](/icons/layout.gif) | 2004123-en-md22.pdf | 2023-07-24 10:14 | 60K | |
![[ ]](/icons/layout.gif) | 2004125-en-md22.pdf | 2023-07-24 10:13 | 55K | |
![[ ]](/icons/layout.gif) | 2004144-en-md22.pdf | 2023-07-24 11:15 | 93K | |
![[ ]](/icons/layout.gif) | 2004209-en-md22.pdf | 2023-11-23 10:37 | 50K | |
![[ ]](/icons/layout.gif) | 2150400.pdf | 2021-09-03 11:50 | 73K | |
![[ ]](/icons/layout.gif) | 6098561.50-entrf-en50549.pdf | 2021-04-22 18:22 | 14M | |
![[ ]](/icons/layout.gif) | 11010260-00-manual-stiebel-eltron-sbb-300-trend--1-.pdf | 2023-12-04 13:56 | 4.2M | |
![[ ]](/icons/layout.gif) | 20190510-eo-mini-pro---ce-declaration.pdf | 2019-10-24 09:35 | 80K | |
![[ ]](/icons/layout.gif) | 20200729-technical-datasheets.pdf | 2022-05-11 13:27 | 6.0M | |
![[ ]](/icons/layout.gif) | 20200729_technical_datasheets.pdf | 2021-10-05 12:00 | 6.0M | |
![[ ]](/icons/layout.gif) | 20201123_fs10-ew_en_system_datasheet.pdf | 2021-04-29 10:02 | 122K | |
![[ ]](/icons/layout.gif) | 20210126_fs10-s_fs18-s_en_system_datasheet.pdf | 2021-03-08 11:18 | 119K | |
![[ ]](/icons/layout.gif) | 20210127_all_languages_fs10-s_fs18-s_installationguide.pdf | 2021-03-08 11:17 | 3.2M | |
![[ ]](/icons/layout.gif) | 20210224_all_languages_fs10-ew_installationguide.pdf | 2021-04-29 10:01 | 6.9M | |
![[ ]](/icons/layout.gif) | 20210303-en-flat-roof-enquiry-form.pdf | 2021-09-08 11:13 | 922K | |
![[ ]](/icons/layout.gif) | 20210303-en-pitched-roof-enquiry-form--1-.pdf | 2022-01-14 12:01 | 889K | |
![[ ]](/icons/layout.gif) | 20210303-en-pitched-roof-enquiry-form.pdf | 2021-09-08 11:12 | 889K | |
![[ ]](/icons/layout.gif) | 20210430-longi-limited-warranty-for-longi-pv-modules--he-single-glass-series--en.pdf---magentacloud.pdf | 2022-04-13 13:04 | 1.3M | |
![[ ]](/icons/layout.gif) | 20211206---sunamp-thermino-product-equivalency-list--1-.pdf | 2021-12-13 10:28 | 281K | |
![[ ]](/icons/layout.gif) | 20211206---sunamp-thermino-product-equivalency-list.pdf | 2021-12-13 11:25 | 281K | |
![[ ]](/icons/layout.gif) | 20220323-longi-data-sheet-lr5-54hph-400-420m-dg-version-v04-lowres-en.pdf | 2023-07-28 11:53 | 1.7M | |
![[ ]](/icons/layout.gif) | 20220325-longi-limited-warranty-for-longi-pv-modules--he-single-glass-series--en.pdf | 2022-05-13 11:34 | 918K | |
![[ ]](/icons/layout.gif) | 20220711-cs--alllanguages-installationguide.pdf | 2024-02-26 16:23 | 13M | |
![[ ]](/icons/layout.gif) | 20231108-fs-d-aslate-a-slate-datasheet-issue-2.2-1-.pdf | 2024-07-08 10:23 | 3.7M | |
![[ ]](/icons/layout.gif) | 6721848164-06-cs3400iaws-6-or-s.pdf | 2024-04-16 15:03 | 92K | |
![[ ]](/icons/layout.gif) | 6721852928-7731600271installationandmaintance-compressed.pdf | 2024-05-01 21:34 | 10M | |
![[ ]](/icons/layout.gif) | 6721852929.pdf | 2024-04-18 09:55 | 3.1M | |
![[ ]](/icons/layout.gif) | 6721852929operatinginstructions.pdf | 2024-05-01 21:24 | 3.1M | |
![[ ]](/icons/layout.gif) | 6721873828-7731600271productdatasheet.pdf | 2024-05-01 21:39 | 51K | |
![[ ]](/icons/layout.gif) | 6721873830-7731600272productdatasheet.pdf | 2024-05-01 21:42 | 51K | |
![[ ]](/icons/layout.gif) | 6721873832-7731600273productdatasheet.pdf | 2024-05-01 21:58 | 51K | |
![[ ]](/icons/layout.gif) | 7731600271-no-2.pdf | 2024-04-18 09:34 | 3.1M | |
![[ ]](/icons/layout.gif) | 7738112961.pdf | 2024-04-17 09:02 | 1.2M | |
![[ ]](/icons/layout.gif) | 8750722680technicaldatasheet.pdf | 2024-04-16 15:02 | 92K | |
![[ ]](/icons/layout.gif) | 8750722682datasheet.pdf | 2024-04-16 15:04 | 91K | |
![[ ]](/icons/layout.gif) | 8750722683datasheet.pdf | 2024-04-16 15:05 | 92K | |
![[ ]](/icons/layout.gif) | 8750742716.pdf | 2024-04-17 09:20 | 1.6M | |
![[ ]](/icons/layout.gif) | 8750742716qsg.pdf | 2024-04-17 09:21 | 5.6M | |
![[ ]](/icons/layout.gif) | 320101040304-x1-hybrid-g4.3-user-manual-20230504-en.pdf | 2023-07-10 15:30 | 12M | |
![[ ]](/icons/layout.gif) | 320102066801-pocket-wifi-lan-series-installation-manual-20230331-global--5-.pdf | 2023-12-15 10:51 | 3.9M | |
![[ ]](/icons/layout.gif) | 1610630343370746.pdf | 2021-11-08 10:55 | 2.6M | |
![[ ]](/icons/layout.gif) | 1629121956390427.pdf | 2022-02-03 14:03 | 2.0M | |
![[ ]](/icons/layout.gif) | 20190117131335815.pdf | 2023-11-13 10:40 | 787K | |
![[ ]](/icons/layout.gif) | 1679402217728057047.pdf | 2023-06-06 17:26 | 564K | |
![[ ]](/icons/layout.gif) | A1100-datasheet.pdf | 2017-05-19 17:23 | 549K | |
![[ ]](/icons/layout.gif) | A1140-brochure.pdf | 2017-05-19 17:23 | 1.4M | |
![[ ]](/icons/layout.gif) | A1140-datasheet.pdf | 2017-05-19 17:23 | 599K | |
![[ ]](/icons/unknown.gif) | ABB Aux Datasheet | 2022-02-10 15:46 | 80K | |
![[ ]](/icons/unknown.gif) | ABB ESB100 Datasheet | 2022-02-10 14:52 | 94K | |
![[ ]](/icons/unknown.gif) | ABB ESB100 Manual | 2022-02-10 14:53 | 1.8M | |
![[ ]](/icons/unknown.gif) | ABB ESB Datasheet | 2022-02-10 15:18 | 1.8M | |
![[ ]](/icons/unknown.gif) | ABB ESB Manual | 2022-02-10 15:18 | 94K | |
![[ ]](/icons/layout.gif) | AH-RH-application-pack.pdf | 2021-10-20 12:08 | 5.3M | |
![[ ]](/icons/unknown.gif) | ASWquickinstallASAW3000-5000 | 2023-09-14 11:09 | 3.9M | |
![[ ]](/icons/layout.gif) | Accounts-Admin-Pack.pdf | 2022-10-21 10:38 | 3.1M | |
![[ ]](/icons/layout.gif) | Admin-Assistant-Application-Pack.pdf | 2022-02-10 15:28 | 3.1M | |
![[ ]](/icons/layout.gif) | App-pack-PA22.pdf | 2022-07-07 16:41 | 2.1M | |
![[ ]](/icons/layout.gif) | Application-pack-AH.pdf | 2020-07-09 16:14 | 2.2M | |
![[ ]](/icons/layout.gif) | Application-pack-GS.pdf | 2020-07-09 16:17 | 2.2M | |
![[ ]](/icons/layout.gif) | Application-pack-MO.pdf | 2020-07-09 16:04 | 2.2M | |
![[ ]](/icons/unknown.gif) | Assembly Manual | 2023-06-08 13:30 | 5.9M | |
![[ ]](/icons/layout.gif) | BDE-software-Application-Pack.pdf | 2022-12-09 11:13 | 2.1M | |
![[ ]](/icons/unknown.gif) | Battery Quick Installation Guide | 2023-03-16 16:23 | 6.3M | |
![[ ]](/icons/layout.gif) | Blue-Smart-ip65-a4-2022-smart-230v-en-highres.pdf | 2023-04-28 12:40 | 2.2M | |
![[ ]](/icons/layout.gif) | Bluesolar100V_15A.pdf | 2016-09-12 11:31 | 917K | |
![[ ]](/icons/layout.gif) | Brochure.pdf | 2017-05-19 17:23 | 745K | |
![[ ]](/icons/layout.gif) | CTEK-d250sa-product-sheet-all-languages-print-file-003_low-20161220.pdf | 2018-06-26 09:44 | 210 | |
![[ ]](/icons/unknown.gif) | Certificate of Conformity | 2024-07-11 10:55 | 667K | |
![[ ]](/icons/unknown.gif) | Certificate of conformity | 2024-07-11 12:13 | 667K | |
![[ ]](/icons/layout.gif) | Climatehub-manual.pdf | 2023-06-08 11:48 | 24M | |
![[ ]](/icons/layout.gif) | CommercialTechnicalBrochure.pdf | 2024-02-24 10:18 | 7.7M | |
![[ ]](/icons/layout.gif) | Compress_2000_AWF_Installation_and_Operating_Instructions.pdf | 2024-06-20 16:01 | 38M | |
![[ ]](/icons/layout.gif) | Credit-Terms-and-Conditions.pdf | 2021-01-07 11:24 | 138K | |
![[ ]](/icons/layout.gif) | Crown_6V_220Ah.pdf | 2016-09-12 11:31 | 1.0M | |
![[ ]](/icons/layout.gif) | Crown_6V_305Ah.pdf | 2016-09-12 11:31 | 856K | |
![[ ]](/icons/unknown.gif) | Datasheet | 2019-01-24 10:33 | 130K | |
![[ ]](/icons/layout.gif) | Datasheet-yonos-pico-25-1-6.pdf | 2021-04-20 16:54 | 750K | |
![[ ]](/icons/layout.gif) | Datasheet-yonos-pico-25-1-8.pdf | 2021-04-20 16:54 | 749K | |
![[ ]](/icons/unknown.gif) | Datasheet 3ph | 2024-04-19 08:36 | 161K | |
![[ ]](/icons/unknown.gif) | Datasheet2022 | 2022-12-13 14:46 | 586K | |
![[ ]](/icons/unknown.gif) | Declaration of Conformity | 2024-02-06 13:43 | 37K | |
![[ ]](/icons/layout.gif) | Deks-20-year-warranty.pdf | 2017-06-12 10:30 | 201K | |
![[ ]](/icons/unknown.gif) | Delta 2 Max Manual | 2024-06-18 16:02 | 1.5M | |
![[ ]](/icons/layout.gif) | Dual_Regulator.pdf | 2016-09-12 11:31 | 591K | |
![[ ]](/icons/layout.gif) | EN50438-ireland.pdf | 2019-10-15 08:28 | 191K | |
![[ ]](/icons/unknown.gif) | EN50438Cert | 2021-01-29 11:58 | 215K | |
![[ ]](/icons/layout.gif) | ENP_Midsummer_flyer_GB.pdf | 2021-03-04 10:53 | 186K | |
![[ ]](/icons/unknown.gif) | ERP Fiche | 2023-04-04 12:27 | 238K | |
![[ ]](/icons/unknown.gif) | ESB Aux Manual | 2022-02-10 15:45 | 1.8M | |
![[ ]](/icons/unknown.gif) | ET112 Manual | 2024-01-26 14:38 | 13M | |
![[ ]](/icons/layout.gif) | EUdeclarationofconformity.pdf | 2022-07-07 14:54 | 69K | |
![[ ]](/icons/layout.gif) | Ecodan_ATW_Databook_Vol.6_.0_.pdf | 2024-02-16 13:03 | 74M | |
![[ ]](/icons/layout.gif) | Ejobar-flat-roof-fixing.pdf | 2018-05-02 16:17 | 602K | |
![[ ]](/icons/layout.gif) | Empo-ni-SOL1-MPPT-regulator-manual.pdf | 2016-09-12 11:31 | 765K | |
![[ ]](/icons/unknown.gif) | Enphase Installer Brochure | 2024-05-23 13:47 | 3.2M | |
![[ ]](/icons/layout.gif) | Etracer_Manual_updated.pdf | 2016-09-12 11:31 | 2.0M | |
![[ ]](/icons/layout.gif) | Eurener-Declaration1.pdf | 2021-05-19 12:48 | 183K | |
![[ ]](/icons/layout.gif) | Eurener-Zebra-375W-hole-dimensions.pdf | 2021-07-16 12:49 | 13K | |
![[ ]](/icons/unknown.gif) | Eurener 340 - Datasheet | 2021-12-10 09:31 | 1.2M | |
![[ ]](/icons/layout.gif) | FLXiSun.pdf | 2016-09-12 11:31 | 1.7M | |
![[ ]](/icons/layout.gif) | Finance-Manager-App-Pack.pdf | 2022-04-12 16:45 | 2.2M | |
![[ ]](/icons/unknown.gif) | Firefighter 430Series | 2024-03-12 11:54 | 155K | |
![[ ]](/icons/layout.gif) | Fronius-symo-20.0-3-m-en50438.pdf | 2019-05-22 15:09 | 34K | |
![[ ]](/icons/unknown.gif) | FurtherSLrackroofhookdatasheet | 2023-09-19 14:52 | 3.7M | |
![[ ]](/icons/layout.gif) | G83Growatt3600.pdf | 2017-05-19 17:23 | 172K | |
![[ ]](/icons/layout.gif) | GEO_SoloPV_User manual.pdf | 2017-05-19 17:23 | 2.0M | |
![[ ]](/icons/layout.gif) | GS-Adjustable-Racking-System-Manual.pdf | 2017-05-19 17:23 | 2.1M | |
![[ ]](/icons/layout.gif) | GS-FR-manual.pdf | 2017-05-19 17:23 | 1.4M | |
![[ ]](/icons/layout.gif) | GS-IK-07-manual.pdf | 2017-05-19 17:23 | 1.0M | |
![[ ]](/icons/unknown.gif) | Gen 24 Plus Primo Fronius | 2024-05-15 21:47 | 553K | |
![[ ]](/icons/layout.gif) | Gracesolar-GS-system-solar-mounting.pdf | 2017-06-15 09:07 | 3.5M | |
![[ ]](/icons/layout.gif) | Grasol-AL-Groundmount-Datasheet.pdf | 2017-05-19 17:23 | 698K | |
![[ ]](/icons/layout.gif) | Grasol-MCS-012-certificate.pdf | 2017-05-19 17:23 | 225K | |
![[ ]](/icons/layout.gif) | Grasol-TUV-R 60042481.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/layout.gif) | Grasol-al-ground-mount-manual.pdf | 2017-05-19 17:23 | 1.8M | |
![[ ]](/icons/layout.gif) | Grasol-tilt-leg-datasheet.pdf | 2017-05-19 17:23 | 244K | |
![[ ]](/icons/layout.gif) | Grasol-triangle-mount.pdf | 2017-05-19 17:23 | 445K | |
![[ ]](/icons/layout.gif) | Growat2500MTLdatasheet.pdf | 2017-05-19 17:23 | 277K | |
![[ ]](/icons/layout.gif) | Growatt-1000TL-4000TL-G832-certificate.pdf | 2017-05-19 17:23 | 227K | |
![[ ]](/icons/layout.gif) | Growatt-1000s-1500-s-mini-g83-2-certificate.pdf | 2017-05-19 17:23 | 165K | |
![[ ]](/icons/layout.gif) | Growatt-3600MTL-G59-certificate.pdf | 2017-05-19 17:23 | 175K | |
![[ ]](/icons/layout.gif) | Growatt-10000EU-12000UE-18000UE-20000UE-datasheet.pdf | 2017-05-19 17:23 | 486K | |
![[ ]](/icons/layout.gif) | Growatt-10000UE-12000UE-18000UE-20000UE-g59.pdf | 2017-05-19 17:23 | 175K | |
![[ ]](/icons/layout.gif) | Growatt-10000UE-12000UE-18000UE-20000UE-manual.pdf | 2017-05-19 17:23 | 1.6M | |
![[ ]](/icons/layout.gif) | Growatt-Re-set-upper-voltge-limit.pdf | 2017-05-26 09:46 | 608K | |
![[ ]](/icons/layout.gif) | Growatt-Shine-Country.pdf | 2017-05-26 09:46 | 74K | |
![[ ]](/icons/layout.gif) | Growatt-Shinevision-monitor.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/layout.gif) | Growatt-VDE0126.pdf | 2017-05-26 09:46 | 688K | |
![[ ]](/icons/layout.gif) | Growatt-registration-guide.pdf | 2021-09-01 14:11 | 1.3M | |
![[ ]](/icons/layout.gif) | Growatt-warranty_v1.pdf | 2017-05-19 17:23 | 43K | |
![[ ]](/icons/layout.gif) | Growatt-wifi-datasheet.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/layout.gif) | Growatt 1000-3000-datasheet.pdf | 2017-05-19 17:23 | 165K | |
![[ ]](/icons/layout.gif) | Growatt1000-4000-G832.pdf | 2017-05-19 17:23 | 227K | |
![[ ]](/icons/layout.gif) | Growatt1000TLdatasheet.pdf | 2017-05-19 17:23 | 241K | |
![[ ]](/icons/layout.gif) | Growatt1500TLManual.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/layout.gif) | Growatt3600MTL_Manual.pdf | 2017-05-19 17:23 | 2.9M | |
![[ ]](/icons/layout.gif) | Growatt3600datasheet.pdf | 2017-05-19 17:23 | 2.0M | |
![[ ]](/icons/layout.gif) | Growatt4000TLManual.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/layout.gif) | Growatt 20000TL-photon-review.pdf | 2017-05-19 17:23 | 326K | |
![[ ]](/icons/unknown.gif) | Guide | 2024-06-13 16:19 | 496K | |
![[ ]](/icons/layout.gif) | HPSE-App-pack.pdf | 2022-03-28 16:50 | 2.6M | |
![[ ]](/icons/unknown.gif) | Harmonics test report | 2024-07-11 10:55 | 1.2M | |
![[ ]](/icons/layout.gif) | Huawei-fusion-create-plant.pdf | 2022-01-31 10:29 | 900K | |
![[ ]](/icons/layout.gif) | I-Tracer_manual.pdf | 2016-09-12 11:31 | 1.1M | |
![[ ]](/icons/layout.gif) | IMOsolarrange0222.pdf | 2022-07-08 14:06 | 4.4M | |
![[ ]](/icons/unknown.gif) | Install Guide | 2020-02-10 12:40 | 6.2M | |
![[ ]](/icons/unknown.gif) | Installation Guide | 2024-03-21 17:17 | 9.5M | |
![[ ]](/icons/unknown.gif) | Installation Manual - 8 12 16 | 2021-02-15 21:32 | 9.7M | |
![[ ]](/icons/unknown.gif) | InstallationManutal1500-2000 | 2023-09-14 10:49 | 1.7M | |
![[ ]](/icons/layout.gif) | InstallerGuide3400i.pdf | 2024-04-23 09:59 | 2.9M | |
![[ ]](/icons/unknown.gif) | Inverter User Manual | 2023-03-17 10:16 | 1.9M | |
![[ ]](/icons/layout.gif) | JA-280-datasheet.pdf | 2018-08-15 11:17 | 1.0M | |
![[ ]](/icons/unknown.gif) | K2 Dome 6.10 | 2023-11-29 23:29 | 52K | |
![[ ]](/icons/layout.gif) | KN-PV-guide.pdf | 2017-05-19 17:23 | 3.3M | |
![[ ]](/icons/layout.gif) | KN-PV.pdf | 2017-05-19 17:23 | 3.2M | |
![[ ]](/icons/layout.gif) | LE-300.pdf | 2016-09-12 11:31 | 1.1M | |
![[ ]](/icons/layout.gif) | LE-300_diag.pdf | 2016-09-12 11:31 | 870K | |
![[ ]](/icons/layout.gif) | LE-300_keyfeatures.pdf | 2016-09-12 11:31 | 1.0M | |
![[ ]](/icons/layout.gif) | LE-600-Speciification-Sheet.pdf | 2016-09-12 11:31 | 1.0M | |
![[ ]](/icons/layout.gif) | LE-600_keyfeatures.pdf | 2016-09-12 11:31 | 1.3M | |
![[ ]](/icons/layout.gif) | LE-V50_datasheet.pdf | 2016-09-12 11:31 | 743K | |
![[ ]](/icons/layout.gif) | LE-V50_keyfeatures.pdf | 2016-09-12 11:31 | 1.1M | |
![[ ]](/icons/layout.gif) | LE-V150.pdf | 2016-09-12 11:31 | 733K | |
![[ ]](/icons/layout.gif) | LG-5219-datasheet.pdf | 2017-05-19 17:23 | 175K | |
![[ ]](/icons/layout.gif) | LG-5219-manual.pdf | 2017-05-19 17:23 | 486K | |
![[ ]](/icons/layout.gif) | LG-E110-datasheet.pdf | 2017-05-19 17:23 | 162K | |
![[ ]](/icons/layout.gif) | LG-datasheet-320W-Neon.pdf | 2017-12-05 16:18 | 468K | |
![[IMG]](/icons/image2.gif) | LHS-Lower-L-Shape.jpg | 2018-01-11 17:36 | 138K | |
![[ ]](/icons/layout.gif) | LVP-200W-folding-portable--lightweight-MPPT-solar-panel-2-.pdf | 2020-11-03 13:04 | 181K | |
![[ ]](/icons/layout.gif) | Landis-Gyr-generation-meter-E110-Manual-5.pdf | 2017-05-19 17:23 | 657K | |
![[ ]](/icons/layout.gif) | Landstar-waterproof-10A-controller-IP68.pdf | 2017-10-10 11:32 | 361K | |
![[ ]](/icons/unknown.gif) | Leaflet | 2023-05-04 12:43 | 2.9M | |
![[ ]](/icons/unknown.gif) | Leaflet Heat Exchanger Protection | 2023-05-04 12:44 | 393K | |
![[ ]](/icons/layout.gif) | Longi-300w-datasheet.pdf | 2019-11-18 10:24 | 2.1M | |
![[ ]](/icons/layout.gif) | Longi-Warranty-2020.pdf | 2020-01-09 08:54 | 412K | |
![[ ]](/icons/layout.gif) | MCS012-fastensol-A-slate.pdf | 2024-07-19 13:42 | 276K | |
![[ ]](/icons/layout.gif) | MCS012-ik0197-issue-09-renusol-mounting.pdf | 2024-07-19 13:48 | 298K | |
![[ ]](/icons/layout.gif) | MCS012_report_1.pdf | 2019-01-29 10:10 | 1.0M | |
![[ ]](/icons/unknown.gif) | MCS012_report_2 | 2019-01-29 10:11 | 1.3M | |
![[ ]](/icons/unknown.gif) | MCS Certificate | 2019-11-05 12:53 | 1.7M | |
![[ ]](/icons/layout.gif) | MPPT_TriStar_Data.pdf | 2016-09-12 11:31 | 1.6M | |
![[ ]](/icons/layout.gif) | MT-50_data.pdf | 2016-09-12 11:31 | 510K | |
![[ ]](/icons/unknown.gif) | Manual for UniQ 12 | 2020-08-26 13:30 | 1.1M | |
![[ ]](/icons/layout.gif) | Midsummer-100W-poly-silver-solar-panel.pdf | 2017-06-07 12:02 | 3.0M | |
![[ ]](/icons/layout.gif) | Midsummer-Grad-Pack-23.pdf | 2023-01-24 15:14 | 2.7M | |
![[ ]](/icons/layout.gif) | Midsummer-Ordering-Guide.pdf | 2022-08-25 09:28 | 5.1M | |
![[ ]](/icons/layout.gif) | Midsummer-code.pdf | 2021-04-27 16:11 | 166K | |
![[ ]](/icons/layout.gif) | Midsummer_AH_Pack.pdf | 2022-08-25 17:02 | 2.6M | |
![[ ]](/icons/layout.gif) | Model-value-setting-manual-Growatt.pdf | 2018-02-01 12:40 | 590K | |
![[ ]](/icons/layout.gif) | NH-fuse-switch-datasheet.pdf | 2018-07-05 10:08 | 353K | |
![[ ]](/icons/layout.gif) | Off-Grid-Sales-Engineer-Pack.pdf | 2022-08-24 11:29 | 2.6M | |
![[ ]](/icons/unknown.gif) | Ohmpilot brochure | 2024-06-13 09:48 | 817K | |
![[ ]](/icons/layout.gif) | Ops-Assistant-Glasgow-Pack.pdf | 2022-08-30 12:56 | 2.6M | |
![[ ]](/icons/layout.gif) | PLM-100W-36-cell-monocrystalline-triple-black-solar-panel-datasheet.pdf | 2019-05-29 16:49 | 2.6M | |
![[ ]](/icons/layout.gif) | Panasonic-brochure-datasheet.pdf | 2017-05-19 17:23 | 1.1M | |
![[ ]](/icons/layout.gif) | Perlight-SA8000.pdf | 2021-05-19 12:54 | 1.0M | |
![[ ]](/icons/layout.gif) | Photovoltaic-Solar-Cable-datasheet-PV1-F.pdf | 2017-05-19 17:23 | 217K | |
![[ ]](/icons/unknown.gif) | Pole Mount Bespoke Instructions | 2019-12-18 14:45 | 1.6M | |
![[ ]](/icons/layout.gif) | Pulontech-US2000C-datasheet.pdf | 2020-12-01 14:10 | 644K | |
![[ ]](/icons/layout.gif) | PulsarPlus-datasheet.pdf | 2020-05-22 16:04 | 385K | |
![[ ]](/icons/layout.gif) | PulsarPlus-drill-template.pdf | 2020-05-22 16:04 | 1.5M | |
![[ ]](/icons/layout.gif) | PulsarPlus-installer-manual.pdf | 2020-05-22 16:04 | 1.3M | |
![[ ]](/icons/layout.gif) | PulsarPlus-user-manual.pdf | 2020-05-22 16:04 | 564K | |
![[ ]](/icons/layout.gif) | Q-Cells-285BF-Poly-datasheet.pdf | 2019-02-14 11:04 | 875K | |
![[ ]](/icons/layout.gif) | QCell340G8.pdf | 2020-05-28 12:44 | 1.7M | |
![[ ]](/icons/layout.gif) | QCells-code.pdf | 2021-08-11 14:40 | 339K | |
![[ ]](/icons/layout.gif) | QCells-statement.pdf | 2021-08-11 14:40 | 84K | |
![[ ]](/icons/layout.gif) | QcellsG8datasheet.pdf | 2020-05-28 12:01 | 1.8M | |
![[ ]](/icons/layout.gif) | RT12100G31.pdf | 2023-12-05 16:42 | 34M | |
![[ ]](/icons/layout.gif) | Renusol-ConSole-General-Notes.pdf | 2017-05-19 17:23 | 219K | |
![[ ]](/icons/layout.gif) | Renusol-Console-datasheet.pdf | 2017-05-19 17:23 | 3.6M | |
![[ ]](/icons/layout.gif) | Rutland-913-windcharger-datasheet.pdf | 2016-09-12 11:31 | 228K | |
![[ ]](/icons/layout.gif) | Rutland914idatasheet.pdf | 2016-09-12 11:31 | 200K | |
![[ ]](/icons/layout.gif) | S12-95AGM_datasheet.pdf | 2016-09-12 11:31 | 1.0M | |
![[ ]](/icons/layout.gif) | S12-116AAGM_datasheet.pdf | 2016-09-12 11:31 | 578K | |
![[ ]](/icons/layout.gif) | S12-128AGM_datasheet.pdf | 2016-09-12 11:31 | 893K | |
![[ ]](/icons/layout.gif) | S12-160AGM_datasheet.pdf | 2016-09-12 11:31 | 457K | |
![[ ]](/icons/layout.gif) | S12-230AGM_datasheet.pdf | 2016-09-12 11:31 | 511K | |
![[ ]](/icons/layout.gif) | SEP300-500datasheet.pdf | 2017-05-19 17:23 | 248K | |
![[ ]](/icons/unknown.gif) | SLrackinfohookdoc | 2023-09-19 14:50 | 3.7M | |
![[ ]](/icons/layout.gif) | SP2000-Model-Explanation.pdf | 2018-02-01 12:40 | 85K | |
![[ ]](/icons/layout.gif) | SSE-application-pack.pdf | 2022-12-09 11:14 | 2.1M | |
![[ ]](/icons/layout.gif) | Sales-Associate-Application-Pack.pdf | 2021-12-09 11:06 | 8.5M | |
![[ ]](/icons/layout.gif) | Sales-Associate-Glasgow-Pack.pdf | 2022-08-30 12:56 | 2.6M | |
![[ ]](/icons/layout.gif) | Samsung-Sunamp.pdf | 2021-04-15 15:44 | 3.1M | |
![[ ]](/icons/layout.gif) | Sapphire-300-MCS.pdf | 2018-08-21 16:16 | 301K | |
![[ ]](/icons/layout.gif) | Sapphire-300-datasheet.pdf | 2018-08-21 16:18 | 488K | |
![[ ]](/icons/layout.gif) | Set-up-instructions.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/compressed.gif) | ShineCountry-V1.0.exe_.zip | 2018-02-01 12:54 | 100K | |
![[ ]](/icons/layout.gif) | Smart-instructions.pdf | 2017-05-19 17:23 | 1.6M | |
![[ ]](/icons/unknown.gif) | Smart Meter Flow chart | 2024-06-13 09:50 | 289K | |
![[ ]](/icons/layout.gif) | Software-Support-Executive-Application-Pack.pdf | 2022-09-16 11:17 | 2.1M | |
![[IMG]](/icons/image2.gif) | SolFiT-LHS-upper.jpg | 2018-01-12 16:17 | 144K | |
![[IMG]](/icons/image2.gif) | SolFiT-RHS-Lower.jpg | 2018-01-12 16:22 | 133K | |
![[ ]](/icons/unknown.gif) | SolFiT-RHS-Upper | 2018-01-12 16:23 | 134K | |
![[ ]](/icons/layout.gif) | Solar-Cache-Datasheet-2pages.pdf | 2017-05-19 17:23 | 1.0M | |
![[ ]](/icons/layout.gif) | Solar-Cache-Datasheet-4pages.pdf | 2017-05-19 17:23 | 1.3M | |
![[ ]](/icons/layout.gif) | Solar-Cache-Installation-guide.pdf | 2017-05-19 17:23 | 370K | |
![[ ]](/icons/layout.gif) | Solar-Cache-User-Guide.pdf | 2017-05-19 17:23 | 462K | |
![[ ]](/icons/layout.gif) | Solar-Cache-touch-brochure.pdf | 2017-05-19 17:23 | 844K | |
![[ ]](/icons/layout.gif) | SolarCache-functions-troubleshooting.pdf | 2017-05-19 17:23 | 419K | |
![[ ]](/icons/layout.gif) | SolarCache-installation-instructions.pdf | 2017-05-19 17:23 | 672K | |
![[ ]](/icons/layout.gif) | SolarCache-instructions.pdf | 2017-05-19 17:23 | 776K | |
![[ ]](/icons/layout.gif) | SolarCache-solar-immersion-controller.pdf | 2017-05-19 17:23 | 289K | |
![[ ]](/icons/layout.gif) | SolarEdge-EV-webinar-Midsummer.pdf | 2020-05-21 16:54 | 1.9M | |
![[ ]](/icons/layout.gif) | SolarEdge-g59-4k-17k.pdf | 2018-10-19 13:12 | 198K | |
![[ ]](/icons/layout.gif) | SolarEdge-g59-25k-2680.pdf | 2018-10-19 14:19 | 195K | |
![[ ]](/icons/layout.gif) | SolarEdge-g59-1000-2500.pdf | 2018-10-19 13:09 | 215K | |
![[ ]](/icons/unknown.gif) | SolarEdge-g59-2200-3680 | 2018-10-19 12:58 | 453K | |
![[ ]](/icons/layout.gif) | SolarEdge-g59-2200-3680.pdf | 2018-10-19 12:59 | 453K | |
![[ ]](/icons/unknown.gif) | SolarEdge-g59-4000-6000 | 2018-10-19 13:03 | 195K | |
![[ ]](/icons/layout.gif) | SolarEdge-g59-4000-6000.pdf | 2018-10-19 13:05 | 195K | |
![[ ]](/icons/unknown.gif) | SolarEdge EnergyBank Provisional Datasheet | 2021-07-26 10:16 | 296K | |
![[ ]](/icons/layout.gif) | SolarEdgeWi-FiModuleKitSE1000-WIFI01Datasheet.pdf | 2017-05-19 17:23 | 418K | |
![[ ]](/icons/layout.gif) | Solarport22panelpackingliist-.pdf | 2024-03-04 09:40 | 71K | |
![[ ]](/icons/layout.gif) | Solax-3ph-meter-manual.pdf | 2019-08-14 13:10 | 621K | |
![[ ]](/icons/layout.gif) | Solax-meter-chint-Datasheet.pdf | 2020-01-10 10:45 | 527K | |
![[ ]](/icons/unknown.gif) | Solion-roof-planner.xlsm | 2017-05-19 17:20 | 1.7M | |
![[ ]](/icons/layout.gif) | Solis-3P-80-110K-5G-Manual-EN.pdf | 2020-11-19 13:52 | 16M | |
![[ ]](/icons/layout.gif) | Solis-data-logging-box.pdf | 2020-10-01 10:47 | 127K | |
![[ ]](/icons/layout.gif) | Solis-monitoring-wifi-box-manual-v1-0.pdf | 2020-10-01 10:48 | 6.8M | |
![[ ]](/icons/layout.gif) | Solis-s5-gr1p-0.7-3.6-k-m-g100-cert.pdf | 2021-04-26 17:16 | 124K | |
![[ ]](/icons/layout.gif) | Solis-s5-gr1p-2.5-6-k-g100-cert.pdf | 2021-04-26 17:26 | 127K | |
![[ ]](/icons/layout.gif) | Solo-II-PV-Datasheet.pdf | 2017-05-19 17:23 | 400K | |
![[ ]](/icons/layout.gif) | SunLight_Data.pdf | 2016-09-12 11:31 | 226K | |
![[ ]](/icons/unknown.gif) | Sungrow Hybrid Datasheet | 2024-04-22 14:09 | 1.9M | |
![[ ]](/icons/layout.gif) | Sunlight_Manual.pdf | 2016-09-12 11:31 | 97K | |
![[ ]](/icons/layout.gif) | TE21-AP.pdf | 2021-08-12 17:06 | 6.3M | |
![[ ]](/icons/unknown.gif) | Telford Tempest | 2023-10-05 17:18 | 841K | |
![[ ]](/icons/layout.gif) | Thermino-hp-SG-datasheet.pdf | 2023-06-08 11:58 | 787K | |
![[ ]](/icons/unknown.gif) | Tolerance Table | 2022-01-11 11:55 | 1.8M | |
![[ ]](/icons/layout.gif) | Tracer_BN_Datasheet.pdf | 2016-09-12 11:31 | 650K | |
![[ ]](/icons/layout.gif) | Tracer_BN_Manual.pdf | 2016-09-12 11:31 | 968K | |
![[ ]](/icons/layout.gif) | Tristar-remote-meter-manual.pdf | 2016-09-12 11:31 | 212K | |
![[ ]](/icons/layout.gif) | UI-UX-Pack.pdf | 2022-09-20 13:53 | 2.1M | |
![[ ]](/icons/unknown.gif) | UK Brochure | 2018-11-13 12:48 | 1.8M | |
![[ ]](/icons/unknown.gif) | UK Tech Support | 2023-11-16 08:36 | 94K | |
![[ ]](/icons/unknown.gif) | UPMM-Datasheet | 2022-10-18 08:45 | 7.3M | |
![[ ]](/icons/unknown.gif) | User Manual | 2023-03-17 10:20 | 2.8M | |
![[ ]](/icons/layout.gif) | VBHN245SJ25_PEWEU_EN.pdf | 2017-05-19 17:23 | 839K | |
![[ ]](/icons/layout.gif) | Victron-Multiplus-manual.pdf | 2016-09-12 11:31 | 1.9M | |
![[ ]](/icons/layout.gif) | Victron-Multiplus-manual5000.pdf | 2016-09-12 11:31 | 2.1M | |
![[ ]](/icons/layout.gif) | Victron_75_15A_manual.pdf | 2016-09-12 11:31 | 805K | |
![[ ]](/icons/layout.gif) | Warranty.pdf | 2022-06-06 15:08 | 918K | |
![[ ]](/icons/layout.gif) | Wilo-yonos-PICO-manual.pdf | 2021-04-19 15:23 | 2.7M | |
![[ ]](/icons/layout.gif) | X1-Matebox-Installation-Guide.pdf | 2022-09-02 15:06 | 14M | |
![[ ]](/icons/layout.gif) | ZLPOWER_DATA_SHEET.pdf | 2016-09-12 11:31 | 471K | |
![[ ]](/icons/layout.gif) | ZLPOWER_Manual.pdf | 2016-09-12 11:31 | 1.2M | |
![[ ]](/icons/unknown.gif) | Ziehl UFR1001E Datasheet | 2022-02-11 13:33 | 642K | |
![[ ]](/icons/unknown.gif) | Ziehl UFR1001E Manual | 2022-02-11 13:33 | 2.6M | |
![[ ]](/icons/unknown.gif) | ] | 2023-09-07 12:57 | 784K | |
![[ ]](/icons/layout.gif) | _hsbc_200_s_gb_set.product.pdf | 2022-01-27 10:54 | 167K | |
![[ ]](/icons/layout.gif) | _sth_210_plus_.product.pdf | 2022-01-24 15:17 | 385K | |
![[ ]](/icons/unknown.gif) | _u_installationsanleitungen | 2022-01-19 15:28 | 0 | |
![[ ]](/icons/layout.gif) | a-slate-installation-instructions.pdf | 2024-02-02 10:28 | 1.4M | |
![[ ]](/icons/layout.gif) | a-slate-p-slate-installation-use-and-maintenance-instructions-v2.7-1---1-.pdf | 2024-07-08 10:23 | 1.2M | |
![[ ]](/icons/layout.gif) | a4-product-flyer-charge-portal.pdf | 2023-04-22 07:11 | 1.7M | |
![[ ]](/icons/layout.gif) | a667e6a0268f513d593a6fcaf213a5cd.pdf | 2022-11-24 13:50 | 10M | |
![[ ]](/icons/layout.gif) | a80748ad36e5b7ff5f4b307ad5db5d16.pdf | 2023-11-06 12:16 | 3.2M | |
![[ ]](/icons/layout.gif) | about-longi.pdf | 2019-10-24 10:37 | 6.0M | |
![[ ]](/icons/layout.gif) | ac-coupled-en50438-ireland-.pdf | 2020-02-06 11:36 | 442K | |
![[ ]](/icons/layout.gif) | ac-coupled-inverter-user-manual.pdf | 2023-10-16 16:16 | 944K | |
![[ ]](/icons/layout.gif) | ac-ef-type2-brackets-tds.pdf | 2023-06-13 09:32 | 448K | |
![[ ]](/icons/layout.gif) | acceptance-of-enforcement-undertaking---wallbox-uk-ltd.pdf | 2022-09-16 11:41 | 218K | |
![[ ]](/icons/layout.gif) | accounts-administrator.pdf | 2023-07-20 16:21 | 5.0M | |
![[ ]](/icons/layout.gif) | ael-tf-32-datasheet.pdf | 2019-01-30 17:16 | 123K | |
![[ ]](/icons/layout.gif) | ael-tf-32-mid-certificate.pdf | 2019-01-30 17:16 | 661K | |
![[ ]](/icons/layout.gif) | ael-tf-32-user-manual.pdf | 2019-01-30 17:17 | 1.1M | |
![[ ]](/icons/layout.gif) | aico-data-sheet-ei650irf--1-.pdf | 2024-02-12 12:44 | 678K | |
![[ ]](/icons/unknown.gif) | aio1-datasheet | 2022-05-16 15:27 | 519K | |
![[ ]](/icons/layout.gif) | aio1-universal-warranty.pdf | 2021-10-12 13:48 | 0 | |
![[ ]](/icons/layout.gif) | aio2-customer-handover-booklet.pdf | 2021-11-16 11:12 | 666K | |
![[ ]](/icons/layout.gif) | aio2-ess-datasheet--1-.pdf | 2021-04-08 16:26 | 1.3M | |
![[ ]](/icons/layout.gif) | aio2-ess-datasheet-battery-only-v1.0.pdf | 2021-04-19 19:15 | 100K | |
![[ ]](/icons/layout.gif) | aio2-warranty-v1.0.pdf | 2021-04-19 19:09 | 313K | |
![[ ]](/icons/layout.gif) | aio2_customer_handover_booklet.pdf | 2021-10-12 13:48 | 0 | |
![[ ]](/icons/layout.gif) | aisw-asw45-60k-lt-unbed-en50549-1-2019-u23-0492-irl.pdf | 2023-10-12 09:20 | 305K | |
![[ ]](/icons/layout.gif) | aisw-asw1000-3000s-s-unbed-en50549-1-2019-u23-0362-irl.pdf | 2023-09-14 15:44 | 462K | |
![[ ]](/icons/layout.gif) | aisw-aswxxk-lt-g2-pro-unbed-en-50549-1-typ-a-eng-u22-0372.pdf | 2022-12-08 15:15 | 352K | |
![[ ]](/icons/layout.gif) | aisw-aswxxk-lt-g3-unbed-en-50549-irl-u22-0726-en.pdf | 2023-08-04 09:22 | 688K | |
![[ ]](/icons/layout.gif) | ak-60171108-001--en-extsigned.pdf | 2023-07-17 14:27 | 2.0M | |
![[ ]](/icons/layout.gif) | ak-60174480-0001--ireland-iq8-enphase.pdf | 2024-05-08 16:37 | 1.6M | |
![[ ]](/icons/layout.gif) | all-in-one-3.6-datasheet--jan-2024--3-2.pdf | 2024-01-18 12:18 | 712K | |
![[ ]](/icons/layout.gif) | all-in-one-3.6-datasheet--jan-2024--4.pdf | 2024-01-22 14:20 | 627K | |
![[ ]](/icons/layout.gif) | all-in-one-installation-manual--june-2023-.pdf | 2023-06-02 09:46 | 3.9M | |
![[ ]](/icons/layout.gif) | all-in-one-installation-manual.pdf | 2023-11-10 12:54 | 4.5M | |
![[ ]](/icons/layout.gif) | all-in-one-product-brochure--june-2023-.pdf | 2023-06-02 09:49 | 1.8M | |
![[ ]](/icons/layout.gif) | all-in-one-product-brochure-2023.pdf | 2023-10-16 15:22 | 954K | |
![[ ]](/icons/layout.gif) | altecnic-flush-fill-valve-datasheet.pdf | 2021-03-26 11:03 | 318K | |
![[ ]](/icons/layout.gif) | altenic-auto-bypass-valve-datasheet.pdf | 2021-03-26 10:27 | 173K | |
![[ ]](/icons/layout.gif) | alumero-warranty-mounting-systems-english.pdf | 2023-02-24 15:04 | 557K | |
![[ ]](/icons/layout.gif) | amass-battery-warranty-terms-and-condition.pdf | 2019-12-13 09:21 | 81K | |
![[ ]](/icons/layout.gif) | amass-storage-gtx2000-setting.pdf | 2022-06-24 13:09 | 624K | |
![[ ]](/icons/layout.gif) | amass-storge-battery-setting.pdf | 2020-06-08 11:42 | 445K | |
![[ ]](/icons/layout.gif) | ambiente-ufh-controls-summary.pdf | 2024-06-07 12:38 | 655K | |
![[ ]](/icons/layout.gif) | ambienteufh-systems-summary.pdf | 2024-06-07 12:38 | 1.3M | |
![[ ]](/icons/layout.gif) | application-note-intercompatibility-se-power-optimizers.pdf | 2023-06-06 13:51 | 305K | |
![[ ]](/icons/layout.gif) | application-pack-AH-Dublin.pdf | 2020-11-05 16:01 | 612K | |
![[ ]](/icons/layout.gif) | application-pack.pdf | 2020-11-05 15:48 | 612K | |
![[ ]](/icons/layout.gif) | aps-ecu-datasheet.pdf | 2017-05-19 17:23 | 1.4M | |
![[ ]](/icons/layout.gif) | aps-ecu-manual.pdf | 2017-05-19 17:23 | 1.5M | |
![[ ]](/icons/layout.gif) | aps-ecu-quick-guide.pdf | 2017-05-19 17:23 | 506K | |
![[ ]](/icons/layout.gif) | aps-portal-guide.pdf | 2017-05-19 17:23 | 566K | |
![[ ]](/icons/layout.gif) | aps-rma.pdf | 2017-05-19 17:23 | 362K | |
![[ ]](/icons/layout.gif) | aps-troubleshooting-guides.pdf | 2019-01-28 13:45 | 1.0M | |
![[ ]](/icons/layout.gif) | aps-warranty.pdf | 2017-05-19 17:23 | 316K | |
![[ ]](/icons/layout.gif) | aps-yc500i-datasheet.pdf | 2017-05-19 17:23 | 771K | |
![[ ]](/icons/layout.gif) | aps-yc500i-g59-3.pdf | 2017-05-19 17:23 | 316K | |
![[ ]](/icons/layout.gif) | aps-yc500i-g83-1.pdf | 2017-05-19 17:23 | 200K | |
![[ ]](/icons/layout.gif) | aps-yc500i-g83-2.pdf | 2017-05-19 17:23 | 209K | |
![[ ]](/icons/layout.gif) | aps-yc500i-manual.pdf | 2017-05-19 17:23 | 4.7M | |
![[ ]](/icons/layout.gif) | apx-5.0-30.0p-s1-quick-guide-en-202308-compressed.pdf | 2023-12-21 12:55 | 9.7M | |
![[ ]](/icons/layout.gif) | apx-5.0-30.0p-s1-user-manual-en-202308--1-.pdf | 2023-12-21 12:51 | 12M | |
![[ ]](/icons/layout.gif) | apx-hv-battery-datasheet-en-202305.pdf | 2024-05-21 15:54 | 2.9M | |
![[ ]](/icons/layout.gif) | apx-hv-battery-datasheet-en-202307.pdf | 2024-05-16 10:35 | 2.9M | |
![[ ]](/icons/layout.gif) | arcbox-brochure-datasheet.pdf | 2024-06-04 16:06 | 1.1M | |
![[ ]](/icons/layout.gif) | arcbox-brochure.pdf | 2023-07-06 11:51 | 593K | |
![[ ]](/icons/layout.gif) | arcbox-installation-guide.pdf | 2023-07-06 11:53 | 251K | |
![[ ]](/icons/layout.gif) | arotherm-plus-add-ons.pdf | 2022-10-13 16:24 | 26K | |
![[ ]](/icons/layout.gif) | arotherm-plus-anti-vibration-feet-small-quick-guide-1824251.pdf | 2022-10-17 16:25 | 773K | |
![[ ]](/icons/layout.gif) | arotherm-plus-datasheet.pdf | 2021-06-22 10:15 | 1.7M | |
![[ ]](/icons/layout.gif) | arotherm-plus-floor-epp-insulation-kit-quick-guide-1824254.pdf | 2022-10-17 16:49 | 3.4M | |
![[ ]](/icons/layout.gif) | arotherm-plus-operating-installation-manual.pdf | 2021-06-22 10:14 | 6.1M | |
![[ ]](/icons/layout.gif) | arotherm-plus-quickguide.pdf | 2021-06-22 10:14 | 9.2M | |
![[ ]](/icons/layout.gif) | arotherm-plus-schematic.pdf | 2021-06-22 10:15 | 4.8M | |
![[ ]](/icons/layout.gif) | arotherm-plus-straight-pipe-connection-kit-quick-guide-1824257.pdf | 2022-10-17 16:44 | 1.3M | |
![[ ]](/icons/layout.gif) | arotherm-plus-wall-brackets-for-insulated-walls-quick-guide-1824264.pdf | 2022-10-17 16:01 | 2.6M | |
![[ ]](/icons/layout.gif) | arotherm-plus-wall-brackets-for-non-insulated-walls-quick-guide-1824265.pdf | 2022-10-17 16:41 | 2.3M | |
![[ ]](/icons/layout.gif) | arotherm-plus-wall-eep-insulation-kit-quick-guide-1824266.pdf | 2022-10-17 16:38 | 2.5M | |
![[ ]](/icons/layout.gif) | arotherm-split-datasheet.pdf | 2021-06-22 10:56 | 1.7M | |
![[ ]](/icons/layout.gif) | arotherm-split-manual.pdf | 2021-06-22 10:57 | 5.8M | |
![[ ]](/icons/layout.gif) | as230-endusersguide.pdf | 2017-05-19 17:23 | 495K | |
![[ ]](/icons/layout.gif) | atle-2022.pdf | 2024-05-09 16:17 | 262K | |
![[ ]](/icons/layout.gif) | auo-bravo-320-330-datasheet.pdf | 2019-04-09 15:40 | 1.2M | |
![[ ]](/icons/layout.gif) | auo-manual-v202.pdf | 2019-04-09 15:41 | 1.8M | |
![[ ]](/icons/layout.gif) | auo-mcs-2018.pdf | 2019-04-09 15:41 | 252K | |
![[ ]](/icons/layout.gif) | auo-warranty.pdf | 2019-04-09 15:42 | 64K | |
![[ ]](/icons/layout.gif) | authorized-distributor-certificate-en-midsummer-energy.pdf | 2022-04-21 10:07 | 459K | |
![[ ]](/icons/layout.gif) | authorized-distributor-certificate.pdf | 2022-04-21 09:35 | 459K | |
![[ ]](/icons/layout.gif) | autocharge-ev-ftu-superfast-data-sheet---02.pdf | 2019-05-21 12:45 | 2.8M | |
![[ ]](/icons/layout.gif) | autocharge-ev-token-mech-payg-superfast-data-sheet---02.pdf | 2019-05-21 12:46 | 3.2M | |
![[ ]](/icons/layout.gif) | automatic-generator-start-stop-en--5-.pdf | 2023-06-28 13:23 | 316K | |
![[ ]](/icons/layout.gif) | awe-indoor-unit--awe-5-9---13-17--installation-manual.pdf | 2022-12-20 12:57 | 7.0M | |
![[ ]](/icons/layout.gif) | axe-battery-rohs.pdf | 2023-05-11 16:00 | 2.2M | |
![[ ]](/icons/layout.gif) | axe-manual.pdf | 2023-05-11 16:00 | 2.9M | |
![[ ]](/icons/layout.gif) | axe-quick-guide.pdf | 2023-05-11 16:00 | 2.0M | |
![[ ]](/icons/layout.gif) | babt-8771-r08-mcs-certificate.pdf | 2022-05-26 17:25 | 275K | |
![[ ]](/icons/layout.gif) | babt-8771-r09-mcs-certificate.pdf | 2023-07-24 15:36 | 2.7M | |
![[ ]](/icons/layout.gif) | babt-8806-r0-mcs-certificate--.pdf | 2022-08-22 17:16 | 846K | |
![[ ]](/icons/layout.gif) | babt8770-r0-certificate-draft.pdf | 2019-09-10 10:11 | 142K | |
![[ ]](/icons/layout.gif) | backup.pdf | 2023-06-12 14:03 | 1.0M | |
![[ ]](/icons/layout.gif) | ballasted-cc.pdf | 2023-10-12 15:11 | 77K | |
![[ ]](/icons/layout.gif) | ballasted.pdf | 2024-02-15 17:24 | 77K | |
![[ ]](/icons/layout.gif) | basic-charge-ev-pedestal-installation-sheet.pdf | 2019-05-21 12:54 | 37K | |
![[ ]](/icons/layout.gif) | basic-charge-ev-pedestal-superfast-installation-sheet.pdf | 2019-05-21 12:55 | 34K | |
![[ ]](/icons/layout.gif) | basiccharge-ev-ftu-data-sheet---02.pdf | 2019-05-21 12:41 | 3.7M | |
![[ ]](/icons/layout.gif) | basiccharge-ev-ftu-superfast-data-sheet---02.pdf | 2019-05-21 12:42 | 3.8M | |
![[ ]](/icons/layout.gif) | basicrail-assembly-en.pdf | 2024-06-24 10:27 | 2.7M | |
![[ ]](/icons/layout.gif) | basicrail-brochure-en.pdf | 2024-06-24 10:27 | 118K | |
![[ ]](/icons/layout.gif) | basicrail-d-dome-6-assembly-en.pdf | 2024-06-24 10:28 | 3.3M | |
![[ ]](/icons/layout.gif) | basicrail-s-dome-6-assembly-en.pdf | 2024-06-24 10:28 | 3.6M | |
![[ ]](/icons/layout.gif) | batten-plan-gse-in-roof-system-en-v3.0.pdf | 2023-05-05 11:41 | 6.8M | |
![[ ]](/icons/layout.gif) | battery-box-premium-hvs-hvm-operating-manual-080421.pdf | 2021-04-08 16:44 | 8.3M | |
![[ ]](/icons/layout.gif) | battery-box-premium-lv-bmu---ip55-instruction-manual-v1.3.pdf | 2022-06-24 13:34 | 3.2M | |
![[ ]](/icons/layout.gif) | battery-cable-compatibility-guide-compressed.pdf | 2023-05-18 12:39 | 468K | |
![[ ]](/icons/layout.gif) | battery-care.pdf | 2018-01-02 09:26 | 100K | |
![[ ]](/icons/unknown.gif) | battery-charger-dc-dc-ring-wiring-diagram | 2018-02-14 10:03 | 22K | |
![[ ]](/icons/layout.gif) | battery-monitor-wiring-diagram.pdf | 2016-09-12 11:31 | 1.5M | |
![[ ]](/icons/layout.gif) | battery-rack-installation-manual-v1.0.pdf | 2024-05-13 12:29 | 430K | |
![[ ]](/icons/unknown.gif) | battery_compatibility:can-bus_bms-cable#introduction | 2021-07-15 09:35 | 19K | |
![[ ]](/icons/layout.gif) | bb-tool-starterkit-en-1.pdf | 2023-05-16 17:36 | 1.8M | |
![[ ]](/icons/layout.gif) | bb125-installation-manual.pdf | 2021-11-25 09:11 | 4.8M | |
![[ ]](/icons/layout.gif) | bba-en-cert.pdf | 2023-05-05 14:24 | 174K | |
![[ ]](/icons/layout.gif) | bd040111-3039-4c93-824d-f528c7b79c4f.pdf | 2020-01-16 12:05 | 427K | |
![[ ]](/icons/layout.gif) | bg-enclosure-datasheet-280121.pdf | 2021-01-28 16:55 | 226K | |
![[ ]](/icons/layout.gif) | bird-blocker-datablad-box-clip-pre-clip-v-23-02-01-en-digital-36d6bd89e8.pdf | 2024-07-17 16:11 | 357K | |
![[ ]](/icons/layout.gif) | birdblocker-brochure-en-1.pdf | 2023-05-16 17:35 | 2.7M | |
![[ ]](/icons/layout.gif) | birdblocker-datasheet-installation-en-v6.pdf | 2019-07-12 15:22 | 5.3M | |
![[ ]](/icons/layout.gif) | birdblocker-manual-bb125-english-v00-03.pdf | 2023-11-03 15:27 | 4.8M | |
![[ ]](/icons/layout.gif) | birdblocker-tool.pdf | 2021-11-24 16:47 | 1.4M | |
![[ ]](/icons/layout.gif) | bluesolar-mppt-datasheet-100-30---100-50.pdf | 2022-12-14 13:40 | 240K | |
![[ ]](/icons/layout.gif) | bluetooth-safety-guide.pdf | 2022-09-06 16:31 | 1.3M | |
![[ ]](/icons/layout.gif) | blygold-uk-ltd-introduction.pdf | 2023-05-04 12:43 | 258K | |
![[ ]](/icons/layout.gif) | bms-parallel-box-ii--1-.pdf | 2023-06-09 13:15 | 2.7M | |
![[ ]](/icons/layout.gif) | bms-parallel-box-quick-installation-guide-en.pdf | 2023-11-27 12:31 | 3.4M | |
![[ ]](/icons/layout.gif) | bms-parallel-box-user-manual-en.pdf | 2023-11-27 12:31 | 3.5M | |
![[ ]](/icons/layout.gif) | boiler-control-energy-saver-auto-instructions.pdf | 2017-05-19 17:23 | 165K | |
![[ ]](/icons/layout.gif) | boiler-control-energysaver-brochure.pdf | 2017-05-19 17:23 | 684K | |
![[ ]](/icons/layout.gif) | boiler-control-installation-guide.pdf | 2017-05-19 17:23 | 417K | |
![[ ]](/icons/layout.gif) | book-energy-unlimited-en.pdf | 2020-02-10 14:53 | 600K | |
![[ ]](/icons/layout.gif) | bosch-brochure.pdf | 2017-05-19 17:23 | 663K | |
![[ ]](/icons/layout.gif) | bosch-cr10h-manual.pdf | 2022-12-20 17:13 | 13M | |
![[ ]](/icons/layout.gif) | bosch-cylinder-5800i-reheat-times-me.pdf | 2024-05-01 10:18 | 57K | |
![[ ]](/icons/layout.gif) | bosch-datasheet.pdf | 2017-05-19 17:23 | 205K | |
![[ ]](/icons/layout.gif) | bosch-g83.pdf | 2017-05-19 17:23 | 275K | |
![[ ]](/icons/layout.gif) | bosch-manual-english.pdf | 2017-05-19 17:23 | 1.4M | |
![[ ]](/icons/layout.gif) | brochure-we-are-sungrow-en.pdf | 2022-07-29 13:43 | 9.3M | |
![[ ]](/icons/layout.gif) | brochure.pdf | 2021-06-21 14:59 | 1.2M | |
![[ ]](/icons/layout.gif) | broschu-re-kbe-solar-db-trar-inkl.-t-v-zertifikat.pdf | 2021-07-12 15:48 | 2.0M | |
![[ ]](/icons/layout.gif) | bs090010-large-solar-PV-pole-mount-install-manual.pdf | 2020-05-19 11:13 | 1.2M | |
![[ ]](/icons/layout.gif) | buff50-installation---maintanence.pdf | 2023-08-11 12:55 | 336K | |
![[ ]](/icons/layout.gif) | buffer-store-o-m.pdf | 2023-11-17 10:13 | 444K | |
![[ ]](/icons/layout.gif) | buttsplice-datasheet.pdf | 2023-08-24 12:32 | 1.0M | |
![[ ]](/icons/layout.gif) | buypv-schematic.pdf | 2020-04-24 12:41 | 2.9M | |
![[ ]](/icons/layout.gif) | byd-240418-byd-battery-box-premium-hvs-hvm-datasheet-v1.9-en-6625be7b46537.pdf | 2024-07-11 08:33 | 145K | |
![[ ]](/icons/layout.gif) | byd-b-box-datasheet.pdf | 2018-11-05 11:18 | 2.0M | |
![[ ]](/icons/layout.gif) | byd-b-box-lithium-ion-datasheet(4).pdf | 2018-10-11 09:15 | 0 | |
![[ ]](/icons/layout.gif) | byd-b-box-lithium-ion-lifepo4-datasheet-.pdf | 2018-06-29 08:49 | 2.0M | |
![[ ]](/icons/layout.gif) | byd-battery-box-premium-hv-limited-warranty-europe-en-v1.1-5ed6f996be770.pdf | 2021-04-08 16:57 | 232K | |
![[ ]](/icons/layout.gif) | byd-battery-box-premium-hvs-hvm-datasheet-210311.pdf | 2021-04-08 16:43 | 121K | |
![[ ]](/icons/layout.gif) | byd-battery-box-premium-lvs-datasheet-v21-en--1-.pdf | 2021-06-15 16:54 | 126K | |
![[ ]](/icons/layout.gif) | byd-battery-box-premium-operating-manual-lvl-v1.2.pdf | 2022-06-24 13:24 | 4.8M | |
![[ ]](/icons/layout.gif) | c-net-sw2-single-section-wall-mount-cabinet-fa2.pdf | 2020-10-01 12:12 | 575K | |
![[ ]](/icons/layout.gif) | c6f74b9a6020918391016ab549da705d--wecompress.com--compressed.pdf | 2023-06-19 10:50 | 12M | |
![[ ]](/icons/layout.gif) | calculate-required-rating.pdf | 2017-05-19 17:23 | 134K | |
![[ ]](/icons/layout.gif) | calro-gavazzi-em340-manual.pdf | 2021-07-06 11:24 | 331K | |
![[ ]](/icons/layout.gif) | cambridge-carbon-footprint.pdf | 2022-12-14 16:19 | 789K | |
![[ ]](/icons/layout.gif) | capacity-graph-m5.pdf | 2022-10-31 16:39 | 234K | |
![[ ]](/icons/layout.gif) | capacity-graph-m8.pdf | 2022-11-04 11:53 | 194K | |
![[ ]](/icons/layout.gif) | capacity-graph-m12.pdf | 2023-02-09 14:28 | 633K | |
![[ ]](/icons/layout.gif) | capacity-graph-m16.pdf | 2022-10-31 16:42 | 644K | |
![[ ]](/icons/layout.gif) | capacity-graph-m16x3.pdf | 2022-10-31 16:50 | 649K | |
![[ ]](/icons/layout.gif) | capacity-graph-s8.pdf | 2022-10-31 16:26 | 202K | |
![[ ]](/icons/layout.gif) | capacity-graph-s12.pdf | 2022-10-31 16:26 | 205K | |
![[ ]](/icons/layout.gif) | capacity-graph-s14x3.pdf | 2022-10-31 16:38 | 246K | |
![[ ]](/icons/layout.gif) | carlo-gavazzi-em340-power-meter-datasheet.pdf | 2021-07-06 11:50 | 331K | |
![[ ]](/icons/layout.gif) | carlo-gavazzi-em340-power-meter-manual.pdf | 2021-07-06 11:50 | 4.7M | |
![[ ]](/icons/layout.gif) | catalogue-page.pdf | 2024-01-19 11:08 | 86K | |
![[ ]](/icons/layout.gif) | ce-certificate-of-conformity-en50549-1-sungrow-1ph-sg2.0-6.0rs-s-solar-inverter-afci-600vdc-20210521-eng.pdf | 2022-07-29 13:21 | 301K | |
![[ ]](/icons/layout.gif) | ce-certificate-pebs-h-dc-miniature-circuit-breaker.pdf | 2022-08-12 11:54 | 61K | |
![[ ]](/icons/layout.gif) | ce-sg110cx-en-50549-2-certificate.pdf | 2022-09-21 14:08 | 1.4M | |
![[ ]](/icons/layout.gif) | ce-sg110cx-eu-declaration-of-conformity-ce-certificate-20190331.pdf | 2022-09-21 14:10 | 299K | |
![[ ]](/icons/layout.gif) | cellular-gsm-modem-datasheet-row-setapp.pdf | 2019-04-16 15:17 | 559K | |
![[ ]](/icons/layout.gif) | cellular-gsm-modem-datasheet-row.pdf | 2019-04-16 15:07 | 1.1M | |
![[ ]](/icons/layout.gif) | cellular_gsm_modem_datasheet.pdf | 2019-01-02 17:27 | 1.1M | |
![[ ]](/icons/layout.gif) | cer-i.s.-en50549-1-asw3000-5000-s-g2-en-v02.pdf | 2023-09-14 15:38 | 1.1M | |
![[ ]](/icons/layout.gif) | cer-tuv-mark-asw25-27-30-33-36-40k-lt-g3-en-v01.pdf | 2023-05-23 11:11 | 1.2M | |
![[ ]](/icons/layout.gif) | cer-tuv-mark-asw45-60kx-lt-g3-en-v01--1-.pdf | 2023-10-12 09:20 | 2.3M | |
![[ ]](/icons/layout.gif) | cert-en-50549-1-hpk-1000-1500-2000-2500-3000-en.pdf | 2022-11-24 09:10 | 230K | |
![[ ]](/icons/layout.gif) | cert-en-50549-1-hpt-15k-17k-20k-25k.pdf | 2023-03-28 08:39 | 230K | |
![[ ]](/icons/layout.gif) | cert-en-50549-1-hpt-30k-33k-36k-40k-50k-1-.pdf | 2022-08-12 10:56 | 221K | |
![[ ]](/icons/layout.gif) | cert-en50549-1-hbs-hhs-3000-3680-5000-6000.pdf | 2022-07-15 12:04 | 238K | |
![[ ]](/icons/layout.gif) | cert-en50549-1-hps-3000-d-l--hps-3680-d---hps-4000-d---hps-5000-d---hps-6000-d---hps-6500-d---1-.pdf | 2022-11-24 09:09 | 327K | |
![[ ]](/icons/layout.gif) | cert-europe-en-50549-1-hpt-3000-4000-5000-6000-8000-10000-en.pdf | 2022-09-08 12:35 | 239K | |
![[ ]](/icons/layout.gif) | cert-iec61727-iec62116-hpt-15k-17k-20k-25k.pdf | 2022-07-15 09:46 | 235K | |
![[ ]](/icons/layout.gif) | certificate--rohs-tracer-an-50-100a-.pdf | 2021-06-23 10:40 | 459K | |
![[ ]](/icons/layout.gif) | certificate-about-firefighter-safety-switch.pdf | 2024-03-20 10:30 | 646K | |
![[ ]](/icons/layout.gif) | certificate-modules-eurener-uk.pdf | 2024-05-03 10:03 | 71K | |
![[ ]](/icons/layout.gif) | certificate-of-conformity---ev-charger.pdf | 2023-10-16 12:18 | 423K | |
![[ ]](/icons/layout.gif) | certificate-rohs-duoracer.pdf | 2021-06-23 10:42 | 9.4M | |
![[ ]](/icons/layout.gif) | certificate-sun2000-2-100ktl-en50549-1-ire.pdf | 2022-02-11 12:28 | 259K | |
![[ ]](/icons/layout.gif) | certificate-sun2000-12-25k-mb0-en50549-1-en-1.pdf | 2024-05-16 15:53 | 267K | |
![[ ]](/icons/unknown.gif) | certificate of conformity | 2024-07-11 12:12 | 667K | |
![[ ]](/icons/layout.gif) | certification-en.pdf | 2023-05-05 14:24 | 2.6M | |
![[ ]](/icons/layout.gif) | cesolarisolators2020.pdf | 2022-07-08 14:17 | 71K | |
![[ ]](/icons/layout.gif) | check-list-for-roof-mounted.pdf | 2021-11-29 15:16 | 1.1M | |
![[ ]](/icons/layout.gif) | checklist-it-administrators.pdf | 2024-03-25 08:38 | 191K | |
![[ ]](/icons/layout.gif) | checklist-trapezoidal-sandwich-en.pdf | 2022-10-03 14:23 | 431K | |
![[ ]](/icons/layout.gif) | chnt-ddsu666-user-manual-en.pdf | 2023-02-07 17:24 | 879K | |
![[ ]](/icons/layout.gif) | clamp-dims.pdf | 2017-05-19 17:23 | 21K | |
![[ ]](/icons/layout.gif) | climacyl-heat-pump-cylinder1-datasheet.pdf | 2021-06-01 16:47 | 719K | |
![[ ]](/icons/layout.gif) | climacyl-heat-pump-cylinder2-manual.pdf | 2021-06-01 16:47 | 3.1M | |
![[ ]](/icons/layout.gif) | climatehub%20manual.pdf | 2023-06-08 10:57 | 0 | |
![[ ]](/icons/layout.gif) | cm-ufd.m33-g99---data-sheet---type-test-report--01097-190719104113--4-.pdf | 2023-02-14 17:31 | 1.0M | |
![[ ]](/icons/layout.gif) | cn-pv-210068-security-en50549.pdf | 2024-07-22 09:31 | 204K | |
![[ ]](/icons/layout.gif) | cn-pv-210254-security.pdf | 2023-03-14 09:13 | 262K | |
![[ ]](/icons/layout.gif) | cnet-wall-cabinet-installation-guide-fa1.pdf | 2020-10-01 12:11 | 732K | |
![[ ]](/icons/layout.gif) | cocp2023081701-envoy-g100-2-amd2-v1.2.pdf | 2023-10-24 10:47 | 2.2M | |
![[ ]](/icons/layout.gif) | commander-2-datasheet.pdf | 2019-12-11 12:21 | 388K | |
![[ ]](/icons/layout.gif) | commander-2-drilling-template.pdf | 2019-12-11 12:23 | 34K | |
![[ ]](/icons/layout.gif) | commander-2-user-manual.pdf | 2019-12-11 12:22 | 4.7M | |
![[ ]](/icons/layout.gif) | commander2-datasheet-english.pdf | 2021-07-29 12:21 | 160K | |
![[ ]](/icons/layout.gif) | commander2-installation-guide.pdf | 2021-07-29 12:17 | 2.1M | |
![[ ]](/icons/layout.gif) | commercial-all-in-one-datasheet--june-2024--9--1-.pdf | 2024-07-19 14:38 | 751K | |
![[ ]](/icons/layout.gif) | commercial-deaerators-technical-data-sheet.pdf | 2022-08-02 12:11 | 1.9M | |
![[ ]](/icons/layout.gif) | commercial-metering.pdf | 2023-03-17 16:28 | 525K | |
![[ ]](/icons/layout.gif) | commercial-q-and-a.pdf | 2020-05-07 22:08 | 130K | |
![[ ]](/icons/layout.gif) | commercial-quotation.pdf | 2023-03-17 16:26 | 204K | |
![[ ]](/icons/layout.gif) | commercial_gateway_datasheet.pdf | 2019-01-02 17:33 | 406K | |
![[ ]](/icons/layout.gif) | commercialtechnicalbrochure.pdf | 2024-02-24 14:36 | 7.7M | |
![[ ]](/icons/layout.gif) | commissioning.pdf | 2023-03-17 16:27 | 246K | |
![[ ]](/icons/layout.gif) | compact-intafil-technical-data-sheet.pdf | 2022-05-19 14:56 | 2.2M | |
![[ ]](/icons/layout.gif) | compact-technology-brochure-uk.pdf | 2019-10-18 09:50 | 1.2M | |
![[ ]](/icons/layout.gif) | compact_technology_brochure_uk.pdf | 2019-01-02 17:14 | 4.0M | |
![[ ]](/icons/layout.gif) | compatibility-list-of-pylontech.pdf | 2023-03-10 12:59 | 192K | |
![[ ]](/icons/layout.gif) | compatibility-sheet-solax-inverters.pdf | 2023-01-17 11:27 | 148K | |
![[ ]](/icons/layout.gif) | compliance-document-of-g98--1-.pdf | 2023-03-28 12:32 | 263K | |
![[ ]](/icons/layout.gif) | compliance-document-of-g99--1-.pdf | 2023-03-28 12:32 | 263K | |
![[ ]](/icons/layout.gif) | compress-2000-heat-pump-brochure--6-.pdf | 2024-06-20 16:25 | 12M | |
![[ ]](/icons/layout.gif) | compress-3400i-aws-installation-manual.pdf | 2024-04-17 08:40 | 3.7M | |
![[ ]](/icons/layout.gif) | compress-3400i-homeowner-guide.pdf | 2024-04-17 08:53 | 2.8M | |
![[ ]](/icons/layout.gif) | compress-5800i-aw-heat-pump-outdoor-unit-installation-manual.pdf | 2024-04-16 14:42 | 6.2M | |
![[ ]](/icons/layout.gif) | compress-5800i-aw-wall-hung-indoor-unit-installation-manual.pdf | 2024-04-16 14:50 | 3.1M | |
![[ ]](/icons/layout.gif) | compress-5800i-homeowner-guide-uk.pdf | 2024-05-03 10:33 | 5.1M | |
![[ ]](/icons/layout.gif) | compress-5800i-hybrid-heat-pump-homeowner-guide.pdf | 2024-05-03 10:31 | 2.2M | |
![[ ]](/icons/layout.gif) | compress-5800i-installer-guide--uk--may-24.pdf | 2024-05-03 10:32 | 13M | |
![[ ]](/icons/layout.gif) | compress-5800i-installer-guide--uk-.pdf | 2024-04-16 15:42 | 10M | |
![[ ]](/icons/layout.gif) | compress-hybrid-3400i-aw-installation-manual-.pdf | 2024-04-16 14:56 | 13M | |
![[ ]](/icons/layout.gif) | conduit.pdf | 2021-09-20 09:31 | 1.1M | |
![[ ]](/icons/unknown.gif) | configurateur-gse-in-roof---v3.6--6-.xlsm | 2021-03-11 09:21 | 4.4M | |
![[ ]](/icons/layout.gif) | configuring-device-control-with-the-monitoring-app.pdf | 2019-04-16 15:05 | 728K | |
![[ ]](/icons/layout.gif) | consumption_monitoring_flyer.pdf | 2018-03-01 15:49 | 290K | |
![[ ]](/icons/layout.gif) | contour_1000_datasheet.pdf | 2016-09-12 11:31 | 19K | |
![[ ]](/icons/layout.gif) | controlkitmim-e03cn.mim-e03eninstallationmanual.pdf | 2024-07-26 14:18 | 4.3M | |
![[ ]](/icons/layout.gif) | cool-earth.pdf | 2022-12-14 15:37 | 190K | |
![[ ]](/icons/layout.gif) | copper-2-instillation-manual.pdf | 2019-12-11 12:22 | 2.2M | |
![[ ]](/icons/layout.gif) | copper-c-drill-template.pdf | 2019-12-10 12:25 | 1.4M | |
![[ ]](/icons/layout.gif) | copper-c-installer-manual.pdf | 2019-12-10 12:24 | 1.9M | |
![[ ]](/icons/layout.gif) | copper-c-user-manual.pdf | 2019-12-10 12:23 | 3.5M | |
![[ ]](/icons/layout.gif) | copper-sb-datasheet.pdf | 2019-12-11 09:26 | 370K | |
![[ ]](/icons/layout.gif) | copper-sb-drill-template.pdf | 2019-12-11 09:28 | 1.3M | |
![[ ]](/icons/layout.gif) | copper-sb-instillation-manual.pdf | 2019-12-11 09:28 | 1.8M | |
![[ ]](/icons/layout.gif) | copper-sb-user-manual.pdf | 2019-12-11 09:26 | 3.0M | |
![[ ]](/icons/layout.gif) | copperc-datasheet.pdf | 2019-12-10 12:23 | 439K | |
![[ ]](/icons/layout.gif) | coppersb-datasheet-english-revision-c.pdf | 2021-07-12 10:28 | 165K | |
![[ ]](/icons/layout.gif) | copy-of-capacity-graph-s14.pdf | 2022-10-31 16:46 | 266K | |
![[ ]](/icons/unknown.gif) | copy-of-dimensionnement-gse-groundsystem-v1.10-ven--1-.xlsm | 2023-03-07 15:15 | 1.1M | |
![[ ]](/icons/unknown.gif) | copy-of-dimensionnement-gse-groundsystem-v1.10-ven.xlsm | 2023-01-09 14:00 | 1.1M | |
![[ ]](/icons/unknown.gif) | copy-of-wind-pressure-evaluation.xlsx | 2023-04-26 11:37 | 273K | |
![[ ]](/icons/layout.gif) | cordivari-volano-termico-pdc-pensile.pdf | 2021-09-01 14:41 | 154K | |
![[IMG]](/icons/image2.gif) | cpn-mh240c.jpg | 2024-06-21 09:42 | 23K | |
![[ ]](/icons/layout.gif) | cr-20-rf.pdf | 2024-04-17 08:58 | 2.7M | |
![[ ]](/icons/layout.gif) | cs--rail-with-elongation-xl-hole-distance.pdf | 2024-02-28 11:49 | 14K | |
![[ ]](/icons/layout.gif) | cs2000awf-4-r-s-6721863553-04.pdf | 2024-06-20 14:52 | 97K | |
![[ ]](/icons/layout.gif) | cs2000awf-4-r-s.pdf | 2024-06-20 14:50 | 95K | |
![[ ]](/icons/layout.gif) | cs2000awf-6-r-s-6721862880-04.pdf | 2024-06-20 15:24 | 97K | |
![[ ]](/icons/layout.gif) | cs2000awf-6-r-s.pdf | 2024-06-20 15:24 | 95K | |
![[ ]](/icons/layout.gif) | cs2000awf-8-r-s-6721862886-04.pdf | 2024-06-20 16:19 | 97K | |
![[ ]](/icons/layout.gif) | cs2000awf-8-r-s.pdf | 2024-06-20 16:19 | 95K | |
![[ ]](/icons/layout.gif) | cs2000awf-10-r-s-6721862897-04.pdf | 2024-06-20 15:45 | 97K | |
![[ ]](/icons/layout.gif) | cs2000awf-10-r-s.pdf | 2024-06-20 15:44 | 95K | |
![[ ]](/icons/layout.gif) | cs2000awf-12-r-s-6721863079-02.pdf | 2024-06-20 15:50 | 97K | |
![[ ]](/icons/layout.gif) | cs2000awf-12-r-s.pdf | 2024-06-20 15:50 | 95K | |
![[ ]](/icons/layout.gif) | cs2000awf-14-r-s-6721863088-02.pdf | 2024-06-20 16:12 | 97K | |
![[ ]](/icons/layout.gif) | cs2000awf-14-r-s.pdf | 2024-06-20 16:11 | 96K | |
![[ ]](/icons/layout.gif) | cs2000awf-16-r-s-6721863098-02.pdf | 2024-06-20 16:16 | 97K | |
![[ ]](/icons/layout.gif) | cs2000awf-16-r-s.pdf | 2024-06-20 16:16 | 95K | |
![[ ]](/icons/layout.gif) | cs7001iaw-5-or-s-6721842479.pdf | 2022-12-20 10:42 | 85K | |
![[ ]](/icons/layout.gif) | cs7001iaw-7-or-s-6721842481.pdf | 2022-12-20 12:47 | 85K | |
![[ ]](/icons/layout.gif) | cs7001iaw-9-or-6721842483.pdf | 2022-12-20 12:55 | 85K | |
![[ ]](/icons/layout.gif) | cs7001iaw-13-or-s-6721842469.pdf | 2022-12-20 12:56 | 85K | |
![[ ]](/icons/layout.gif) | cs7001iaw-17-or-t-6721842463.pdf | 2022-12-20 13:04 | 85K | |
![[ ]](/icons/layout.gif) | cs7400iaw-5-or-6721842465.pdf | 2022-12-20 14:11 | 85K | |
![[ ]](/icons/layout.gif) | cs7400iaw-7-or-6721821608.pdf | 2022-12-20 14:13 | 91K | |
![[ ]](/icons/layout.gif) | ct-datasheet-rev-1.4-english.pdf | 2023-05-03 17:16 | 189K | |
![[ ]](/icons/layout.gif) | ct1-safety-sheet.pdf | 2023-09-29 12:41 | 136K | |
![[ ]](/icons/layout.gif) | ct1-tech-data.pdf | 2023-09-29 12:41 | 502K | |
![[ ]](/icons/layout.gif) | ctclampselector.pdf | 2019-10-17 15:51 | 134K | |
![[ ]](/icons/layout.gif) | ctcs%20gsei%20en%202021.pdf | 2021-03-11 09:03 | 0 | |
![[ ]](/icons/layout.gif) | ctcs-gsei-en-2022.pdf | 2022-11-17 11:06 | 144K | |
![[ ]](/icons/layout.gif) | cudis-mh-range-datasheet--1-.pdf | 2024-06-24 15:08 | 111K | |
![[ ]](/icons/layout.gif) | cy-2core-1mm-comms-cable-datasheet.pdf | 2021-03-26 11:22 | 271K | |
![[ ]](/icons/layout.gif) | cy-flexisure.pdf | 2024-04-12 15:22 | 483K | |
![[ ]](/icons/layout.gif) | d-252f1-252f9-252f4-252fd19437154c03aabbda28e1f2302f87017a63d84f-ia-iv-se-three-phase-setapp-quick-en-fr-nl-it-de-pl-es-cht-pt-ko-jp-se-cz-tr-huvlm62afykmeij.pdf | 2022-02-04 14:47 | 3.3M | |
![[ ]](/icons/layout.gif) | d-dome-6-assembly-en.pdf | 2023-07-24 10:14 | 8.8M | |
![[ ]](/icons/layout.gif) | d250s_dual-productsheet-low-uk-en.pdf | 2018-07-10 10:20 | 744K | |
![[ ]](/icons/layout.gif) | d250sa-manual-uk-en.pdf | 2018-07-31 13:20 | 3.8M | |
![[ ]](/icons/layout.gif) | d250se-productsheet-low-uk-en.pdf | 2020-03-10 13:25 | 370K | |
![[ ]](/icons/layout.gif) | d3511-retrofit-tamper-instructions-rev-1.4-november-2022-online-copy-1.pdf | 2023-05-04 10:17 | 2.5M | |
![[ ]](/icons/layout.gif) | d14137c07f525c77c6a560b5cf187c601.pdf | 2023-05-19 15:01 | 804K | |
![[ ]](/icons/layout.gif) | datahub-1000-datasheet-en--1-.pdf | 2023-12-18 09:18 | 5.3M | |
![[ ]](/icons/layout.gif) | datahub-1000-datasheet-en.pdf | 2023-11-14 09:44 | 492K | |
![[ ]](/icons/unknown.gif) | datasheet | 2019-10-21 15:28 | 157K | |
![[ ]](/icons/layout.gif) | datasheet---all-in-one--july-2023-.pdf | 2023-07-10 10:02 | 581K | |
![[ ]](/icons/layout.gif) | datasheet---all-in-one--june-2023-.pdf | 2023-06-02 09:45 | 5.0M | |
![[ ]](/icons/layout.gif) | datasheet---alps-series-battery-5.2kwh--proof-v6-.pdf | 2024-04-08 10:49 | 103K | |
![[ ]](/icons/layout.gif) | datasheet---alps-series-hybrid-inverter--proof-v1-.pdf | 2024-02-08 16:24 | 140K | |
![[ ]](/icons/layout.gif) | datasheet---battery-rack--apr-2023-.pdf | 2024-05-13 12:28 | 761K | |
![[ ]](/icons/layout.gif) | datasheet---dc-cabinet--apr-2023-.pdf | 2024-05-13 13:08 | 213K | |
![[ ]](/icons/layout.gif) | datasheet---gem120-polar-ess.pdf | 2024-02-27 09:13 | 122K | |
![[ ]](/icons/layout.gif) | datasheet---giv-gateway--june-2023-.pdf | 2023-06-09 16:59 | 122K | |
![[ ]](/icons/layout.gif) | datasheet---hybrid-gen-1-3.6--mar-2023-.pdf | 2023-03-21 13:54 | 159K | |
![[ ]](/icons/layout.gif) | datasheet---hybrid-gen-1-5.0--mar-2023---1-.pdf | 2023-03-21 13:53 | 158K | |
![[ ]](/icons/layout.gif) | datasheet---hybrid-gen-2-3.6--mar-2023-.pdf | 2023-03-21 13:55 | 218K | |
![[ ]](/icons/layout.gif) | datasheet---hybrid-gen-2-5.0--mar-2023-.pdf | 2023-03-21 13:56 | 218K | |
![[ ]](/icons/layout.gif) | datasheet---hybrid-gen-3-3.6--mar-2023-.pdf | 2023-03-24 10:33 | 178K | |
![[ ]](/icons/layout.gif) | datasheet---hybrid-gen-3-5.0--mar-2023-.pdf | 2023-03-24 12:56 | 178K | |
![[ ]](/icons/layout.gif) | datasheet---lora-lcd--dec-2023-.pdf | 2023-12-05 14:40 | 127K | |
![[ ]](/icons/layout.gif) | datasheet---pcs--apr-2023-.pdf | 2024-05-13 12:32 | 1.1M | |
![[ ]](/icons/layout.gif) | datasheet---polar-battery-handle-white.pdf | 2024-02-27 09:25 | 127K | |
![[ ]](/icons/layout.gif) | datasheet---polar-inverter-cable-pack.pdf | 2024-02-27 09:10 | 176K | |
![[ ]](/icons/layout.gif) | datasheet---polar-parallel-bracket--foot-.pdf | 2024-02-27 09:24 | 140K | |
![[ ]](/icons/layout.gif) | datasheet---polar-parallel-cable-pack.pdf | 2024-02-27 09:12 | 123K | |
![[ ]](/icons/layout.gif) | datasheet---polar-top-single-pack-foot-bracket.pdf | 2024-02-27 09:21 | 140K | |
![[ ]](/icons/layout.gif) | datasheet---polar-wifi---4g-dongle.pdf | 2024-02-27 09:17 | 597K | |
![[ ]](/icons/layout.gif) | datasheet---sme-battery-cabinet--jan-2024-.pdf | 2024-05-13 13:08 | 695K | |
![[ ]](/icons/layout.gif) | datasheet--ei3016-ei3016--12-feb-2024-.pdf | 2024-02-12 12:53 | 175K | |
![[ ]](/icons/layout.gif) | datasheet--wifi-or-4g-stick-global-en-1122-web.pdf | 2023-02-02 11:48 | 97K | |
![[ ]](/icons/layout.gif) | datasheet-1x4mm2-solar-cable-shanghai-kuka.pdf | 2022-09-05 13:59 | 2.0M | |
![[ ]](/icons/layout.gif) | datasheet-1x6mm2-solar-cable-shanghai-kuka.pdf | 2022-09-05 14:00 | 1.8M | |
![[ ]](/icons/layout.gif) | datasheet-1x10mm2-solar-cable-shanghai-kuka.pdf | 2022-09-05 14:00 | 1.8M | |
![[ ]](/icons/layout.gif) | datasheet-3-phase-hybrid-gen-3-11kw-sept-2023.pdf | 2023-11-21 12:36 | 158K | |
![[ ]](/icons/layout.gif) | datasheet-12,8-&-25,6-volt-lithium-iron-phosphate-batteries-smart-en.pdf | 2021-07-27 12:00 | 307K | |
![[ ]](/icons/layout.gif) | datasheet-12-8---25-6-volt-lithium-iron-phosphate-batteries-smart-en--4-.pdf | 2022-02-03 15:26 | 322K | |
![[ ]](/icons/layout.gif) | datasheet-12-8-volt-lithium-iron-phosphate-batteries-en.pdf | 2017-05-19 17:23 | 110K | |
![[ ]](/icons/layout.gif) | datasheet-100w-poly.pdf | 2020-02-10 17:13 | 1.2M | |
![[ ]](/icons/layout.gif) | datasheet-210r-neg9r.25-en-2024a-web-20240423--1-.pdf | 2024-06-06 10:06 | 531K | |
![[ ]](/icons/layout.gif) | datasheet-210r-neg9r.25-en-2024a-web-20240423.pdf | 2024-06-05 10:48 | 531K | |
![[ ]](/icons/layout.gif) | datasheet-2501573182-01.pdf | 2024-07-24 09:52 | 129K | |
![[ ]](/icons/layout.gif) | datasheet-about-firefighter-safety-switchv7.0--2-.pdf | 2022-12-06 09:48 | 1.4M | |
![[ ]](/icons/layout.gif) | datasheet-ac-coupled-mar-2023.pdf | 2023-09-14 10:29 | 568K | |
![[ ]](/icons/layout.gif) | datasheet-ai-dongle-global-en-1122-web.pdf | 2023-01-17 09:48 | 97K | |
![[ ]](/icons/layout.gif) | datasheet-all-in-one-july-2023.pdf | 2023-09-14 10:07 | 582K | |
![[ ]](/icons/unknown.gif) | datasheet-asw-3-5k | 2023-09-14 11:07 | 289K | |
![[ ]](/icons/layout.gif) | datasheet-asw-3-5k-s-series-global-en-0523.web-.pdf | 2024-01-26 12:25 | 180K | |
![[ ]](/icons/layout.gif) | datasheet-asw-3-10k-lt-g2-pro-series-0722-global-en-web.pdf | 2022-12-08 15:12 | 175K | |
![[ ]](/icons/layout.gif) | datasheet-asw-3-10k-lt-g2-pro-series-global-en-1023-web--1-.pdf | 2024-01-26 12:29 | 185K | |
![[ ]](/icons/layout.gif) | datasheet-asw-45-50-60k-lt-g3-series-en-0523.web.pdf | 2023-10-12 09:19 | 130K | |
![[ ]](/icons/layout.gif) | datasheet-asw-asw-12-20k-lt-g2-pro-series-0822-global-en-web.pdf | 2022-12-12 15:17 | 177K | |
![[ ]](/icons/layout.gif) | datasheet-asw-asw-25-40k-lt-g3-series-0722-global-en-web--2-.pdf | 2023-01-12 17:03 | 110K | |
![[ ]](/icons/layout.gif) | datasheet-battery-switch-275-a-en.pdf | 2022-07-11 16:55 | 245K | |
![[ ]](/icons/layout.gif) | datasheet-blue-solar-charge-controller-mppt-75-10--75-15---mppt-100-15-en.pdf | 2016-09-12 11:31 | 103K | |
![[ ]](/icons/layout.gif) | datasheet-blue-solar-charge-controller-mppt-75-10--75-15--100-15--100-20-48v-en-.pdf | 2021-08-17 21:07 | 589K | |
![[ ]](/icons/layout.gif) | datasheet-blue-solar-charge-controller-overview-en-(1).pdf | 2016-09-12 11:31 | 1.1M | |
![[ ]](/icons/layout.gif) | datasheet-blue-solar-charge-controller-overview-en--1-.pdf | 2021-07-13 16:01 | 1.1M | |
![[ ]](/icons/layout.gif) | datasheet-bluesolar-and-smartsolar-charge-controller-overview-en-.pdf | 2021-07-13 16:18 | 247K | |
![[ ]](/icons/layout.gif) | datasheet-bluesolar-and-smartsolar-charge-controller-overview-en.pdf | 2024-06-19 11:20 | 248K | |
![[ ]](/icons/layout.gif) | datasheet-bluesolar-charge-controller-mppt-100-30-en.pdf | 2017-10-11 09:55 | 168K | |
![[ ]](/icons/layout.gif) | datasheet-bluesolar-charge-controller-mppt-150-35---150-45-en--1-.pdf | 2021-07-13 15:58 | 213K | |
![[ ]](/icons/layout.gif) | datasheet-bluesolar-monocrystalline-panels-en--1-.pdf | 2021-10-14 09:59 | 173K | |
![[ ]](/icons/layout.gif) | datasheet-bluesolar-monocrystalline-panels-en.pdf | 2016-09-12 11:31 | 80K | |
![[ ]](/icons/layout.gif) | datasheet-bluesolar-monocrystalline-panels-en2015.pdf | 2016-09-12 11:31 | 80K | |
![[ ]](/icons/layout.gif) | datasheet-bms-12-200-en.pdf | 2018-12-07 14:42 | 183K | |
![[ ]](/icons/layout.gif) | datasheet-bmv-700-series-en.pdf | 2017-05-19 17:23 | 257K | |
![[ ]](/icons/layout.gif) | datasheet-bmv-712-smart-en.pdf | 2017-11-29 15:24 | 220K | |
![[ ]](/icons/layout.gif) | datasheet-buck-boost-dc-dc-converter-25a-50a-100a-en.pdf | 2021-07-13 15:37 | 233K | |
![[ ]](/icons/layout.gif) | datasheet-buck-boost-dc-dc-converter-25a-50a-en.pdf | 2017-09-20 13:00 | 189K | |
![[ ]](/icons/layout.gif) | datasheet-centaur-charger-en.pdf | 2021-06-28 15:44 | 198K | |
![[ ]](/icons/layout.gif) | datasheet-color-control-gx-en.pdf | 2020-05-11 15:41 | 871K | |
![[ ]](/icons/layout.gif) | datasheet-cyrix-ct-120a-230a-en.pdf | 2018-08-21 10:52 | 229K | |
![[ ]](/icons/layout.gif) | datasheet-cyrix-li-ion-120-a-en.pdf | 2018-12-07 13:26 | 377K | |
![[ ]](/icons/layout.gif) | datasheet-cyrix-li-ion-230-a-en.pdf | 2020-02-05 17:20 | 250K | |
![[ ]](/icons/layout.gif) | datasheet-easysolar-1600va-en.pdf | 2017-02-01 11:01 | 357K | |
![[ ]](/icons/layout.gif) | datasheet-easysolar-3000va-en.pdf | 2017-02-01 11:02 | 370K | |
![[ ]](/icons/layout.gif) | datasheet-easysolar-ii-24v-48v-3kva-48v-5kva-mppt-250-70-100-gx-en.pdf | 2022-02-03 13:13 | 337K | |
![[ ]](/icons/layout.gif) | datasheet-easysolar-ii-48-3000-35-32-mppt-250-70-gx-en.pdf | 2020-02-04 17:04 | 347K | |
![[ ]](/icons/layout.gif) | datasheet-easysolar-with-color-control-en.pdf | 2018-03-15 11:45 | 191K | |
![[ ]](/icons/layout.gif) | datasheet-ekrano-gx-en.pdf | 2023-06-28 13:22 | 760K | |
![[ ]](/icons/layout.gif) | datasheet-em115-meter-sept-2023.pdf | 2023-10-16 17:11 | 146K | |
![[ ]](/icons/layout.gif) | datasheet-energy-meters-selection-guide-en.pdf | 2023-12-12 16:37 | 172K | |
![[ ]](/icons/layout.gif) | datasheet-english-34.pdf | 2023-08-25 13:19 | 1.9M | |
![[ ]](/icons/layout.gif) | datasheet-ev-charger-apr-2023.pdf | 2023-10-16 12:16 | 115K | |
![[ ]](/icons/layout.gif) | datasheet-firefighter-safety-switch.pdf | 2024-03-07 10:35 | 478K | |
![[ ]](/icons/layout.gif) | datasheet-flexalu-q32019-eng.pdf | 2020-09-18 09:17 | 2.1M | |
![[ ]](/icons/layout.gif) | datasheet-fusionsolar-sun2000-3-10ktl-m1--high-current-version-.pdf | 2024-03-25 11:15 | 300K | |
![[ ]](/icons/layout.gif) | datasheet-gel-and-agm-batteries-en.pdf | 2019-03-01 09:02 | 626K | |
![[ ]](/icons/layout.gif) | datasheet-gem120-meter-august-2023.pdf | 2023-10-16 17:10 | 141K | |
![[ ]](/icons/layout.gif) | datasheet-gem630-meter-june-2023.pdf | 2023-11-21 14:45 | 132K | |
![[ ]](/icons/layout.gif) | datasheet-giv-bat-2.6-mar-2023.pdf | 2023-10-16 17:16 | 556K | |
![[ ]](/icons/layout.gif) | datasheet-giv-bat-5.2-mar-2023.pdf | 2023-10-16 17:17 | 564K | |
![[ ]](/icons/layout.gif) | datasheet-giv-bat-8.2-mar-2023.pdf | 2023-10-26 15:14 | 143K | |
![[ ]](/icons/layout.gif) | datasheet-giv-bat-9.5-mar-2023.pdf | 2023-10-16 17:18 | 568K | |
![[ ]](/icons/layout.gif) | datasheet-giv-gateway-may-2023.pdf | 2023-09-14 10:07 | 541K | |
![[ ]](/icons/layout.gif) | datasheet-gse-in-roof-system-en-sept-2022.pdf | 2023-05-05 14:24 | 7.3M | |
![[ ]](/icons/layout.gif) | datasheet-huawei-600w-p-optimiser.pdf | 2022-08-03 15:59 | 705K | |
![[ ]](/icons/layout.gif) | datasheet-huawei-sun2000-12-20ktl-m2-en.pdf | 2021-12-02 09:57 | 889K | |
![[ ]](/icons/layout.gif) | datasheet-hybrid-gen-1-3.6-mar-2023.pdf | 2023-09-14 10:14 | 156K | |
![[ ]](/icons/layout.gif) | datasheet-hybrid-gen-1-5.0-may-2023.pdf | 2023-09-14 10:18 | 154K | |
![[ ]](/icons/layout.gif) | datasheet-hybrid-gen-3-3.6-mar-2023.pdf | 2023-09-13 16:01 | 557K | |
![[ ]](/icons/layout.gif) | datasheet-inverter-1200va-5000va-en--1-.pdf | 2024-06-05 11:24 | 651K | |
![[ ]](/icons/layout.gif) | datasheet-juicebox.pdf | 2022-04-25 11:36 | 127K | |
![[ ]](/icons/layout.gif) | datasheet-lg-solar-neon-2-all-black-lg355n1k-n5-solar-module-2020-eng.pdf | 2020-12-17 14:52 | 420K | |
![[ ]](/icons/layout.gif) | datasheet-lithium-batteries-en.pdf | 2016-09-12 11:31 | 92K | |
![[ ]](/icons/layout.gif) | datasheet-merc-1100-1300w-p-ne-preliminary.pdf | 2023-05-25 16:48 | 660K | |
![[ ]](/icons/layout.gif) | datasheet-modular-mega-fuse-holder-and-high-current-busbar-en.pdf | 2020-02-13 14:27 | 284K | |
![[ ]](/icons/layout.gif) | datasheet-mono-60-cell-series-2018.10.pdf | 2018-11-30 16:52 | 1.6M | |
![[ ]](/icons/layout.gif) | datasheet-multi-rs-solar-dual-tracker-en.pdf | 2024-02-01 17:04 | 198K | |
![[ ]](/icons/layout.gif) | datasheet-multiplus-500va-1200va-en.pdf | 2017-09-20 16:43 | 147K | |
![[ ]](/icons/layout.gif) | datasheet-multiplus-500va-1600va-en.pdf | 2020-05-05 13:52 | 207K | |
![[ ]](/icons/layout.gif) | datasheet-multiplus-500va-2000va-en.pdf | 2022-12-13 15:44 | 527K | |
![[ ]](/icons/layout.gif) | datasheet-multiplus-ii-gx-inverter-charger-en.pdf | 2019-09-09 13:29 | 653K | |
![[ ]](/icons/layout.gif) | datasheet-multiplus-ii-inverter-charger-en--3-.pdf | 2024-04-15 13:18 | 586K | |
![[ ]](/icons/layout.gif) | datasheet-multiplus-ii-inverter-charger-en-24v.pdf | 2022-12-13 15:20 | 586K | |
![[ ]](/icons/layout.gif) | datasheet-multiplus-ii-inverter-charger-en.pdf | 2020-02-04 15:15 | 617K | |
![[ ]](/icons/layout.gif) | datasheet-multiplus-inverter-charger--800va-5kva-en-.pdf | 2021-09-24 11:04 | 484K | |
![[ ]](/icons/layout.gif) | datasheet-multiplus-inverter-charger--800va-5kva-en.pdf | 2020-02-05 10:03 | 457K | |
![[ ]](/icons/layout.gif) | datasheet-multiplus-inverter-charger-800va-5kva-en-(1).pdf | 2016-09-12 11:31 | 864K | |
![[ ]](/icons/layout.gif) | datasheet-orion-tr-dc-dc-converters-isolated-100-250-400w-en-.pdf | 2024-04-15 13:43 | 274K | |
![[ ]](/icons/layout.gif) | datasheet-orion-tr-dc-dc-converters-isolated-100-250-400w-en.pdf | 2020-02-05 13:12 | 236K | |
![[ ]](/icons/layout.gif) | datasheet-orion-tr-smart-dc-dc-chargers-isolated-250-400w-en.pdf | 2020-02-05 13:46 | 293K | |
![[ ]](/icons/layout.gif) | datasheet-orion-xs-12-12-50a-dc-dc-battery-charger-en.pdf | 2024-01-25 11:40 | 401K | |
![[ ]](/icons/layout.gif) | datasheet-pebs-h-l-dc-miniature-circuit-breaker.pdf | 2022-08-12 11:54 | 1.0M | |
![[ ]](/icons/layout.gif) | datasheet-pefs-firefighter-safety-switches-1-10-string-p2--2024.pdf | 2024-07-17 16:04 | 1.3M | |
![[ ]](/icons/layout.gif) | datasheet-perlight-100w-36-delta.pdf | 2021-05-14 09:41 | 1.4M | |
![[ ]](/icons/layout.gif) | datasheet-perlight-200w-240-delta.pdf | 2021-05-14 09:43 | 1.4M | |
![[ ]](/icons/layout.gif) | datasheet-phoenix-inverter-smart-1600va-3000va-en.pdf | 2020-02-04 15:44 | 647K | |
![[ ]](/icons/layout.gif) | datasheet-phoenix-inverter-ve.direct-250va-1200va-en.pdf | 2021-05-21 16:15 | 359K | |
![[ ]](/icons/layout.gif) | datasheet-plm-175ma-124-1080x885x30-.pdf | 2022-08-31 16:13 | 421K | |
![[ ]](/icons/layout.gif) | datasheet-plm-200ma-42.pdf | 2020-02-11 13:50 | 3.8M | |
![[ ]](/icons/layout.gif) | datasheet-plm-200ma-192-delta--1036x1002x30mm---3-.pdf | 2024-06-19 12:22 | 1.5M | |
![[ ]](/icons/layout.gif) | datasheet-plm-200ma-234-1036x1002x30-.pdf | 2022-08-31 16:12 | 420K | |
![[ ]](/icons/layout.gif) | datasheet-q.peak-duo-ml-g10.a-385-410--2-.pdf | 2022-02-08 16:21 | 1.8M | |
![[ ]](/icons/layout.gif) | datasheet-quattro-3kva-10kva-en.pdf | 2017-05-19 17:23 | 288K | |
![[ ]](/icons/layout.gif) | datasheet-quattro-3kva-15kva-en.pdf | 2020-03-05 13:30 | 430K | |
![[ ]](/icons/layout.gif) | datasheet-s5-gc-25-40-k.pdf | 2022-03-10 10:06 | 557K | |
![[ ]](/icons/layout.gif) | datasheet-s5-gc-50-60-k.pdf | 2022-03-10 14:53 | 622K | |
![[ ]](/icons/layout.gif) | datasheet-s500-b-optimiser-solaredge.pdf | 2023-08-02 12:23 | 240K | |
![[ ]](/icons/layout.gif) | datasheet-shunt-1000a-50mv.pdf | 2020-02-12 14:35 | 101K | |
![[ ]](/icons/layout.gif) | datasheet-smart-battery-protect-65-a--100-a--220-a-en-.pdf | 2019-08-20 10:57 | 334K | |
![[ ]](/icons/layout.gif) | datasheet-smart-batteryprotect-48v-100a-en.pdf | 2021-05-19 14:09 | 177K | |
![[ ]](/icons/layout.gif) | datasheet-smart-plug-mar-2023.pdf | 2023-10-16 16:25 | 170K | |
![[ ]](/icons/layout.gif) | datasheet-smartshunt-en-.pdf | 2020-05-12 12:38 | 464K | |
![[ ]](/icons/layout.gif) | datasheet-smartshunt-ip65-en.pdf | 2023-07-28 13:50 | 450K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-75-10,-75-15,-100-15,-100-20,-100-20_48v-en-.pdf | 2020-03-02 13:03 | 265K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-75-10,-75-15,-100-15,-100-20-en.pdf | 2018-09-20 13:35 | 144K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-75-10,-75-15,-100-15,-100-20_48v-en.pdf | 2021-12-01 16:57 | 0 | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-75-10--75-15--100-15--100-20--100-20-48v-en-.pdf | 2020-05-11 09:38 | 265K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-75-10--75-15--100-15--100-20-48v-en.pdf | 2024-06-19 11:20 | 279K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-100-30-&-100-50-en.pdf | 2019-08-29 11:47 | 198K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-100-30---100-50-en--1-.pdf | 2021-10-14 09:08 | 209K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-100-30---100-50-en.pdf | 2020-05-11 09:33 | 206K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-150-35---150-45-en--1-.pdf | 2021-06-29 12:33 | 204K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-150-35---150-45-en.pdf | 2024-01-16 16:45 | 220K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-150-35-en.pdf | 2020-05-11 11:37 | 202K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-150-45-up-to-150-70-en.pdf | 2024-01-31 09:56 | 360K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-150-45-up-to-150-100-en.pdf | 2020-05-11 14:19 | 357K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-150-70-up-to-150-100-ve.can-en.pdf | 2021-06-29 12:35 | 377K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-250-60,-250-70,-250-85-&-250-100-en.pdf | 2017-10-10 09:53 | 216K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-250-60-and-250-70-en.pdf | 2021-07-13 16:11 | 345K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-250-60-up-to-250-100-en.pdf | 2020-05-12 10:31 | 339K | |
![[ ]](/icons/layout.gif) | datasheet-smartsolar-charge-controller-mppt-250-70-up-to-250-100-ve.can-en.pdf | 2021-07-13 16:17 | 365K | |
![[ ]](/icons/layout.gif) | datasheet-solis--100-125-k-5g.pdf | 2020-10-22 10:41 | 951K | |
![[ ]](/icons/layout.gif) | datasheet-solis-6k-3phase.pdf | 2018-07-10 10:47 | 1.0M | |
![[ ]](/icons/layout.gif) | datasheet-solis-mini700-3600-4g-181220.pdf | 2020-12-18 09:43 | 1.1M | |
![[ ]](/icons/layout.gif) | datasheet-stackable-batteries-hv-jun-2023.pdf | 2023-11-21 16:21 | 208K | |
![[ ]](/icons/layout.gif) | datasheet-sun2000-115ktl-m2-en-10-2022.pdf | 2024-03-25 09:19 | 391K | |
![[ ]](/icons/layout.gif) | datasheet-sun2000-450w-p2-m600w-p-en--1-.pdf | 2022-07-29 15:21 | 705K | |
![[ ]](/icons/layout.gif) | datasheet-sungrow-1ph-sg3.0-6.0rs-solar-inverter-afci-600vdc-v11-20210413-eng.pdf | 2022-07-29 13:08 | 146K | |
![[ ]](/icons/layout.gif) | datasheet-torquetool-en.pdf | 2023-09-27 11:35 | 150K | |
![[ ]](/icons/layout.gif) | datasheet-ve-bus-bms-en.pdf | 2018-12-07 15:23 | 611K | |
![[ ]](/icons/layout.gif) | datasheet-victron-battery-monitor-bmv-700-series-en.pdf | 2017-09-26 13:15 | 226K | |
![[ ]](/icons/layout.gif) | datasheet-victron-bluesolar-monocrystalline-panels-en.pdf | 2019-07-17 09:30 | 150K | |
![[ ]](/icons/layout.gif) | datasheet-victron-energy-bluesolar-monocrystalline-panels-en.pdf | 2020-03-24 15:42 | 161K | |
![[ ]](/icons/layout.gif) | datasheet-victron-energy-shore-power-cable-en.pdf | 2020-06-17 09:46 | 172K | |
![[ ]](/icons/layout.gif) | datasheet-voltage-optimiser-dec-2022.pdf | 2023-10-16 16:26 | 121K | |
![[ ]](/icons/layout.gif) | datasheet-wall-mounted-display-enclosures-en.pdf | 2020-05-11 14:34 | 174K | |
![[ ]](/icons/layout.gif) | datasheet.pdf | 2018-04-11 11:01 | 85K | |
![[ ]](/icons/unknown.gif) | datasheetASW1500S-S | 2023-09-14 10:42 | 176K | |
![[ ]](/icons/layout.gif) | datasheet_eflex_3.1m.pdf | 2018-03-29 12:48 | 323K | |
![[ ]](/icons/layout.gif) | datasheet_mi-300350400_eu_v202103.pdf | 2021-09-03 11:51 | 2.4M | |
![[ ]](/icons/layout.gif) | datasheet_solis_s5-3phase(3-20)k.pdf | 2022-05-26 15:51 | 561K | |
![[ ]](/icons/layout.gif) | datasheetevchargingstationen1.pdf | 2023-01-17 16:06 | 134K | |
![[ ]](/icons/layout.gif) | datasheetplm100madelta.pdf | 2023-06-20 10:16 | 1.6M | |
![[ ]](/icons/layout.gif) | datasheetplm175madelta.pdf | 2023-06-20 10:18 | 2.0M | |
![[ ]](/icons/layout.gif) | datasheets-sun2000-12-25k-mb0-v01-2023-12-en.pdf | 2024-05-16 15:53 | 1.5M | |
![[ ]](/icons/unknown.gif) | datasheetsmartsolarmppt-RS | 2021-01-12 13:49 | 683K | |
![[ ]](/icons/unknown.gif) | datasheet smartsolar mppt rs en | 2021-01-12 13:45 | 683K | |
![[ ]](/icons/layout.gif) | datenblatt-f%c3%bcr-huawei-sun2000-6ktl-m1-wechselrichter.pdf | 2021-10-19 15:39 | 0 | |
![[ ]](/icons/layout.gif) | datenblatt-f-r-huawei-sun2000-10ktl-m1-wechselrichter.pdf | 2021-10-19 15:51 | 387K | |
![[ ]](/icons/layout.gif) | datenblatt-fuer-huawei-sun2000-50ktl-m3-wechselrichter-englisch.pdf | 2024-05-15 12:55 | 182K | |
![[ ]](/icons/layout.gif) | datenblatt-fuer-huawei-sun2000-450w-p2---600w-optimizer-englisch.pdf | 2023-12-14 16:39 | 705K | |
![[ ]](/icons/layout.gif) | datenblatt-fuer-huawei-sun2000-450w-p2-optimizer-englisch.pdf | 2022-08-02 15:38 | 705K | |
![[ ]](/icons/layout.gif) | datenblatt-huawei-smartlogger3000a01eu.pdf | 2022-02-23 10:37 | 168K | |
![[ ]](/icons/layout.gif) | datenblatt-huawei-smartpowersensor-dtsu666-h-1.pdf | 2021-10-19 16:38 | 234K | |
![[ ]](/icons/layout.gif) | dbl-etfe-100w-20v-datasheet.pdf | 2021-11-30 12:18 | 348K | |
![[ ]](/icons/layout.gif) | dbl-etfe-120w-18v-top-jb.pdf | 2021-11-30 11:42 | 351K | |
![[ ]](/icons/layout.gif) | dc-cabinet-installation-manual-v1.0.pdf | 2024-05-13 13:09 | 486K | |
![[ ]](/icons/layout.gif) | de09r.05.pdf | 2022-06-16 11:25 | 452K | |
![[ ]](/icons/layout.gif) | de23smnp-002.pdf | 2023-07-17 14:27 | 1.4M | |
![[ ]](/icons/layout.gif) | dec-18-wallpod-ev-tethered-data-sheet.pdf | 2019-10-07 09:52 | 1.8M | |
![[ ]](/icons/layout.gif) | dec-ce-asw25-27-30-33-36-40k-lt-g3-en-v02.pdf | 2023-01-12 17:03 | 148K | |
![[ ]](/icons/layout.gif) | declaration-of-conformity-fronius-smart-meter-ts-65a-3.pdf | 2021-07-08 09:56 | 136K | |
![[ ]](/icons/layout.gif) | declaration-of-conformity-ireland-hpk-1000-1500-2000-2500-3000--en---1-.pdf | 2021-06-17 16:52 | 150K | |
![[ ]](/icons/layout.gif) | declaration-of-conformity-ireland-hps-3000l-3680-4000-5000-3000dl-3680d-4000d-5000d-en-.pdf | 2021-05-24 11:21 | 150K | |
![[ ]](/icons/layout.gif) | declaration-of-conformity-ireland-hps-3000l-3680-4000-5000-6000-3000dl-3680d-4000d-5000d-6000d--en-.pdf | 2021-12-07 12:13 | 153K | |
![[ ]](/icons/layout.gif) | declaration-of-conformity-ireland-hpt-15k-17k-20k-25k--en-.pdf | 2023-03-27 16:12 | 149K | |
![[ ]](/icons/layout.gif) | declaration-of-conformity-ireland-hpt-3000-4000-5000-6000-8000-10000--en-.pdf | 2021-04-09 09:29 | 151K | |
![[ ]](/icons/layout.gif) | declaration-of-conformity-matebox.pdf | 2022-08-31 16:42 | 211K | |
![[ ]](/icons/layout.gif) | declaration-of-en50438-for-ireland---mi-300-mi-350-1-.pdf | 2021-02-16 15:24 | 86K | |
![[ ]](/icons/layout.gif) | declaration-of-en50549-for-ireland-mi-300-doc-21072201.pdf | 2021-10-04 14:44 | 100K | |
![[ ]](/icons/layout.gif) | dektite-solar-flashing.pdf | 2017-06-12 10:29 | 309K | |
![[ ]](/icons/layout.gif) | delaration-of-conformity-x1-boost-g3.2.pdf | 2022-08-09 13:36 | 434K | |
![[ ]](/icons/layout.gif) | delete-me-test.pdf | 2020-09-30 11:41 | 473K | |
![[ ]](/icons/layout.gif) | delta-pro-specifications.pdf | 2023-09-04 16:39 | 65K | |
![[ ]](/icons/layout.gif) | demoplant.pdf | 2017-05-19 17:23 | 621K | |
![[ ]](/icons/layout.gif) | detach-pro-2-port-motorised-control-valve-datasheet.pdf | 2021-04-06 09:29 | 840K | |
![[ ]](/icons/compressed.gif) | df7f34efc3fa77d0f4cae6b83daa1044--1-.zip | 2023-05-16 14:43 | 6.1M | |
![[ ]](/icons/layout.gif) | dimensiondrawing-ekrano-gx.pdf | 2023-06-28 13:22 | 425K | |
![[ ]](/icons/layout.gif) | dimensions-of-plastic-panel-for-bpp000300100r-color-control-gx-v1.0.pdf | 2020-05-11 15:42 | 354K | |
![[ ]](/icons/unknown.gif) | directfixperprepickedsystem | 2024-04-12 09:17 | 68K | |
![[ ]](/icons/layout.gif) | domestic-webinar-q-and-a.pdf | 2020-05-15 17:11 | 151K | |
![[ ]](/icons/layout.gif) | domestic-weinar-q-and-a.pdf | 2020-05-15 17:09 | 151K | |
![[ ]](/icons/layout.gif) | doncaster-cables-pv-ultra-stripping-tool-datasheet.pdf | 2024-01-08 16:34 | 167K | |
![[ ]](/icons/layout.gif) | dongle2.0-datasheet-wlan.pdf | 2023-05-03 15:59 | 91K | |
![[ ]](/icons/layout.gif) | download?p=%2f-%2fmedia%2fsolar%2fattachment%2fpdf%2feu%2fdatasheet%2fsun2000-60ktl-m0.pdf | 2021-09-27 15:48 | 328K | |
![[ ]](/icons/layout.gif) | drf2618a.pdf | 2020-05-11 14:27 | 285K | |
![[ ]](/icons/layout.gif) | drf2619a.pdf | 2020-05-11 14:31 | 198K | |
![[ ]](/icons/layout.gif) | driven-pile-cc.pdf | 2023-10-12 15:12 | 81K | |
![[ ]](/icons/layout.gif) | driven-pile.pdf | 2024-02-15 17:22 | 82K | |
![[ ]](/icons/layout.gif) | ds-08.02.04-modular-2-in-portrait.pdf | 2024-01-26 13:12 | 1.3M | |
![[ ]](/icons/layout.gif) | ds-20210206-sg33cx-sg40cx-sg50cx-including-premium--datasheet-v1.1.1-en.pdf | 2023-02-09 11:38 | 253K | |
![[ ]](/icons/layout.gif) | ds-20220421-sbr096-128-160-192-224-256-datasheet-v13-en--2-.pdf | 2022-10-03 11:59 | 531K | |
![[ ]](/icons/layout.gif) | ds-20220516-sh3.0-3.6-4.0-5.0-6.0rs-datasheet-v13-en.pdf | 2022-10-03 11:05 | 377K | |
![[ ]](/icons/layout.gif) | ds-20230301-sh5.0-6.0-8.0-10rt-20-datasheet-v22-en.pdf | 2023-12-14 15:45 | 397K | |
![[ ]](/icons/layout.gif) | ds-20230718-sh3.0-3.6-4.0-5.0-6.0rs-datasheet-v16-en-iec-.pdf | 2023-12-14 15:17 | 365K | |
![[ ]](/icons/layout.gif) | ds-20231013-sg25-30-33cx-p2-datasheet-v3-en.pdf | 2023-12-14 15:03 | 415K | |
![[ ]](/icons/layout.gif) | ds-20231013-sg36-40-50cx-p2-datasheet-v3-en.pdf | 2023-12-14 15:04 | 410K | |
![[ ]](/icons/layout.gif) | ds-20231013-sg125cx-p2-datasheet-v3-en.pdf | 2023-12-14 15:06 | 391K | |
![[ ]](/icons/layout.gif) | ds-hp6m-helioprotection-photovoltaic-fuses-mersen.pdf | 2020-02-19 09:37 | 128K | |
![[ ]](/icons/layout.gif) | ds-iec-low-voltage-gp-multibloc-size-00-st8-nh-fuse-switch-disconnector-en.pdf | 2020-02-19 11:32 | 1.5M | |
![[ ]](/icons/layout.gif) | ds-iec-low-voltage-gp-multibloc-size-1-st8-nh-fuse-switch-disconnector-en.pdf | 2020-02-18 16:54 | 2.8M | |
![[ ]](/icons/layout.gif) | ds-meyer-burger-black-en--1-.pdf | 2023-03-20 12:01 | 621K | |
![[ ]](/icons/layout.gif) | ds-meyer-burger-glass-en.pdf | 2023-07-03 17:23 | 203K | |
![[ ]](/icons/layout.gif) | ds-neonr-60cells.pdf | 2019-01-29 15:55 | 1.8M | |
![[ ]](/icons/layout.gif) | ds-nh-fuse-links-gg-400vac-double-indicator-live-gripping-lugs-size-000-00-1-2-3-en.pdf | 2020-02-19 09:26 | 1.4M | |
![[ ]](/icons/layout.gif) | ds-pv-modular-fuse-holder-cus101hel-en.pdf | 2020-02-19 09:32 | 607K | |
![[ ]](/icons/layout.gif) | ds-rec-alpha-pure-r-series-ul-web.pdf | 2022-10-12 10:20 | 1.0M | |
![[ ]](/icons/layout.gif) | ds-rec-alpha-pure-series-en.pdf | 2021-11-19 14:13 | 951K | |
![[ ]](/icons/layout.gif) | ds-rec-twinpeak-4-black-series-en--1-.pdf | 2021-05-26 09:48 | 1.2M | |
![[ ]](/icons/layout.gif) | ds-rec-twinpeak-4-series-en.pdf | 2022-05-17 17:14 | 1.3M | |
![[ ]](/icons/layout.gif) | ds-rec-twinpeak-5-black-series-rev-a.pdf | 2022-11-25 11:27 | 1.2M | |
![[ ]](/icons/layout.gif) | ds-sg110cx-datasheet-v14-en.pdf.pdf | 2022-09-21 13:33 | 356K | |
![[ ]](/icons/layout.gif) | ds-vertexs--neg9r.28-en.pdf | 2023-06-14 15:48 | 433K | |
![[ ]](/icons/unknown.gif) | ds_rec_twinpeak_4_series_en.pdf?t=1625487180 | 2021-07-05 13:14 | 1.3M | |
![[ ]](/icons/layout.gif) | ds_sg110cx%20datasheet_v14_en.pdf.pdf | 2022-09-21 13:38 | 356K | |
![[ ]](/icons/layout.gif) | dt-m--a-datasheet-vertex-s--neg9r.28-en-2022-pa2-web-neg9r.28-2022pa2-en-20220726.pdf | 2023-06-24 08:48 | 765K | |
![[ ]](/icons/layout.gif) | dt-m-0035-a-datasheet-vertexs-de09r.05-en-2022-a-print.pdf | 2023-05-24 13:04 | 450K | |
![[ ]](/icons/layout.gif) | dt-m-0070-a-datasheet-vertexs-ne09rc.05-na-en-2023-a-web.pdf | 2023-12-04 13:41 | 2.6M | |
![[ ]](/icons/layout.gif) | dt-m-a-datasheet-vertexs-de09r.08-en-2022-a-web.pdf | 2023-05-24 13:06 | 579K | |
![[ ]](/icons/layout.gif) | dtsu666-energy-meter-datasheet-en.pdf | 2024-02-01 12:11 | 517K | |
![[ ]](/icons/layout.gif) | dtsu666-hw-smart-power-sensor-quick-guide.pdf | 2023-06-12 15:14 | 1.3M | |
![[ ]](/icons/layout.gif) | dtsu666-hw-yds60-80-20230131--1-.pdf | 2023-06-12 15:14 | 111K | |
![[ ]](/icons/layout.gif) | dual-mppt-controller-datasheet.pdf | 2017-09-06 13:42 | 618K | |
![[ ]](/icons/layout.gif) | dual-mppt-controller-manual.pdf | 2017-09-06 13:42 | 1.9M | |
![[ ]](/icons/unknown.gif) | dual fuel product specifications | 2023-12-12 10:25 | 496K | |
![[ ]](/icons/layout.gif) | duoracer-manual-en-v2.1.pdf | 2021-06-23 10:41 | 1.3M | |
![[ ]](/icons/layout.gif) | durite-12v-24v-electronic-split-charger.pdf | 2017-09-22 11:23 | 170K | |
![[ ]](/icons/layout.gif) | durite-smart-vsr-200A-12V-datasheet-installation.pdf | 2019-01-31 15:49 | 249K | |
![[ ]](/icons/layout.gif) | e362479-20200410-certificate-of-compliance-1000v-1500v-ul61730-2021-09-28-monofacial.pdf | 2023-01-27 16:24 | 396K | |
![[ ]](/icons/layout.gif) | easee-one-ready-guide.pdf | 2023-04-22 07:19 | 348K | |
![[ ]](/icons/unknown.gif) | easeeoneproductflyer | 2023-04-22 06:03 | 1.1M | |
![[ ]](/icons/layout.gif) | eastron-catalogue-2019.pdf | 2020-02-18 12:06 | 12M | |
![[ ]](/icons/layout.gif) | eastron-energy-meter-ce-.pdf | 2021-08-05 12:51 | 456K | |
![[ ]](/icons/layout.gif) | eastron-sdm120a-manual.pdf | 2020-02-18 11:54 | 2.0M | |
![[ ]](/icons/layout.gif) | eastron-sdm630-modbus-protocol-v1-5.pdf | 2021-08-05 12:50 | 258K | |
![[ ]](/icons/layout.gif) | eastron-sdm630-standard-v2-user-manual-2016-v1.1.pdf | 2022-06-20 14:17 | 1.5M | |
![[ ]](/icons/layout.gif) | eastron-sdm630modbus-v2-user-manual-2016-v1-3.pdf | 2021-08-05 12:50 | 1.7M | |
![[ ]](/icons/layout.gif) | eca2-meter-user-info-general-information-for-pv-and-battery-storage.pdf | 2022-10-25 14:36 | 355K | |
![[ ]](/icons/layout.gif) | eco-eye-elite-fitting-instructions.pdf | 2017-05-19 17:23 | 213K | |
![[ ]](/icons/layout.gif) | eco-eye-elite-instruction-manual.pdf | 2017-05-19 17:23 | 1.1M | |
![[ ]](/icons/layout.gif) | ecoflow%20powerocean%20installation%20guide%20v1.6%20(en)_20240424.pdf | 2024-06-17 10:26 | 0 | |
![[ ]](/icons/layout.gif) | ecoflow---delta-2---user-manual.pdf | 2023-10-27 11:07 | 2.6M | |
![[ ]](/icons/layout.gif) | ecoflow-blade-user-manual.pdf | 2023-08-27 13:31 | 12M | |
![[ ]](/icons/layout.gif) | ecoflow-brochure.pdf | 2021-02-17 20:03 | 473K | |
![[ ]](/icons/layout.gif) | ecoflow-data-sheet-heat-losses-oct-20.pdf | 2021-02-17 10:27 | 349K | |
![[ ]](/icons/layout.gif) | ecoflow-delta-pro-multi-language-user-manual.pdf | 2023-09-04 16:48 | 11M | |
![[ ]](/icons/layout.gif) | ecoflow-installation-manual-iss-1.pdf | 2021-02-17 10:28 | 759K | |
![[ ]](/icons/layout.gif) | ecoflow-powerocean--single-phase--datasheet-en-20240306--1-.pdf | 2024-06-17 10:20 | 1.9M | |
![[ ]](/icons/layout.gif) | ecoflow-powerocean-single-phase-en-50549-1-dtis-doc-certificate-6182214.01-coc-ireland.pdf | 2024-07-18 15:48 | 526K | |
![[ ]](/icons/layout.gif) | ecoflow-river-2--user-manual-eu-en-v1.0.pdf | 2023-09-01 12:45 | 722K | |
![[ ]](/icons/unknown.gif) | ecoflowpower ocean datasheet | 2024-06-26 16:14 | 1.9M | |
![[ ]](/icons/layout.gif) | ecologi.pdf | 2022-12-07 12:15 | 24K | |
![[ ]](/icons/layout.gif) | eddi-2.1-installation-manual-rev-2.0.2-july-2022.pdf | 2022-08-10 12:30 | 2.3M | |
![[ ]](/icons/layout.gif) | eddi-2.1-installation-manual-rev-2.0.3-september-2022.pdf | 2023-05-03 16:37 | 2.1M | |
![[ ]](/icons/layout.gif) | eddi-brochure.pdf | 2018-06-11 13:36 | 1.6M | |
![[ ]](/icons/layout.gif) | eddi-datasheet-rev-2.0-june-2022--1-.pdf | 2022-08-10 12:30 | 414K | |
![[ ]](/icons/layout.gif) | eddi-datasheet-rev-2.0-june-2022.pdf | 2022-07-21 17:28 | 414K | |
![[ ]](/icons/layout.gif) | eddi-datasheet.pdf | 2018-06-11 13:36 | 549K | |
![[ ]](/icons/layout.gif) | eddi-manual-v1-2.pdf | 2018-06-11 13:36 | 1.4M | |
![[ ]](/icons/layout.gif) | eddi-user-manual-rev-2.0.1-july-2022.pdf | 2022-08-10 12:31 | 1.3M | |
![[ ]](/icons/layout.gif) | eden-reforestation.pdf | 2022-12-07 12:28 | 50K | |
![[ ]](/icons/layout.gif) | editeddatasheet---giv-gateway--june-2023-.pdf | 2023-06-09 17:00 | 122K | |
![[ ]](/icons/layout.gif) | ef-hd-p1-3k-3.68k-4.6k-5k-6k-s1-nf-en50549-1-certificate-6182216.02-coc.pdf | 2024-06-26 16:14 | 456K | |
![[ ]](/icons/layout.gif) | eging-m60-c-datasheet.pdf | 2019-01-15 17:06 | 751K | |
![[ ]](/icons/layout.gif) | eging-mcs.pdf | 2019-01-15 17:12 | 2.5M | |
![[ ]](/icons/layout.gif) | ehs-install-guide-samsung.pdf | 2023-01-12 11:44 | 53M | |
![[ ]](/icons/layout.gif) | ehs-modbus-control.pdf | 2023-11-24 13:13 | 325K | |
![[ ]](/icons/layout.gif) | ehs-mono-5-capacity-graph.pdf | 2021-03-03 15:22 | 103K | |
![[ ]](/icons/layout.gif) | ehs-mono-8-capacity-graph.pdf | 2021-03-03 15:23 | 103K | |
![[ ]](/icons/layout.gif) | ehs-mono-12-capacity-graph.pdf | 2021-03-03 15:23 | 102K | |
![[ ]](/icons/layout.gif) | ehs-mono-16-capacity-graph.pdf | 2021-03-03 15:23 | 104K | |
![[ ]](/icons/layout.gif) | ehs-r290-installation-guide.pdf | 2024-03-21 17:18 | 9.5M | |
![[ ]](/icons/layout.gif) | ehs-r290-mono-with-pump-installation-guide.pdf | 2024-04-18 09:38 | 11M | |
![[ ]](/icons/layout.gif) | eiffel-installation-guide-multilingual.pdf | 2021-10-07 14:29 | 1.4M | |
![[ ]](/icons/layout.gif) | eiffel_installation_guide_multilingual.pdf | 2021-10-07 14:28 | 0 | |
![[ ]](/icons/layout.gif) | ejobar-manual.pdf | 2020-07-22 15:34 | 887K | |
![[ ]](/icons/layout.gif) | eland-pv-cable-datasheet.pdf | 2021-05-04 16:58 | 201K | |
![[ ]](/icons/layout.gif) | eland-welding-cable.pdf | 2021-05-04 17:40 | 205K | |
![[ ]](/icons/layout.gif) | em530-ds-eng-2902779.pdf | 2022-06-24 14:43 | 823K | |
![[ ]](/icons/layout.gif) | em530-im-inst.pdf | 2022-06-24 14:43 | 1.3M | |
![[ ]](/icons/layout.gif) | emlite-3ph-meter-emp1.pdf | 2020-08-25 09:51 | 361K | |
![[ ]](/icons/unknown.gif) | emlite-EMGSM1-meter-MIDcertificate | 2018-04-11 11:58 | 503K | |
![[ ]](/icons/unknown.gif) | emlite-EMGSM1-meter-datasheet | 2018-04-11 11:03 | 85K | |
![[ ]](/icons/layout.gif) | emlite-NET-installer-notes.pdf | 2019-04-11 17:11 | 140K | |
![[ ]](/icons/layout.gif) | emlite-eca-mid-cert-oct18.pdf | 2018-10-26 14:52 | 251K | |
![[ ]](/icons/layout.gif) | emlite-eca2-meter-datasheet.pdf | 2017-11-30 16:10 | 281K | |
![[ ]](/icons/layout.gif) | emlite-warranty.pdf | 2018-12-20 16:52 | 244K | |
![[ ]](/icons/layout.gif) | emp1-basic-versions-user-manual-v1-0.pdf | 2023-10-31 16:52 | 1.1M | |
![[ ]](/icons/layout.gif) | emp1.ax-datasheet.pdf | 2023-10-31 16:52 | 254K | |
![[ ]](/icons/layout.gif) | emponi-datasheet.pdf | 2016-09-12 11:31 | 85K | |
![[ ]](/icons/layout.gif) | en-1-phase-solution-factsheet-v10.pdf | 2023-02-10 11:39 | 944K | |
![[ ]](/icons/layout.gif) | en-10-500-10052-01-h3ac3-user-manual-.pdf | 2024-06-10 14:58 | 9.5M | |
![[ ]](/icons/layout.gif) | en-10-500-10052-01-h3ac3-user-manual-compressed.pdf | 2024-07-12 10:19 | 9.5M | |
![[ ]](/icons/layout.gif) | en-ce-sg33cx-sg40cx-sg50cx-en-50549-1-certificate-20190715.pdf | 2023-08-04 09:34 | 1.4M | |
![[ ]](/icons/layout.gif) | en-ce-sh5.0-6.0-8.0-10rt-en-50549-1-certificate-20200828.pdf | 2023-03-28 16:15 | 750K | |
![[ ]](/icons/layout.gif) | en-datasheet-eiffel-english.pdf | 2021-10-07 14:29 | 53K | |
![[ ]](/icons/layout.gif) | en-datasheet-warranty-period-v2019.pdf | 2020-10-09 09:58 | 351K | |
![[ ]](/icons/layout.gif) | en-de-it-fr-nl-pl-es-pt-sv-sbr096-256-quick-installation-guide-ver-15-202205.pdf | 2023-06-09 12:03 | 6.3M | |
![[ ]](/icons/layout.gif) | en-de-it-fr-nl-pl-qg-sg15-20ktl-m-sg10ktl-mt-quick-installation-guide-v15-202003.pdf | 2023-08-21 13:32 | 4.7M | |
![[ ]](/icons/layout.gif) | en-de08m-ii--datasheet-2020-a-web--1-.pdf | 2020-12-15 11:27 | 433K | |
![[ ]](/icons/layout.gif) | en-de08m-ii--datasheet-2020-a-web--2-.pdf | 2020-12-15 17:00 | 433K | |
![[ ]](/icons/layout.gif) | en-ds-20230718-sh3.0rs-sh3.6rs-sh4.0rs-sh5.0rs-sh6.0rs-datasheet.pdf | 2024-05-20 16:25 | 341K | |
![[ ]](/icons/layout.gif) | en-ds-com100e-datasheet-v10-20190615.pdf | 2023-03-17 13:34 | 185K | |
![[ ]](/icons/layout.gif) | en-ds-dtsd1352-datasheet.pdf | 2023-05-10 16:21 | 198K | |
![[ ]](/icons/layout.gif) | en-ds-dtsu666-5-80--datasheet-v1.2.pdf | 2023-03-22 11:07 | 89K | |
![[ ]](/icons/layout.gif) | en-ds-eyem4-datasheet-v152-20200709.pdf | 2023-03-17 13:16 | 129K | |
![[ ]](/icons/layout.gif) | en-ds-sbr064-096-sbr128-sbr160-sbr192-sbr224-sbr256-datasheet-v14-20230418.pdf | 2024-07-12 08:41 | 538K | |
![[ ]](/icons/layout.gif) | en-ds-sbr096-sbr128-sbr160-sbr192-sbr224-sbr256-datasheet-v122-20211117--1-.pdf | 2023-03-16 16:23 | 514K | |
![[ ]](/icons/layout.gif) | en-ds-sbr096-sbr128-sbr160-sbr192-sbr224-sbr256-datasheet-v122-20211117.pdf | 2023-03-16 13:43 | 514K | |
![[ ]](/icons/layout.gif) | en-ds-sg15ktl-m-sg20ktl-m-datasheet-v153-20200724.pdf | 2023-08-21 13:31 | 351K | |
![[ ]](/icons/layout.gif) | en-ds-sg33-50cx-p2-datasheet-v12-20230110.pdf | 2023-05-25 16:05 | 358K | |
![[ ]](/icons/layout.gif) | en-ds-sg125cx-p2-datasheet-v11-20220406.pdf | 2023-03-16 09:10 | 354K | |
![[ ]](/icons/layout.gif) | en-ds-sg350hx-datasheet.pdf | 2024-04-04 17:08 | 330K | |
![[ ]](/icons/layout.gif) | en-ds-sh3.0rs-sh3.6rs-sh4.0rs-sh5.0rs-sh6.0rs-datasheet-v123-20210906.pdf | 2023-03-17 09:47 | 232K | |
![[ ]](/icons/layout.gif) | en-ds-sh5.0rt-6.0rt-8.0rt-10rt-datasheet-v121-20210609--1-.pdf | 2023-03-17 09:03 | 189K | |
![[ ]](/icons/layout.gif) | en-ds-sh5.0rt-6.0rt-8.0rt-10rt-datasheet-v121-20210609.pdf | 2023-03-28 16:14 | 189K | |
![[ ]](/icons/layout.gif) | en-ds-winet-s-datasheet-v111-20210320.pdf | 2023-05-23 16:08 | 79K | |
![[ ]](/icons/layout.gif) | en-easee-charge-productsheet-v1-12.pdf | 2023-04-22 07:27 | 813K | |
![[ ]](/icons/layout.gif) | en-easee-equalizer-p1-productsheet-v2-03.pdf | 2023-04-22 07:50 | 283K | |
![[ ]](/icons/layout.gif) | en-easee-one-guide-v1.07-d.pdf | 2023-04-22 07:16 | 763K | |
![[ ]](/icons/layout.gif) | en-easee-one-productsheet.pdf | 2023-04-22 06:07 | 649K | |
![[ ]](/icons/layout.gif) | en-easee-ready-productsheet-v2-01.pdf | 2024-02-06 13:39 | 223K | |
![[ ]](/icons/layout.gif) | en-easee-uhookcable-productsheet.pdf | 2023-04-23 08:02 | 474K | |
![[ ]](/icons/layout.gif) | en-fs-1-phase-solution-factsheet-v11-20230511.pdf | 2023-05-12 16:45 | 942K | |
![[ ]](/icons/layout.gif) | en-fs-compatibility-factsheet-v11-20220809-1.pdf | 2023-01-10 08:22 | 489K | |
![[ ]](/icons/layout.gif) | en-fs-compatibility-factsheet-v25.pdf | 2024-05-23 12:00 | 376K | |
![[ ]](/icons/layout.gif) | en-fs-consumption-monitoring-and-feed-in-zero-v10-20220216.pdf | 2023-04-20 17:00 | 361K | |
![[ ]](/icons/layout.gif) | en-fs-sg125cx-factsheet-v11.pdf | 2023-02-10 10:23 | 716K | |
![[ ]](/icons/layout.gif) | en-fs-sungrow-isolarcloud-factsheet.pdf | 2023-06-12 15:05 | 741K | |
![[ ]](/icons/layout.gif) | en-h1-g2-datasheet-v1.5-3.28.pdf | 2024-06-11 09:58 | 348K | |
![[ ]](/icons/layout.gif) | en-h1ac1-g2--guide-v1.2-compressed.pdf | 2024-06-11 11:09 | 2.1M | |
![[ ]](/icons/layout.gif) | en-h1ac1-g2--user-manual-v1.5-compressed.pdf | 2024-06-11 10:06 | 3.5M | |
![[ ]](/icons/layout.gif) | en-h3-ac3-datasheet-v3.8-3.28.pdf | 2024-07-12 10:14 | 724K | |
![[ ]](/icons/layout.gif) | en-h3-pro-datasheet-v1.9-5.20.pdf | 2024-07-12 13:09 | 365K | |
![[ ]](/icons/layout.gif) | en-h3-pro-installation-guide-20240410-.pdf | 2024-06-10 15:04 | 2.8M | |
![[ ]](/icons/layout.gif) | en-h3-pro-user-manual-20240410-.pdf | 2024-06-10 15:04 | 13M | |
![[ ]](/icons/layout.gif) | en-home-charge-ig-v1-02.pdf | 2023-04-22 07:29 | 921K | |
![[ ]](/icons/layout.gif) | en-home-charge-ug-v1-01--1-.pdf | 2023-04-22 07:30 | 95K | |
![[ ]](/icons/layout.gif) | en-k-guide-v1.3.pdf | 2024-06-12 09:36 | 13M | |
![[ ]](/icons/layout.gif) | en-k-manual-v1.4.pdf | 2024-06-12 09:36 | 8.8M | |
![[ ]](/icons/layout.gif) | en-k-series-datasheet-v1.7-3.28.pdf | 2024-06-12 09:35 | 235K | |
![[ ]](/icons/layout.gif) | en-manual-valkpro-l10-south-v1-0-4.pdf | 2020-10-09 09:57 | 2.0M | |
![[ ]](/icons/layout.gif) | en-qg-dtsu666-quick-installation-guide-v12-202003--1-.pdf | 2023-03-17 09:03 | 805K | |
![[ ]](/icons/layout.gif) | en-qg-dtsu666-quick-installation-guide-v12-202003.pdf | 2023-03-16 12:11 | 805K | |
![[ ]](/icons/layout.gif) | en-ready-ig-v1-01.pdf | 2024-02-06 13:41 | 480K | |
![[ ]](/icons/layout.gif) | en-sbr096-256-user-manual-ver-15-202205--1-.pdf | 2023-03-16 16:24 | 7.5M | |
![[ ]](/icons/layout.gif) | en-sbr096-256-user-manual-ver-15-202205.pdf | 2023-06-09 12:02 | 7.5M | |
![[ ]](/icons/layout.gif) | en-um-com100d-e-user-manual-v12-202111.pdf | 2023-04-20 17:05 | 7.3M | |
![[ ]](/icons/layout.gif) | en-um-sg15-20ktl-m-sg10ktl-mt-user-manual-v17-202004.pdf | 2023-08-21 13:33 | 11M | |
![[ ]](/icons/layout.gif) | en-user-manual-100-115ktl-m2-20220630-210x297.pdf | 2024-02-07 09:56 | 5.4M | |
![[ ]](/icons/unknown.gif) | en50438-certificate | 2019-06-06 08:33 | 66K | |
![[ ]](/icons/layout.gif) | en50438-for-ie-1-.pdf | 2021-01-29 11:57 | 215K | |
![[ ]](/icons/unknown.gif) | en50438cert | 2021-02-25 13:06 | 215K | |
![[ ]](/icons/layout.gif) | en50549-1-12-20m0.pdf | 2021-12-02 10:04 | 268K | |
![[ ]](/icons/layout.gif) | en50549-1-sun2000-2-6-l1.pdf | 2021-08-03 08:53 | 267K | |
![[ ]](/icons/layout.gif) | en50549-6098561.01-aoc-signed.pdf | 2021-04-22 18:21 | 693K | |
![[ ]](/icons/layout.gif) | en50549cer-i.s.-en50549-1-asw3000-5000-s-g2-en-v02.pdf | 2024-01-26 12:35 | 1.1M | |
![[ ]](/icons/layout.gif) | en_installation_guide_multilingual_coppersb_revision_a.pdf | 2021-07-12 10:29 | 1.8M | |
![[ ]](/icons/layout.gif) | energy-bank-limited-warranty.pdf | 2021-08-24 13:43 | 187K | |
![[ ]](/icons/layout.gif) | energy-meter-et112-manual.pdf | 2020-05-11 14:41 | 424K | |
![[ ]](/icons/unknown.gif) | energy-meters:et112 | 2020-02-13 11:43 | 22K | |
![[ ]](/icons/layout.gif) | energy-minder-install.pdf | 2018-02-12 09:32 | 360K | |
![[ ]](/icons/layout.gif) | energy-minder-user-guide.pdf | 2018-02-12 09:33 | 195K | |
![[ ]](/icons/layout.gif) | enphase-3ph-schematic-gb.pdf | 2020-08-20 14:59 | 450K | |
![[ ]](/icons/layout.gif) | enphase-activation-guide.pdf | 2020-09-21 14:53 | 505K | |
![[ ]](/icons/layout.gif) | enphase-comms-kit-2-installation-guide.pdf | 2024-02-29 11:00 | 852K | |
![[ ]](/icons/layout.gif) | enphase-communication-kit-2-datasheet.pdf | 2024-02-29 11:00 | 419K | |
![[ ]](/icons/layout.gif) | enphase-company-information.pdf | 2020-03-19 17:18 | 461K | |
![[ ]](/icons/layout.gif) | enphase-connector-frame-brochure-1.pdf | 2019-10-14 14:56 | 746K | |
![[ ]](/icons/layout.gif) | enphase-european-warranty.pdf | 2019-10-14 15:31 | 153K | |
![[ ]](/icons/unknown.gif) | enphase-g99-pdf | 2022-03-09 14:08 | 314K | |
![[ ]](/icons/layout.gif) | enphase-g100-export-limitation-configuration-july-2020.pdf | 2020-07-08 10:20 | 117K | |
![[ ]](/icons/layout.gif) | enphase-half-price.pdf | 2021-03-16 16:34 | 188K | |
![[ ]](/icons/layout.gif) | enphase-half-price1.pdf | 2021-03-17 10:57 | 513K | |
![[ ]](/icons/layout.gif) | enphase-iq8-manual.pdf | 2024-03-21 12:46 | 2.2M | |
![[ ]](/icons/layout.gif) | enphase-iq8-microinverter-wiring-diagrams.pdf | 2024-05-08 10:00 | 126K | |
![[ ]](/icons/layout.gif) | enphase-iq8-microinverters-at-higher-altitudes.pdf | 2023-09-22 15:44 | 258K | |
![[ ]](/icons/layout.gif) | enphase-iq8-microinverters-installation-and-operation-manual.pdf | 2023-09-22 15:43 | 2.2M | |
![[ ]](/icons/layout.gif) | enphase-iq8-quick-install-guide.pdf | 2024-05-08 09:59 | 1.2M | |
![[ ]](/icons/layout.gif) | enphase-iq8-series-microinverters-best-pracice.pdf | 2024-05-08 10:00 | 98K | |
![[ ]](/icons/layout.gif) | enphase-iq8-series-microinverters-datasheet--1-.pdf | 2024-05-08 09:59 | 949K | |
![[ ]](/icons/layout.gif) | enphase-iq8-series-microinverters-datasheet.pdf | 2023-09-22 15:42 | 949K | |
![[ ]](/icons/layout.gif) | enphase-limited-warranty-uk-25-years--1-.pdf | 2024-05-08 10:06 | 211K | |
![[ ]](/icons/layout.gif) | enphase-limited-warranty-uk-25-years.pdf | 2020-03-19 17:08 | 211K | |
![[ ]](/icons/layout.gif) | enphase-nhs-case-study.pdf | 2020-06-25 14:34 | 244K | |
![[ ]](/icons/layout.gif) | enphase-phase-coupler-datasheet.pdf | 2020-08-20 15:09 | 169K | |
![[ ]](/icons/layout.gif) | enphase-relay-1ph-datasheet.pdf | 2024-05-08 10:13 | 250K | |
![[ ]](/icons/layout.gif) | enphase-relay-1ph-manual.pdf | 2024-05-08 10:13 | 275K | |
![[ ]](/icons/layout.gif) | enphase-safety-whitepaper--why-an-ac-system-is-safer.pdf | 2020-02-12 17:14 | 939K | |
![[ ]](/icons/layout.gif) | enphase-webinar-pres-2020.pdf | 2020-05-14 15:11 | 1.5M | |
![[ ]](/icons/layout.gif) | enphaseframemountinstallationguide.pdf | 2019-10-14 14:26 | 875K | |
![[ ]](/icons/layout.gif) | envoy-s-installation-operation.pdf | 2024-02-29 11:02 | 1.9M | |
![[ ]](/icons/layout.gif) | envoy-s-stan-ds-en-uk.pdf | 2021-07-22 17:33 | 175K | |
![[ ]](/icons/layout.gif) | envoys-datasheet.pdf | 2019-10-14 15:39 | 225K | |
![[ ]](/icons/layout.gif) | envoysinstallationsheet.pdf | 2019-10-15 09:46 | 2.0M | |
![[ ]](/icons/layout.gif) | eo-basic-datasheet.pdf | 2018-06-11 12:30 | 154K | |
![[ ]](/icons/layout.gif) | eo-charger-manual.pdf | 2018-06-11 12:30 | 5.3M | |
![[ ]](/icons/layout.gif) | eo-charging-warranty-uk-roi.pdf | 2021-03-10 18:25 | 191K | |
![[ ]](/icons/layout.gif) | eo-garo-datasheet.pdf | 2020-12-15 11:43 | 1.1M | |
![[ ]](/icons/layout.gif) | eo-genius-architecture.pdf | 2018-06-11 12:40 | 102K | |
![[ ]](/icons/layout.gif) | eo-genius-datasheet.pdf | 2018-06-11 12:40 | 172K | |
![[ ]](/icons/layout.gif) | eo-hub-datasheet.pdf | 2018-06-11 12:41 | 176K | |
![[ ]](/icons/layout.gif) | eo-mini---eo-basic-led-guide--1-.pdf | 2019-10-24 09:36 | 178K | |
![[ ]](/icons/layout.gif) | eo-mini-basic-socket-datasheet.pdf | 2018-06-11 09:52 | 126K | |
![[ ]](/icons/layout.gif) | eo-mini-current-switch-values.pdf | 2019-10-24 09:36 | 426K | |
![[ ]](/icons/layout.gif) | eo-mini-manual.pdf | 2018-06-11 12:27 | 228K | |
![[ ]](/icons/layout.gif) | eo-mini-pro---installation-guide.pdf | 2019-10-24 09:36 | 942K | |
![[ ]](/icons/layout.gif) | eo-mini-pro-2-datasheet.pdf | 2021-03-10 18:24 | 472K | |
![[ ]](/icons/layout.gif) | eo-mini-pro-2-installation-and-userguide.pdf | 2021-03-10 18:25 | 601K | |
![[ ]](/icons/layout.gif) | eo-mini-pro-datasheet-uk-ie.pdf | 2019-10-24 09:32 | 202K | |
![[ ]](/icons/layout.gif) | eo-portal-user-guide.pdf | 2018-06-11 11:55 | 1.3M | |
![[ ]](/icons/layout.gif) | eo-post--square--data-sheet--uk---ireland-.pdf | 2021-07-06 15:11 | 152K | |
![[ ]](/icons/layout.gif) | eo-warranty.pdf | 2019-10-24 09:32 | 551K | |
![[ ]](/icons/layout.gif) | eoalm-installation-and-user-guide.pdf | 2018-09-17 15:34 | 1.2M | |
![[ ]](/icons/layout.gif) | eoalm-installation-guide.pdf | 2018-09-17 15:33 | 0 | |
![[ ]](/icons/layout.gif) | eos-5k--dip-switch-instruction.pdf | 2022-11-28 15:48 | 837K | |
![[ ]](/icons/layout.gif) | eos-5k-datasheet.pdf | 2021-11-17 10:18 | 119K | |
![[ ]](/icons/layout.gif) | ep5a.pdf | 2016-09-12 11:31 | 423K | |
![[ ]](/icons/layout.gif) | epever-datasheet-duoracer.pdf | 2021-06-23 10:41 | 295K | |
![[ ]](/icons/layout.gif) | epever-datasheet-landstar%20e(eu).pdf | 2019-04-30 09:28 | 268K | |
![[ ]](/icons/layout.gif) | epever-datasheet-landstar-e-eu-.pdf | 2021-01-15 12:12 | 250K | |
![[ ]](/icons/layout.gif) | epever-datasheet-ls-epd--1-.pdf | 2021-07-12 10:27 | 238K | |
![[ ]](/icons/layout.gif) | epever-datasheet-mt11.pdf | 2021-06-23 10:45 | 219K | |
![[ ]](/icons/layout.gif) | epever-datasheet-tracer-an(10-40a).pdf | 2019-08-14 13:29 | 0 | |
![[ ]](/icons/layout.gif) | epever-datasheet-tracer-an%ef%bc%8810-40a%ef%bc%89.pdf | 2019-08-14 13:24 | 283K | |
![[ ]](/icons/layout.gif) | epever-datasheet-tracer-an-10a-4oa-.pdf | 2021-06-23 13:36 | 338K | |
![[ ]](/icons/layout.gif) | epever-datasheet-tracer-an-50-100a-.pdf | 2021-06-23 10:37 | 498K | |
![[ ]](/icons/layout.gif) | epever-datasheet-tracer-bp.pdf | 2021-07-12 11:57 | 1.5M | |
![[ ]](/icons/layout.gif) | epever-datasheet-triron-mppt-solar-controller.pdf | 2019-04-09 11:47 | 279K | |
![[ ]](/icons/layout.gif) | epever-datasheet-triron.pdf | 2019-08-14 13:20 | 279K | |
![[ ]](/icons/layout.gif) | epever-datasheet.pdf | 2016-09-12 11:31 | 550K | |
![[ ]](/icons/layout.gif) | epever-manual.pdf | 2016-09-12 11:31 | 484K | |
![[ ]](/icons/layout.gif) | eplus-installation-manual.pdf | 2024-04-30 11:23 | 3.6M | |
![[ ]](/icons/layout.gif) | eps-changeover-2-pole-100a-with-integrated-rcbo.pdf | 2017-11-10 10:12 | 45K | |
![[ ]](/icons/layout.gif) | eps-wiring-diagram.pdf | 2017-11-08 15:39 | 69K | |
![[ ]](/icons/layout.gif) | epsolar-epipdb-com-data.pdf | 2016-09-12 11:31 | 374K | |
![[ ]](/icons/layout.gif) | epsolar-epipdb-com.pdf | 2016-09-12 11:31 | 347K | |
![[ ]](/icons/layout.gif) | epsolar-tracer-bn-mppt-controller-10a-20a-30a-40a-datasheet.pdf | 2018-09-17 13:04 | 735K | |
![[ ]](/icons/layout.gif) | epsolar-tracer-bn-mppt-controller-10a-20a-30a-40a-manual.pdf | 2018-09-17 13:06 | 1.2M | |
![[ ]](/icons/layout.gif) | ess-datasheet-rsa-v4--1-.pdf | 2021-11-16 11:07 | 519K | |
![[ ]](/icons/layout.gif) | ess-datasheet-rsa-v4.pdf | 2021-10-12 13:48 | 0 | |
![[ ]](/icons/layout.gif) | ess1-datasheet-rsa-v4.pdf | 2022-05-24 17:02 | 519K | |
![[ ]](/icons/layout.gif) | etfe-110w-semi-flexible-solar-panel.pdf | 2017-10-10 11:22 | 209K | |
![[ ]](/icons/layout.gif) | etracer_spec.pdf | 2016-09-12 11:31 | 543K | |
![[ ]](/icons/layout.gif) | eu-declaration-of-conformity-hpt-15k-17k-20k-25k.pdf | 2022-07-15 09:44 | 148K | |
![[ ]](/icons/layout.gif) | eu-warranty-2022-06.pdf | 2024-06-10 17:01 | 781K | |
![[ ]](/icons/layout.gif) | eudeclarationofconformity.pdf | 2022-08-15 10:10 | 69K | |
![[ ]](/icons/layout.gif) | eurener-installation-guide-100521.pdf | 2021-05-10 09:46 | 916K | |
![[ ]](/icons/layout.gif) | eurener-installation-guide.pdf | 2024-05-03 10:03 | 878K | |
![[ ]](/icons/layout.gif) | eurener-mcs-annex.pdf | 2023-06-21 14:21 | 845K | |
![[ ]](/icons/layout.gif) | eurener-mcs-cert.pdf | 2021-05-10 09:48 | 804K | |
![[ ]](/icons/layout.gif) | eurener-mcs-declaration-2022q1.pdf | 2022-01-28 09:53 | 222K | |
![[ ]](/icons/layout.gif) | eurener-mcs-q2-2022.pdf | 2022-04-13 11:51 | 846K | |
![[ ]](/icons/layout.gif) | eurener-mcs.pdf | 2019-01-21 10:22 | 804K | |
![[ ]](/icons/layout.gif) | eurener-mepv-108-half-cut-icon-400-420wp-2022en.pdf | 2022-10-28 14:41 | 918K | |
![[ ]](/icons/layout.gif) | eurener-mepv-108-nexa-topcon-420-435wp-2023en--1-.pdf | 2023-05-19 15:01 | 658K | |
![[ ]](/icons/layout.gif) | eurener-mepv-120-half-cut-9bb-375wp-2021en-midsummer.pdf | 2021-12-10 09:36 | 1.2M | |
![[ ]](/icons/layout.gif) | eurener-mepv-120-half-cut-340w.pdf | 2021-11-22 15:59 | 793K | |
![[ ]](/icons/layout.gif) | eurener-mepv-120-half-cut-360-375w-9bb-2021en-datasheet.pdf | 2021-05-10 09:43 | 727K | |
![[ ]](/icons/layout.gif) | eurener-mepv-120-nexa-topcon-475-480wp-2023en.pdf | 2024-01-12 15:25 | 693K | |
![[ ]](/icons/layout.gif) | eurener-mepv-120-ultra-premium-400wp-2022en--1-.pdf | 2022-09-14 13:25 | 406K | |
![[ ]](/icons/layout.gif) | eurener-mepv-132-ultra-440wp-2024en.pdf | 2024-05-03 10:01 | 361K | |
![[ ]](/icons/layout.gif) | eurener-mepv-nexa-480-500w-enafce.pdf | 2024-06-03 11:43 | 376K | |
![[ ]](/icons/layout.gif) | eurener-mepv-nexa-dg-bif-480-500w-enafce--1---1-.pdf | 2024-06-05 11:58 | 498K | |
![[ ]](/icons/layout.gif) | eurener-polysilicone-statement-1.pdf | 2021-05-10 10:13 | 183K | |
![[ ]](/icons/layout.gif) | eurener-polysilicone-statement.pdf | 2021-05-10 10:11 | 183K | |
![[ ]](/icons/layout.gif) | eurener-premium-warranty-430w.pdf | 2024-01-31 11:15 | 804K | |
![[ ]](/icons/layout.gif) | eurener-premium-warranty-480w.pdf | 2024-01-31 12:02 | 828K | |
![[ ]](/icons/layout.gif) | eurener-turbo-superior-300-320-datasheet.pdf | 2019-01-15 15:16 | 634K | |
![[ ]](/icons/layout.gif) | eurener-updated-mcs-certificate.pdf | 2021-09-06 15:14 | 796K | |
![[ ]](/icons/layout.gif) | eurener-warranty-certificate---mepv-108-cells-en-oct22.pdf | 2022-11-02 09:10 | 117K | |
![[ ]](/icons/layout.gif) | eurener-warranty-certificate---mepv-ultra-premium-en-oct2022--1-.pdf | 2024-05-03 10:01 | 113K | |
![[ ]](/icons/layout.gif) | eurener-warranty-certificate---mepv-ultra-premium-en-oct2022.pdf | 2023-06-08 14:48 | 113K | |
![[ ]](/icons/layout.gif) | eurener-warranty-certificate-2019-en.pdf | 2021-05-10 09:48 | 133K | |
![[ ]](/icons/layout.gif) | eurener-warranty-certificate-en-sep2021--2---1-.pdf | 2022-11-08 14:43 | 123K | |
![[ ]](/icons/layout.gif) | eurener-warranty-certificate-mepv-topcon-430W.pdf | 2023-10-26 17:35 | 90K | |
![[ ]](/icons/layout.gif) | eurener-warranty.pdf | 2019-02-18 14:30 | 112K | |
![[ ]](/icons/layout.gif) | ev-autocharge-pedestal-coin-token-superfast-installation-sheet.pdf | 2019-05-21 12:57 | 97K | |
![[ ]](/icons/layout.gif) | ev-autocharge-pedestal-superfast-installation-sheet.pdf | 2019-05-21 12:55 | 32K | |
![[ ]](/icons/layout.gif) | ev-charger-brochure---oct-2023.pdf | 2023-10-16 12:17 | 3.1M | |
![[ ]](/icons/layout.gif) | ev-charger-wiring-into-giv-gateway-1.pdf | 2024-02-23 12:19 | 561K | |
![[ ]](/icons/layout.gif) | ev-ehs-ae080bxydeg-eu-220714.pdf | 2023-01-12 10:48 | 2.0M | |
![[ ]](/icons/layout.gif) | ev-ehs-ae120-140bxydeg-eu-220714--1-.pdf | 2023-01-12 10:50 | 2.0M | |
![[ ]](/icons/layout.gif) | ev-ehs-ae120-140bxydgg-eu-220714.pdf | 2023-01-12 10:52 | 2.1M | |
![[ ]](/icons/layout.gif) | ev-installation-manual-2022-v2.pdf | 2022-05-23 09:44 | 1.7M | |
![[ ]](/icons/layout.gif) | ev-pres.pdf | 2021-04-28 09:32 | 155K | |
![[ ]](/icons/layout.gif) | ev-session-rightcharge-pres.pdf | 2020-05-21 16:15 | 331K | |
![[ ]](/icons/layout.gif) | ev-ultra-cat5e-datasheet--1-.pdf | 2024-01-03 15:26 | 867K | |
![[ ]](/icons/layout.gif) | ev-ultra-stripping-tool-datasheet.pdf | 2024-01-04 11:46 | 803K | |
![[ ]](/icons/layout.gif) | evchargingstationenmanuel.pdf | 2023-01-17 16:07 | 911K | |
![[ ]](/icons/layout.gif) | evoenergy-mhr.pdf | 2022-05-10 10:23 | 1.5M | |
![[ ]](/icons/layout.gif) | evse-test-box-manual.pdf | 2019-05-21 14:17 | 185K | |
![[ ]](/icons/layout.gif) | evt28---root-mount-specification.pdf | 2023-12-01 11:56 | 148K | |
![[ ]](/icons/layout.gif) | evwp2016data-sheet.pdf | 2019-10-15 14:52 | 1.8M | |
![[ ]](/icons/layout.gif) | extend-your-input-power-for-p801-power-optimizer---waiver-rfw-002064--2-.pdf | 2024-04-23 17:13 | 83K | |
![[ ]](/icons/layout.gif) | extend-your-input-power-for-p801-power-optimizer---waiver-rfw-002064.pdf | 2023-11-01 15:46 | 83K | |
![[ ]](/icons/layout.gif) | f-252fa-252f0-252f0-252ffa004524bdfa49e466a79ae52749879b5efa0d24-gb-iv-sung-enlbjlrdfleumec.pdf | 2022-07-29 13:08 | 399K | |
![[ ]](/icons/layout.gif) | factory-quality-warranty-terms-for-overseas-territory-of-aiswei-v2.0.pdf | 2023-10-12 09:21 | 155K | |
![[ ]](/icons/layout.gif) | fairshare.pdf | 2022-12-14 15:49 | 69K | |
![[ ]](/icons/layout.gif) | faq-1099-how-to-connect-a-smart-meter.pdf | 2023-08-21 13:37 | 97K | |
![[ ]](/icons/layout.gif) | fast-flash--technical-data-sheet-gb.pdf | 2024-05-10 15:45 | 193K | |
![[ ]](/icons/layout.gif) | fast-flash-datasheet.pdf | 2021-03-09 15:45 | 486K | |
![[ ]](/icons/layout.gif) | fast-flash-montage-brugervejledning.pdf | 2024-05-10 15:45 | 1.6M | |
![[ ]](/icons/layout.gif) | fastensol-400mm-mini-rail-portrait-datasheet.pdf | 2020-11-17 08:48 | 2.2M | |
![[ ]](/icons/layout.gif) | fastensol-datasheet-tile-roof.pdf | 2019-02-20 12:42 | 520K | |
![[ ]](/icons/layout.gif) | fastensol-gs-install-manual.pdf | 2019-12-11 13:32 | 2.5M | |
![[ ]](/icons/layout.gif) | fastensol-hanger-bolt-manual.pdf | 2020-11-11 15:01 | 352K | |
![[ ]](/icons/layout.gif) | fastensol-mcs-full.pdf | 2018-04-23 15:34 | 562K | |
![[ ]](/icons/layout.gif) | fastensol-metal-roof-clamps-datasheet.pdf | 2020-02-25 09:12 | 5.5M | |
![[ ]](/icons/layout.gif) | fastensol-mini-rail--portrait-datasheet.pdf | 2020-01-17 09:20 | 1.9M | |
![[ ]](/icons/layout.gif) | fastensol-mini-rail-landscape-datasheet.pdf | 2020-01-17 09:20 | 1.9M | |
![[ ]](/icons/layout.gif) | fastensol-pitched-install-manual.pdf | 2018-07-10 16:24 | 2.5M | |
![[ ]](/icons/layout.gif) | fastensol-pitched-roof-installation-manual-.pdf | 2024-07-05 11:28 | 1.8M | |
![[ ]](/icons/layout.gif) | fastensol-slate-mate-v2-003.pdf | 2023-09-20 15:34 | 3.7M | |
![[ ]](/icons/layout.gif) | fastensol-triangle-manaul.pdf | 2018-09-14 09:37 | 1.6M | |
![[ ]](/icons/layout.gif) | fastensol-triangle-mount-datasheet.pdf | 2018-09-14 10:27 | 347K | |
![[ ]](/icons/layout.gif) | fastensol-universal-clamp-datasheet.pdf | 2020-01-17 09:19 | 1.7M | |
![[ ]](/icons/layout.gif) | fastensol-warranty-01102.pdf | 2024-07-05 11:31 | 215K | |
![[ ]](/icons/layout.gif) | fastensol-warranty-011020--1-.pdf | 2024-01-03 15:03 | 215K | |
![[ ]](/icons/layout.gif) | fastensol-warranty-011020.pdf | 2020-10-01 10:41 | 215K | |
![[ ]](/icons/layout.gif) | fastensol-warranty.pdf | 2019-03-14 09:10 | 237K | |
![[ ]](/icons/layout.gif) | fe-7.product.pdf | 2021-11-11 09:55 | 872K | |
![[ ]](/icons/layout.gif) | feature---dynamicpricing.pdf | 2023-04-13 13:37 | 4.4M | |
![[ ]](/icons/layout.gif) | feature---instant-charge.pdf | 2023-04-13 13:38 | 4.3M | |
![[ ]](/icons/layout.gif) | feature---load-balancing.pdf | 2023-04-13 13:38 | 1.2M | |
![[ ]](/icons/layout.gif) | feature---sponsored-charge-point.pdf | 2023-04-13 13:39 | 3.3M | |
![[ ]](/icons/layout.gif) | female-push-on-terminals.pdf | 2023-08-24 12:41 | 663K | |
![[ ]](/icons/layout.gif) | fet-technical.pdf | 2021-11-17 11:48 | 874K | |
![[ ]](/icons/layout.gif) | ff8080818465bc79018473eea49e002c.pdf | 2023-07-07 16:13 | 5.9M | |
![[ ]](/icons/layout.gif) | ff808081836983ff01838832563200b4--1-.pdf | 2024-04-17 10:27 | 447K | |
![[ ]](/icons/layout.gif) | ff808081836983ff01838832563200b4.pdf | 2023-05-16 15:19 | 447K | |
![[ ]](/icons/layout.gif) | ff808081836983ff01838852cc7800c8.pdf | 2023-07-07 16:14 | 3.1M | |
![[ ]](/icons/layout.gif) | field-wireable-3p-qig-en-int-rev03-04-03-2023--1-.pdf | 2024-03-12 11:16 | 637K | |
![[ ]](/icons/layout.gif) | field-wireable-3p-qig-en-int-rev03-04-03-2023.pdf | 2024-02-27 15:49 | 637K | |
![[ ]](/icons/layout.gif) | field-wireable-3p-qig-english--1-.pdf | 2024-03-12 11:17 | 547K | |
![[ ]](/icons/layout.gif) | field-wireable-3p-qig-english.pdf | 2024-02-27 15:48 | 547K | |
![[ ]](/icons/layout.gif) | file-1380725620.pdf | 2022-09-26 09:20 | 585K | |
![[ ]](/icons/layout.gif) | file-1380725656.pdf | 2022-09-26 09:20 | 466K | |
![[ ]](/icons/layout.gif) | finance-assistant--1-.pdf | 2023-08-09 16:59 | 5.0M | |
![[ ]](/icons/layout.gif) | finance-assistant.pdf | 2023-08-09 16:56 | 5.0M | |
![[ ]](/icons/layout.gif) | finance-manager.pdf | 2021-07-27 16:09 | 12M | |
![[ ]](/icons/layout.gif) | fire-safety-certificates.pdf | 2018-08-01 10:07 | 2.4M | |
![[ ]](/icons/layout.gif) | fire-safety-white-paper.pdf | 2019-10-18 09:40 | 2.2M | |
![[ ]](/icons/layout.gif) | fire-test-repot.pdf | 2017-05-19 17:23 | 81K | |
![[ ]](/icons/layout.gif) | fireblock-lithium-battery-fire-extinguishers-brochure-fireblock-europe-issue-1.1.pdf | 2023-11-30 15:13 | 3.1M | |
![[ ]](/icons/layout.gif) | fireblock-lithium-material-safety-data-sheet.pdf | 2023-10-31 11:05 | 207K | |
![[ ]](/icons/layout.gif) | fireblock-lithium-technical-data-sheet.pdf | 2023-11-23 08:50 | 216K | |
![[ ]](/icons/layout.gif) | flex-02nl_datasheet_6.pdf | 2018-09-25 11:49 | 0 | |
![[ ]](/icons/layout.gif) | flex-03m-2.6m-datasheet-2--3-.pdf | 2020-02-27 12:09 | 847K | |
![[ ]](/icons/layout.gif) | flex-03n-datasheet.pdf | 2018-12-11 13:29 | 306K | |
![[ ]](/icons/layout.gif) | flex-03n_datasheet.pdf | 2018-12-11 13:29 | 0 | |
![[ ]](/icons/layout.gif) | flex-03ns-datasheet.pdf | 2018-12-13 10:10 | 300K | |
![[ ]](/icons/layout.gif) | flex-03w-2.6m-datasheet-7--2-.pdf | 2020-02-27 12:10 | 766K | |
![[ ]](/icons/layout.gif) | flxisun.pdf | 2016-09-12 11:31 | 1.7M | |
![[ ]](/icons/layout.gif) | flxs-150m-semi-flexible-solar-panel.pdf | 2017-10-10 11:19 | 168K | |
![[ ]](/icons/layout.gif) | flyer-prlc-100.pdf | 2021-11-01 15:21 | 1.3M | |
![[ ]](/icons/unknown.gif) | fmfcgzgsmdrrwhsprwzgxrqcvpgtzmxl?projector=1&messagepartid=0.1 | 2023-04-20 14:35 | 153K | |
![[ ]](/icons/layout.gif) | folder-victron-energy-blue-smart-ip65-charger-230v-en_web.pdf | 2020-02-05 16:44 | 1.1M | |
![[ ]](/icons/layout.gif) | folding-solar-kit-spec-sheet.pdf | 2017-01-19 17:03 | 138K | |
![[ ]](/icons/layout.gif) | fox-battery-ec-series-factsheet.pdf | 2024-06-10 13:08 | 3.9M | |
![[ ]](/icons/layout.gif) | fox-ecs-manual.pdf | 2024-06-10 13:24 | 2.3M | |
![[ ]](/icons/layout.gif) | fox-ecs-quick-guide.pdf | 2024-06-10 13:23 | 1.4M | |
![[ ]](/icons/layout.gif) | fox-ecs2900-datasheet.pdf | 2024-07-16 10:53 | 512K | |
![[ ]](/icons/layout.gif) | fox-ep-batt-warranty-ext.pdf | 2024-07-16 09:18 | 702K | |
![[ ]](/icons/layout.gif) | fox-ep-series-factsheet.pdf | 2024-06-10 17:14 | 2.3M | |
![[ ]](/icons/layout.gif) | fox-ep5-datasheet.pdf | 2024-07-12 13:26 | 628K | |
![[ ]](/icons/layout.gif) | fox-ep11-datasheet.pdf | 2024-07-16 09:26 | 654K | |
![[ ]](/icons/layout.gif) | fox-eq4800-datasheet.pdf | 2024-07-16 10:30 | 513K | |
![[ ]](/icons/layout.gif) | fox-ess-battery-sizing-guide.pdf | 2024-07-08 11:16 | 127K | |
![[IMG]](/icons/image2.gif) | foxes-afloat-wiring-diagram.png | 2021-09-17 16:34 | 200K | |
![[ ]](/icons/layout.gif) | froni-02103-200507041509.pdf | 2020-12-09 10:15 | 1.0M | |
![[ ]](/icons/layout.gif) | froni-02104-200507041821.pdf | 2020-12-09 10:16 | 1.0M | |
![[ ]](/icons/layout.gif) | fronius-5-g59.pdf | 2017-05-19 17:23 | 620K | |
![[ ]](/icons/layout.gif) | fronius-5-g83.pdf | 2017-05-19 17:23 | 605K | |
![[ ]](/icons/layout.gif) | fronius-6-g83.pdf | 2017-05-19 17:23 | 605K | |
![[ ]](/icons/layout.gif) | fronius-7-g83.pdf | 2017-05-19 17:23 | 578K | |
![[ ]](/icons/layout.gif) | fronius-8-g83.pdf | 2017-05-19 17:23 | 569K | |
![[ ]](/icons/layout.gif) | fronius-10-g83.pdf | 2017-05-19 17:23 | 73K | |
![[ ]](/icons/layout.gif) | fronius-12-g59.pdf | 2017-05-19 17:23 | 154K | |
![[ ]](/icons/layout.gif) | fronius-17-g59.pdf | 2017-05-19 17:23 | 151K | |
![[ ]](/icons/layout.gif) | fronius-20-g59.pdf | 2017-05-19 17:23 | 151K | |
![[ ]](/icons/layout.gif) | fronius-25-g59.pdf | 2017-05-19 17:23 | 643K | |
![[ ]](/icons/layout.gif) | fronius-27-g59.pdf | 2017-05-19 17:23 | 662K | |
![[ ]](/icons/layout.gif) | fronius-45-g83.pdf | 2017-05-19 17:23 | 578K | |
![[ ]](/icons/layout.gif) | fronius-2023-statement.pdf | 2023-02-14 12:24 | 38K | |
![[ ]](/icons/layout.gif) | fronius-battery-adr.pdf | 2017-10-20 16:43 | 768K | |
![[ ]](/icons/layout.gif) | fronius-brochure-100621.pdf | 2021-06-10 16:34 | 3.4M | |
![[ ]](/icons/layout.gif) | fronius-brochure-280621.pdf | 2021-06-28 10:06 | 3.4M | |
![[ ]](/icons/layout.gif) | fronius-brochure-battery-storage.pdf | 2017-10-20 16:42 | 1.2M | |
![[ ]](/icons/layout.gif) | fronius-ct-clamp-schematic.pdf | 2018-07-24 10:23 | 349K | |
![[ ]](/icons/layout.gif) | fronius-ct-infosheet.pdf | 2018-07-24 10:27 | 209K | |
![[ ]](/icons/layout.gif) | fronius-datamanager-2-0.pdf | 2020-09-18 13:57 | 425K | |
![[ ]](/icons/layout.gif) | fronius-datamanager-manual.pdf | 2020-09-18 13:59 | 1.6M | |
![[ ]](/icons/layout.gif) | fronius-datcom-manual.pdf | 2019-07-19 10:24 | 1.4M | |
![[ ]](/icons/layout.gif) | fronius-dc-con-kit-25.pdf | 2021-06-11 12:37 | 73K | |
![[ ]](/icons/layout.gif) | fronius-eco-datasheet.pdf | 2017-05-19 17:23 | 2.0M | |
![[ ]](/icons/layout.gif) | fronius-eco-install-manual.pdf | 2017-05-19 17:23 | 6.8M | |
![[ ]](/icons/layout.gif) | fronius-eco-quick-install.pdf | 2017-05-19 17:23 | 8.2M | |
![[ ]](/icons/layout.gif) | fronius-export-dno-reqs.pdf | 2017-05-19 17:23 | 543K | |
![[ ]](/icons/layout.gif) | fronius-export-limitation.pdf | 2017-05-19 17:23 | 3.0M | |
![[ ]](/icons/unknown.gif) | fronius-export-planning | 2017-05-19 17:23 | 915K | |
![[ ]](/icons/layout.gif) | fronius-galvo-datasheet.pdf | 2017-05-19 17:23 | 1.6M | |
![[ ]](/icons/layout.gif) | fronius-galvo-install-manual.pdf | 2017-05-19 17:23 | 3.6M | |
![[ ]](/icons/layout.gif) | fronius-galvo-operating-manual.pdf | 2017-05-19 17:23 | 4.0M | |
![[ ]](/icons/layout.gif) | fronius-galvo-quick-install.pdf | 2017-05-19 17:23 | 1.8M | |
![[ ]](/icons/layout.gif) | fronius-gen24-6kw-g98-cert.pdf | 2020-11-19 11:18 | 1.0M | |
![[ ]](/icons/layout.gif) | fronius-gen24-plus-brochure.pdf | 2024-05-16 09:41 | 504K | |
![[ ]](/icons/layout.gif) | fronius-gen24-primo-3-6kw-g98-cert.pdf | 2021-04-08 11:16 | 1.0M | |
![[ ]](/icons/layout.gif) | fronius-gen24-primo-4-6kw-g99-cert.pdf | 2021-04-08 11:19 | 815K | |
![[ ]](/icons/layout.gif) | fronius-gen24-primo-4kw-g99-cert.pdf | 2021-04-08 11:15 | 800K | |
![[ ]](/icons/layout.gif) | fronius-gen24-primo-5kw-g99-cert.pdf | 2021-04-08 11:21 | 780K | |
![[ ]](/icons/layout.gif) | fronius-gen24-primo-6kw-g99-cert.pdf | 2021-04-08 11:23 | 821K | |
![[ ]](/icons/layout.gif) | fronius-hybrid-datasheet.pdf | 2017-10-20 13:08 | 1.4M | |
![[ ]](/icons/layout.gif) | fronius-hybrid-manual.pdf | 2018-08-17 11:53 | 3.4M | |
![[ ]](/icons/layout.gif) | fronius-ig-tl-datasheet.pdf | 2017-10-06 16:17 | 331K | |
![[ ]](/icons/layout.gif) | fronius-ohmpilot-datasheet.pdf | 2018-07-24 10:30 | 898K | |
![[ ]](/icons/layout.gif) | fronius-ohmpilot-manual.pdf | 2018-07-24 10:30 | 2.8M | |
![[ ]](/icons/layout.gif) | fronius-performance-solar-battery.pdf | 2017-10-27 13:00 | 72K | |
![[ ]](/icons/layout.gif) | fronius-primo-3.0-1-EN50438.pdf | 2019-05-20 15:27 | 131K | |
![[ ]](/icons/layout.gif) | fronius-primo-3.6-1-EN50438.pdf | 2019-05-20 15:29 | 131K | |
![[ ]](/icons/layout.gif) | fronius-primo-4.0-1-EN50438.pdf | 2019-05-20 15:28 | 131K | |
![[ ]](/icons/layout.gif) | fronius-primo-4.6-1-EN50438.pdf | 2019-05-20 15:29 | 131K | |
![[ ]](/icons/layout.gif) | fronius-primo-6.0-1-EN50438.pdf | 2019-05-20 15:32 | 131K | |
![[ ]](/icons/layout.gif) | fronius-primo-8.2-EN50438.pdf | 2019-05-20 15:31 | 131K | |
![[ ]](/icons/layout.gif) | fronius-primo-datasheet.pdf | 2017-05-19 17:23 | 551K | |
![[ ]](/icons/layout.gif) | fronius-primo-gen24-3kw-g98-cert.pdf | 2021-02-09 16:50 | 1.0M | |
![[ ]](/icons/layout.gif) | fronius-primo-gen24-plus-datasheet.pdf | 2022-06-08 15:36 | 298K | |
![[ ]](/icons/layout.gif) | fronius-primo-gen24-quick-guide.pdf | 2022-06-08 15:36 | 4.8M | |
![[ ]](/icons/layout.gif) | fronius-primo-installation-manual.pdf | 2017-05-19 17:23 | 3.5M | |
![[ ]](/icons/layout.gif) | fronius-primo-operating-manual.pdf | 2017-05-19 17:23 | 4.1M | |
![[ ]](/icons/layout.gif) | fronius-primo-quick-install.pdf | 2017-05-19 17:23 | 1.8M | |
![[ ]](/icons/layout.gif) | fronius-sensor-info.pdf | 2019-07-19 09:58 | 151K | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-ct-clamp-selection.pdf | 2017-05-19 17:23 | 209K | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-datasheet--2-.pdf | 2021-10-18 14:12 | 2.2M | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-datasheet.pdf | 2020-03-16 11:40 | 2.2M | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-flow-chart-and-tech-may-23-page-7.pdf | 2024-01-18 17:15 | 260K | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-installation-manual--1-.pdf | 2021-10-18 14:13 | 565K | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-installation-manual.pdf | 2020-03-16 11:40 | 565K | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-op-man.pdf | 2017-05-19 17:23 | 155K | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-overview-brochure.pdf | 2021-04-30 13:24 | 462K | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-overview.pdf | 2021-07-08 09:59 | 456K | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-ts-datasheet.pdf | 2021-04-30 13:23 | 222K | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-ts100-manual.pdf | 2021-04-30 13:23 | 1.0M | |
![[ ]](/icons/layout.gif) | fronius-smart-meter-ts100-quick-guide.pdf | 2021-04-30 13:26 | 871K | |
![[ ]](/icons/layout.gif) | fronius-smartmeter-presentation.pdf | 2017-05-19 17:23 | 3.6M | |
![[ ]](/icons/layout.gif) | fronius-string-inverter-overview-en-uk-060821.pdf | 2021-08-06 09:27 | 3.6M | |
![[ ]](/icons/layout.gif) | fronius-symo-6.0-3-m-en50438.pdf | 2019-05-22 15:07 | 34K | |
![[ ]](/icons/layout.gif) | fronius-symo-8.2-3-m-en50438.pdf | 2019-05-22 15:07 | 34K | |
![[ ]](/icons/layout.gif) | fronius-symo-10.0-3-m-en50438.pdf | 2019-05-22 15:08 | 32K | |
![[ ]](/icons/layout.gif) | fronius-symo-12.5-3-m-en50438.pdf | 2019-05-22 15:09 | 34K | |
![[ ]](/icons/layout.gif) | fronius-symo-15.0-3-m-en50438.pdf | 2019-05-22 15:09 | 34K | |
![[ ]](/icons/layout.gif) | fronius-symo-datasheet.pdf | 2017-05-19 17:23 | 2.1M | |
![[ ]](/icons/layout.gif) | fronius-symo-eco-operating-manual.pdf | 2017-05-19 17:23 | 5.5M | |
![[ ]](/icons/layout.gif) | fronius-symo-gen24-operating-instructions.pdf | 2020-11-19 11:15 | 15M | |
![[ ]](/icons/layout.gif) | fronius-symo-gen24-plus-datasheet.pdf | 2020-11-19 10:28 | 409K | |
![[ ]](/icons/layout.gif) | fronius-symo-over-10kw-install-manual.pdf | 2017-05-19 17:23 | 6.8M | |
![[ ]](/icons/layout.gif) | fronius-symo-over-10kw-quick-install.pdf | 2017-05-19 17:23 | 6.9M | |
![[ ]](/icons/layout.gif) | fronius-symo-under-10kw-install-manual.pdf | 2017-05-19 17:23 | 4.1M | |
![[ ]](/icons/layout.gif) | fronius-tauro-datasheet.pdf | 2021-11-29 16:37 | 690K | |
![[ ]](/icons/layout.gif) | fronius-tds-ohmpilot-en.pdf | 2024-03-29 09:41 | 893K | |
![[ ]](/icons/layout.gif) | fronius-ul-meter-wiring-diag.pdf | 2021-10-18 14:13 | 199K | |
![[ ]](/icons/layout.gif) | fronius-warranty-010121.pdf | 2021-02-08 16:23 | 221K | |
![[ ]](/icons/layout.gif) | fronius-warranty-infopage.pdf | 2021-02-08 16:21 | 833K | |
![[ ]](/icons/layout.gif) | fronius-warranty-registration-instructions.pdf | 2017-05-19 17:23 | 1.9M | |
![[ ]](/icons/layout.gif) | fronius-warranty.pdf | 2019-02-06 12:28 | 338K | |
![[ ]](/icons/layout.gif) | fs-d-aslate-a-slate-datasheet-issue-2.1.pdf | 2023-11-24 10:08 | 3.5M | |
![[ ]](/icons/layout.gif) | ft-55w-flexible-solar-panel-datasheet-sunpower-solar-cells.pdf | 2018-05-11 11:54 | 201K | |
![[ ]](/icons/layout.gif) | ftc7pi-sheet-2023-v2--2-.pdf | 2024-01-30 09:04 | 303K | |
![[ ]](/icons/layout.gif) | fund-paymentsQ1.pdf | 2021-04-22 14:53 | 179K | |
![[ ]](/icons/layout.gif) | future-forest-co.pdf | 2022-12-07 12:25 | 27K | |
![[ ]](/icons/layout.gif) | g3-model--local-upgrade---import-safety-regulations.pdf | 2022-09-06 16:32 | 157K | |
![[ ]](/icons/layout.gif) | g59-3-4-for-growatt-4200mtl-s-5000mtl-s-5500mtl-s.pdf | 2018-10-19 14:46 | 188K | |
![[ ]](/icons/layout.gif) | g59-3-mi-300.pdf | 2018-11-26 10:15 | 104K | |
![[ ]](/icons/layout.gif) | g59-mi-600.pdf | 2018-11-23 15:44 | 103K | |
![[ ]](/icons/layout.gif) | g59-mi-1200.pdf | 2018-11-26 10:42 | 104K | |
![[ ]](/icons/layout.gif) | g83-2-1-for-growatt-750-s-1000-s-1500-s-2000-s-25.pdf | 2018-10-19 14:35 | 174K | |
![[ ]](/icons/layout.gif) | g83-2-1-for-growatt-2500mtl-s-3000mtl-s--3600mtl-.pdf | 2018-10-19 14:42 | 173K | |
![[ ]](/icons/layout.gif) | g83-2-certificate.pdf | 2017-10-06 16:18 | 74K | |
![[ ]](/icons/layout.gif) | g83-2-growatt-4000-6000ue.pdf | 2017-05-19 17:23 | 193K | |
![[ ]](/icons/layout.gif) | g83-2-mi-300.pdf | 2018-11-26 10:11 | 99K | |
![[ ]](/icons/layout.gif) | g83-2-mi-600.pdf | 2018-11-23 15:43 | 392K | |
![[ ]](/icons/layout.gif) | g83-2-mi-1200.pdf | 2018-11-26 10:42 | 98K | |
![[ ]](/icons/layout.gif) | g98-0-test-report-for-mi-1200.pdf | 2018-12-11 11:35 | 471K | |
![[ ]](/icons/layout.gif) | g98-form-c-for-mod-3000tl3-x-mod-4000tl3-x-mod-5000tl3-x--mod-6000tl3-xmod-7000tl3-x--mod-8000tl3-x--mod-9000tl3-x--mod-10000tl3-x-.pdf | 2022-02-17 09:54 | 599K | |
![[ ]](/icons/layout.gif) | g98-g4-x1-3.0-3.7-d.pdf | 2022-04-12 11:25 | 310K | |
![[ ]](/icons/layout.gif) | g98-mi-300-mi-250--trp-18120704.pdf | 2018-12-11 11:32 | 472K | |
![[ ]](/icons/layout.gif) | g98-mi-600.pdf | 2018-12-11 11:33 | 489K | |
![[ ]](/icons/layout.gif) | g98-mic750tl-x-3300tl-x.pdf | 2023-11-03 10:50 | 463K | |
![[ ]](/icons/layout.gif) | g98-min2500-3600tl-xh.pdf | 2024-07-22 09:29 | 693K | |
![[ ]](/icons/layout.gif) | g98_solis_S5_3ph_03-10k.pdf | 2022-05-26 15:52 | 3.6M | |
![[ ]](/icons/layout.gif) | g99--growa-04138-211129091953.pdf | 2022-03-04 14:36 | 886K | |
![[ ]](/icons/layout.gif) | g99-1--test-report-mi-1200.pdf | 2018-12-11 11:35 | 449K | |
![[ ]](/icons/layout.gif) | g99-for-min7-10k-x2.pdf | 2023-11-06 13:02 | 687K | |
![[ ]](/icons/layout.gif) | g99-form-a2-3-50k.pdf | 2019-10-04 16:40 | 201K | |
![[ ]](/icons/layout.gif) | g99-form-a2-3-for-mod-11-15ktl3-x.pdf | 2022-02-17 09:55 | 799K | |
![[ ]](/icons/layout.gif) | g99-mi-300.pdf | 2018-12-11 11:33 | 446K | |
![[ ]](/icons/layout.gif) | g99-mi-600.pdf | 2018-12-11 11:34 | 0 | |
![[ ]](/icons/layout.gif) | g99-min4200-6000tl-xh.pdf | 2024-07-22 09:29 | 270K | |
![[ ]](/icons/layout.gif) | g99-solis-80k-5g.pdf | 2020-03-02 17:36 | 202K | |
![[ ]](/icons/layout.gif) | g99_solis_s5_3ph_03-10k.pdf | 2022-05-26 15:55 | 7.0M | |
![[ ]](/icons/layout.gif) | g100-declaration-x1-fit.pdf | 2018-10-05 17:10 | 582K | |
![[ ]](/icons/layout.gif) | g100-huawei-declaration-nov-2019.pdf | 2022-05-16 16:50 | 198K | |
![[ ]](/icons/layout.gif) | g100-manufacturers-product-declaration--2-.pdf | 2023-03-28 12:33 | 209K | |
![[ ]](/icons/layout.gif) | g100_solis_3ph_s5_3-20k.pdf | 2022-05-27 10:19 | 2.6M | |
![[ ]](/icons/layout.gif) | ga-letu-016-le450-user-manual-e.pdf | 2016-09-12 11:31 | 2.7M | |
![[ ]](/icons/layout.gif) | garo-dc-32.pdf | 2022-06-27 09:48 | 1.9M | |
![[ ]](/icons/layout.gif) | gbli-6532-quick-guide-202007.pdf | 2023-07-14 14:03 | 2.7M | |
![[ ]](/icons/layout.gif) | gbli6532-datasheet-en-202305.pdf | 2023-07-14 14:03 | 6.4M | |
![[ ]](/icons/layout.gif) | gbli6532-datasheet.pdf | 2023-01-31 13:02 | 6.4M | |
![[ ]](/icons/unknown.gif) | gcl430-450bifacialblackNT10R | 2024-03-06 10:44 | 726K | |
![[ ]](/icons/layout.gif) | gclwarrranty.pdf | 2024-03-19 10:40 | 79K | |
![[ ]](/icons/layout.gif) | gem-120-ct-meter.pdf | 2023-01-30 10:22 | 312K | |
![[ ]](/icons/layout.gif) | gen-1-battery-installation-manual-june-2023.pdf | 2023-10-16 17:17 | 2.1M | |
![[ ]](/icons/layout.gif) | gen-1-hybrid-inverter-manual.pdf | 2023-10-16 16:06 | 3.1M | |
![[ ]](/icons/layout.gif) | gen-1-to-gen-2-cable-datasheet.pdf | 2023-10-16 17:20 | 152K | |
![[ ]](/icons/layout.gif) | gen-2-to-gen-2-cable-datasheet.pdf | 2023-10-16 17:21 | 158K | |
![[ ]](/icons/layout.gif) | gen-3-3-phase-hybrid-inverter-stackable-battery-uk.pdf | 2023-11-21 12:36 | 1.3M | |
![[ ]](/icons/layout.gif) | gen-3-hybrid-inverter-installation-manual--1-.pdf | 2023-06-29 14:53 | 2.9M | |
![[ ]](/icons/layout.gif) | gen-3-hybrid-inverter-installation-manual.pdf | 2023-10-16 15:25 | 3.0M | |
![[ ]](/icons/layout.gif) | gen4-en50549-ie--1-.pdf | 2022-06-30 10:51 | 309K | |
![[ ]](/icons/layout.gif) | gen4-en50549-ie.pdf | 2022-02-25 15:43 | 309K | |
![[ ]](/icons/layout.gif) | general-gcl-leaflet.pdf | 2024-03-22 12:03 | 5.7M | |
![[ ]](/icons/layout.gif) | geo-solo-2-guide.pdf | 2016-09-12 11:31 | 2.1M | |
![[ ]](/icons/layout.gif) | geo-solo-3-datasheet.pdf | 2017-05-19 17:23 | 1.9M | |
![[ ]](/icons/layout.gif) | geo-solo-3-guide.pdf | 2017-05-19 17:23 | 1.4M | |
![[ ]](/icons/layout.gif) | geo-solo-3-quick-guide.pdf | 2017-05-19 17:23 | 2.2M | |
![[ ]](/icons/layout.gif) | geo_solopv_user-manual.pdf | 2016-09-12 11:31 | 2.0M | |
![[ ]](/icons/layout.gif) | getting-started-with-monta-en.pdf | 2024-04-02 16:53 | 11M | |
![[ ]](/icons/layout.gif) | giv-3.6-5-en-50438-ie.pdf | 2019-08-02 11:04 | 414K | |
![[ ]](/icons/layout.gif) | giv-5-2-batt-datasheet.pdf | 2020-04-20 15:56 | 2.4M | |
![[ ]](/icons/layout.gif) | giv-5-2kwh-batt-manual.pdf | 2020-04-20 15:55 | 732K | |
![[ ]](/icons/layout.gif) | giv-7kw-ev-charger.pdf | 2022-05-20 10:03 | 1.2M | |
![[ ]](/icons/layout.gif) | giv-80a-dc-breaker-datasheet.pdf | 2020-05-20 16:09 | 487K | |
![[ ]](/icons/layout.gif) | giv-80a-dc-breaker-manual.pdf | 2020-05-20 16:08 | 582K | |
![[ ]](/icons/layout.gif) | giv-2024-warranty-card.pdf | 2024-03-13 12:23 | 322K | |
![[ ]](/icons/layout.gif) | giv-ac-datasheet.pdf | 2019-07-30 12:55 | 180K | |
![[ ]](/icons/layout.gif) | giv-ac-manual.pdf | 2019-07-30 12:51 | 2.7M | |
![[ ]](/icons/layout.gif) | giv-ac-service-card.pdf | 2019-07-30 12:52 | 122K | |
![[ ]](/icons/layout.gif) | giv-all-in-one.pdf | 2023-05-30 09:19 | 662K | |
![[ ]](/icons/layout.gif) | giv-bat-2-6.pdf | 2023-03-24 11:45 | 145K | |
![[ ]](/icons/layout.gif) | giv-bat-5-2.pdf | 2023-03-24 12:37 | 151K | |
![[ ]](/icons/layout.gif) | giv-bat-5.12-datasheet.pdf | 2024-07-25 17:24 | 163K | |
![[ ]](/icons/layout.gif) | giv-bat-8-2.pdf | 2023-03-24 12:43 | 147K | |
![[ ]](/icons/layout.gif) | giv-bat-9-5-datasheet-v1.pdf | 2022-02-24 17:36 | 453K | |
![[ ]](/icons/layout.gif) | giv-bat-9-5.pdf | 2023-03-24 12:54 | 151K | |
![[ ]](/icons/layout.gif) | giv-batt-50kw-datasheet.pdf | 2019-12-13 15:43 | 5.4M | |
![[ ]](/icons/layout.gif) | giv-battery-datasheet.pdf | 2019-09-23 16:28 | 120K | |
![[ ]](/icons/layout.gif) | giv-battery-eco-datasheet.pdf | 2019-07-30 14:13 | 103K | |
![[ ]](/icons/layout.gif) | giv-battery-msds.pdf | 2019-07-30 14:12 | 4.4M | |
![[ ]](/icons/layout.gif) | giv-battery-warranty-2018.pdf | 2019-07-30 14:12 | 818K | |
![[ ]](/icons/layout.gif) | giv-battery-warranty-2022-v3.pdf | 2022-11-28 11:37 | 145K | |
![[ ]](/icons/layout.gif) | giv-brochure-2019.pdf | 2019-07-30 12:52 | 3.8M | |
![[ ]](/icons/layout.gif) | giv-com-brochure-compressed.pdf | 2023-03-20 12:54 | 765K | |
![[ ]](/icons/layout.gif) | giv-com-pcs.pdf | 2023-03-20 12:49 | 2.2M | |
![[ ]](/icons/layout.gif) | giv-ct-manual.pdf | 2019-07-31 11:53 | 519K | |
![[ ]](/icons/layout.gif) | giv-datasheet-3-phase-hybrid-inverter-20kw.pdf | 2024-07-03 10:25 | 3.9M | |
![[ ]](/icons/layout.gif) | giv-em418-user-manual.pdf | 2019-07-31 11:54 | 1.3M | |
![[ ]](/icons/layout.gif) | giv-eps-configuration-v2.pdf | 2022-11-29 16:24 | 381K | |
![[ ]](/icons/layout.gif) | giv-g99.pdf | 2020-08-27 10:20 | 403K | |
![[ ]](/icons/layout.gif) | giv-g100-declaration.pdf | 2020-07-01 16:12 | 1.1M | |
![[ ]](/icons/layout.gif) | giv-gen2-cable-change-instructions.pdf | 2022-09-21 09:45 | 101K | |
![[ ]](/icons/layout.gif) | giv-hy-3-6-gen-2.pdf | 2023-02-08 12:44 | 770K | |
![[ ]](/icons/layout.gif) | giv-hy-5-0-gen-2.pdf | 2023-02-23 13:51 | 769K | |
![[ ]](/icons/layout.gif) | giv-hy-5-0-gen-3.pdf | 2023-09-14 10:09 | 161K | |
![[ ]](/icons/layout.gif) | giv-hybrid-datasheet.pdf | 2019-07-30 13:11 | 195K | |
![[ ]](/icons/layout.gif) | giv-hybrid-g98.pdf | 2019-07-30 13:09 | 425K | |
![[ ]](/icons/layout.gif) | giv-hybrid-manual.pdf | 2019-07-31 11:25 | 3.6M | |
![[ ]](/icons/layout.gif) | giv-inverter-warranty-april-2018.pdf | 2019-07-30 12:52 | 824K | |
![[ ]](/icons/layout.gif) | giv-key-features.pdf | 2019-07-30 12:51 | 729K | |
![[ ]](/icons/layout.gif) | giv-lora-2022-manual.pdf | 2022-05-04 17:04 | 2.4M | |
![[ ]](/icons/layout.gif) | giv-vo-datasheet.pdf | 2020-06-04 16:33 | 133K | |
![[ ]](/icons/layout.gif) | giv-wifi-manual.pdf | 2019-07-31 11:47 | 3.8M | |
![[ ]](/icons/layout.gif) | givenergy-3kw-ac-coupled-g98.pdf | 2020-02-06 15:41 | 552K | |
![[ ]](/icons/layout.gif) | givenergy-full-schematics.pdf | 2019-11-06 14:42 | 261K | |
![[ ]](/icons/layout.gif) | givenergy-gen2-hybrid-datasheet.pdf | 2022-03-16 13:14 | 1.3M | |
![[ ]](/icons/layout.gif) | givenergy-hybrid-inverter-warranty-2022.pdf | 2023-08-15 11:32 | 1.1M | |
![[ ]](/icons/layout.gif) | givenergy-installation-manual--9-.pdf | 2023-09-05 15:41 | 1.1M | |
![[ ]](/icons/layout.gif) | givenergy-installation-note.pdf | 2019-08-13 14:56 | 627K | |
![[ ]](/icons/layout.gif) | givenergy-product-warranty---13.02.2024.pdf | 2024-02-22 15:51 | 169K | |
![[ ]](/icons/layout.gif) | givenergy-residential-battery-warranty-2020v1.pdf | 2020-04-14 13:56 | 780K | |
![[ ]](/icons/layout.gif) | givenergy-solar-battery-installation-manual.pdf | 2022-11-25 09:44 | 2.3M | |
![[ ]](/icons/layout.gif) | gledhill-stainlesslite-installer-brochure-march2019-v19.2-web.pdf | 2022-12-21 12:43 | 5.1M | |
![[ ]](/icons/unknown.gif) | global-brochure-solplanet-en-0723 | 2023-09-14 10:58 | 7.8M | |
![[ ]](/icons/layout.gif) | grad-developer-pack.pdf | 2021-06-29 17:11 | 5.3M | |
![[ ]](/icons/layout.gif) | graduate-developer-pack-2022.pdf | 2022-04-19 11:34 | 2.2M | |
![[ ]](/icons/layout.gif) | graduate-scheme---application-pack-2024.pdf | 2024-01-24 13:58 | 2.7M | |
![[ ]](/icons/layout.gif) | grasol-al-groundmount-4kw.pdf | 2017-05-19 17:23 | 300K | |
![[ ]](/icons/layout.gif) | grasol-groundmount-brochure.pdf | 2018-04-17 16:20 | 4.0M | |
![[ ]](/icons/layout.gif) | grasol-salt-mist-test.pdf | 2017-05-19 17:23 | 1.5M | |
![[ ]](/icons/layout.gif) | grasol-solar-mounting-warranty.pdf | 2017-05-19 17:23 | 144K | |
![[ ]](/icons/layout.gif) | grasol-standing-seam-manual.pdf | 2017-10-18 16:13 | 1.5M | |
![[ ]](/icons/layout.gif) | grasol-triangle-mount-guide.pdf | 2017-05-19 17:23 | 699K | |
![[ ]](/icons/layout.gif) | gro-infinity-1500-manual.pdf | 2024-07-02 11:31 | 1.7M | |
![[ ]](/icons/layout.gif) | ground-mount-single-drawing.pdf | 2021-03-03 18:31 | 15K | |
![[ ]](/icons/layout.gif) | ground-screw-document.pdf | 2024-02-15 17:30 | 86K | |
![[ ]](/icons/layout.gif) | groundmount-al-50kw-design.pdf | 2017-05-19 17:23 | 312K | |
![[ ]](/icons/layout.gif) | groundmount-datasheet.pdf | 2019-04-18 11:29 | 499K | |
![[ ]](/icons/layout.gif) | groundmount-single-row-datasheet.pdf | 2020-04-06 16:30 | 80K | |
![[ ]](/icons/layout.gif) | growa-05462-220817110225.pdf | 2023-11-14 11:45 | 641K | |
![[ ]](/icons/layout.gif) | growa-05464-220817115753.pdf | 2022-08-22 14:51 | 586K | |
![[ ]](/icons/layout.gif) | growa-g99.pdf | 2023-11-14 11:48 | 586K | |
![[ ]](/icons/layout.gif) | growa-mid-15000-25000tl3-x-for-g99.pdf | 2022-02-08 15:09 | 809K | |
![[ ]](/icons/layout.gif) | growat-750-3000-s-mic.pdf | 2023-11-09 16:13 | 480K | |
![[ ]](/icons/layout.gif) | growat-asb-automatic-switch-box.pdf | 2024-01-18 13:47 | 313K | |
![[ ]](/icons/layout.gif) | growat-en50438-1-3kw.pdf | 2017-05-19 17:23 | 419K | |
![[ ]](/icons/layout.gif) | growat-gbli6532-6-5kwh-battery-ce-cert.pdf | 2020-11-12 13:31 | 168K | |
![[ ]](/icons/layout.gif) | growat-gbli6532-6-5kwh-battery-datasheet.pdf | 2020-11-12 13:28 | 840K | |
![[ ]](/icons/layout.gif) | growat-gbli6532-6-5kwh-battery-manual.pdf | 2020-11-12 13:29 | 1.4M | |
![[ ]](/icons/layout.gif) | growatt--3-11ktl3-s-selfdeclaration-g100.pdf | 2020-02-27 16:45 | 290K | |
![[ ]](/icons/layout.gif) | growatt--10-25ktl3-x-selfdeclaration-for-g100.pdf | 2022-02-08 15:09 | 298K | |
![[ ]](/icons/layout.gif) | growatt--12-15ktl3-s-selfdeclaration-g100.pdf | 2020-02-27 16:51 | 290K | |
![[ ]](/icons/layout.gif) | growatt--17-50ktl3-s-selfdeclaration-g100.pdf | 2020-02-27 16:55 | 275K | |
![[ ]](/icons/layout.gif) | growatt--50-100ktl3-s-selfdeclaration-g100.pdf | 2020-02-27 17:02 | 295K | |
![[ ]](/icons/layout.gif) | growatt--master-box-user-manual.pdf | 2017-12-06 11:24 | 456K | |
![[ ]](/icons/layout.gif) | growatt--spa1-3k-selfdeclaration-for-g100.pdf | 2021-04-07 14:50 | 273K | |
![[ ]](/icons/layout.gif) | growatt-2-5-mtl-s-datasheet.pdf | 2020-01-06 14:29 | 661K | |
![[ ]](/icons/layout.gif) | growatt-2.5-6kmtl-s-selfdeclaration-g100.pdf | 2020-02-27 16:03 | 240K | |
![[ ]](/icons/layout.gif) | growatt-3.3-kwh-battery-quick-guide-.pdf | 2020-11-18 08:46 | 1.2M | |
![[ ]](/icons/layout.gif) | growatt-3.3-kwh-user-manual.pdf | 2024-01-15 16:32 | 6.1M | |
![[ ]](/icons/layout.gif) | growatt-3.3kwh-ml33rta-battery-datasheet---11-09-2020.pdf | 2023-07-06 12:36 | 658K | |
![[ ]](/icons/layout.gif) | growatt-3ph-50-100-kw-max-user-manual.pdf | 2020-08-05 13:51 | 6.6M | |
![[ ]](/icons/layout.gif) | growatt-3ph-hybrid-ce-certif.pdf | 2020-01-30 11:15 | 338K | |
![[ ]](/icons/layout.gif) | growatt-3ph-hybrid-datasheet.pdf | 2020-01-30 11:12 | 649K | |
![[ ]](/icons/layout.gif) | growatt-3ph-hybrid-installation-manual.pdf | 2020-01-30 11:12 | 6.5M | |
![[ ]](/icons/layout.gif) | growatt-4-6kue.pdf | 2017-05-19 17:23 | 332K | |
![[ ]](/icons/layout.gif) | growatt-4-6ue-datasheet.pdf | 2017-05-19 17:23 | 915K | |
![[ ]](/icons/layout.gif) | growatt-7-9ue-datasheet.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/layout.gif) | growatt-7-10k-g83-2.pdf | 2017-05-19 17:23 | 3.6M | |
![[ ]](/icons/layout.gif) | growatt-7-20k-ue-g59-3.pdf | 2017-05-19 17:23 | 454K | |
![[ ]](/icons/layout.gif) | growatt-10-20kue-troubleshooting-.pdf | 2017-05-19 17:23 | 1.4M | |
![[ ]](/icons/layout.gif) | growatt-15-25ktl3-x-datasheet.pdf | 2020-03-05 12:11 | 1.7M | |
![[ ]](/icons/layout.gif) | growatt-15-25ktl3-x-g99.pdf.pdf | 2020-03-05 12:27 | 761K | |
![[ ]](/icons/layout.gif) | growatt-15-25ktl3-x-manual.pdf | 2020-03-05 12:25 | 5.0M | |
![[ ]](/icons/layout.gif) | growatt-17-50kw-g99.pdf | 2019-04-03 09:59 | 427K | |
![[ ]](/icons/layout.gif) | growatt-25-40kw-tl3-x-datasheet.pdf | 2021-01-12 11:33 | 1.5M | |
![[ ]](/icons/layout.gif) | growatt-25-40kw-tl3-x-manual.pdf | 2021-01-12 11:36 | 3.5M | |
![[ ]](/icons/layout.gif) | growatt-30k-33k-40k-tl3-manual.pdf | 2020-04-14 14:05 | 4.8M | |
![[ ]](/icons/layout.gif) | growatt-30k-40k-datasheet.pdf | 2017-05-19 17:23 | 252K | |
![[ ]](/icons/layout.gif) | growatt-30k-inverter.pdf | 2019-03-20 14:59 | 3.0M | |
![[ ]](/icons/layout.gif) | growatt-40k-tl3-g59-3.pdf | 2017-05-19 17:23 | 201K | |
![[ ]](/icons/layout.gif) | growatt-750-2000-x-range-datasheet-20200928.pdf | 2020-11-16 15:48 | 480K | |
![[ ]](/icons/layout.gif) | growatt-750-3000-s-datasheet.pdf | 2020-06-12 11:14 | 619K | |
![[ ]](/icons/layout.gif) | growatt-750-3000s-datasheet.pdf | 2019-03-21 09:23 | 698K | |
![[ ]](/icons/layout.gif) | growatt-750-3000s-manual.pdf | 2019-03-21 09:23 | 4.0M | |
![[ ]](/icons/layout.gif) | growatt-750-3000tl-x-datasheet.pdf | 2020-10-26 11:48 | 480K | |
![[ ]](/icons/layout.gif) | growatt-750-3000tl-x-manual.pdf | 2023-11-03 10:50 | 7.6M | |
![[ ]](/icons/layout.gif) | growatt-750-3000tl-x-quick-guide.pdf | 2020-10-26 11:49 | 2.1M | |
![[ ]](/icons/layout.gif) | growatt-1000-3000-s-datasheet-sep2017.pdf | 2017-09-21 10:36 | 221K | |
![[ ]](/icons/layout.gif) | growatt-1000-3000-s-datasheet-v2.pdf | 2017-09-21 10:16 | 0 | |
![[ ]](/icons/layout.gif) | growatt-1000-3000-s-g83-2-2017.pdf | 2017-09-26 14:49 | 551K | |
![[ ]](/icons/layout.gif) | growatt-1000s-3000s-datasheet.pdf | 2017-05-19 17:23 | 225K | |
![[ ]](/icons/layout.gif) | growatt-2500-3000-3600-5000-manual.pdf | 2017-05-19 17:23 | 1.7M | |
![[ ]](/icons/layout.gif) | growatt-2500-3600mtl-s-g83-2-2017.pdf | 2017-09-26 14:50 | 328K | |
![[ ]](/icons/layout.gif) | growatt-2500-6000tl-xe-datasheet.pdf | 2020-10-26 10:46 | 874K | |
![[ ]](/icons/layout.gif) | growatt-2500-6000tl-xe-export-limitation.pdf | 2020-10-26 10:56 | 713K | |
![[ ]](/icons/layout.gif) | growatt-2500-6000tl-xe-quick-guide.pdf | 2020-10-26 10:55 | 1.8M | |
![[ ]](/icons/layout.gif) | growatt-2500tl-xe-g98-cert.pdf | 2020-10-26 10:58 | 445K | |
![[ ]](/icons/layout.gif) | growatt-3000-10000tl3-s--g83-2-1---.pdf | 2019-03-20 15:09 | 185K | |
![[ ]](/icons/layout.gif) | growatt-3600-5500mtl-s-g59-3.pdf | 2018-01-29 12:50 | 432K | |
![[ ]](/icons/layout.gif) | growatt-3600-6000mtl-datasheet.pdf | 2017-05-19 17:23 | 1.0M | |
![[ ]](/icons/layout.gif) | growatt-4000-5000-6000-manual.pdf | 2017-05-19 17:23 | 3.4M | |
![[ ]](/icons/layout.gif) | growatt-4000-6000ue-g59-3.pdf | 2017-05-19 17:23 | 219K | |
![[ ]](/icons/layout.gif) | growatt-4200-6000tl-xe-g99-cert.pdf | 2020-10-26 11:10 | 474K | |
![[ ]](/icons/layout.gif) | growatt-5000-g83-2.pdf | 2017-05-19 17:23 | 226K | |
![[ ]](/icons/layout.gif) | growatt-6000mtl-g59.pdf | 2017-05-19 17:23 | 278K | |
![[ ]](/icons/layout.gif) | growatt-7000mtl-s.pdf | 2020-01-21 15:53 | 2.3M | |
![[ ]](/icons/layout.gif) | growatt-20000-photon-review2.pdf | 2017-05-19 17:23 | 765K | |
![[ ]](/icons/layout.gif) | growatt-25000-6000tl-xe-datasheet-uk-20200928.pdf | 2020-11-16 15:51 | 494K | |
![[ ]](/icons/layout.gif) | growatt-30000-33000-tl3-g59-3.pdf | 2017-05-19 17:23 | 209K | |
![[ ]](/icons/layout.gif) | growatt-ac-v-outrange-troubleshooting.pdf | 2017-05-19 17:23 | 308K | |
![[ ]](/icons/layout.gif) | growatt-apx-14.3p-71-114kwh-hv-battery-datasheet---15-09-2023--1-.pdf | 2024-07-24 10:26 | 3.6M | |
![[ ]](/icons/layout.gif) | growatt-ark-lv-ce-cert.pdf | 2021-02-09 15:51 | 1.0M | |
![[ ]](/icons/layout.gif) | growatt-ark-lv-datasheet.pdf | 2021-02-09 15:36 | 2.6M | |
![[ ]](/icons/layout.gif) | growatt-ark-lv-quick-guide.pdf | 2021-02-09 15:36 | 2.7M | |
![[ ]](/icons/layout.gif) | growatt-ark-lv-un38-cert.pdf | 2021-02-09 15:50 | 481K | |
![[ ]](/icons/layout.gif) | growatt-ark-xh-a1-emc.pdf | 2024-01-18 12:04 | 274K | |
![[ ]](/icons/layout.gif) | growatt-ark-xh-a1-user-manual-en-202201.pdf | 2024-01-18 12:04 | 4.8M | |
![[ ]](/icons/layout.gif) | growatt-ark-xh-datasheet.pdf | 2024-01-18 12:02 | 3.4M | |
![[ ]](/icons/layout.gif) | growatt-battery-warranty-atl202007.pdf | 2020-12-16 09:37 | 369K | |
![[ ]](/icons/layout.gif) | growatt-battery.pdf | 2018-05-17 17:15 | 274K | |
![[ ]](/icons/layout.gif) | growatt-car-ev-charging-system.pdf | 2017-05-19 17:23 | 333K | |
![[ ]](/icons/layout.gif) | growatt-country-dips.pdf | 2019-09-04 08:57 | 565K | |
![[ ]](/icons/layout.gif) | growatt-energy-management-solution.pdf | 2022-09-14 10:32 | 3.7M | |
![[ ]](/icons/layout.gif) | growatt-export-limitation-guide.pdf | 2019-02-06 10:18 | 760K | |
![[ ]](/icons/layout.gif) | growatt-g59-3.pdf | 2017-05-19 17:23 | 129K | |
![[ ]](/icons/layout.gif) | growatt-g59-3ph.pdf | 2019-03-27 09:01 | 454K | |
![[ ]](/icons/layout.gif) | growatt-g59-4400-5000tl.pdf | 2017-05-19 17:23 | 86K | |
![[ ]](/icons/layout.gif) | growatt-g59-sph6000.pdf | 2018-04-17 16:14 | 610K | |
![[ ]](/icons/layout.gif) | growatt-g83-2-certificate-2500mtl-3000mtl.pdf | 2017-05-19 17:23 | 212K | |
![[ ]](/icons/layout.gif) | growatt-g83-2-certificate-3600mtl.pdf | 2017-05-19 17:23 | 227K | |
![[ ]](/icons/layout.gif) | growatt-g83-sph3600.pdf | 2018-04-17 11:55 | 590K | |
![[ ]](/icons/layout.gif) | growatt-g100.pdf | 2018-12-14 11:27 | 351K | |
![[ ]](/icons/layout.gif) | growatt-gbli-6531-user-manual-v1-1.pdf | 2020-11-18 08:50 | 1.0M | |
![[ ]](/icons/layout.gif) | growatt-groboost-ce-emc.pdf | 2024-01-18 13:56 | 870K | |
![[ ]](/icons/layout.gif) | growatt-groboost-user-manual-202212.pdf | 2024-01-18 13:57 | 2.2M | |
![[ ]](/icons/layout.gif) | growatt-hybrid-manual.pdf | 2018-01-23 12:03 | 2.3M | |
![[ ]](/icons/layout.gif) | growatt-inverter-warranty-10-years.pdf | 2022-03-15 15:29 | 262K | |
![[ ]](/icons/layout.gif) | growatt-master-box-datasheet.pdf | 2017-12-06 11:24 | 882K | |
![[ ]](/icons/layout.gif) | growatt-meboost-datasheet.pdf | 2017-10-10 11:28 | 437K | |
![[ ]](/icons/layout.gif) | growatt-meboost-manual.pdf | 2017-10-10 16:56 | 1.8M | |
![[ ]](/icons/layout.gif) | growatt-min-2500-6000-tl-x-quick-guide---24-11-2020.pdf | 2023-01-19 12:13 | 3.0M | |
![[ ]](/icons/layout.gif) | growatt-min-2500-6000-tl-xe-datasheet.pdf | 2021-11-25 16:36 | 6.3M | |
![[ ]](/icons/layout.gif) | growatt-min-2500-6000-tl-xh-quick-guide.pdf | 2024-07-22 09:30 | 3.2M | |
![[ ]](/icons/layout.gif) | growatt-min-2500-6000tl-xe-user-manual.pdf | 2024-07-22 09:30 | 3.2M | |
![[ ]](/icons/layout.gif) | growatt-mini-g98.pdf | 2019-04-03 09:46 | 163K | |
![[ ]](/icons/layout.gif) | growatt-ml33rta-battery-datasheet.pdf | 2020-11-12 14:00 | 658K | |
![[ ]](/icons/layout.gif) | growatt-mtl-s-datasheet.pdf | 2019-10-22 13:02 | 661K | |
![[ ]](/icons/layout.gif) | growatt-mtl-s-manual.pdf | 2017-08-16 14:16 | 3.4M | |
![[ ]](/icons/layout.gif) | growatt-pcs5-datasheet.pdf | 2017-05-19 17:23 | 902K | |
![[ ]](/icons/layout.gif) | growatt-shine-lan-datasheet.pdf | 2017-05-19 17:23 | 201K | |
![[ ]](/icons/layout.gif) | growatt-shine-lan.pdf | 2017-05-19 17:23 | 333K | |
![[ ]](/icons/layout.gif) | growatt-shinebus-manual.pdf | 2018-02-06 14:02 | 832K | |
![[ ]](/icons/layout.gif) | growatt-shinelan-x-datasheet.pdf | 2020-11-23 14:03 | 473K | |
![[ ]](/icons/layout.gif) | growatt-shinelan-x-manual.pdf | 2020-11-23 14:05 | 581K | |
![[ ]](/icons/layout.gif) | growatt-shinelink-datasheet.pdf | 2017-06-09 16:44 | 95K | |
![[ ]](/icons/layout.gif) | growatt-shinelink-quick-manual.pdf | 2017-06-09 16:45 | 637K | |
![[ ]](/icons/layout.gif) | growatt-shinelink-quickstart-guide.pdf | 2021-02-05 11:33 | 2.4M | |
![[ ]](/icons/layout.gif) | growatt-shinelink-x-datasheet.pdf | 2020-11-12 10:21 | 566K | |
![[ ]](/icons/layout.gif) | growatt-shinelink-x-quick-install.pdf | 2020-11-12 10:23 | 1.8M | |
![[ ]](/icons/layout.gif) | growatt-single-phase-troubleshooting.pdf | 2017-05-19 17:23 | 4.6M | |
![[ ]](/icons/layout.gif) | growatt-smart-meter-datasheet.pdf | 2019-02-06 10:18 | 1.5M | |
![[ ]](/icons/layout.gif) | growatt-smart-meter-tpm-manual.pdf | 2019-02-06 10:24 | 1.8M | |
![[ ]](/icons/layout.gif) | growatt-sp-warranty-claim-form.pdf | 2017-05-19 17:23 | 160K | |
![[ ]](/icons/layout.gif) | growatt-sp1000-2000-3000.pdf | 2017-05-19 17:23 | 1.1M | |
![[ ]](/icons/layout.gif) | growatt-sp1000-2000-battery.pdf | 2017-05-19 17:23 | 516K | |
![[ ]](/icons/layout.gif) | growatt-sp1000-sp2000-sp3000-warranty-5-years.pdf | 2017-05-19 17:23 | 44K | |
![[ ]](/icons/layout.gif) | growatt-sp2000-battery-warranty.pdf | 2017-05-19 17:23 | 283K | |
![[ ]](/icons/layout.gif) | growatt-sp2000-certificate.pdf | 2017-05-19 17:23 | 481K | |
![[ ]](/icons/layout.gif) | growatt-sp2000-datasheet.pdf | 2017-05-19 17:23 | 3.1M | |
![[ ]](/icons/layout.gif) | growatt-sp2000-info.pdf | 2017-05-19 17:23 | 1.8M | |
![[ ]](/icons/layout.gif) | growatt-sp2000-installation-manual.pdf | 2017-05-19 17:23 | 3.0M | |
![[ ]](/icons/layout.gif) | growatt-sp3000-manual.pdf | 2017-06-22 13:43 | 3.2M | |
![[ ]](/icons/layout.gif) | growatt-spa-1ph-g98-cert.pdf | 2020-11-12 10:43 | 461K | |
![[ ]](/icons/layout.gif) | growatt-spa-1ph-quick-install-guide.pdf | 2020-11-12 10:45 | 3.3M | |
![[ ]](/icons/layout.gif) | growatt-spa1000-3000tl-bl-user-manual-120421.pdf | 2021-04-12 14:45 | 6.8M | |
![[ ]](/icons/layout.gif) | growatt-sph-3000-3600w-g98-cert.pdf | 2020-11-12 09:22 | 466K | |
![[ ]](/icons/layout.gif) | growatt-sph-4000-6000w-g99-cert.pdf | 2020-11-11 16:26 | 491K | |
![[ ]](/icons/layout.gif) | growatt-sph-datasheet-1.pdf | 2020-11-12 09:19 | 497K | |
![[ ]](/icons/layout.gif) | growatt-sph-datasheet.pdf | 2020-11-11 16:25 | 590K | |
![[ ]](/icons/layout.gif) | growatt-sph-hybrid-manual.pdf | 2018-01-23 12:10 | 3.7M | |
![[ ]](/icons/layout.gif) | growatt-sph-quick-install-guide.pdf | 2020-11-11 16:27 | 2.6M | |
![[ ]](/icons/layout.gif) | growatt-sph3000-6000-datasheet---13-10-2021.pdf | 2023-07-11 09:58 | 2.8M | |
![[ ]](/icons/layout.gif) | growatt-sph3000-6000-datasheet.pdf | 2023-07-17 10:26 | 1.2M | |
![[ ]](/icons/layout.gif) | growatt-sph3000-6000-hybrid-datasheet.pdf | 2017-10-06 11:56 | 1.3M | |
![[ ]](/icons/layout.gif) | growatt-sph3000-6000-user-manual-120421.pdf | 2021-04-12 14:48 | 7.6M | |
![[ ]](/icons/layout.gif) | growatt-spm-meter-manual.pdf | 2019-02-06 10:18 | 1.1M | |
![[ ]](/icons/layout.gif) | growatt-storage-configuration-check-list---05-02-2024--1-.pdf | 2024-05-22 16:14 | 743K | |
![[ ]](/icons/layout.gif) | growatt-technical-support--2023--1-.pdf | 2024-07-22 09:31 | 85K | |
![[ ]](/icons/layout.gif) | growatt-technical-support--2023.pdf | 2024-03-13 09:13 | 85K | |
![[ ]](/icons/layout.gif) | growatt-tl3-3-6-datasheet.pdf | 2019-03-06 13:53 | 409K | |
![[ ]](/icons/layout.gif) | growatt-tl3-3-6-manual.pdf | 2019-03-06 13:54 | 4.8M | |
![[ ]](/icons/layout.gif) | growatt-tl3-7-11-datasheet.pdf | 2019-02-01 11:17 | 324K | |
![[ ]](/icons/layout.gif) | growatt-tl3-7-15kw-manual.pdf | 2019-01-14 12:45 | 2.8M | |
![[ ]](/icons/layout.gif) | growatt-tl3-12-15kw-datasheet.pdf | 2019-01-14 12:43 | 4.1M | |
![[ ]](/icons/layout.gif) | growatt-tl3-17-25-datasheet.pdf | 2019-03-06 14:04 | 452K | |
![[ ]](/icons/layout.gif) | growatt-tl3s-12-15kw-datasheet.pdf | 2019-01-14 12:51 | 402K | |
![[ ]](/icons/layout.gif) | growatt-ue-g98-form.pdf | 2019-08-15 10:54 | 237K | |
![[ ]](/icons/layout.gif) | growatt-ue-g99-form.pdf | 2019-08-15 10:45 | 427K | |
![[ ]](/icons/layout.gif) | growatt-uk-contact-information.pdf | 2023-11-16 08:44 | 94K | |
![[ ]](/icons/layout.gif) | growatt-uk-contact-information.pdf.pdf | 2023-11-16 08:43 | 94K | |
![[ ]](/icons/layout.gif) | growatt-vo60-datasheet.pdf | 2017-06-05 15:09 | 633K | |
![[ ]](/icons/layout.gif) | growatt-vo60-manual.pdf | 2017-06-05 15:10 | 1.8M | |
![[ ]](/icons/layout.gif) | growatt-voltage-optimiser-warranty.pdf | 2017-08-21 17:00 | 259K | |
![[ ]](/icons/unknown.gif) | growatt-warranty | 2024-04-29 12:41 | 1.6M | |
![[ ]](/icons/layout.gif) | growatt-warranty-10-years-midsummer.pdf | 2017-08-03 17:14 | 457K | |
![[ ]](/icons/layout.gif) | growatt-warranty-claim-procedure-2023---1-.pdf | 2023-11-14 11:48 | 200K | |
![[ ]](/icons/layout.gif) | growatt-warranty-claim-procedure-2023-.pdf | 2023-11-03 10:51 | 200K | |
![[ ]](/icons/layout.gif) | growatt-warranty-procedures-for-the-uk-market-03.2024.pdf | 2024-03-27 09:44 | 1.6M | |
![[ ]](/icons/layout.gif) | growatt-webbox-datasheet.pdf | 2017-05-19 17:23 | 153K | |
![[ ]](/icons/layout.gif) | growatt-webbox-manual.pdf | 2017-05-19 17:23 | 3.7M | |
![[ ]](/icons/layout.gif) | growatt-wifi-manual-iphone.pdf | 2017-05-19 17:23 | 835K | |
![[ ]](/icons/layout.gif) | growatt-wifi-manual-new.pdf | 2017-05-19 17:23 | 1.6M | |
![[ ]](/icons/layout.gif) | growatt-wireless-ct-clamp.pdf | 2017-05-19 17:23 | 1.3M | |
![[ ]](/icons/layout.gif) | growatt5000mtl(a13.1-g59-3-type-test-sheet).pdf | 2017-05-19 17:23 | 129K | |
![[ ]](/icons/layout.gif) | growattmin2500-6000usermanual.pdf | 2024-01-18 10:23 | 5.0M | |
![[ ]](/icons/layout.gif) | growattselfdeclaration-for-g100.pdf | 2022-01-05 14:35 | 332K | |
![[ ]](/icons/layout.gif) | growattt-min-2500-6000-tl-xe-datasheet.pdf | 2021-11-25 16:30 | 6.3M | |
![[ ]](/icons/layout.gif) | growttmin2500-6000datasheet.pdf | 2024-01-18 10:22 | 8.3M | |
![[ ]](/icons/layout.gif) | grundfos-upm3-datasheet.pdf | 2022-10-20 10:42 | 4.2M | |
![[ ]](/icons/layout.gif) | grundfos-upm4-pump-data.pdf | 2024-05-14 10:24 | 287K | |
![[ ]](/icons/layout.gif) | grundfos-upm4l-pump-data.pdf | 2023-03-15 15:35 | 297K | |
![[ ]](/icons/layout.gif) | grundfos-upm4xl-pump-data.pdf | 2024-05-14 11:07 | 226K | |
![[ ]](/icons/layout.gif) | grundfos-upmm-pump-data.pdf | 2023-03-15 15:45 | 325K | |
![[ ]](/icons/layout.gif) | gs-ec-l80-2-.pdf | 2020-12-08 09:15 | 80K | |
![[ ]](/icons/layout.gif) | gs-en-ft--1-.pdf | 2022-08-04 11:27 | 1.9M | |
![[ ]](/icons/layout.gif) | gs-en-gu--1-.pdf | 2024-04-18 11:31 | 1.6M | |
![[ ]](/icons/layout.gif) | gs-en-gu.pdf | 2022-08-04 11:26 | 1.6M | |
![[ ]](/icons/layout.gif) | gs-ic-l80---1-.pdf | 2020-12-08 09:13 | 120K | |
![[ ]](/icons/layout.gif) | gs-ik-01-tech-drawing.pdf | 2017-05-19 17:23 | 115K | |
![[ ]](/icons/layout.gif) | gs-ik-04.pdf | 2017-05-19 17:23 | 93K | |
![[ ]](/icons/layout.gif) | gs-ik-07-force-analysis.pdf | 2017-05-19 17:23 | 384K | |
![[ ]](/icons/unknown.gif) | gse-2022-configurator-tool.xlsm | 2022-02-25 11:09 | 3.7M | |
![[ ]](/icons/unknown.gif) | gse-2022-configurator-v4.xlsm | 2022-02-25 11:10 | 5.1M | |
![[ ]](/icons/layout.gif) | gse-adaptation-of-universal-top-flashings-guide.pdf | 2020-11-13 14:17 | 347K | |
![[ ]](/icons/layout.gif) | gse-batten-plan.pdf | 2017-05-19 17:23 | 1.0M | |
![[ ]](/icons/layout.gif) | gse-batten-planning-guide.pdf | 2021-03-11 09:21 | 1.2M | |
![[ ]](/icons/layout.gif) | gse-bbacert-2024.pdf | 2024-03-25 10:51 | 490K | |
![[ ]](/icons/unknown.gif) | gse-calculateur-champs-pv--gse-ir--v2.7-en.xlsm | 2021-08-25 10:09 | 1.1M | |
![[ ]](/icons/layout.gif) | gse-clamp-datasheet.pdf | 2020-06-18 14:22 | 218K | |
![[ ]](/icons/unknown.gif) | gse-configurator-v3.8.xlsm | 2021-04-01 16:30 | 4.4M | |
![[ ]](/icons/layout.gif) | gse-in-roof---evolution-2020--en--v9.pdf | 2022-01-11 11:59 | 1.8M | |
![[ ]](/icons/layout.gif) | gse-in-roof---evolution-2020--en--v10--3-.pdf | 2022-07-06 12:03 | 2.1M | |
![[ ]](/icons/layout.gif) | gse-in-roof---evolution-2020--en--v10.pdf | 2023-03-30 11:33 | 202K | |
![[ ]](/icons/layout.gif) | gse-in-roof-system-manuel-dinstallation-en-v13.1.pdf | 2024-07-12 11:36 | 6.7M | |
![[ ]](/icons/layout.gif) | gse-integrated-roof-datasheet.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/layout.gif) | gse-manual-2022-v3.pdf | 2022-02-25 11:08 | 1.8M | |
![[ ]](/icons/layout.gif) | gse-manual-131020.pdf | 2021-03-11 09:19 | 6.7M | |
![[ ]](/icons/layout.gif) | gse-manual-v10.pdf | 2017-05-19 17:23 | 5.6M | |
![[ ]](/icons/layout.gif) | gse-manual-v11.pdf | 2018-01-24 10:59 | 6.4M | |
![[ ]](/icons/unknown.gif) | gse-quick-guide | 2021-07-05 10:29 | 1.5M | |
![[ ]](/icons/layout.gif) | gse-quickguide.pdf | 2021-07-05 10:31 | 1.5M | |
![[ ]](/icons/layout.gif) | gse-roof-integrated-certificates-tests.pdf | 2017-05-19 17:23 | 3.4M | |
![[ ]](/icons/layout.gif) | gse-roof-integrated-mcs-012-certificate.pdf | 2017-05-19 17:23 | 250K | |
![[ ]](/icons/layout.gif) | gse-roof-integrated-solar-pv-tolerances-2018.pdf | 2018-01-24 10:28 | 62K | |
![[ ]](/icons/layout.gif) | gse-roof-integrated-solar-pv-tolerances.pdf | 2018-01-24 10:25 | 62K | |
![[ ]](/icons/unknown.gif) | gse-sizing-calculator.xlsm | 2020-06-26 10:59 | 3.7M | |
![[ ]](/icons/layout.gif) | gse-tolarance-table-2020-v2.pdf | 2020-06-03 16:58 | 127K | |
![[ ]](/icons/layout.gif) | gse-tolerance-table-2020.pdf | 2020-03-30 15:54 | 247K | |
![[ ]](/icons/layout.gif) | gse-tolerance-table2019.pdf | 2020-06-04 09:31 | 127K | |
![[ ]](/icons/layout.gif) | gse-tolerances--3-.pdf | 2021-03-11 09:22 | 323K | |
![[ ]](/icons/layout.gif) | gse-tolerances-2021-v6.pdf | 2021-04-01 16:31 | 273K | |
![[IMG]](/icons/image2.gif) | gseclampdatasheet.png | 2022-09-29 15:15 | 94K | |
![[ ]](/icons/layout.gif) | guarantee-sese-jcjd-21-en-7-2-1.pdf | 2023-08-16 13:28 | 192K | |
![[ ]](/icons/layout.gif) | guarantee-terms-en.pdf | 2022-12-14 16:49 | 418K | |
![[ ]](/icons/layout.gif) | guick-guidance-for-installersv2.pdf | 2023-11-13 12:35 | 46K | |
![[ ]](/icons/layout.gif) | guide-to-installation-of-pv-systems.pdf | 2021-03-24 10:57 | 3.8M | |
![[ ]](/icons/layout.gif) | guide-to-ordering.pdf | 2023-11-27 10:26 | 5.1M | |
![[ ]](/icons/layout.gif) | gx-touch-50.pdf | 2020-05-11 15:31 | 376K | |
![[ ]](/icons/layout.gif) | h1-g2-series-factsheet-v1.0.pdf | 2024-06-11 09:10 | 4.9M | |
![[ ]](/icons/layout.gif) | h1z2z2-k-solar-pv-cw.pdf | 2024-05-17 13:30 | 1.0M | |
![[ ]](/icons/layout.gif) | h3-pro-series-factsheet-v1.3.pdf | 2024-06-11 09:18 | 4.7M | |
![[ ]](/icons/layout.gif) | h838-00036-01-quick-installation-guide-20220322--1-.pdf | 2022-11-22 13:25 | 2.5M | |
![[ ]](/icons/layout.gif) | handbuch-f-r-huawei-sun2000-10ktl-m1-wechselrichter.pdf | 2024-03-25 11:15 | 6.4M | |
![[ ]](/icons/layout.gif) | handbuch-fuer-huawei-ddsu666-h-smart-power-sensor-englisch-1.pdf | 2023-03-14 17:17 | 840K | |
![[ ]](/icons/layout.gif) | handbuch-fuer-huawei-smart-charger-7ks22kt-s0-englisch.pdf | 2023-07-28 11:30 | 8.6M | |
![[ ]](/icons/layout.gif) | handbuch-fuer-huawei-sun2000-12-25ktl-m5-englisch.pdf | 2024-05-22 09:36 | 2.5M | |
![[ ]](/icons/layout.gif) | handbuch-fuer-huawei-sun2000-30ktl-m3-wechselrichter.pdf | 2022-07-18 15:19 | 3.7M | |
![[ ]](/icons/layout.gif) | handbuch-fuer-huawei-sun2000-450w-p2-optimizer-englisch.pdf | 2022-08-02 15:39 | 623K | |
![[ ]](/icons/layout.gif) | handbuch-huawei-smartpowersensor-dtsu666-h.pdf | 2021-10-19 16:37 | 1.1M | |
![[ ]](/icons/layout.gif) | handbuch-huawei-sun2000-12ktl-m2.pdf | 2022-02-09 08:02 | 6.0M | |
![[ ]](/icons/layout.gif) | handbuch-huawei-sun2000-60ktl-m0.pdf | 2021-09-27 15:58 | 10M | |
![[ ]](/icons/layout.gif) | hanger-bolts-for-steel-purlins-datasheet.pdf | 2017-05-19 17:23 | 533K | |
![[ ]](/icons/layout.gif) | hanwha-q-cells-certificate-pv-60153211-qcpv-2020-12--1-.pdf | 2022-03-25 16:24 | 1.5M | |
![[ ]](/icons/layout.gif) | hanwha_q_cells_certificate_pv%2060153211_qcpv_2020_12.pdf | 2021-02-26 15:44 | 0 | |
![[ ]](/icons/unknown.gif) | harmonics | 2024-07-11 12:13 | 1.2M | |
![[ ]](/icons/unknown.gif) | harmonics report | 2024-07-11 12:12 | 1.2M | |
![[ ]](/icons/layout.gif) | harmonised-crimping-plier.pdf | 2023-06-29 17:03 | 4.1M | |
![[ ]](/icons/layout.gif) | harvi-datasheet-apr-2019.pdf | 2019-04-17 09:39 | 279K | |
![[ ]](/icons/layout.gif) | harvi-datasheet.pdf | 2018-06-11 13:44 | 461K | |
![[ ]](/icons/layout.gif) | harvi-manual-rev-4.2-june-2022-website.pdf | 2023-05-03 17:08 | 333K | |
![[ ]](/icons/layout.gif) | harvi-manual.pdf | 2018-06-11 13:44 | 122K | |
![[ ]](/icons/layout.gif) | harvi-refresh-datasheet-rev-1.1-july-2022.pdf | 2023-05-03 17:09 | 245K | |
![[ ]](/icons/layout.gif) | haze-gel-ev12-7.5-110511.pdf | 2018-12-14 13:16 | 635K | |
![[ ]](/icons/layout.gif) | haze-gel-ev12-18-290114.pdf | 2018-12-14 13:17 | 653K | |
![[ ]](/icons/layout.gif) | haze-gel-ev12-33-290114.pdf | 2018-12-14 13:17 | 663K | |
![[ ]](/icons/layout.gif) | haze-gel-ev12-55-290114.pdf | 2018-12-14 13:18 | 661K | |
![[ ]](/icons/layout.gif) | haze-gel-ev12-100-290114.pdf | 2018-12-14 13:19 | 656K | |
![[ ]](/icons/layout.gif) | haze-gel-ev12-110-290114.pdf | 2018-12-14 13:19 | 660K | |
![[ ]](/icons/layout.gif) | haze-gel-vehicle-solar-12V-datasheet-7-33-44-100ah.pdf | 2018-09-04 13:20 | 944K | |
![[ ]](/icons/layout.gif) | haze-hzb12-55.pdf | 2023-04-28 12:51 | 267K | |
![[ ]](/icons/layout.gif) | haze-hzb12-70.pdf | 2023-04-28 12:50 | 233K | |
![[ ]](/icons/layout.gif) | haze-hzb12-100.pdf | 2023-04-28 12:49 | 224K | |
![[ ]](/icons/layout.gif) | haze-hzb12-135.pdf | 2023-04-28 12:51 | 271K | |
![[ ]](/icons/layout.gif) | haze_gel_batteries_datasheet.pdf | 2016-09-12 11:31 | 422K | |
![[ ]](/icons/layout.gif) | hd-wave-inverter-technology-brochure.pdf | 2017-05-19 17:23 | 779K | |
![[ ]](/icons/layout.gif) | heat-pump-checklist.pdf | 2024-04-17 08:55 | 4.1M | |
![[ ]](/icons/layout.gif) | heat-pump-manager-wpm-manual.pdf | 2023-11-29 11:54 | 5.6M | |
![[ ]](/icons/layout.gif) | heat-pump-mini-technical-guidebook.pdf | 2023-11-29 11:54 | 4.7M | |
![[ ]](/icons/layout.gif) | heatpunk-software-sales-app.pdf | 2022-09-21 16:32 | 2.1M | |
![[ ]](/icons/layout.gif) | heatshrink-datasheet.pdf | 2023-08-24 12:35 | 218K | |
![[ ]](/icons/layout.gif) | hhs-3-6k-en.pdf | 2022-07-15 12:04 | 2.4M | |
![[ ]](/icons/layout.gif) | hi-mo-5m-lr-5-54-hpb-400-420-m-30-30-and-15-v16-9476f27f62.pdf | 2023-08-28 12:12 | 1.6M | |
![[ ]](/icons/layout.gif) | hi-portal-introduction-of-user-account-management.pdf | 2021-06-17 16:53 | 1.4M | |
![[ ]](/icons/layout.gif) | hms-trend---installation-manual.pdf | 2021-11-26 16:21 | 12M | |
![[ ]](/icons/layout.gif) | hms-trend---technical-datasheet.pdf | 2021-11-26 16:20 | 533K | |
![[ ]](/icons/layout.gif) | home3.0-technical-specification.pdf | 2024-03-25 10:19 | 112K | |
![[ ]](/icons/layout.gif) | homecom-pro-homeowner-guide.pdf | 2024-04-17 08:45 | 3.9M | |
![[ ]](/icons/layout.gif) | homely-installation-manual--mini--en-a5-generic-v1.2.pdf | 2023-08-18 13:13 | 1.8M | |
![[ ]](/icons/layout.gif) | homely-installation-manual--mini--en-a5-lg-v1.2.pdf | 2023-08-18 13:12 | 2.5M | |
![[ ]](/icons/layout.gif) | homely-installation-manual-samsung-v1.0.pdf | 2022-07-11 11:58 | 2.5M | |
![[ ]](/icons/layout.gif) | homely-installer-flyer-v3-image-sc-2804.pdf | 2023-11-21 08:29 | 835K | |
![[ ]](/icons/layout.gif) | homely-tech-sheet-nov23-v1.pdf | 2023-11-16 15:46 | 2.5M | |
![[ ]](/icons/layout.gif) | homeowner-quickstart-guide-aw-2023.pdf | 2024-01-30 09:00 | 1.5M | |
![[ ]](/icons/unknown.gif) | hookstodata | 2024-02-19 12:11 | 218K | |
![[ ]](/icons/layout.gif) | hookstop-datasheet.pdf | 2017-09-01 14:38 | 218K | |
![[ ]](/icons/layout.gif) | hookstop-installation-manual.pdf | 2017-09-01 14:38 | 848K | |
![[ ]](/icons/unknown.gif) | hookstopinstall | 2024-02-19 12:12 | 848K | |
![[ ]](/icons/layout.gif) | how-to-sell-solaredge-eng.pdf | 2019-10-18 09:25 | 677K | |
![[ ]](/icons/layout.gif) | how-to-sell-solaredge.pdf | 2017-07-04 13:17 | 651K | |
![[ ]](/icons/layout.gif) | hoym-hm-x00-unbed-en50549-1-2019-eng-u20-0492-2-.pdf | 2021-10-12 15:46 | 421K | |
![[ ]](/icons/layout.gif) | hoym-mi-600-unbed-en50438-2013-ned-u18-0048.pdf | 2021-02-16 15:25 | 302K | |
![[ ]](/icons/layout.gif) | hoym-mi-1200-unbed-en50438-2013-ned-eng-u18-0459.pdf | 2021-02-16 15:26 | 266K | |
![[ ]](/icons/layout.gif) | hoymiles-dtu-user-manual.pdf | 2019-01-18 16:14 | 2.8M | |
![[ ]](/icons/layout.gif) | hoymiles-mi-500-datasheet.pdf | 2019-02-21 13:22 | 199K | |
![[ ]](/icons/layout.gif) | hoymiles-mi250-datasheet.pdf | 2019-03-06 17:41 | 117K | |
![[ ]](/icons/layout.gif) | hoymiles-monitoring.pdf | 2019-01-18 16:13 | 750K | |
![[ ]](/icons/layout.gif) | hoymiles-pretend-test.pdf | 2018-11-22 16:58 | 1.0M | |
![[ ]](/icons/layout.gif) | hoymiles-setup.pdf | 2019-01-18 16:17 | 2.6M | |
![[ ]](/icons/layout.gif) | hoymiles-usb-dtu.pdf | 2019-12-12 10:22 | 808K | |
![[ ]](/icons/layout.gif) | hoymiles-warranty-terms-conditions-global-v202110.pdf | 2021-11-18 16:45 | 516K | |
![[ ]](/icons/layout.gif) | hoymiles-wifi.pdf | 2019-01-18 16:12 | 38K | |
![[ ]](/icons/layout.gif) | hp120-12V-AGM-battery-for-motorhomes-caravans.pdf | 2019-06-20 16:03 | 321K | |
![[ ]](/icons/layout.gif) | hp120-12v-agm-120ah-battery-motorhomes-caravans-boats.pdf | 2019-06-20 14:01 | 372K | |
![[ ]](/icons/layout.gif) | hp120-12v-agm-battery.pdf | 2019-06-20 13:58 | 371K | |
![[ ]](/icons/layout.gif) | hp120-12v-sterling-agm-battery.pdf | 2019-06-20 13:55 | 170K | |
![[ ]](/icons/layout.gif) | hpc115-12dt-final--1-AGM-lead-carbon-deep-cycle-battery.pdf | 2019-11-26 13:16 | 285K | |
![[ ]](/icons/layout.gif) | hpk-1-3kw-en.pdf | 2021-06-17 16:50 | 2.1M | |
![[ ]](/icons/layout.gif) | hpk-quick-installation-guide-en-1.pdf | 2022-06-29 14:44 | 3.9M | |
![[ ]](/icons/layout.gif) | hps-3-6.5kw-en.pdf | 2021-06-14 12:05 | 1.8M | |
![[ ]](/icons/layout.gif) | hps1500-6500-user-manual-20200817-1.pdf | 2021-06-14 12:06 | 4.4M | |
![[ ]](/icons/layout.gif) | hpt-3-11kw-en.pdf | 2021-04-09 09:17 | 1.8M | |
![[ ]](/icons/layout.gif) | hpt-15-25kw-en.pdf | 2021-06-22 15:31 | 1.8M | |
![[ ]](/icons/layout.gif) | hpt-30-50k-20220125en.pdf | 2022-09-09 10:35 | 1.6M | |
![[ ]](/icons/layout.gif) | hpt-33-50kw-en--1-.pdf | 2022-08-12 10:56 | 1.7M | |
![[ ]](/icons/layout.gif) | hrdi-data-sheet.pdf | 2016-09-12 11:31 | 52K | |
![[ ]](/icons/layout.gif) | hrs-data-sheet.pdf | 2016-09-12 11:31 | 156K | |
![[ ]](/icons/layout.gif) | hrsi-data-sheet.pdf | 2016-09-12 11:31 | 57K | |
![[ ]](/icons/layout.gif) | hsbb-180---installation-manual.pdf | 2021-11-09 10:37 | 12M | |
![[ ]](/icons/layout.gif) | hsbb-180-installation-manual.pdf | 2021-11-08 10:23 | 12M | |
![[ ]](/icons/layout.gif) | hsbb-datasheet.pdf | 2022-10-25 15:53 | 170K | |
![[ ]](/icons/layout.gif) | hsbc-200---technical-datasheet.pdf | 2021-11-09 11:36 | 167K | |
![[ ]](/icons/layout.gif) | hsbc-200-installation-manual-compressed.pdf | 2023-11-29 11:59 | 10M | |
![[ ]](/icons/layout.gif) | hsbc-datasheet.pdf | 2022-10-24 15:06 | 129K | |
![[ ]](/icons/layout.gif) | ht-quiet-datasheet.pdf | 2023-04-12 11:22 | 117K | |
![[ ]](/icons/layout.gif) | https---www.solaredge.com-sites-default-files-installing-environmental-sensors.pdf | 2019-10-21 12:49 | 756K | |
![[ ]](/icons/layout.gif) | https---www.solaredge.com-sites-default-files-se-power-optimizer-s-series-datasheet.pdf | 2022-08-03 15:47 | 240K | |
![[ ]](/icons/layout.gif) | https---www.solaredge.com-sites-default-files-se-sensor-datasheet.pdf | 2019-10-21 12:48 | 449K | |
![[ ]](/icons/layout.gif) | https---www.solaredge.com-sites-default-files-se-solaredge-home-hub-inverter-three-phase-backup-datasheet-eng-row.pdf | 2022-10-05 16:33 | 200K | |
![[ ]](/icons/layout.gif) | https---www.solaredge.com-sites-default-files-solaredge-gateway-installation-guide.pdf | 2019-10-21 12:49 | 1.9M | |
![[ ]](/icons/layout.gif) | huawe-02720-201201012532.pdf | 2022-11-02 16:22 | 907K | |
![[ ]](/icons/layout.gif) | huawe-03562-210614112647--1-.pdf | 2022-11-02 16:19 | 458K | |
![[ ]](/icons/layout.gif) | huawei-3ph-m1-hyb-datasheet.pdf | 2021-11-11 12:12 | 318K | |
![[ ]](/icons/layout.gif) | huawei-3ph-m1-hyd-g98.pdf | 2021-11-11 12:13 | 870K | |
![[ ]](/icons/layout.gif) | huawei-3ph-m1-hyd-g99.pdf | 2021-11-11 12:13 | 822K | |
![[ ]](/icons/layout.gif) | huawei-3ph-m1-hyd-manual.pdf | 2021-11-11 12:14 | 6.1M | |
![[ ]](/icons/layout.gif) | huawei-3ph-m1-hyd-quick.pdf | 2021-11-11 12:14 | 3.3M | |
![[ ]](/icons/unknown.gif) | huawei-8-28-guide | 2017-05-19 17:23 | 4.8M | |
![[ ]](/icons/unknown.gif) | huawei-8-28-manual | 2017-05-19 17:23 | 1.0M | |
![[ ]](/icons/unknown.gif) | huawei-8-g83 | 2017-05-19 17:23 | 401K | |
![[ ]](/icons/unknown.gif) | huawei-12-28-g59 | 2017-05-19 17:23 | 554K | |
![[ ]](/icons/unknown.gif) | huawei-33-40-guide | 2017-05-19 17:23 | 1.3M | |
![[ ]](/icons/unknown.gif) | huawei-33-40-user-guide | 2017-05-19 17:23 | 7.5M | |
![[ ]](/icons/layout.gif) | huawei-33-datasheet.pdf | 2017-05-19 17:23 | 576K | |
![[ ]](/icons/unknown.gif) | huawei-33-g59 | 2017-05-19 17:23 | 1.3M | |
![[ ]](/icons/unknown.gif) | huawei-40-datasheet | 2017-05-19 17:23 | 684K | |
![[ ]](/icons/unknown.gif) | huawei-40-g59 | 2017-05-19 17:23 | 923K | |
![[ ]](/icons/layout.gif) | huawei-100-ktl-m1-g99-type-a-cert.pdf | 2021-02-26 10:17 | 194K | |
![[ ]](/icons/layout.gif) | huawei-100-ktl-m1-g99-type-b-cert.pdf | 2021-02-26 10:18 | 755K | |
![[ ]](/icons/layout.gif) | huawei-backup-box-quickguide.pdf | 2021-07-28 10:57 | 1.5M | |
![[ ]](/icons/layout.gif) | huawei-backup-box-warranty.pdf | 2021-06-21 17:10 | 361K | |
![[ ]](/icons/layout.gif) | huawei-backup-box.pdf | 2021-07-28 10:57 | 215K | |
![[ ]](/icons/layout.gif) | huawei-certificate-en-50549-50ktl-60ktl.pdf | 2021-12-02 10:06 | 641K | |
![[ ]](/icons/layout.gif) | huawei-datasheet.pdf | 2017-05-19 17:23 | 856K | |
![[ ]](/icons/layout.gif) | huawei-g100-compliance-declaration.pdf | 2022-05-03 17:44 | 108K | |
![[ ]](/icons/layout.gif) | huawei-hybrid-warranty--1-.pdf | 2021-09-24 13:11 | 370K | |
![[ ]](/icons/layout.gif) | huawei-hybrid-warranty.pdf | 2023-11-06 09:32 | 370K | |
![[ ]](/icons/layout.gif) | huawei-installer-account-on-fusionsolar.pdf | 2022-01-31 11:07 | 714K | |
![[ ]](/icons/layout.gif) | huawei-luna-5kwh-battery-datasheet.pdf | 2021-09-24 13:10 | 301K | |
![[ ]](/icons/layout.gif) | huawei-luna2000--5-30--s0-user-manual.pdf | 2021-09-24 13:10 | 4.8M | |
![[ ]](/icons/layout.gif) | huawei-luna2000-5-30-s0-quick-guide--1-.pdf | 2021-09-24 13:11 | 4.2M | |
![[ ]](/icons/layout.gif) | huawei-luna2000-5-30-s0-quick-guide.pdf | 2021-08-03 12:25 | 4.2M | |
![[ ]](/icons/layout.gif) | huawei-monitor-datasheet.pdf | 2017-05-19 17:23 | 653K | |
![[ ]](/icons/layout.gif) | huawei-monitor-manual.pdf | 2017-05-19 17:23 | 5.6M | |
![[ ]](/icons/layout.gif) | huawei-monitor-quick.pdf | 2017-05-19 17:23 | 892K | |
![[ ]](/icons/layout.gif) | huawei-roadshow.pdf | 2021-09-29 09:40 | 1.0M | |
![[ ]](/icons/layout.gif) | huawei-smart-dongle-datasheet--1-.pdf | 2021-07-09 16:22 | 172K | |
![[ ]](/icons/layout.gif) | huawei-smart-dongle-datasheet.pdf | 2021-07-09 15:50 | 172K | |
![[ ]](/icons/layout.gif) | huawei-smart-power-sensor-1ph-datasheet.pdf | 2021-07-09 15:43 | 336K | |
![[ ]](/icons/layout.gif) | huawei-smartlogger3000-quick-guide.pdf | 2022-01-28 11:58 | 2.1M | |
![[ ]](/icons/layout.gif) | huawei-smartlogger3000-user-manual.pdf | 2022-01-28 11:57 | 3.6M | |
![[ ]](/icons/layout.gif) | huawei-smartlogger3000a-datasheet.pdf | 2022-01-28 11:57 | 194K | |
![[ ]](/icons/layout.gif) | huawei-sun2000--2ktl-6ktl--l1-quick-guide.pdf | 2021-04-28 14:24 | 2.4M | |
![[ ]](/icons/layout.gif) | huawei-sun2000-2-6ktl-l1-datasheet.pdf | 2021-07-09 16:11 | 434K | |
![[ ]](/icons/layout.gif) | huawei-sun2000-2ktl-6ktl-l1-user-manual--1-.pdf | 2022-12-19 14:25 | 5.3M | |
![[ ]](/icons/layout.gif) | huawei-sun2000-2ktl-6ktl-l1-user-manual.pdf | 2021-07-09 16:13 | 5.3M | |
![[ ]](/icons/layout.gif) | huawei-sun2000-12-20ktl-m0.pdf | 2019-12-11 16:31 | 261K | |
![[ ]](/icons/layout.gif) | huawei-sun2000-12-20ktl-m2-datasheet.pdf | 2021-04-20 11:00 | 335K | |
![[ ]](/icons/layout.gif) | huawei-sun2000-100ktl-125ktl-user-manual---19-02-2020-1.pdf | 2022-02-09 16:49 | 4.8M | |
![[ ]](/icons/layout.gif) | huawei-sun2000-100ktl-m1-datasheet---03.02.2020.pdf | 2022-02-09 16:48 | 190K | |
![[ ]](/icons/layout.gif) | huawei-sun2000-100m1-en50549-certificate---06-11-2019-1--1-.pdf | 2022-02-09 16:49 | 384K | |
![[ ]](/icons/layout.gif) | huawei-sun2000-115ktl-m2-datasheet---18-10-2022.pdf | 2023-02-16 16:20 | 391K | |
![[ ]](/icons/layout.gif) | huawei-sun2000-installer-manual.pdf | 2019-12-11 16:38 | 3.2M | |
![[ ]](/icons/layout.gif) | huawei-uk-sun2000-2-4-l1-g98-cert-bv.pdf | 2021-04-28 14:25 | 458K | |
![[ ]](/icons/layout.gif) | huawei-uk-sun2000-2-6-l1-g99-cert-bv.pdf | 2021-04-28 14:26 | 266K | |
![[ ]](/icons/layout.gif) | huawei-warranty.pdf | 2017-05-19 17:23 | 199K | |
![[ ]](/icons/layout.gif) | hv-pack-parallel-box-au-v2.pdf | 2022-08-09 12:15 | 829K | |
![[ ]](/icons/layout.gif) | hv-series.pdf | 2022-08-09 12:11 | 11M | |
![[ ]](/icons/layout.gif) | hyd3-6kw-en50438-ieland.pdf | 2019-07-08 10:06 | 205K | |
![[ ]](/icons/layout.gif) | hyd3-6kw-en50438-ireland.pdf | 2019-07-08 10:12 | 205K | |
![[ ]](/icons/layout.gif) | hyd3-6kw-g98-coc.pdf | 2019-04-23 11:00 | 206K | |
![[ ]](/icons/layout.gif) | hyd3-6kw-g99-coc.pdf | 2019-10-10 09:22 | 207K | |
![[ ]](/icons/layout.gif) | hydroflow-leaflet.pdf | 2019-09-26 12:08 | 4.7M | |
![[ ]](/icons/layout.gif) | hyp0139-pearl-instructions-uk-02-lr.pdf | 2023-04-20 14:36 | 385K | |
![[ ]](/icons/layout.gif) | hypervolt-home-3-pro---technical-sheet.pdf | 2024-04-25 14:56 | 173K | |
![[ ]](/icons/layout.gif) | hyponcloud-pre-release-presentation-deck-v0--2-.pdf | 2022-08-10 13:15 | 2.7M | |
![[ ]](/icons/layout.gif) | hypontech-warranty-eur-only-2021.pdf | 2022-02-07 09:07 | 595K | |
![[ ]](/icons/layout.gif) | hypontech-warranty-eur-only-20200605--1-.pdf | 2021-06-17 16:52 | 553K | |
![[ ]](/icons/layout.gif) | hypontech-wi-fi-stick-guide-v2.0.0.pdf | 2021-06-17 16:51 | 1.2M | |
![[ ]](/icons/layout.gif) | hzs12-7.5hr.pdf | 2018-12-18 15:38 | 202K | |
![[ ]](/icons/layout.gif) | hzs12-14.pdf | 2018-12-18 15:44 | 191K | |
![[ ]](/icons/layout.gif) | i-tracer_manual.pdf | 2016-09-12 11:31 | 1.1M | |
![[ ]](/icons/layout.gif) | iboost-accreditations.pdf | 2017-05-19 17:23 | 48K | |
![[ ]](/icons/layout.gif) | iboost-buddy-manual.pdf | 2018-04-09 14:58 | 1.1M | |
![[ ]](/icons/layout.gif) | iboost-faq.pdf | 2017-05-19 17:23 | 94K | |
![[ ]](/icons/layout.gif) | iboost-faultfind-2.pdf | 2017-05-19 17:23 | 530K | |
![[ ]](/icons/layout.gif) | iboost-kettletest.pdf | 2017-05-19 17:23 | 299K | |
![[ ]](/icons/layout.gif) | iboost-maximise-benefits.pdf | 2017-05-19 17:23 | 34K | |
![[ ]](/icons/layout.gif) | iboost-troubleshooting.pdf | 2017-05-19 17:23 | 147K | |
![[ ]](/icons/layout.gif) | iboost-user-manual.pdf | 2017-05-19 17:23 | 1.1M | |
![[ ]](/icons/layout.gif) | ie-7001i-aw-installation-manual.pdf | 2022-12-20 13:03 | 6.8M | |
![[ ]](/icons/layout.gif) | iewc-cable-datasheet.pdf | 2018-07-04 15:46 | 88K | |
![[ ]](/icons/layout.gif) | im-08-05-03-modular-system-installation-guide-28-11-23.pdf | 2023-12-06 09:52 | 2.9M | |
![[ ]](/icons/layout.gif) | im-08.05.24-modular-system-installation-guide---iss-1--1---1-.pdf | 2023-11-14 14:01 | 2.7M | |
![[IMG]](/icons/image2.gif) | image--4-.png | 2023-08-04 13:50 | 121K | |
![[ ]](/icons/layout.gif) | imo-isolator-datasheet.pdf | 2022-07-01 15:14 | 0 | |
![[ ]](/icons/layout.gif) | imo-solar-range-0222--2-.pdf | 2022-08-24 14:58 | 4.4M | |
![[ ]](/icons/layout.gif) | imodatasheet.pdf | 2022-07-06 17:25 | 191K | |
![[ ]](/icons/layout.gif) | in-roof-en-05-2023-v5.pdf | 2024-01-29 15:23 | 7.2M | |
![[ ]](/icons/layout.gif) | in-roof-pv-performance-assessment.pdf | 2022-05-06 10:49 | 1.7M | |
![[ ]](/icons/layout.gif) | infinity_1500_user_manual_ue_au_uk___.pdf | 2024-01-15 10:49 | 36K | |
![[ ]](/icons/layout.gif) | information-sheet-rec-alpha-pure-series-en.pdf | 2021-11-19 14:13 | 2.7M | |
![[ ]](/icons/layout.gif) | insertion-system-assembly-en.pdf | 2023-05-08 15:52 | 2.4M | |
![[ ]](/icons/layout.gif) | instagen-435-datasheet.pdf | 2024-05-10 13:37 | 1.0M | |
![[ ]](/icons/layout.gif) | instagen-batt-manual.pdf | 2024-03-20 10:26 | 1.0M | |
![[ ]](/icons/layout.gif) | instagen-battery-v1.pdf | 2024-02-28 11:13 | 312K | |
![[ ]](/icons/layout.gif) | instagen-hybrid-inverter-5kw.pdf | 2024-05-24 15:13 | 370K | |
![[ ]](/icons/layout.gif) | instagen-hybrid-manual.pdf | 2024-03-20 10:26 | 2.8M | |
![[ ]](/icons/layout.gif) | instagen-inverter-v1.pdf | 2024-02-28 10:33 | 363K | |
![[IMG]](/icons/image2.gif) | instagen-logo.png | 2024-06-10 10:01 | 23K | |
![[ ]](/icons/layout.gif) | instagen-quick-guide.pdf | 2024-03-20 10:26 | 28M | |
![[ ]](/icons/layout.gif) | instagen-solar-pv-v1-2.pdf | 2024-04-29 12:49 | 1.0M | |
![[ ]](/icons/layout.gif) | instagen-solar-pv-v1.pdf | 2024-02-28 11:51 | 3.9M | |
![[ ]](/icons/layout.gif) | instagen-wifi-manual.pdf | 2024-03-20 10:27 | 4.4M | |
![[ ]](/icons/layout.gif) | installation-checklist.pdf | 2023-03-17 16:27 | 424K | |
![[ ]](/icons/layout.gif) | installation-flexalu-en.pdf | 2020-09-18 09:17 | 894K | |
![[ ]](/icons/unknown.gif) | installation-guide | 2024-02-27 15:55 | 169K | |
![[ ]](/icons/layout.gif) | installation-guide-gse-in-roof-system-en-4.1.pdf | 2023-05-05 11:58 | 1.7M | |
![[ ]](/icons/layout.gif) | installation-guide-mim-e03cn---mim-e03en.pdf | 2023-05-24 09:26 | 2.3M | |
![[ ]](/icons/layout.gif) | installation-manual---ev-charger---11.10.23.pdf | 2023-10-16 12:17 | 1.0M | |
![[ ]](/icons/layout.gif) | installation-manual-for-lon-gi-solar-pv-modules-v15-4b75a96278.pdf | 2022-11-10 17:23 | 2.6M | |
![[ ]](/icons/layout.gif) | installation-manual-for-lon-gi-solar-pv-modules-v17-15f62c5b73-compressed.pdf | 2023-12-21 13:00 | 4.0M | |
![[ ]](/icons/layout.gif) | installation-manual-gse-in-roof-system-en-v13.1.pdf | 2023-05-05 14:24 | 6.7M | |
![[ ]](/icons/layout.gif) | installation-manual-jinko-iec-updated-version-2023.05.08.pdf | 2024-06-05 12:37 | 1.7M | |
![[ ]](/icons/layout.gif) | installation-manual-juicebox---print-ready.pdf | 2022-04-25 11:36 | 632K | |
![[ ]](/icons/layout.gif) | installation-manual-of-a-slate--1-.pdf | 2023-11-10 13:35 | 4.1M | |
![[ ]](/icons/layout.gif) | installation-manual-rt12100g31-21p1rt0701.pdf | 2023-12-05 15:37 | 3.6M | |
![[ ]](/icons/layout.gif) | installation-manual.pdf | 2022-01-14 09:46 | 8.3M | |
![[ ]](/icons/layout.gif) | installation-process-with-surface-mount.pdf | 2023-11-24 09:56 | 200K | |
![[ ]](/icons/layout.gif) | installationmanual1500-2000.pdf | 2023-09-14 11:20 | 1.7M | |
![[ ]](/icons/unknown.gif) | installationoperateASW3000-5000 | 2023-09-14 11:08 | 2.2M | |
![[ ]](/icons/layout.gif) | installer-benefits-brochure---all-in-one--june-2023-.pdf | 2023-06-02 09:49 | 1.4M | |
![[ ]](/icons/layout.gif) | installer-manual-allstor-plus-uk-0020200898-00.pdf | 2023-11-22 13:13 | 783K | |
![[ ]](/icons/layout.gif) | installer-training-manual-v12.pdf | 2023-04-11 13:15 | 9.1M | |
![[ ]](/icons/layout.gif) | installer-training-manual-v14-givenergy.pdf | 2023-11-23 15:49 | 11M | |
![[ ]](/icons/layout.gif) | installing-frame-mounted-power-optimizers--1-.pdf | 2022-06-20 12:06 | 458K | |
![[ ]](/icons/layout.gif) | installing-frame-mounted-power-optimizers.pdf | 2021-11-24 11:20 | 458K | |
![[ ]](/icons/layout.gif) | instruction-manual-v8.pdf | 2020-10-28 13:23 | 1.1M | |
![[ ]](/icons/layout.gif) | instructions-for-installation-of-industrial-and-commercial-inverters-in-different-scenarios-v12-en.pdf | 2023-12-14 15:13 | 7.3M | |
![[ ]](/icons/layout.gif) | inta-15mm-aav-datasheet.pdf | 2023-07-12 12:53 | 1.6M | |
![[ ]](/icons/layout.gif) | inta-y-strainer-document.pdf | 2023-08-31 16:36 | 2.0M | |
![[ ]](/icons/layout.gif) | intasol-combi-diverter-technical-data-sheet.pdf | 2022-04-01 10:35 | 3.0M | |
![[ ]](/icons/layout.gif) | intenergy-datasheet.pdf | 2017-06-06 16:00 | 631K | |
![[ ]](/icons/layout.gif) | intercompatibility-se-power-optimizers-march19.pdf | 2019-04-16 12:35 | 177K | |
![[ ]](/icons/layout.gif) | intercompatibility_se_power_optimizers_2019.pdf | 2019-01-03 10:25 | 240K | |
![[ ]](/icons/layout.gif) | introduction-to-sunamp-midsummer.pdf | 2020-05-11 14:15 | 1.8M | |
![[ ]](/icons/layout.gif) | introduction-to-sunamp-new-range.pdf | 2021-01-12 13:49 | 2.2M | |
![[ ]](/icons/layout.gif) | inverter-ccg-meter--psti-approved-.pdf | 2024-05-09 12:12 | 553K | |
![[ ]](/icons/layout.gif) | inverter-ccgs-meter--psti-approved-.pdf | 2024-05-09 12:13 | 610K | |
![[ ]](/icons/layout.gif) | inverter-ffg-ccg-meter--psti-approved-.pdf | 2024-05-09 12:17 | 623K | |
![[ ]](/icons/layout.gif) | inverter-ffg-meter--psti-approved-.pdf | 2024-05-09 12:16 | 761K | |
![[ ]](/icons/layout.gif) | inverter-remote-en-a5.pdf | 2020-02-05 10:40 | 85K | |
![[ ]](/icons/layout.gif) | iq-battery-5p-datasheet.pdf | 2023-09-22 15:32 | 1.0M | |
![[ ]](/icons/layout.gif) | iq-battery-5p-handling-guidelines-ten-00010-1.0-en-us-2024-03-25-vk.pdf | 2024-04-15 15:44 | 383K | |
![[ ]](/icons/unknown.gif) | iq-battery-5p-quick-install-guide | 2023-10-24 10:50 | 56M | |
![[ ]](/icons/layout.gif) | iq-battery-5p-technial-brief.pdf | 2023-09-22 15:34 | 1.4M | |
![[ ]](/icons/layout.gif) | iq-cabling-datasheet.pdf | 2024-05-08 10:08 | 3.2M | |
![[ ]](/icons/layout.gif) | iq-gateway-met-2-em-230-ds-en-us-08-26-2022-0--1-.pdf | 2024-02-29 11:01 | 157K | |
![[ ]](/icons/layout.gif) | iq-gateway-standard-rev06-09-19-2022.pdf | 2024-05-08 10:03 | 585K | |
![[ ]](/icons/layout.gif) | iq7-ds-qdcc2-v2-eu-2022-06-24.pdf | 2022-11-30 15:05 | 1.5M | |
![[ ]](/icons/layout.gif) | iq7-ds-v2-mc4-en-eu-2022-06-24.pdf | 2022-11-30 15:11 | 1.5M | |
![[ ]](/icons/layout.gif) | iq7-iq7-iq7xinstallationsheet.pdf | 2019-10-14 15:03 | 1.1M | |
![[ ]](/icons/layout.gif) | iq7-iq7plusdatasheet.pdf | 2019-10-14 15:11 | 224K | |
![[ ]](/icons/layout.gif) | iq7-model-m-ds-en-europe.pdf | 2022-03-07 16:53 | 320K | |
![[ ]](/icons/layout.gif) | iq7a-ds-en-uk-08-17-2020.pdf | 2020-12-15 11:28 | 273K | |
![[ ]](/icons/layout.gif) | iq7a-model-m-ds-en-europe.pdf | 2022-03-07 17:05 | 315K | |
![[ ]](/icons/layout.gif) | iqca-ds-0032-01-en-eu-2023-03-15.pdf | 2024-02-27 15:26 | 3.2M | |
![[ ]](/icons/layout.gif) | iqgateway-datasheet-en-int-2023-02-22.pdf | 2024-05-08 10:05 | 541K | |
![[ ]](/icons/layout.gif) | iqgateway-metered-man-en-intl.pdf | 2024-05-03 11:59 | 1.6M | |
![[ ]](/icons/layout.gif) | iqgateway-metered-multiphase-qig-en-uk.pdf | 2024-05-03 11:59 | 706K | |
![[ ]](/icons/layout.gif) | ir-en-mi-v11.3-4.pdf | 2022-03-02 14:39 | 8.0M | |
![[ ]](/icons/layout.gif) | irl-fronius-eco-25.0-3-en50438.pdf | 2019-05-22 15:10 | 188K | |
![[ ]](/icons/layout.gif) | isg---installation-manual--1-.pdf | 2021-11-10 11:51 | 1.9M | |
![[ ]](/icons/layout.gif) | isg---technical-datasheet.pdf | 2021-11-10 11:48 | 193K | |
![[ ]](/icons/layout.gif) | iskra-me162-manual.pdf | 2023-03-20 16:03 | 238K | |
![[ ]](/icons/layout.gif) | iskra-me382-manual.pdf | 2017-09-29 15:24 | 4.8M | |
![[ ]](/icons/layout.gif) | istop-antifreeze-valve-data-sheet.pdf | 2024-07-26 08:41 | 947K | |
![[ ]](/icons/layout.gif) | itracer_data.pdf | 2016-09-12 11:31 | 646K | |
![[ ]](/icons/layout.gif) | ja-310-datasheet.pdf | 2020-01-21 13:59 | 357K | |
![[ ]](/icons/layout.gif) | ja-325-silver-mono.pdf | 2019-07-05 15:25 | 489K | |
![[ ]](/icons/layout.gif) | ja-ammonia-certificate.pdf | 2019-07-05 15:48 | 1.6M | |
![[ ]](/icons/layout.gif) | ja-certificte-sand-dust.pdf | 2019-07-05 15:47 | 1.7M | |
![[ ]](/icons/layout.gif) | ja-manual.pdf | 2019-07-05 15:28 | 5.4M | |
![[ ]](/icons/layout.gif) | ja-salt-certificate.pdf | 2019-07-05 15:48 | 1.6M | |
![[ ]](/icons/layout.gif) | ja-warranty.pdf | 2019-07-05 15:28 | 722K | |
![[ ]](/icons/layout.gif) | jinko-66tr-n-bw-datasheet.pdf | 2022-03-24 13:28 | 1.2M | |
![[ ]](/icons/layout.gif) | jinko-320w-black-mono-datasheet.pdf | 2020-11-30 11:32 | 3.8M | |
![[ ]](/icons/layout.gif) | jinko-345-365w-JKMXXXN-6TL3-B-datasheet-240321.pdf | 2021-03-24 09:16 | 384K | |
![[ ]](/icons/layout.gif) | jinko-395-415-datasheet.pdf | 2022-01-12 11:14 | 1.5M | |
![[ ]](/icons/layout.gif) | jinko-400-420-54c-ab-n-datasheet.pdf | 2022-04-20 15:43 | 339K | |
![[ ]](/icons/layout.gif) | jinko-cheetah-mcs-certificate.pdf | 2021-07-12 10:08 | 694K | |
![[ ]](/icons/layout.gif) | jinko-cheetah-n-datasheet.pdf | 2021-06-04 09:38 | 1.9M | |
![[ ]](/icons/layout.gif) | jinko-cheetah-n-manual.pdf | 2021-07-12 10:11 | 8.0M | |
![[ ]](/icons/layout.gif) | jinko-code.pdf | 2021-04-27 15:46 | 215K | |
![[ ]](/icons/layout.gif) | jinko-csr.pdf | 2021-04-27 15:46 | 15M | |
![[ ]](/icons/layout.gif) | jinko-datasheet.pdf | 2024-01-15 14:03 | 7.6M | |
![[ ]](/icons/layout.gif) | jinko-installation-manual-tuv.pdf | 2022-11-10 17:13 | 3.1M | |
![[ ]](/icons/layout.gif) | jinko-installation-manual.pdf | 2024-01-15 10:38 | 1.7M | |
![[ ]](/icons/layout.gif) | jinko-manual-240321.pdf | 2021-03-24 10:10 | 949K | |
![[ ]](/icons/layout.gif) | jinko-mcs-april2021.pdf | 2021-04-26 11:33 | 694K | |
![[ ]](/icons/layout.gif) | jinko-mcs-certs-240321-min.pdf | 2021-03-24 11:00 | 13M | |
![[ ]](/icons/layout.gif) | jinko-statement.pdf | 2021-04-27 15:41 | 533K | |
![[ ]](/icons/layout.gif) | jinko-supplier-code.pdf | 2021-04-27 15:46 | 300K | |
![[ ]](/icons/layout.gif) | jinko-tiger-66tr-datasheet.pdf | 2022-03-24 13:12 | 549K | |
![[ ]](/icons/layout.gif) | jinko-tiger-n-type-385-405w-blk-mono-datasheet.pdf | 2021-03-25 08:56 | 393K | |
![[ ]](/icons/layout.gif) | jinko-tiger-neo-54--limited-warranty.pdf | 2024-06-05 12:37 | 582K | |
![[ ]](/icons/layout.gif) | jinko-tigerpro-54hc-datasheet.pdf | 2021-12-09 16:14 | 1.8M | |
![[ ]](/icons/layout.gif) | jinko-warranty-240321.pdf | 2021-03-25 11:37 | 666K | |
![[ ]](/icons/layout.gif) | jinko-warranty.pdf | 2024-01-15 10:37 | 582K | |
![[ ]](/icons/layout.gif) | jinko-warranty01-240321.pdf | 2021-03-24 10:12 | 949K | |
![[ ]](/icons/layout.gif) | jinkosolar-global-limited-warranty.pdf | 2022-08-03 14:18 | 673K | |
![[ ]](/icons/layout.gif) | jkm420-440n-54hl4r-b-f1.3-en--4-.pdf | 2024-06-05 12:36 | 1.4M | |
![[ ]](/icons/layout.gif) | jkm420-440n-54hl4r-b-f1.3-en.pdf | 2023-03-20 13:30 | 1.4M | |
![[ ]](/icons/layout.gif) | jkm425n-54hl4-b.pdf | 2023-09-05 14:50 | 7.6M | |
![[ ]](/icons/layout.gif) | job-pack----business-development-executive-glasgow--1-.pdf | 2024-07-12 14:22 | 5.3M | |
![[ ]](/icons/layout.gif) | job-pack---marketing-executive.pdf | 2024-03-28 19:49 | 5.2M | |
![[ ]](/icons/layout.gif) | job-pack---operations-manager--1-.pdf | 2024-03-26 14:41 | 5.1M | |
![[ ]](/icons/layout.gif) | job-pack---operations-manager.pdf | 2024-03-11 11:50 | 5.1M | |
![[ ]](/icons/layout.gif) | job-pack-business-development-executive-glasgow.pdf | 2024-07-10 13:28 | 5.3M | |
![[ ]](/icons/layout.gif) | job-pack-grad-scheme.pdf | 2024-01-29 15:55 | 4.9M | |
![[ ]](/icons/layout.gif) | job-pack-grad-scheme1.pdf | 2024-03-11 09:51 | 5.1M | |
![[ ]](/icons/layout.gif) | job-pack-graduate-developer.pdf | 2024-01-29 15:10 | 4.9M | |
![[ ]](/icons/layout.gif) | job-pack-sales-associate.pdf | 2024-03-10 21:02 | 5.1M | |
![[ ]](/icons/layout.gif) | jw-sct-series-current-transformers.pdf | 2020-02-21 10:01 | 1.0M | |
![[ ]](/icons/layout.gif) | k-30-rf-quick-start.pdf | 2024-04-18 09:11 | 5.6M | |
![[ ]](/icons/layout.gif) | k2-assembly-maintenance-notes---27-11-2019-1.pdf | 2024-02-07 09:33 | 41K | |
![[ ]](/icons/layout.gif) | k2-ce-certificate-of-conformity---22-06-2017--1-.pdf | 2022-09-26 09:25 | 295K | |
![[ ]](/icons/layout.gif) | k2-ce-certificate-of-conformity---22-06-2017.pdf | 2024-02-07 09:34 | 295K | |
![[ ]](/icons/layout.gif) | k2-checklist-flatroof-en--2---1-.pdf | 2022-10-14 12:27 | 342K | |
![[ ]](/icons/layout.gif) | k2-crosshook-2-set-layout-datasheet---15-04-2021.pdf | 2023-03-16 10:39 | 60K | |
![[ ]](/icons/layout.gif) | k2-declaration-of-performance---23-04-2015.pdf | 2024-02-07 09:35 | 712K | |
![[ ]](/icons/layout.gif) | k2-guarantee-terms--31-10-2019--1-.pdf | 2022-09-26 09:26 | 42K | |
![[ ]](/icons/layout.gif) | k2-guarantee-terms--31-10-2019.pdf | 2024-02-07 09:35 | 42K | |
![[ ]](/icons/layout.gif) | k2-iso-certificate---09-03-2020-1.pdf | 2021-11-22 13:30 | 208K | |
![[ ]](/icons/layout.gif) | k2-pitched-roof-systems-en.pdf | 2021-11-29 15:17 | 8.9M | |
![[ ]](/icons/layout.gif) | k2-rf-flat-dr-p1000074-07-2017-1.pdf | 2024-05-17 07:51 | 52K | |
![[ ]](/icons/layout.gif) | k2-rf-vario2-p1000107-003-07-2017.pdf | 2022-08-03 08:02 | 67K | |
![[ ]](/icons/layout.gif) | k2-solidrail-hangerbolt-assembly---10-09-2020.pdf | 2022-09-26 09:25 | 3.5M | |
![[ ]](/icons/layout.gif) | k30-rf.pdf | 2024-04-18 09:12 | 1.6M | |
![[ ]](/icons/layout.gif) | katko---kem-4200c-yr-mf11.pdf | 2023-07-19 16:05 | 738K | |
![[ ]](/icons/layout.gif) | klefr-691x-full-user-manual-v2.18.pdf | 2021-11-26 13:44 | 5.7M | |
![[ ]](/icons/layout.gif) | kltm-g2datasheet.pdf | 2018-11-06 10:25 | 1.1M | |
![[ ]](/icons/layout.gif) | kn-isolator-datasheet.pdf | 2017-05-19 17:23 | 801K | |
![[ ]](/icons/layout.gif) | kraus-naimer-20a-ac.pdf | 2017-05-19 17:23 | 212K | |
![[ ]](/icons/layout.gif) | kraus-naimer-new204p-datasheet.pdf | 2017-05-19 17:23 | 358K | |
![[ ]](/icons/layout.gif) | kraus-naimer-notes.pdf | 2017-05-19 17:23 | 62K | |
![[ ]](/icons/layout.gif) | krausandnaimerdatasheet.pdf | 2019-10-21 11:20 | 732K | |
![[ ]](/icons/layout.gif) | krausnaimerdatasheet.pdf | 2022-07-29 14:47 | 218K | |
![[ ]](/icons/layout.gif) | kseries-factsheet-v1.pdf | 2024-06-11 09:14 | 2.6M | |
![[ ]](/icons/layout.gif) | ktl-xdatasheet.pdf | 2018-11-06 10:28 | 1.3M | |
![[ ]](/icons/layout.gif) | kurzanleitung-f-r-huawei-sun2000-10ktl-m1-wechselrichter.pdf | 2024-03-25 11:15 | 3.3M | |
![[ ]](/icons/layout.gif) | kurzanleitung-fuer-huawei-sun2000-450w-p2-optimizer-englisch.pdf | 2022-08-04 10:44 | 1.0M | |
![[ ]](/icons/layout.gif) | kurzanleitung-huawei-smartlogger3000a01eu--1-.pdf | 2022-02-23 10:38 | 2.2M | |
![[ ]](/icons/layout.gif) | kurzanleitung-huawei-smartpowersensor-ddsu666-h.pdf | 2023-03-14 17:19 | 373K | |
![[ ]](/icons/layout.gif) | kurzanleitung-huawei-smartpowersensor-dtsu666-h.pdf | 2021-10-19 16:38 | 764K | |
![[ ]](/icons/layout.gif) | kurzanleitung-huawei-sun2000-12ktl-m2.pdf | 2022-02-09 08:02 | 3.0M | |
![[ ]](/icons/layout.gif) | kurzanleitung-huawei-sun2000-20ktl-m2.pdf | 2021-12-02 10:02 | 3.0M | |
![[ ]](/icons/layout.gif) | kurzanleitung-huawei-sun2000-60ktl-m0.pdf | 2021-09-27 15:59 | 3.1M | |
![[ ]](/icons/layout.gif) | l-gi-le-pm-t-pmd-059-f128-lr-5-54-htb-415-435-m-v1-30-30-and-15-frame-explorer-v19-5c087cf07a.pdf | 2024-01-10 16:20 | 2.8M | |
![[ ]](/icons/layout.gif) | l1-declaration-for-ena-erec-g100-requirements---for-single-phase-inverter.pdf | 2022-08-18 13:46 | 337K | |
![[ ]](/icons/layout.gif) | laminate-solar-installation-guide.pdf | 2016-09-12 11:31 | 1.8M | |
![[ ]](/icons/layout.gif) | landatu-manual-assembly.pdf | 2024-06-13 10:52 | 1.5M | |
![[ ]](/icons/unknown.gif) | landatu datasheet | 2024-06-13 10:53 | 196K | |
![[ ]](/icons/unknown.gif) | landatu landblock datasheet | 2024-06-13 10:54 | 196K | |
![[ ]](/icons/layout.gif) | landis-e230-brochure.pdf | 2017-06-28 12:15 | 1.6M | |
![[ ]](/icons/layout.gif) | landis-e230-manual.pdf | 2017-06-28 12:16 | 1.1M | |
![[ ]](/icons/layout.gif) | landis-e230-mid-cert.pdf | 2017-06-28 12:16 | 482K | |
![[ ]](/icons/layout.gif) | landis-e350-datasheet.pdf | 2018-02-09 09:28 | 517K | |
![[ ]](/icons/layout.gif) | landstar_datasheet.pdf | 2016-09-12 11:31 | 618K | |
![[ ]](/icons/layout.gif) | landstar_manual.pdf | 2016-09-12 11:31 | 328K | |
![[ ]](/icons/layout.gif) | lcd-schema-klefr-691x-v2.18.pdf | 2021-11-26 13:46 | 3.9M | |
![[ ]](/icons/layout.gif) | le-450-brochure-webversion-july2015.pdf | 2016-09-12 11:31 | 652K | |
![[ ]](/icons/layout.gif) | le-v50_datasheet.pdf | 2016-08-18 16:05 | 743K | |
![[ ]](/icons/layout.gif) | lead-zero-data-sheet.pdf | 2024-05-29 12:05 | 4.1M | |
![[ ]](/icons/layout.gif) | leaflet-heat-exchanger-protection.pdf | 2023-05-04 12:43 | 393K | |
![[ ]](/icons/layout.gif) | leaflet-poluai-xt.pdf | 2023-05-04 12:44 | 2.9M | |
![[ ]](/icons/layout.gif) | lee-m2-120w---b.pdf | 2024-01-30 14:27 | 819K | |
![[ ]](/icons/layout.gif) | lg-325-340-neon2-black-datasheet.pdf | 2020-06-02 10:48 | 476K | |
![[ ]](/icons/layout.gif) | lg-325-340-neon2-black-manual.pdf | 2020-06-02 10:48 | 1.9M | |
![[ ]](/icons/layout.gif) | lg-325-datasheet.pdf | 2019-04-24 13:10 | 493K | |
![[ ]](/icons/layout.gif) | lg-370-ce-cert.pdf | 2020-06-01 14:53 | 243K | |
![[ ]](/icons/layout.gif) | lg-370-manual.pdf | 2020-06-01 14:52 | 5.7M | |
![[ ]](/icons/layout.gif) | lg-370-mcs-cert.pdf | 2020-06-01 14:53 | 834K | |
![[ ]](/icons/layout.gif) | lg-chem-10-hv-spec.pdf | 2018-03-01 17:08 | 251K | |
![[ ]](/icons/layout.gif) | lg-chem-battery-installation-manual.pdf | 2017-05-19 17:23 | 2.9M | |
![[ ]](/icons/layout.gif) | lg-chem-battery-warranty.pdf | 2017-05-19 17:23 | 234K | |
![[ ]](/icons/layout.gif) | lg-chem-hv-warranty.pdf | 2018-03-01 17:13 | 244K | |
![[ ]](/icons/layout.gif) | lg-chem-resu-datasheet.pdf | 2017-05-19 17:23 | 1.3M | |
![[ ]](/icons/layout.gif) | lg-chem-storedge-hv-manual.pdf | 2018-03-01 17:13 | 2.0M | |
![[ ]](/icons/layout.gif) | lg-chem-troubleshooting.pdf | 2018-03-01 17:07 | 4.7M | |
![[ ]](/icons/layout.gif) | lg-datasheet-neon2-320-325-330.pdf | 2019-09-23 09:03 | 497K | |
![[ ]](/icons/layout.gif) | lg-neon2-black-warranty.pdf | 2020-06-02 10:49 | 487K | |
![[ ]](/icons/layout.gif) | lg-neonr-datasheet-360-365-370-375.pdf | 2019-09-23 09:31 | 516K | |
![[ ]](/icons/layout.gif) | lg-solar-2020.pdf | 2020-05-14 15:09 | 6.2M | |
![[ ]](/icons/layout.gif) | lg02.0222_neon2_bifacial_390_395_siegel_en_1805_rz.pdf | 2019-01-29 15:52 | 511K | |
![[ ]](/icons/layout.gif) | lgchem-wiring-schematic.pdf | 2017-05-19 17:23 | 181K | |
![[ ]](/icons/layout.gif) | lgile-pm--t-pmd-059-f123--lr5-66hih-490-510m-35-35-15black-frame--v18--1-.pdf | 2023-07-24 15:03 | 2.2M | |
![[ ]](/icons/layout.gif) | lgile-pm--t-pmd-059-f128-lr5-54htb-415-435m-v1-30-30-15frame-explorer--v19-black-draft--compressed.pdf | 2023-09-07 13:03 | 192K | |
![[ ]](/icons/layout.gif) | lgile-pm--t-pmd-059-f130--lr5-54hth-420-440m-v1-30-30-15black-frame-explorer--v19-compressed.pdf | 2024-02-12 15:06 | 256K | |
![[ ]](/icons/layout.gif) | lgile-pm--t-pmd-059-f130--lr5-54hth-420-440m-v1-30-30-15black-frame-explorer--v19-en.pdf-compressed.pdf | 2023-09-07 12:23 | 256K | |
![[ ]](/icons/layout.gif) | lgile-t-tmd-059-104--lr4-72hih-440-460m--v13--6-.pdf | 2022-02-16 15:37 | 4.1M | |
![[ ]](/icons/layout.gif) | lgile-t-tmd-059-109-lr4-66hph-405-425m--v13.pdf | 2021-09-28 17:03 | 4.0M | |
![[ ]](/icons/layout.gif) | libbi-datasheet-25.07.pdf | 2023-07-26 17:19 | 246K | |
![[ ]](/icons/layout.gif) | libbi-datasheet-rev-2-18-october-2022.pdf | 2022-10-28 15:49 | 252K | |
![[ ]](/icons/layout.gif) | libbi-datasheet-rev-6---24.03.2023--1-.pdf | 2023-07-17 17:41 | 246K | |
![[ ]](/icons/layout.gif) | libbi-datasheet-rev-6-24.03.2023.pdf | 2023-05-30 09:33 | 246K | |
![[ ]](/icons/layout.gif) | libbi-declaration-of-conformity-en-eu-signed.pdf | 2023-07-31 12:58 | 195K | |
![[ ]](/icons/layout.gif) | libbi-eess-installation-schematics.pdf | 2023-05-03 13:16 | 542K | |
![[ ]](/icons/layout.gif) | libbi-install-manual-rev-6-20.04.2023.pdf | 2023-08-01 09:18 | 4.9M | |
![[ ]](/icons/layout.gif) | libbi-user-operating-instructions-rev-5-20.04.2023.pdf | 2023-05-03 13:14 | 1.4M | |
![[ ]](/icons/layout.gif) | libbibatterydatasheet.pdf | 2023-07-31 12:56 | 246K | |
![[ ]](/icons/layout.gif) | libbiinverterdatasheet.pdf | 2023-07-31 12:56 | 246K | |
![[ ]](/icons/layout.gif) | libbiwarranty.pdf | 2023-05-03 13:16 | 70K | |
![[ ]](/icons/layout.gif) | limited-guarantee-11.09.19.pdf | 2022-12-16 10:27 | 51K | |
![[ ]](/icons/layout.gif) | limited-warranty-for-lon-gi-hi-mo-6-solar-modules-distributed-generation-market-8bf491979a--1-.pdf | 2024-03-25 13:13 | 1.1M | |
![[ ]](/icons/layout.gif) | limited-warranty-for-lon-gi-hi-mo-6-solar-modules-distributed-generation-market-8bf491979a.pdf | 2023-09-08 11:27 | 1.1M | |
![[ ]](/icons/layout.gif) | limited-warranty-for-lon-gi-pv-modules-he-single-glass-series-en-20220325-0bae43f418.pdf | 2023-07-28 11:54 | 918K | |
![[ ]](/icons/layout.gif) | limited-warranty-for-lon-gi-pv-modules-he-single-glass-series-utility-202305-5f31780484.pdf | 2023-06-21 11:15 | 969K | |
![[ ]](/icons/layout.gif) | limited-warranty-supplement-25-year-product-warranty-for-vertex-s--all-1.1-signed.pdf | 2024-07-19 14:07 | 278K | |
![[ ]](/icons/layout.gif) | lithium-conversion-kit.pdf | 2024-01-19 15:52 | 158K | |
![[ ]](/icons/layout.gif) | longi-54HIH-warrenty.pdf | 2022-05-16 10:52 | 918K | |
![[ ]](/icons/layout.gif) | longi-60HPB-345-370w-datasheet-v11.pdf | 2020-10-02 10:19 | 2.1M | |
![[ ]](/icons/layout.gif) | longi-60hpb-345-370w-datasheet-v11--2-.pdf | 2022-04-13 12:33 | 2.1M | |
![[ ]](/icons/layout.gif) | longi-60hpb-345-370w-datasheet-v11.pdf | 2021-03-15 11:22 | 2.1M | |
![[ ]](/icons/layout.gif) | longi-295-315-datasheet.pdf | 2020-01-17 10:13 | 2.8M | |
![[ ]](/icons/layout.gif) | longi-300-305-datasheet.pdf | 2020-01-29 10:35 | 2.1M | |
![[ ]](/icons/layout.gif) | longi-300w-datasheet.pdf | 2019-11-18 14:47 | 2.1M | |
![[ ]](/icons/layout.gif) | longi-320-mcs-20200120.pdf | 2020-05-29 16:43 | 2.1M | |
![[ ]](/icons/layout.gif) | longi-345-360w-datasheet.pdf | 2020-02-27 17:28 | 1.5M | |
![[ ]](/icons/layout.gif) | longi-350-380-himo4-mono-datasheet.pdf | 2020-06-02 16:08 | 2.1M | |
![[ ]](/icons/layout.gif) | longi-350-380-splitcell-datasheet.pdf | 2020-03-05 13:16 | 4.8M | |
![[ ]](/icons/layout.gif) | longi-350-split-cell.pdf | 2020-02-10 16:22 | 1.6M | |
![[ ]](/icons/layout.gif) | longi-350w-datasheet.pdf | 2020-01-22 15:37 | 1.5M | |
![[ ]](/icons/layout.gif) | longi-365w-datasheet.pdf | 2020-01-22 15:47 | 1.5M | |
![[ ]](/icons/layout.gif) | longi-370-375-mcs-cert-20200522.pdf | 2021-02-18 16:38 | 1.5M | |
![[ ]](/icons/layout.gif) | longi-395-315-datasheet.pdf | 2020-01-17 10:11 | 2.8M | |
![[ ]](/icons/layout.gif) | longi-445-450-mcs-certificate.pdf | 2021-07-09 13:37 | 1.5M | |
![[ ]](/icons/layout.gif) | longi-450-datasheet--1-.pdf | 2021-04-22 15:21 | 1.3M | |
![[ ]](/icons/layout.gif) | longi-450-datasheet.pdf | 2021-02-24 15:47 | 1.3M | |
![[ ]](/icons/layout.gif) | longi-code.pdf | 2021-04-27 14:53 | 356K | |
![[ ]](/icons/layout.gif) | longi-company-brochure.pdf | 2021-02-24 15:48 | 2.5M | |
![[ ]](/icons/layout.gif) | longi-csr.pdf | 2021-05-10 16:20 | 18M | |
![[ ]](/icons/layout.gif) | longi-datasheet-lr4-60-hpb-345-375m-20201231.pdf | 2021-03-09 15:12 | 744K | |
![[ ]](/icons/layout.gif) | longi-datasheet-lr5-54hibd-410m.pdf | 2023-10-12 16:29 | 2.3M | |
![[ ]](/icons/layout.gif) | longi-hib-datasheet.pdf | 2021-09-29 13:32 | 4.1M | |
![[ ]](/icons/layout.gif) | longi-hih-datasheet-q421.pdf | 2021-09-29 14:00 | 1.0M | |
![[ ]](/icons/layout.gif) | longi-hih-hib-mcs.pdf | 2021-09-29 12:55 | 2.3M | |
![[ ]](/icons/layout.gif) | longi-himo4-and-gse-compatibility.pdf | 2021-01-15 12:47 | 60K | |
![[ ]](/icons/layout.gif) | longi-hpb-410w.pdf | 2023-11-17 14:23 | 1.0M | |
![[ ]](/icons/layout.gif) | longi-install-manual.pdf | 2018-12-18 14:12 | 827K | |
![[ ]](/icons/layout.gif) | longi-instillation-manual.pdf | 2020-03-02 15:09 | 1.8M | |
![[ ]](/icons/layout.gif) | longi-labour-statement.pdf | 2021-04-27 14:53 | 167K | |
![[ ]](/icons/layout.gif) | longi-lr4-60hpb-345-365-datasheet.pdf | 2020-05-14 16:59 | 1.6M | |
![[ ]](/icons/layout.gif) | longi-lr4-60hpb-345-365-full-black-datasheet.pdf | 2020-03-02 15:00 | 1.6M | |
![[ ]](/icons/layout.gif) | longi-lr4-60hph-350-370-black-frame-datasheet.pdf | 2020-03-02 15:01 | 1.9M | |
![[ ]](/icons/layout.gif) | longi-lr5hib-400w.pdf | 2022-05-12 16:44 | 1.2M | |
![[ ]](/icons/layout.gif) | longi-lr5hib.pdf | 2022-06-29 17:14 | 1.2M | |
![[ ]](/icons/layout.gif) | longi-lr5hih-datasheet.pdf | 2022-06-29 17:01 | 793K | |
![[ ]](/icons/layout.gif) | longi-lr6-60-datasheet.pdf | 2019-11-07 12:45 | 2.1M | |
![[ ]](/icons/layout.gif) | longi-lr6-60hpb-300-320-full-black.pdf | 2020-03-02 15:07 | 3.2M | |
![[ ]](/icons/layout.gif) | longi-lr6-60hph-305-325-black-frame.pdf | 2020-03-02 15:06 | 4.3M | |
![[ ]](/icons/layout.gif) | longi-manual2.pdf | 2021-11-02 14:59 | 3.9M | |
![[ ]](/icons/layout.gif) | longi-mcs-cert.pdf | 2020-06-01 14:05 | 2.1M | |
![[ ]](/icons/layout.gif) | longi-mcs-certificate.pdf | 2018-12-18 14:12 | 420K | |
![[ ]](/icons/layout.gif) | longi-mcs.pdf | 2022-04-21 10:49 | 2.3M | |
![[ ]](/icons/layout.gif) | longi-salt-mist-report.pdf | 2019-04-26 12:48 | 953K | |
![[ ]](/icons/layout.gif) | longi-split-cell-295-315w-datasheet.pdf | 2019-10-15 12:05 | 2.8M | |
![[ ]](/icons/unknown.gif) | longi-warranty-2020-new | 2020-01-13 09:08 | 423K | |
![[ ]](/icons/layout.gif) | longi-warranty-2020-new.pdf | 2021-04-22 15:22 | 423K | |
![[ ]](/icons/layout.gif) | longi-warranty-v09-12-years.pdf | 2020-09-18 12:08 | 424K | |
![[ ]](/icons/layout.gif) | longi-warranty-v8-18092020.pdf | 2020-09-18 12:06 | 423K | |
![[ ]](/icons/layout.gif) | longi-warranty.pdf | 2020-05-26 17:05 | 424K | |
![[ ]](/icons/layout.gif) | longi-webinar-pres.pdf | 2020-05-01 17:13 | 3.6M | |
![[ ]](/icons/unknown.gif) | longi54HTB430 | 2024-02-20 10:50 | 2.3M | |
![[ ]](/icons/unknown.gif) | longi305-325blackframe | 2021-01-13 14:45 | 4.3M | |
![[ ]](/icons/layout.gif) | longi320hph.pdf | 2019-10-21 16:31 | 3.9M | |
![[ ]](/icons/layout.gif) | lora-2022-manual.pdf | 2023-11-27 14:50 | 1.1M | |
![[ ]](/icons/layout.gif) | lora-b2-433mhz-user-manual-heyuan-intelligence.pdf | 2023-05-16 13:55 | 787K | |
![[ ]](/icons/layout.gif) | lora-manual-2023.pdf | 2023-08-22 15:44 | 186K | |
![[ ]](/icons/layout.gif) | lora-manual.pdf | 2020-01-08 15:21 | 5.5M | |
![[ ]](/icons/layout.gif) | lora-user-manual.pdf | 2020-01-08 15:20 | 5.5M | |
![[ ]](/icons/layout.gif) | lorab1-usermanual.pdf | 2023-11-23 10:04 | 727K | |
![[ ]](/icons/layout.gif) | low-voltage-energy-storage-system--20lv030904-1---2-.pdf | 2021-03-26 11:59 | 644K | |
![[ ]](/icons/layout.gif) | lr5-54htb-410-430m--30-30-15frame-explorer--v18-black.pdf | 2023-09-13 09:46 | 719K | |
![[ ]](/icons/layout.gif) | lr5-54htb-415-435m-v1-30-30-15frame-explorer--v19-1-.pdf | 2023-09-08 10:58 | 1.0M | |
![[ ]](/icons/layout.gif) | lr5-54htb-415-435m-v1-30-30-15frame-explorer--v19-black---europe-only-compressed--1---2-.pdf | 2024-04-16 12:02 | 195K | |
![[ ]](/icons/layout.gif) | lr5-54htb-415-435m-v1-30-30-15frame-explorer--v19-black---europe-only-compressed--1-.pdf | 2024-02-12 15:11 | 195K | |
![[ ]](/icons/layout.gif) | lr5-54hth-415-435m--30-30-15black-frame-explorer--v18.pdf | 2023-09-13 09:47 | 737K | |
![[ ]](/icons/layout.gif) | lr5-66hth-520-540m--35-35-15frame-explorer--v19-compressed.pdf | 2023-12-14 09:34 | 923K | |
![[ ]](/icons/layout.gif) | ls-e-eu-sms-el-v2.0.pdf | 2019-04-30 09:29 | 659K | |
![[ ]](/icons/layout.gif) | ls-epd-sms-el-v1.1.pdf | 2019-08-14 11:23 | 229K | |
![[ ]](/icons/layout.gif) | ls0512-datasheet.pdf | 2016-09-12 11:31 | 296K | |
![[ ]](/icons/layout.gif) | luna2000--5-30--s0-user-manual.pdf | 2022-12-05 14:12 | 7.2M | |
![[ ]](/icons/layout.gif) | luna2000-7-14-21-s1-quick-guide.pdf | 2024-05-16 16:03 | 1.6M | |
![[ ]](/icons/layout.gif) | luna2000-7-14-21-s1-user-manual.pdf | 2024-05-16 16:02 | 9.3M | |
![[ ]](/icons/layout.gif) | luna2000-71421-s1-datasheet-20240130.pdf | 2024-04-16 10:09 | 284K | |
![[ ]](/icons/layout.gif) | lv-hub-communication-hub-product-manual-updating.pdf | 2024-01-23 15:30 | 2.2M | |
![[ ]](/icons/layout.gif) | lv-hub-communication-hub-product-manual.pdf | 2020-01-17 16:05 | 1.1M | |
![[ ]](/icons/layout.gif) | lvl---msds-2021.pdf | 2022-06-24 13:25 | 546K | |
![[ ]](/icons/layout.gif) | lvs---msds-2021.pdf | 2022-02-02 16:57 | 546K | |
![[ ]](/icons/layout.gif) | lynx-dc-distribution-2018-06-25.pdf | 2018-11-23 12:58 | 41K | |
![[ ]](/icons/layout.gif) | lynx-dc-distribution-system--2-.pdf | 2020-05-12 12:53 | 6.8M | |
![[ ]](/icons/layout.gif) | lynx-dc-distribution-system.pdf | 2020-05-12 12:47 | 6.8M | |
![[ ]](/icons/layout.gif) | lynx-distributor-1000a.pdf | 2020-05-12 12:47 | 216K | |
![[ ]](/icons/layout.gif) | lynx-distributor-en.pdf | 2022-05-04 17:02 | 3.1M | |
![[ ]](/icons/layout.gif) | lynx-power-in-1000a.pdf | 2020-05-12 12:54 | 216K | |
![[ ]](/icons/layout.gif) | m8---17mm---mech-chem-analysis--s-2101-189-signed--1-.pdf | 2024-02-07 09:09 | 415K | |
![[ ]](/icons/layout.gif) | m8-bolt.pdf | 2024-02-07 09:09 | 133K | |
![[ ]](/icons/layout.gif) | m240020-8-panel-2-in-p-packing-list--1-.pdf | 2024-02-01 11:35 | 51K | |
![[ ]](/icons/layout.gif) | m240021-12-panel-2-in-p-packing-list--2---1-.pdf | 2024-02-01 11:23 | 51K | |
![[ ]](/icons/layout.gif) | m240021-12-panel-2-in-p-packing-list--2---2-.pdf | 2024-02-01 11:37 | 52K | |
![[ ]](/icons/layout.gif) | m240022-16-panel-2-in-p-packing-list--1-.pdf | 2024-02-01 11:27 | 52K | |
![[ ]](/icons/layout.gif) | m240065-18-panel-2-in-p-packing-list--1-.pdf | 2024-02-01 11:32 | 52K | |
![[ ]](/icons/layout.gif) | mangrove-action-project.pdf | 2022-12-07 12:28 | 166K | |
![[ ]](/icons/layout.gif) | manual-375wp-landscape-web-24.pdf | 2024-03-14 16:58 | 3.0M | |
![[ ]](/icons/layout.gif) | manual-375wp-landscape-web.pdf | 2023-07-05 10:49 | 3.0M | |
![[ ]](/icons/layout.gif) | manual-ac-current-sensor-en.pdf | 2020-02-12 12:51 | 93K | |
![[ ]](/icons/layout.gif) | manual-array-level-rapid-shutdown--p2-.pdf | 2022-05-04 15:55 | 1.2M | |
![[ ]](/icons/layout.gif) | manual-asw-3k-20k-lt-g2-pro-en-1--1-.pdf | 2024-01-26 12:32 | 1.7M | |
![[ ]](/icons/layout.gif) | manual-bluesolar-pwm-duo-12v-24v-20a-lcd-usb-en-nl-fr-de-es-se-it-cz-ru.pdf | 2022-03-17 15:21 | 1.1M | |
![[ ]](/icons/layout.gif) | manual-bluesolar-pwm-pro-setup-and-monitoring-software-en.pdf | 2020-02-13 15:15 | 1.0M | |
![[ ]](/icons/layout.gif) | manual-buck-boost-dc-dc-converter-en-nl-fr-de-se-ru.pdf | 2021-07-13 15:37 | 2.1M | |
![[ ]](/icons/layout.gif) | manual-cerbo-gx-en.pdf | 2020-02-18 13:51 | 4.9M | |
![[ ]](/icons/layout.gif) | manual-cyrix-li-ion-230-a-en.pdf | 2020-02-05 17:21 | 250K | |
![[ ]](/icons/layout.gif) | manual-easysolar-1600-en-nl-fr-de-es-it.pdf | 2022-12-13 15:16 | 1.7M | |
![[ ]](/icons/layout.gif) | manual-easysolar-ii-gx-en-nl-fr-de-es-se-it.pdf | 2020-02-04 17:05 | 2.7M | |
![[ ]](/icons/layout.gif) | manual-galvanic-isolator-en-nl-fr-de-es-tr-.pdf | 2020-06-16 08:41 | 432K | |
![[ ]](/icons/layout.gif) | manual-growatt-spa1000-3000tl-bl.pdf | 2020-11-11 17:19 | 6.8M | |
![[ ]](/icons/layout.gif) | manual-huawei-600w-p-optimiser.pdf | 2022-08-03 15:59 | 623K | |
![[ ]](/icons/layout.gif) | manual-instrucciones-inversor-solar-sofar-hyd-ep.pdf | 2023-06-06 17:25 | 7.0M | |
![[ ]](/icons/layout.gif) | manual-inverter-3k-5k-230v-ve-bus-enabled--firmware-xxxx4xx--en-nl-fr-de-es-se-it--1-.pdf | 2024-06-05 11:24 | 1.9M | |
![[ ]](/icons/layout.gif) | manual-mppt-control-a4-en.pdf | 2016-09-12 11:31 | 335K | |
![[ ]](/icons/layout.gif) | manual-multiplus-3k-230v-16a-50a--firmware-xxxx4xx--en-nl-fr-de-es-se.pdf | 2022-12-13 15:48 | 2.2M | |
![[ ]](/icons/layout.gif) | manual-multiplus-500va-1200va-en-nl-fr-de-es-it.pdf | 2023-07-20 17:17 | 1.6M | |
![[ ]](/icons/layout.gif) | manual-multiplus-1600va-en-nl-fr-de-es-it.pdf | 2021-06-30 15:56 | 1.5M | |
![[ ]](/icons/layout.gif) | manual-multiplus-compact-800-1200-1600-en-nl-fr-de-es.pdf | 2020-02-05 10:04 | 1.6M | |
![[ ]](/icons/layout.gif) | manual-multiplus-compact-2000-230v-en-nl-fr-de-es.pdf | 2021-06-30 16:04 | 1.6M | |
![[ ]](/icons/layout.gif) | manual-multiplus-ii-24v-48v-3k-and-5k-230v-en-nl-fr-de-es-se-it-.pdf | 2020-02-04 15:15 | 3.3M | |
![[ ]](/icons/layout.gif) | manual-multiplus-ii-24v-48v-3k-and-5k-230v-en-nl-fr-de-es-se-it.pdf | 2020-05-12 14:01 | 3.4M | |
![[ ]](/icons/layout.gif) | manual-multiplus-ii-48v-3k-230v-32a-en-nl-fr-de-es-se.pdf | 2018-11-01 10:59 | 2.6M | |
![[ ]](/icons/layout.gif) | manual-multiplus-ii-gx-en-nl-fr-de-es-se-it.pdf | 2020-05-12 14:10 | 2.7M | |
![[ ]](/icons/layout.gif) | manual-multiplus-ii-gx-en.pdf | 2022-12-13 16:01 | 3.4M | |
![[ ]](/icons/layout.gif) | manual-orion-dc-dc-converters-non-isolated-2412-25a-en-nl-fr-de-it-pt-es.pdf | 2021-07-13 15:31 | 86K | |
![[ ]](/icons/layout.gif) | manual-orion-dc-dc-converters-non-isolated-2412-40a-en-nl-fr-de-it-pt-es.pdf | 2021-07-13 15:31 | 92K | |
![[ ]](/icons/layout.gif) | manual-orion-dc-dc-converters-non-isolated-2412-70a-en-nl-fr-de-it-pt-es.pdf | 2021-07-13 15:32 | 69K | |
![[ ]](/icons/layout.gif) | manual-orion-tr-isolated-dc-dc-converters-en-fr-nl-es-it-de-.pdf | 2021-07-13 15:19 | 553K | |
![[ ]](/icons/layout.gif) | manual-orion-tr-isolated-dc-dc-converters-en-fr-nl-es-it-de.pdf | 2024-04-15 13:43 | 550K | |
![[ ]](/icons/layout.gif) | manual-orion-tr-smart-charger-isolated-en-nl-fr-de-es-se-it.pdf | 2020-02-05 13:46 | 1.4M | |
![[ ]](/icons/layout.gif) | manual-pebs-dc-miniature-circuit-breaker.pdf | 2022-08-12 11:54 | 582K | |
![[ ]](/icons/layout.gif) | manual-phoenix-inverter-smart-1600-3000-en-nl-fr-de-es-se.pdf | 2020-02-04 15:44 | 1.1M | |
![[ ]](/icons/layout.gif) | manual-phoenix-inverter-ve.direct-250va-1200va-en-nl-fr-de-es-it.pdf | 2021-05-21 16:15 | 1.5M | |
![[ ]](/icons/layout.gif) | manual-quattro-3k-50-30a-230v-en-nl-fr-de-es-se.pdf | 2017-05-19 17:23 | 2.1M | |
![[ ]](/icons/layout.gif) | manual-quattro-5k-8k-10k-15k-100-100a-230v--firmware-xxxx4xx--en-nl-fr-de-es-se-it.pdf | 2020-05-12 13:54 | 2.6M | |
![[ ]](/icons/layout.gif) | manual-remote-panel-for-bluesolar-pwm-pro-charge-controller-en-a5.pdf | 2020-02-12 13:42 | 611K | |
![[ ]](/icons/layout.gif) | manual-smart-battery-protect-48v-100-a-en-nl-fr-sv-de-pt-es-it-tr.pdf | 2021-05-19 14:09 | 1.2M | |
![[ ]](/icons/layout.gif) | manual-smartsolar-charge-controller-mppt-75-10-75-15-100-15-100-20-en-nl-fr-de-es-se-ul.pdf | 2017-10-02 17:08 | 946K | |
![[ ]](/icons/layout.gif) | manual-smartsolar-charge-controller-mppt-150-35-en-nl-fr-de-es-se.pdf | 2020-05-11 11:40 | 942K | |
![[ ]](/icons/layout.gif) | manual-smartsolar-charge-controller-mppt-150-45-to-150-100---250-60-to-250-100-en-nl-fr-de-es-se--1-.pdf | 2020-05-12 10:31 | 1.6M | |
![[ ]](/icons/layout.gif) | manual-smartsolar-charge-controller-mppt-150-45-to-150-100---250-60-to-250-100-en-nl-fr-de-es-se.pdf | 2020-05-11 14:19 | 1.6M | |
![[ ]](/icons/layout.gif) | manual-solis--7-8-k-5g.pdf | 2020-03-06 16:54 | 12M | |
![[ ]](/icons/layout.gif) | manual-soltaro-aio2-ins-v1.1-.pdf | 2021-04-19 19:12 | 835K | |
![[ ]](/icons/layout.gif) | manual-soltaro-aio2-ins-v1.1.pdf | 2021-05-20 10:23 | 1.1M | |
![[ ]](/icons/layout.gif) | manual-soltaro-hyper-lv-1p-eu1.08.pdf | 2021-11-16 11:09 | 1.5M | |
![[ ]](/icons/layout.gif) | manual-ve.direct-non-inverting-remote-on-off-cable-en.pdf | 2022-06-21 16:33 | 226K | |
![[ ]](/icons/layout.gif) | manual.pdf | 2022-08-03 10:03 | 623K | |
![[ ]](/icons/layout.gif) | manual_solis_w3wifi.pdf | 2022-06-21 10:38 | 2.3M | |
![[ ]](/icons/layout.gif) | manualmultiplus3k230v16a50afirmwarexxxx4xx.pdf | 2022-12-13 15:08 | 2.2M | |
![[ ]](/icons/unknown.gif) | manualmultiplusiiquattroii120v230v | 2022-12-13 14:48 | 7.9M | |
![[ ]](/icons/layout.gif) | manualsoltarolaio2-btlv-eu-v1.0-aio.pdf | 2021-04-19 19:14 | 1.0M | |
![[ ]](/icons/layout.gif) | marlec-iboost-returns-form.pdf | 2018-06-19 16:07 | 10K | |
![[ ]](/icons/layout.gif) | matebox-v2.0.pdf | 2022-08-31 16:38 | 1.1M | |
![[ ]](/icons/layout.gif) | material-safety-data-sheet-lithium-ion-batteries-en.pdf | 2022-02-02 16:36 | 275K | |
![[ ]](/icons/layout.gif) | material-safety-data-sheet-vrla-battery-en.pdf | 2022-02-02 16:47 | 227K | |
![[ ]](/icons/layout.gif) | matrix-tiles-roof-hooks-en.pdf | 2023-05-08 15:53 | 1.2M | |
![[ ]](/icons/layout.gif) | max-50-80ktl3-lv-datasheet-1.pdf | 2019-10-21 12:14 | 474K | |
![[ ]](/icons/layout.gif) | max-50-80ktl3-lv-datasheet-202305.pdf | 2023-11-09 17:11 | 2.6M | |
![[ ]](/icons/layout.gif) | max-50-100ktl3-lv-mv-quick-guide-en-202305.pdf | 2023-11-09 17:12 | 3.3M | |
![[ ]](/icons/layout.gif) | max-50-100ktl3-lv-mv-user-manual-en-202305--1-.pdf | 2024-01-15 15:56 | 5.4M | |
![[ ]](/icons/layout.gif) | max-100-150ktl3-x-lv-mv-quick-guide-en-202305.pdf | 2023-11-09 17:20 | 4.3M | |
![[ ]](/icons/layout.gif) | max-100-150ktl3-x-lv-mv-user-manual-en-202305.pdf | 2023-11-09 17:20 | 10M | |
![[ ]](/icons/layout.gif) | max100-125ktl3-x-lv-1-.pdf | 2023-03-20 12:26 | 1.3M | |
![[ ]](/icons/layout.gif) | mc-mcb---datasheet---cudis--1---1-.pdf | 2024-05-10 15:19 | 275K | |
![[ ]](/icons/layout.gif) | mc4-bulkhead-datasheet.pdf | 2019-11-28 09:57 | 332K | |
![[ ]](/icons/layout.gif) | mc4-datasheet.pdf | 2017-11-03 11:45 | 2.0M | |
![[ ]](/icons/layout.gif) | mc4-manual.pdf | 2019-11-28 09:32 | 589K | |
![[ ]](/icons/layout.gif) | mc4c-solar-cable-connector-data-sheet.pdf | 2021-05-25 13:23 | 154K | |
![[ ]](/icons/layout.gif) | mcg-metal-enclosure-2-module-datasheet.pdf | 2021-01-06 16:07 | 930K | |
![[ ]](/icons/layout.gif) | mcg-metal-enclosure-datasheet.pdf | 2020-09-18 08:42 | 1.4M | |
![[ ]](/icons/layout.gif) | mcs-cert-issue-12-trina-solar-1.pdf | 2021-06-21 12:11 | 1.0M | |
![[ ]](/icons/layout.gif) | mcs-cert-issue-12-trina-solar.pdf | 2020-08-10 13:57 | 1.0M | |
![[ ]](/icons/layout.gif) | mcs-certificate-8757-r1.pdf | 2019-07-03 11:16 | 1.7M | |
![[ ]](/icons/unknown.gif) | mcs-certificate-8757-r1pdf | 2019-07-03 11:17 | 1.7M | |
![[ ]](/icons/layout.gif) | mcs-certificate-eurener-updated-2024.pdf | 2023-05-10 09:35 | 796K | |
![[ ]](/icons/layout.gif) | mcs-certificate.pdf | 2022-01-14 09:46 | 694K | |
![[ ]](/icons/layout.gif) | mcs-cetification-fastensol-090920.pdf | 2020-09-09 09:10 | 687K | |
![[ ]](/icons/layout.gif) | mcs-pv0062-issue-22-hanwha-q-cells-22.12.2020.pdf | 2021-07-02 10:16 | 4.3M | |
![[ ]](/icons/layout.gif) | mcs-trina-01.04.2021.pdf | 2022-07-27 10:01 | 262K | |
![[ ]](/icons/layout.gif) | mcs012-ik0182-k2-solar-mounting-solutions.pdf | 2024-07-19 13:39 | 526K | |
![[ ]](/icons/layout.gif) | mcsbba0156i3-(1).pdf | 2017-05-19 17:23 | 302K | |
![[ ]](/icons/layout.gif) | md-mcb---datasheet---cudis.pdf | 2024-01-17 10:11 | 2.5M | |
![[ ]](/icons/layout.gif) | me-3000sp-uk-voc-g98.pdf | 2019-04-23 11:07 | 199K | |
![[ ]](/icons/layout.gif) | me3000-manual-20190929.pdf | 2020-05-13 10:50 | 1.7M | |
![[ ]](/icons/layout.gif) | me3000sp-g83-2.pdf | 2018-05-25 14:28 | 1.2M | |
![[ ]](/icons/layout.gif) | me3000sp-user-manual-1.7v.pdf | 2020-02-17 14:24 | 2.3M | |
![[ ]](/icons/layout.gif) | me3000sp-user-manual-v1.7-.pdf | 2019-10-30 08:53 | 2.2M | |
![[ ]](/icons/compressed.gif) | me3000sp-v3-10-firmware.zip | 2022-07-21 09:43 | 750K | |
![[ ]](/icons/layout.gif) | medecins-sans-frontieres.pdf | 2022-12-14 16:20 | 145K | |
![[ ]](/icons/layout.gif) | merc-1100-1300w-p-datasheet-new-20231212.pdf | 2024-06-07 14:07 | 228K | |
![[ ]](/icons/layout.gif) | merc-1300w-1100w-p-smart-pv-optimizer-quick-guide.pdf | 2023-05-25 16:49 | 1.1M | |
![[ ]](/icons/layout.gif) | mersen-helio-brochure.pdf | 2017-05-19 17:23 | 3.5M | |
![[ ]](/icons/layout.gif) | metasol-400mm-technical-datasheets-20200729.pdf | 2020-08-07 14:47 | 127K | |
![[ ]](/icons/layout.gif) | meyer-burger-1-0-1-installationguide-en.pdf | 2024-05-28 12:17 | 396K | |
![[ ]](/icons/layout.gif) | meyer-burger-2023-02-sales-cards-en.pdf | 2023-04-27 10:24 | 1.4M | |
![[ ]](/icons/layout.gif) | meyer-burger-brochure-en.pdf | 2023-04-27 10:27 | 2.4M | |
![[ ]](/icons/layout.gif) | meyer-burger-industries-manufacturer-declaration-gse-compatibility-2023-11-signed.pdf | 2023-11-16 16:54 | 256K | |
![[ ]](/icons/unknown.gif) | mi-300-hoymiles-microinverter-user-manual-v1.7.docx | 2018-11-26 10:12 | 1.1M | |
![[ ]](/icons/layout.gif) | mi-1000-mi-1200-microinverter-user-manual-v1.pdf | 2018-11-23 12:05 | 766K | |
![[ ]](/icons/layout.gif) | mi-1200-user-manual-v1.pdf | 2018-11-26 10:43 | 766K | |
![[ ]](/icons/layout.gif) | mi600-manual.pdf | 2018-11-23 15:45 | 951K | |
![[ ]](/icons/layout.gif) | mi600datasheet.pdf | 2018-11-23 15:49 | 68K | |
![[ ]](/icons/layout.gif) | mi1200datasheet.pdf | 2019-05-01 11:25 | 78K | |
![[ ]](/icons/layout.gif) | miasole-CIGS-flex-03n-datasheet.pdf | 2018-11-21 16:00 | 0 | |
![[ ]](/icons/layout.gif) | miasole-flex-03m_2.6m_datasheet_2.pdf | 2020-02-27 11:57 | 0 | |
![[ ]](/icons/layout.gif) | miasole-flex-03w_2.6m_datasheet_7.pdf | 2020-02-27 10:24 | 0 | |
![[ ]](/icons/layout.gif) | mic-750-3300tl-x-datasheet--1-.pdf | 2023-04-14 15:12 | 691K | |
![[ ]](/icons/layout.gif) | microinverter-specifications.pdf | 2021-10-12 15:48 | 2.7M | |
![[ ]](/icons/layout.gif) | microrail-assembly-en.pdf | 2021-11-22 13:52 | 1.9M | |
![[ ]](/icons/layout.gif) | mid-10-25ktl3-x-quick-guide-en-202305.pdf | 2023-11-09 17:02 | 2.0M | |
![[ ]](/icons/layout.gif) | mid-10-25ktl3-x-user-manual-en-202305.pdf | 2023-11-09 16:59 | 5.0M | |
![[ ]](/icons/layout.gif) | mid-10-40ktl3-x-user-manual-en-202305.pdf | 2024-05-22 16:01 | 3.8M | |
![[ ]](/icons/layout.gif) | mid-11-30ktl3-xh-datasheet-202307.pdf | 2023-12-20 15:37 | 781K | |
![[ ]](/icons/layout.gif) | mid-11-30ktl3-xh-quick-guide-en-202309.pdf | 2023-12-20 15:38 | 3.7M | |
![[ ]](/icons/layout.gif) | mid-11-30ktl3-xh-user-manual-en-202309.pdf | 2023-12-20 15:38 | 5.2M | |
![[ ]](/icons/layout.gif) | mid-15-25ktl3-x-datasheet-en-202309.pdf | 2023-11-09 16:56 | 809K | |
![[ ]](/icons/layout.gif) | mid-17-40ktl3-x-quick-guide-en-202305.pdf | 2024-05-22 16:01 | 2.1M | |
![[ ]](/icons/layout.gif) | mid-17-40ktl3-x-selfdeclaration-for-g100.pdf | 2022-09-15 10:38 | 521K | |
![[ ]](/icons/layout.gif) | mid-17-40ktl3-x-user-manual-1-.pdf | 2022-03-04 14:33 | 3.7M | |
![[ ]](/icons/layout.gif) | mid-25-40ktl3-x-datasheet.pdf | 2022-03-04 14:32 | 1.5M | |
![[ ]](/icons/layout.gif) | mid-25-40ktl3-x-eu-datasheet-en-202310.pdf | 2024-05-22 16:00 | 5.3M | |
![[ ]](/icons/layout.gif) | mid-25-40ktl3-x-quick-guide.pdf | 2022-03-04 14:33 | 3.9M | |
![[ ]](/icons/layout.gif) | mid-30-50ktl3-x2-datasheet-202307.pdf | 2023-08-01 17:08 | 4.7M | |
![[ ]](/icons/layout.gif) | mid-33-50ktl3-x2-quick-guide-en-202305.pdf | 2023-08-01 17:09 | 3.1M | |
![[ ]](/icons/layout.gif) | mid-33-50ktl3-x2-user-manual-en-202305.pdf | 2023-08-01 17:09 | 3.7M | |
![[ ]](/icons/layout.gif) | mid-50m-monocrystalline.pdf | 2018-04-16 11:54 | 116K | |
![[IMG]](/icons/image2.gif) | mid-200m-12v-monocrystalline-datasheet.jpg | 2018-06-29 11:06 | 394K | |
![[ ]](/icons/layout.gif) | mid-200m-datasheet.pdf | 2018-06-29 11:03 | 271K | |
![[ ]](/icons/layout.gif) | midsummer-code.pdf | 2021-04-27 16:06 | 167K | |
![[ ]](/icons/layout.gif) | midsummer-doncaster-cables-h6242y-datasheet.pdf | 2024-01-11 14:24 | 266K | |
![[ ]](/icons/layout.gif) | midsummer-energy-ltd-weee-cert.pdf | 2021-03-17 10:19 | 123K | |
![[ ]](/icons/layout.gif) | midsummer-energy-narrowboat-tilt-mount-instructions--1-.pdf | 2021-10-14 09:06 | 1.9M | |
![[ ]](/icons/layout.gif) | midsummer-energy-narrowboat-tilt-mount-instructions.pdf | 2021-05-24 16:18 | 1.9M | |
![[ ]](/icons/layout.gif) | midsummer-privacy-policy.pdf | 2018-11-16 12:45 | 35K | |
![[ ]](/icons/layout.gif) | midsummer-returns-policy-2023-04-v2.pdf | 2023-03-27 13:51 | 57K | |
![[ ]](/icons/layout.gif) | midsummer-returns-policy-2023-04.pdf | 2023-03-15 14:57 | 56K | |
![[ ]](/icons/layout.gif) | midsummer-returns-policy-2023-v5.pdf | 2023-09-25 10:11 | 76K | |
![[ ]](/icons/layout.gif) | midsummer-samsung-data.pdf | 2021-03-03 15:25 | 240K | |
![[ ]](/icons/layout.gif) | midsummer-weee-2023.pdf | 2023-02-23 13:38 | 123K | |
![[ ]](/icons/layout.gif) | mim-b19n-manual.pdf | 2022-05-23 10:16 | 6.9M | |
![[ ]](/icons/layout.gif) | mim-e03enusermanual.pdf | 2024-07-26 14:22 | 2.9M | |
![[ ]](/icons/layout.gif) | min-7-10ktl-x2-quick-guide-en.pdf | 2024-01-22 17:01 | 2.3M | |
![[ ]](/icons/layout.gif) | min-7-10ktl-x2-user-manual-en.pdf | 2024-01-22 17:01 | 3.8M | |
![[ ]](/icons/layout.gif) | min-2500-6000-tl-x-user-manual-general-en-202206.pdf | 2023-11-14 11:48 | 3.7M | |
![[ ]](/icons/layout.gif) | min-2500-6000-tl-xe-datasheet.pdf | 2021-11-25 16:27 | 6.3M | |
![[ ]](/icons/layout.gif) | min-2500-6000tl-x-datasheet.pdf | 2023-11-14 11:47 | 2.0M | |
![[ ]](/icons/layout.gif) | min-2500-6000tl-xh-quick-guide-en-202201.pdf | 2024-05-20 12:50 | 3.2M | |
![[ ]](/icons/layout.gif) | min-2500-6000tl-xh-user-manual-en-202201.pdf | 2024-05-20 12:51 | 5.0M | |
![[ ]](/icons/layout.gif) | min-7000-10000-tl-x2-eu.pdf | 2024-01-22 17:00 | 2.9M | |
![[ ]](/icons/layout.gif) | min2500-6000tl-xh-datasheet.pdf | 2023-12-05 13:10 | 8.3M | |
![[ ]](/icons/layout.gif) | mini_plama_wpl_a_hk_premium.pdf | 2022-01-24 11:56 | 4.7M | |
![[ ]](/icons/layout.gif) | minirail-assembly-en.pdf | 2021-09-03 15:02 | 2.8M | |
![[ ]](/icons/layout.gif) | minirail-infos-en.pdf | 2021-09-03 15:01 | 603K | |
![[ ]](/icons/layout.gif) | minirail-mk2-assembly-en--1-.pdf | 2022-12-14 16:42 | 3.2M | |
![[ ]](/icons/layout.gif) | mitsubishi-ecodan-4kw-datasheet-quhz-w40vha-aug2016.pdf | 2021-02-12 13:13 | 2.8M | |
![[ ]](/icons/layout.gif) | mitsubishi-ecodan-5kw-datasheet.pdf | 2021-02-12 15:48 | 2.9M | |
![[ ]](/icons/layout.gif) | mitsubishi-ecodan-6kw-datasheet.pdf | 2021-02-12 16:33 | 2.8M | |
![[ ]](/icons/layout.gif) | mixergy-installation-guide.pdf | 2021-02-05 16:58 | 1.7M | |
![[ ]](/icons/layout.gif) | mixergy-user-guide.pdf | 2021-02-05 17:07 | 12M | |
![[ ]](/icons/layout.gif) | ml-g9-blk-datasheet.pdf | 2021-11-08 11:33 | 0 | |
![[ ]](/icons/layout.gif) | ml33rta--1-.pdf | 2023-07-17 10:12 | 501K | |
![[ ]](/icons/layout.gif) | mnl-solax-chint-3-phase-dtsu666-ct-en-1.pdf | 2023-01-24 09:38 | 743K | |
![[ ]](/icons/layout.gif) | mod-3-6ktl3-x-quick-guide-en-202201.pdf | 2023-11-09 16:41 | 3.9M | |
![[ ]](/icons/layout.gif) | mod-3-10ktl3-xh-datasheet.pdf | 2022-01-21 16:55 | 3.0M | |
![[ ]](/icons/layout.gif) | mod-3-10ktl3-xh-quick-guide-en-202310--2-.pdf | 2024-06-03 11:06 | 5.1M | |
![[ ]](/icons/layout.gif) | mod-3-10ktl3-xh-quick-guide-en-202310.pdf | 2024-05-31 11:11 | 5.1M | |
![[ ]](/icons/layout.gif) | mod-3-10ktl3-xh-user-manual-en-202310.pdf | 2024-05-29 09:05 | 4.7M | |
![[ ]](/icons/layout.gif) | mod-3-15ktl3-x-quick-guide.pdf | 2022-01-21 16:58 | 2.5M | |
![[ ]](/icons/layout.gif) | mod-3-15ktl3-x-user-manual-en-202201.pdf | 2023-11-09 16:50 | 4.7M | |
![[ ]](/icons/layout.gif) | mod-3-15ktl3-x-user-manual.pdf | 2022-01-21 16:59 | 4.4M | |
![[ ]](/icons/layout.gif) | mod-3-15ktl3-xh-user-en-202201.pdf.pdf | 2023-12-20 12:40 | 4.7M | |
![[ ]](/icons/layout.gif) | mod-3-15ktl3-xh-user-manual-en-202201.pdf.pdf | 2023-12-20 12:39 | 2.9M | |
![[ ]](/icons/layout.gif) | mod-7-15ktl3-x-quick-guide-en-202201.pdf | 2023-11-09 16:44 | 4.4M | |
![[ ]](/icons/layout.gif) | mod-10-15ktl3-x-datasheet.pdf | 2022-01-24 14:55 | 3.5M | |
![[ ]](/icons/layout.gif) | mod-3000-9000tl3-x-datasheet.pdf | 2022-01-24 12:04 | 3.0M | |
![[ ]](/icons/layout.gif) | mod-3000-10000tl3-xh-ark-xh-battery--2-.pdf | 2024-06-03 11:06 | 2.7M | |
![[ ]](/icons/layout.gif) | mod-3000-10000tl3-xh-ark-xh-battery.pdf | 2024-05-31 11:11 | 2.7M | |
![[ ]](/icons/layout.gif) | mod-3000-10000tl3-xh-backup-apx-hv-battery.pdf | 2023-12-21 12:06 | 2.7M | |
![[ ]](/icons/layout.gif) | mod3-15ktl3-x-selfdeclaration-for-g100.pdf | 2022-02-17 09:56 | 351K | |
![[ ]](/icons/layout.gif) | modbus-application-note-2019.pdf | 2019-01-02 17:29 | 1.2M | |
![[ ]](/icons/layout.gif) | modbusmanual.pdf | 2019-10-17 15:50 | 3.6M | |
![[ ]](/icons/layout.gif) | modular-20-degree-dims.pdf | 2023-10-12 14:12 | 58K | |
![[ ]](/icons/layout.gif) | modular-25-degree-dims.pdf | 2023-10-12 14:12 | 61K | |
![[ ]](/icons/layout.gif) | modular-30-degree-dims-pdf.pdf | 2023-10-12 14:13 | 62K | |
![[ ]](/icons/layout.gif) | modular-system-warranty-issue-02.pdf | 2024-02-27 14:36 | 661K | |
![[ ]](/icons/layout.gif) | moixa-datasheet.pdf | 2017-05-19 17:23 | 124K | |
![[ ]](/icons/layout.gif) | moixa-install-manual.pdf | 2017-09-18 10:45 | 1.0M | |
![[ ]](/icons/layout.gif) | moixa-quick-install.pdf | 2017-05-19 17:23 | 900K | |
![[ ]](/icons/layout.gif) | moixa-times-article.pdf | 2017-05-19 17:23 | 701K | |
![[ ]](/icons/layout.gif) | moixa-user-manual.pdf | 2017-05-19 17:23 | 398K | |
![[IMG]](/icons/image2.gif) | mono-panel-100w-midsummer-energy-12v.jpg | 2018-06-29 11:05 | 316K | |
![[ ]](/icons/layout.gif) | mono-panel-100w.pdf | 2017-09-07 16:27 | 354K | |
![[ ]](/icons/layout.gif) | mono-panel-200w.pdf | 2017-05-02 12:46 | 2.8M | |
![[ ]](/icons/layout.gif) | monobloc-datasheet--1-.pdf | 2022-11-02 15:05 | 85K | |
![[ ]](/icons/layout.gif) | monobloc-datasheet--2-.pdf | 2022-11-02 15:16 | 84K | |
![[ ]](/icons/layout.gif) | monta-commercial.pdf | 2023-04-13 14:06 | 3.8M | |
![[ ]](/icons/layout.gif) | monta-home-owners.pdf | 2023-04-13 13:41 | 3.8M | |
![[ ]](/icons/layout.gif) | morningstar-remote-meter-manual.pdf | 2016-09-12 11:31 | 365K | |
![[ ]](/icons/layout.gif) | morningstar-remote-temp-sensor-datasheet.pdf | 2016-09-12 11:31 | 230K | |
![[ ]](/icons/layout.gif) | morningstar-remote-temp-sensor-manual.pdf | 2016-09-12 11:31 | 124K | |
![[ ]](/icons/layout.gif) | morningstar-tristar-datasheet.pdf | 2016-09-12 11:31 | 356K | |
![[ ]](/icons/layout.gif) | morningstar-tristar-manual.pdf | 2016-09-12 11:31 | 352K | |
![[ ]](/icons/layout.gif) | morningstar-tristar-remote-meter-datasheet.pdf | 2016-09-12 11:31 | 2.1M | |
![[ ]](/icons/layout.gif) | morningstar_remote_monitor_datasheet.pdf | 2016-09-12 11:31 | 287K | |
![[ ]](/icons/layout.gif) | morningstar_sunguard_datasheet.pdf | 2016-09-12 11:31 | 150K | |
![[ ]](/icons/layout.gif) | morningstar_sunguard_manual.pdf | 2016-09-12 11:31 | 39K | |
![[ ]](/icons/layout.gif) | morningstar_sunsaver_datasheet.pdf | 2016-09-12 11:31 | 120K | |
![[ ]](/icons/layout.gif) | morningstar_sunsaver_manual.pdf | 2016-09-12 11:31 | 93K | |
![[ ]](/icons/layout.gif) | morningstar_sunsaver_mppt_datasheet.pdf | 2016-09-12 11:31 | 484K | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-75-10-to-100-20.pdf | 2022-12-14 13:36 | 8.2M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en--1-.pdf | 2024-01-16 10:39 | 6.8M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en--2-.pdf | 2021-06-29 12:24 | 6.7M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en--3-.pdf | 2021-06-29 12:35 | 8.5M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en--4-.pdf | 2021-06-29 12:33 | 6.3M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en--5-.pdf | 2021-07-13 15:44 | 6.6M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en--6-.pdf | 2021-07-13 15:47 | 6.6M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en--7-.pdf | 2021-07-13 15:58 | 6.1M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en--8-.pdf | 2021-07-13 16:00 | 6.7M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en--9-.pdf | 2021-07-13 16:11 | 6.8M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en--10-.pdf | 2021-07-13 16:17 | 8.5M | |
![[ ]](/icons/layout.gif) | mppt-solar-charger-manual-en.pdf | 2021-08-17 21:08 | 8.0M | |
![[ ]](/icons/layout.gif) | mrw-ta-installation-manual.pdf | 2023-06-26 15:19 | 2.9M | |
![[ ]](/icons/layout.gif) | msds---haze-agm-june-2021-xf.pdf | 2022-02-03 09:58 | 128K | |
![[ ]](/icons/layout.gif) | msds-haze-gel-batteries.pdf | 2016-09-12 11:31 | 69K | |
![[ ]](/icons/layout.gif) | mt-1-manual.pdf | 2016-09-12 11:31 | 583K | |
![[ ]](/icons/layout.gif) | mt-50-datasheet.pdf | 2016-09-12 11:31 | 552K | |
![[ ]](/icons/layout.gif) | mt-50-manual.pdf | 2016-09-12 11:31 | 657K | |
![[ ]](/icons/layout.gif) | mt11-sms-el-v2.0.pdf | 2021-06-23 10:45 | 742K | |
![[ ]](/icons/layout.gif) | mt50-manual-en-v3.2.pdf | 2022-05-30 14:58 | 1.0M | |
![[ ]](/icons/layout.gif) | mt375_ang.pdf | 2017-05-19 17:23 | 194K | |
![[ ]](/icons/layout.gif) | multi-contact-buy-genuine-mc4.pdf | 2017-11-03 11:47 | 862K | |
![[ ]](/icons/layout.gif) | multi-contact-spanner-manual.pdf | 2017-05-19 17:23 | 300K | |
![[ ]](/icons/layout.gif) | multi-contact-staubli-brochure.pdf | 2017-11-03 11:46 | 2.0M | |
![[ ]](/icons/layout.gif) | multi-rs-solar-en.pdf | 2022-12-13 16:29 | 4.6M | |
![[ ]](/icons/layout.gif) | multiplus-ii---quattro-ii-120v-230v-en--2-.pdf | 2022-05-17 16:01 | 3.0M | |
![[ ]](/icons/unknown.gif) | multiplusiimanual | 2022-12-06 12:21 | 7.9M | |
![[ ]](/icons/layout.gif) | multirail-assembly-en--1-.pdf | 2022-12-14 16:43 | 3.8M | |
![[ ]](/icons/layout.gif) | multirail-assembly-en.pdf | 2024-01-30 10:36 | 3.1M | |
![[ ]](/icons/layout.gif) | multirail-infos-en.pdf | 2022-12-14 16:43 | 472K | |
![[ ]](/icons/layout.gif) | multirail25-ds.pdf | 2024-01-30 10:35 | 61K | |
![[ ]](/icons/layout.gif) | mut-meccanica-tovo-sv-3port-valve-datasheet.pdf | 2021-05-14 11:11 | 2.5M | |
![[ ]](/icons/layout.gif) | myenergi-hub-app-data-sheets.pdf | 2019-04-17 09:36 | 554K | |
![[ ]](/icons/layout.gif) | myenergi-olev-application.pdf | 2018-05-18 16:23 | 66K | |
![[ ]](/icons/layout.gif) | myenergi-returns-prodcedure.pdf | 2023-03-07 16:52 | 158K | |
![[ ]](/icons/layout.gif) | myenergi-system-overview-2.1-with-v2-zappi--battery-storage-device---the-hub.pdf | 2019-04-17 09:44 | 147K | |
![[ ]](/icons/layout.gif) | myenergi-system-overview.pdf | 2018-05-18 16:20 | 84K | |
![[ ]](/icons/layout.gif) | myenergi-zappi-post-instructions-d4863562e86dcb281c6c00244a747f18.pdf | 2022-02-14 15:35 | 1.1M | |
![[ ]](/icons/layout.gif) | myvaillant-connect-installation-instructions-2659622.pdf | 2023-10-26 16:29 | 870K | |
![[ ]](/icons/layout.gif) | narrowboat-tilt-mount-instructions.pdf | 2018-01-18 10:01 | 288K | |
![[ ]](/icons/layout.gif) | nasa_BM1_battery_monitor_datasheet.pdf | 2016-09-12 11:31 | 81K | |
![[ ]](/icons/layout.gif) | neostar-datashet.pdf | 2024-07-12 14:21 | 4.9M | |
![[ ]](/icons/layout.gif) | netatmo-thermostat-brochure.pdf | 2018-02-23 13:58 | 0 | |
![[ ]](/icons/layout.gif) | netatmo-thermostat-user-manual.pdf | 2018-02-23 14:00 | 1.9M | |
![[ ]](/icons/layout.gif) | netatmo-wired-manual.pdf | 2018-02-23 13:57 | 542K | |
![[ ]](/icons/layout.gif) | netatmo-wireless-thermostat.pdf | 2018-02-23 13:57 | 536K | |
![[ ]](/icons/layout.gif) | new-build-webinar-myenergi.pdf | 2020-05-07 22:08 | 2.9M | |
![[ ]](/icons/layout.gif) | new-build-webinar-trina.pdf | 2020-05-07 22:08 | 2.3M | |
![[ ]](/icons/layout.gif) | new-iboost-buddy-manual-2023.pdf | 2023-07-24 11:24 | 812K | |
![[ ]](/icons/layout.gif) | new-wifi-dongle-configuration20221121.pdf | 2022-12-06 10:29 | 1.1M | |
![[ ]](/icons/layout.gif) | nh-fuse-switch-drawing.pdf | 2018-07-05 10:07 | 96K | |
![[ ]](/icons/unknown.gif) | nh2datasheet | 2021-09-15 13:47 | 2.1M | |
![[ ]](/icons/layout.gif) | nicholson-rooftrak-ifp-brochure.pdf | 2017-06-01 12:40 | 1.5M | |
![[ ]](/icons/layout.gif) | nxhm-mcs-certification.pdf | 2023-09-12 14:02 | 293K | |
![[ ]](/icons/layout.gif) | obm-lora-223--1---1-.pdf | 2024-07-05 12:35 | 2.4M | |
![[ ]](/icons/layout.gif) | ocpp-customer-deck.pdf | 2023-08-09 10:43 | 796K | |
![[ ]](/icons/layout.gif) | ohme-epod-product-manual-v1.0--1-.pdf | 2023-01-11 15:42 | 414K | |
![[ ]](/icons/layout.gif) | ohme-home-pro-product-manual.pdf | 2022-02-17 11:01 | 1.6M | |
![[ ]](/icons/layout.gif) | ohme-home-pro-specs.pdf | 2022-02-17 11:01 | 893K | |
![[ ]](/icons/layout.gif) | operating-manual-of-lifepo4-battery-optimumnano20170922.pdf | 2018-06-12 17:14 | 3.7M | |
![[ ]](/icons/layout.gif) | operating-manual-of-lifepo4-battery.pdf | 2018-09-19 11:52 | 3.7M | |
![[ ]](/icons/layout.gif) | operation-wallacea.pdf | 2022-12-07 12:26 | 110K | |
![[ ]](/icons/layout.gif) | operations-assistant-pack.pdf | 2021-07-20 09:51 | 6.2M | |
![[ ]](/icons/layout.gif) | optimiser-installation-clearance-guide.pdf | 2021-11-24 11:23 | 301K | |
![[ ]](/icons/layout.gif) | optimiser-spec-and-connections.pdf | 2021-11-24 11:28 | 630K | |
![[ ]](/icons/layout.gif) | ordering-guide--merchants.pdf | 2024-01-23 13:10 | 5.0M | |
![[ ]](/icons/layout.gif) | outback-flexmax-mppt-datasheet.pdf | 2016-09-12 11:31 | 193K | |
![[ ]](/icons/layout.gif) | outback-flexmax-mppt-manual.pdf | 2016-09-12 11:31 | 966K | |
![[ ]](/icons/layout.gif) | overview-luna2000-ess-approved-grid-tied-scenarios-v2-en-2022-02-14--1---1---1-.pdf | 2022-10-24 13:19 | 838K | |
![[ ]](/icons/layout.gif) | overview.pdf | 2024-01-19 10:47 | 1.8M | |
![[ ]](/icons/layout.gif) | owl-Intuition-pv-datasheet.pdf | 2017-05-19 17:23 | 1.0M | |
![[ ]](/icons/layout.gif) | owl-Intuition-pv-manual.pdf | 2017-05-19 17:23 | 487K | |
![[ ]](/icons/layout.gif) | owl-int-3ph-install.pdf | 2017-09-20 12:29 | 40K | |
![[ ]](/icons/layout.gif) | owl-int-3ph-type1-schematic.pdf | 2017-09-20 12:25 | 106K | |
![[ ]](/icons/layout.gif) | owl-int-3ph-type2-schematic.pdf | 2017-09-20 12:25 | 128K | |
![[ ]](/icons/layout.gif) | owl-intuition-lc-manual.pdf | 2017-09-19 11:42 | 428K | |
![[ ]](/icons/layout.gif) | owl-intuition-pv.pdf | 2017-05-19 17:23 | 783K | |
![[ ]](/icons/layout.gif) | owl-intution-lc-brochure.pdf | 2017-09-19 11:45 | 1.1M | |
![[ ]](/icons/layout.gif) | owl-micro-consumer.pdf | 2017-05-19 17:23 | 1.8M | |
![[ ]](/icons/layout.gif) | owl-micro-electricity-monitor-manual.pdf | 2016-09-12 11:31 | 909K | |
![[ ]](/icons/layout.gif) | owl-room-sensor-manual.pdf | 2017-05-19 17:23 | 385K | |
![[ ]](/icons/layout.gif) | owl-tank-sensor.pdf | 2017-05-19 17:23 | 446K | |
![[ ]](/icons/layout.gif) | owl-wiring-diagram.pdf | 2017-05-19 17:23 | 427K | |
![[ ]](/icons/layout.gif) | p600-p-series-optimiser-datasheet.pdf | 2017-05-19 17:23 | 248K | |
![[TXT]](/icons/text.gif) | page_1.html | 2021-11-22 13:54 | 0 | |
![[TXT]](/icons/text.gif) | page_41.html | 2021-11-22 13:53 | 0 | |
![[ ]](/icons/layout.gif) | pan-tile-hook-p1000001.pdf | 2022-09-26 09:15 | 52K | |
![[ ]](/icons/layout.gif) | panasonic-25-year-guarantee-registration.pdf | 2017-05-19 17:23 | 193K | |
![[ ]](/icons/layout.gif) | panasonic-25-year-warranty.pdf | 2017-05-19 17:23 | 339K | |
![[ ]](/icons/layout.gif) | panasonic-240-245-datasheet-2017.pdf | 2017-06-30 12:55 | 690K | |
![[ ]](/icons/layout.gif) | panasonic-240-245-monocrystalline-solar-panel-datasheet-2017.pdf | 2019-08-29 11:48 | 690K | |
![[ ]](/icons/layout.gif) | panasonic-245w-datasheet.pdf | 2017-05-19 17:23 | 650K | |
![[ ]](/icons/layout.gif) | panasonic-250w-datasheet.pdf | 2019-11-04 16:03 | 1.2M | |
![[ ]](/icons/layout.gif) | panasonic-285-295w-datasheet.pdf | 2017-05-19 17:23 | 779K | |
![[ ]](/icons/layout.gif) | panasonic-295-datasheet-2017.pdf | 2017-06-30 12:57 | 2.0M | |
![[ ]](/icons/layout.gif) | panasonic-325-330-datasheet-2017.pdf | 2017-06-30 12:57 | 770K | |
![[ ]](/icons/layout.gif) | panasonic-335-datasheet.pdf | 2020-02-05 17:23 | 953K | |
![[ ]](/icons/layout.gif) | panasonic-335-installation-manual-en.pdf | 2020-02-05 17:24 | 647K | |
![[ ]](/icons/layout.gif) | panasonic-335-warrenty.pdf | 2020-02-05 17:24 | 242K | |
![[ ]](/icons/layout.gif) | panasonic-brochure-2017.pdf | 2017-06-30 12:56 | 2.3M | |
![[ ]](/icons/layout.gif) | panasonic-hit-335-brochure.pdf | 2020-02-05 17:22 | 3.4M | |
![[ ]](/icons/layout.gif) | panasonic-hitplus-n340-340-335-datasheet-en.pdf | 2020-03-27 16:09 | 961K | |
![[ ]](/icons/layout.gif) | panasonic-installation-manual.pdf | 2017-05-19 17:23 | 1.0M | |
![[ ]](/icons/layout.gif) | panasonic-mcs-certificate.pdf | 2017-05-19 17:23 | 1.8M | |
![[ ]](/icons/layout.gif) | panasonic-n330w-datasheet.pdf | 2017-05-19 17:23 | 630K | |
![[ ]](/icons/layout.gif) | panasonic-salt-mist.pdf | 2017-05-19 17:23 | 647K | |
![[ ]](/icons/layout.gif) | panasonic-solar-mcs-cert.pdf | 2020-06-01 15:34 | 437K | |
![[ ]](/icons/layout.gif) | panasonic-warranty.pdf | 2017-05-19 17:23 | 203K | |
![[ ]](/icons/layout.gif) | panasonic240-manual.pdf | 2017-05-19 17:23 | 241K | |
![[ ]](/icons/layout.gif) | panasonic330data.pdf | 2018-11-21 16:41 | 1.4M | |
![[ ]](/icons/layout.gif) | panasonic_240W_data_sheet.pdf | 2016-09-12 11:31 | 586K | |
![[ ]](/icons/layout.gif) | pantile-assembly-en.pdf | 2021-09-13 13:09 | 2.1M | |
![[ ]](/icons/layout.gif) | parallel-branch-connectors.pdf | 2022-06-01 10:11 | 105K | |
![[ ]](/icons/layout.gif) | partdiagrams.pdf | 2017-11-02 17:07 | 495K | |
![[ ]](/icons/layout.gif) | pcs-datasheet-march22-v2.pdf | 2022-09-02 14:38 | 2.5M | |
![[ ]](/icons/layout.gif) | pcs-installation-manual-v1.0.pdf | 2024-05-13 13:09 | 1.0M | |
![[ ]](/icons/layout.gif) | pds-sentinel-pfs-x100-uk-v6-sept-2021.pdf | 2024-05-17 09:54 | 644K | |
![[ ]](/icons/layout.gif) | pebs--dc-miniature-circuit-breakers.pdf | 2022-03-09 09:15 | 582K | |
![[ ]](/icons/layout.gif) | pedsc--cage-type-dc-isolators.pdf | 2022-02-03 14:08 | 1.3M | |
![[ ]](/icons/layout.gif) | pefs-el-firefighter-safety-switches-1-2-strings-2nd-generation.pdf | 2022-05-04 15:55 | 1.1M | |
![[ ]](/icons/layout.gif) | peimar-285poly-datasheet.pdf | 2019-10-02 12:44 | 761K | |
![[ ]](/icons/unknown.gif) | peimar-300w-panel-datasheet | 2019-05-17 12:49 | 797K | |
![[ ]](/icons/unknown.gif) | peimar-300w-panel-installation-manual | 2018-11-09 10:47 | 604K | |
![[ ]](/icons/unknown.gif) | peimar-300w-panel-mcs-certificate | 2018-11-08 13:12 | 1.2M | |
![[ ]](/icons/layout.gif) | peimar-company-profile.pdf | 2018-11-13 12:49 | 2.6M | |
![[ ]](/icons/layout.gif) | peimar-fire-report-poly.pdf | 2019-01-10 13:07 | 1.8M | |
![[ ]](/icons/layout.gif) | peimar-install-manual.pdf | 2019-01-10 13:07 | 604K | |
![[ ]](/icons/layout.gif) | peimar-mcs.pdf | 2019-01-10 13:06 | 405K | |
![[ ]](/icons/layout.gif) | peimar-sg280p-datasheet.pdf | 2019-01-10 12:59 | 1.2M | |
![[ ]](/icons/layout.gif) | peimar-uk-brochure.pdf | 2018-11-13 12:51 | 1.8M | |
![[ ]](/icons/layout.gif) | peimar-uk-sg310m-fb-.pdf | 2019-08-22 14:15 | 318K | |
![[ ]](/icons/layout.gif) | peimar-warranty-2018.pdf | 2019-01-10 13:08 | 698K | |
![[ ]](/icons/layout.gif) | perlight-295-mono-datasheet.pdf | 2022-02-24 15:26 | 2.2M | |
![[ ]](/icons/layout.gif) | perlight-330mb-60-blk-datasheet.pdf | 2021-04-06 16:51 | 1.6M | |
![[ ]](/icons/layout.gif) | perlight-400-delta-datasheet.pdf | 2022-02-24 14:32 | 2.4M | |
![[ ]](/icons/layout.gif) | perlight-400-delta-warranty.pdf | 2022-02-25 10:23 | 174K | |
![[ ]](/icons/layout.gif) | perlight-ammonia-certificate.pdf | 2017-05-19 17:23 | 3.1M | |
![[ ]](/icons/layout.gif) | perlight-ammonia-test.pdf | 2019-06-18 10:04 | 824K | |
![[ ]](/icons/layout.gif) | perlight-antislavery.pdf | 2021-05-19 12:54 | 1.2M | |
![[ ]](/icons/layout.gif) | perlight-black-plus-60-310.pdf | 2019-06-18 10:00 | 1.2M | |
![[ ]](/icons/layout.gif) | perlight-black-plus-warranty-terms-2022.pdf | 2022-03-02 12:48 | 180K | |
![[ ]](/icons/layout.gif) | perlight-black-series-datasheet.pdf | 2017-05-19 17:23 | 436K | |
![[ ]](/icons/layout.gif) | perlight-clamping.pdf | 2017-05-19 17:23 | 75K | |
![[ ]](/icons/layout.gif) | perlight-company-profile.pdf | 2017-12-19 12:30 | 3.9M | |
![[ ]](/icons/layout.gif) | perlight-delta-400-mcs.pdf | 2022-02-25 10:23 | 362K | |
![[ ]](/icons/layout.gif) | perlight-delta-black-54-270.pdf | 2019-06-18 09:45 | 1.2M | |
![[ ]](/icons/layout.gif) | perlight-delta-black-415w-mcs.pdf | 2022-08-10 11:57 | 368K | |
![[ ]](/icons/layout.gif) | perlight-delta-datasheet-2015.pdf | 2016-09-12 11:31 | 887K | |
![[ ]](/icons/layout.gif) | perlight-delta-range-2017.pdf | 2017-05-19 17:23 | 1.1M | |
![[ ]](/icons/layout.gif) | perlight-delta-series-datasheet.pdf | 2017-05-19 17:23 | 886K | |
![[ ]](/icons/layout.gif) | perlight-delta-series-datasheets.pdf | 2017-05-19 17:23 | 414K | |
![[ ]](/icons/layout.gif) | perlight-fire-safety.pdf | 2017-05-19 17:23 | 2.7M | |
![[ ]](/icons/layout.gif) | perlight-installation-manual-2021--1-.pdf | 2021-04-20 14:37 | 1.4M | |
![[ ]](/icons/layout.gif) | perlight-installation-manual-2021-1.pdf | 2022-04-21 16:54 | 1.4M | |
![[ ]](/icons/layout.gif) | perlight-installation-manual-2021.pdf | 2021-04-08 14:59 | 1.4M | |
![[ ]](/icons/layout.gif) | perlight-installation-manual.pdf | 2019-06-18 10:05 | 876K | |
![[ ]](/icons/layout.gif) | perlight-manual-march2019.pdf | 2019-03-05 10:02 | 876K | |
![[ ]](/icons/layout.gif) | perlight-mcs-2018.pdf | 2019-01-11 17:26 | 487K | |
![[ ]](/icons/layout.gif) | perlight-mcs-cert-070421.pdf | 2021-04-07 10:25 | 415K | |
![[ ]](/icons/layout.gif) | perlight-mcs-certificate.pdf | 2017-05-19 17:23 | 243K | |
![[ ]](/icons/layout.gif) | perlight-mcs-certs.pdf | 2021-04-20 13:13 | 420K | |
![[ ]](/icons/layout.gif) | perlight-mcs.pdf | 2022-04-21 16:49 | 243K | |
![[ ]](/icons/layout.gif) | perlight-mono-range-2017.pdf | 2017-05-19 17:23 | 1.0M | |
![[ ]](/icons/layout.gif) | perlight-pid-free-certificate.pdf | 2017-05-19 17:23 | 1.8M | |
![[ ]](/icons/layout.gif) | perlight-plm-260p-60-260w-poly-solar-panel-datasheet.pdf | 2017-05-19 17:23 | 1.0M | |
![[ ]](/icons/layout.gif) | perlight-plm-295mb-54-delta-serie-1.pdf | 2021-04-20 14:37 | 1.6M | |
![[ ]](/icons/layout.gif) | perlight-plm-295mb-54.pdf | 2023-01-18 16:07 | 699K | |
![[ ]](/icons/layout.gif) | perlight-plm-320m-60-320w-plus.pdf | 2018-12-03 11:58 | 1.2M | |
![[ ]](/icons/layout.gif) | perlight-plm-330mb-60-black-plus-series-datasheet-130421.pdf | 2021-04-14 15:31 | 1.6M | |
![[ ]](/icons/layout.gif) | perlight-plus-datasheet.pdf | 2019-01-11 17:26 | 1.3M | |
![[ ]](/icons/layout.gif) | perlight-poly-range-datasheet.pdf | 2019-01-10 15:38 | 1.2M | |
![[ ]](/icons/layout.gif) | perlight-poly-smart-ready-2017-me1.pdf | 2017-05-19 17:23 | 395K | |
![[ ]](/icons/layout.gif) | perlight-pv-back-frame-drawing_60cell_35mm.pdf | 2017-05-19 17:23 | 33K | |
![[ ]](/icons/layout.gif) | perlight-salt-mist-certificate.pdf | 2017-05-19 17:23 | 871K | |
![[ ]](/icons/layout.gif) | perlight-salt-mist-test.pdf | 2019-06-18 10:03 | 288K | |
![[ ]](/icons/layout.gif) | perlight-sand-dust-test.pdf | 2019-06-18 10:04 | 423K | |
![[ ]](/icons/layout.gif) | perlight-smart.pdf | 2017-12-19 12:30 | 843K | |
![[ ]](/icons/layout.gif) | perlight-think-black--100ma-36-datasheet-.pdf | 2019-07-02 12:10 | 2.4M | |
![[ ]](/icons/layout.gif) | perlight-warranty-2021.pdf | 2021-04-21 08:55 | 206K | |
![[ ]](/icons/layout.gif) | perlight-warranty-terms-2017.pdf | 2017-05-19 17:23 | 152K | |
![[ ]](/icons/layout.gif) | perlight-warranty-terms-for-mini-size-panels-100w--200w-2021.pdf | 2021-05-17 11:41 | 182K | |
![[ ]](/icons/layout.gif) | perlight-warranty.pdf | 2019-06-18 10:02 | 189K | |
![[ ]](/icons/layout.gif) | phase-coupler-tech-brief-eu.pdf | 2020-08-20 15:09 | 476K | |
![[ ]](/icons/layout.gif) | pl-ce-sg3-20rt-en-50549-1-certificate-20210303.pdf | 2023-08-21 13:40 | 1.4M | |
![[ ]](/icons/layout.gif) | plastic-tray-bracket--2-.pdf | 2023-12-01 10:03 | 6.4M | |
![[ ]](/icons/layout.gif) | plm-400om2b-66-perlight-installation-manual-2022.pdf | 2022-03-02 12:32 | 1.2M | |
![[ ]](/icons/layout.gif) | plm-415om6b-60--1-.pdf | 2022-08-08 17:07 | 294K | |
![[ ]](/icons/layout.gif) | plm-415om6b-60-perlight-installation-manual-2022.pdf | 2024-06-05 13:28 | 604K | |
![[ ]](/icons/layout.gif) | plm-415om6b-60.pdf | 2022-09-09 10:43 | 946K | |
![[ ]](/icons/layout.gif) | plm-425om10a-44b-datasheet--4-.pdf | 2024-06-05 13:28 | 373K | |
![[ ]](/icons/layout.gif) | plm-425om10a-44b-datasheet.pdf | 2023-02-01 16:08 | 373K | |
![[ ]](/icons/layout.gif) | pocket-lan-user-manual-en.pdf | 2023-11-14 09:44 | 1.1M | |
![[ ]](/icons/layout.gif) | pocket-wifi-4gm.pdf | 2024-03-07 17:19 | 5.3M | |
![[ ]](/icons/layout.gif) | pocket-wifi-datasheet-en.pdf | 2024-03-06 16:56 | 47K | |
![[ ]](/icons/layout.gif) | pocket-wifi-plus.pdf | 2022-08-31 14:37 | 795K | |
![[ ]](/icons/layout.gif) | polar-breaker-datasheet.pdf | 2024-03-26 14:05 | 98K | |
![[ ]](/icons/layout.gif) | polar-ess-battery-installation---quick-start-guide.pdf | 2024-03-21 16:28 | 790K | |
![[ ]](/icons/layout.gif) | polar-ess-battery-installation-quick-start-guide-v2.pdf | 2024-07-24 14:20 | 796K | |
![[ ]](/icons/layout.gif) | polar-ess-hybrid-inverter---installation-manual.pdf | 2024-03-21 16:30 | 2.3M | |
![[ ]](/icons/layout.gif) | polar-ess-hybrid-inverter-installation---quick-guide.pdf | 2024-03-21 16:30 | 549K | |
![[ ]](/icons/layout.gif) | polar-ess-lithium-ion-battery---installation-manual.pdf | 2024-03-21 16:29 | 1.2M | |
![[ ]](/icons/layout.gif) | polar-install-manual-v2.pdf | 2024-03-27 15:23 | 3.0M | |
![[ ]](/icons/layout.gif) | polar-top-tips.pdf | 2024-04-08 17:17 | 313K | |
![[ ]](/icons/layout.gif) | powerocean-brochure-20230605-en.pdf | 2023-11-01 15:14 | 2.6M | |
![[ ]](/icons/layout.gif) | powerwall-3-datasheet-uk-en-us.pdf | 2024-06-20 09:34 | 1.3M | |
![[ ]](/icons/layout.gif) | pre-plumbed-buffer-interim--1-.pdf | 2022-05-16 14:31 | 1.1M | |
![[ ]](/icons/layout.gif) | pre-plumbed-buffer-interim- datasheet.pdf | 2022-05-16 14:23 | 1.1M | |
![[ ]](/icons/layout.gif) | pre-plumbed-quick-start-guide.pdf | 2024-01-03 11:12 | 0 | |
![[ ]](/icons/layout.gif) | pre-plumbed-schematic.pdf | 2023-08-03 16:10 | 5.5M | |
![[ ]](/icons/layout.gif) | pro1-user-manual-v2.18.pdf | 2018-07-11 12:23 | 4.7M | |
![[ ]](/icons/layout.gif) | prod-lit-s-5-k-grip.pdf | 2020-03-23 16:34 | 803K | |
![[ ]](/icons/layout.gif) | product-brochure-august-2023.pdf | 2023-10-16 16:16 | 8.6M | |
![[ ]](/icons/layout.gif) | product-information-sheet----samsung-pre-plumbed-heat-pump-cylinder-range-with-50l-buffer--midsummer---feb-22.pdf | 2022-02-18 16:39 | 802K | |
![[ ]](/icons/layout.gif) | product-information-sheet----samsung-pre-plumbed-heat-pump-cylinder-range-with-50l-buffer--midsummer---may-22---customer-copy--1-.pdf | 2022-06-16 11:07 | 487K | |
![[ ]](/icons/layout.gif) | product-information-sheet----slimline-samsung-pre-plumbed-heat-pump-cylinder-range-with-25l-buffer--midsummer---customer-copy-23.pdf | 2023-06-26 16:42 | 468K | |
![[ ]](/icons/layout.gif) | product-information-sheet---buffer-vessels-50l-to-500l.pdf | 2021-09-06 14:56 | 1.7M | |
![[ ]](/icons/layout.gif) | product-information-sheet-libbi-battery-rev-1.0-october-2022.pdf | 2023-05-03 13:16 | 111K | |
![[ ]](/icons/layout.gif) | product-information-sheet-samsung-pre-plumb.pdf | 2021-07-15 14:06 | 433K | |
![[ ]](/icons/layout.gif) | product-leaflet-all-in-one--1-.pdf | 2022-10-07 12:00 | 3.8M | |
![[ ]](/icons/layout.gif) | product-leaflet-low-voltage-battery-51.pdf.pdf | 2022-10-07 13:14 | 2.5M | |
![[ ]](/icons/layout.gif) | product-sheet.pdf | 2017-11-02 16:44 | 1.1M | |
![[ ]](/icons/layout.gif) | projoy-4pole.pdf | 2019-06-05 11:09 | 891K | |
![[ ]](/icons/layout.gif) | projoy-ac-isolators-peas-ce-certificate.pdf | 2022-02-03 14:03 | 148K | |
![[ ]](/icons/layout.gif) | projoy-ac-isolators-peas-tuv-certificate.pdf | 2022-02-03 14:03 | 511K | |
![[ ]](/icons/layout.gif) | projoy-dc-isolators-pedsc-ce-cetificate.pdf | 2022-02-03 14:09 | 56K | |
![[ ]](/icons/layout.gif) | projoy-dc-isolators-pedsc-tuv-cetificate.pdf | 2022-02-03 14:09 | 241K | |
![[ ]](/icons/layout.gif) | projoy-electric-warranty-20201110.pdf | 2021-04-14 14:29 | 870K | |
![[ ]](/icons/layout.gif) | projoy_ac_peas69.pdf | 2022-06-23 16:26 | 2.0M | |
![[ ]](/icons/layout.gif) | projoy_dc_peas69.pdf | 2022-06-23 16:27 | 2.0M | |
![[ ]](/icons/unknown.gif) | projoy_dc_peds150-el | 2022-06-23 16:19 | 633K | |
![[ ]](/icons/layout.gif) | projoy_dc_peds150-el.pdf | 2022-06-23 16:20 | 633K | |
![[ ]](/icons/layout.gif) | projoy_dc_peds150_el.pdf | 2022-06-23 16:21 | 633K | |
![[ ]](/icons/layout.gif) | projoydatasheet-pefs-firefighter-safety-switches-1-10-string-p2--2024.pdf | 2024-05-22 09:42 | 1.3M | |
![[ ]](/icons/layout.gif) | ps-m-0135-u-global-limited-warranty-for-trina-solar-brand-crystalline-so....pdf | 2024-06-05 10:49 | 3.5M | |
![[ ]](/icons/layout.gif) | ptlon-compat-list-v199.pdf | 2021-06-02 09:42 | 214K | |
![[ ]](/icons/layout.gif) | pulsar-compliant-acfrogchpoux97rgnoryy2okv3f7rb4fswsjzcwmzsw0wtbc0fhrcqpqms6y-reqpv6zeasmzwu5-elgl0xgjz4pum5hu-ar8crqxnyrhq8t93l5bv97ykzf8w-dbh0-.pdf | 2022-09-16 11:41 | 54K | |
![[ ]](/icons/layout.gif) | pulsar-datasheet.pdf | 2019-12-10 10:48 | 378K | |
![[ ]](/icons/layout.gif) | pulsar-drill-template.pdf | 2019-12-10 10:54 | 1.5M | |
![[ ]](/icons/layout.gif) | pulsar-installer-guide.pdf | 2019-12-10 10:53 | 1.6M | |
![[ ]](/icons/layout.gif) | pulsar-user-guides.pdf | 2019-12-10 10:51 | 3.3M | |
![[ ]](/icons/layout.gif) | pulsarplus-datasheet-english-210825.pdf | 2021-08-25 11:18 | 169K | |
![[ ]](/icons/layout.gif) | pulsarplus-datasheet-english.pdf | 2022-11-29 16:08 | 169K | |
![[ ]](/icons/layout.gif) | pulsarplus-earthing-howitworks-v1-1.pdf | 2021-04-19 09:59 | 282K | |
![[ ]](/icons/layout.gif) | pulsarpulsarplus-installationguide-multilingual.pdf | 2022-11-29 16:08 | 1.8M | |
![[ ]](/icons/layout.gif) | pulsarpulsarplus_installationguide_multilingual.pdf | 2021-06-17 13:09 | 1.8M | |
![[ ]](/icons/layout.gif) | pumphouse-wall-bracket-3a-datasheet.pdf | 2024-07-12 09:18 | 432K | |
![[ ]](/icons/layout.gif) | purchasing-assistant-pack.pdf | 2023-07-18 08:59 | 2.5M | |
![[ ]](/icons/layout.gif) | puz-hwm140vha--bs-.pdf | 2023-01-27 12:50 | 1.5M | |
![[ ]](/icons/layout.gif) | puz-wm50vha--bs-.pdf | 2023-01-26 16:19 | 4.4M | |
![[ ]](/icons/layout.gif) | puz-wm60vaa--bs-.pdf | 2023-01-26 16:30 | 528K | |
![[ ]](/icons/layout.gif) | puz-wm85vaa--bs-.pdf | 2023-01-26 16:50 | 527K | |
![[ ]](/icons/layout.gif) | puz-wm112vaa--bs-.pdf | 2023-01-26 17:17 | 527K | |
![[ ]](/icons/layout.gif) | puz-wz50vaa-tm65.pdf | 2024-01-29 10:03 | 353K | |
![[ ]](/icons/layout.gif) | puz-wz60vaa-tm65.pdf | 2024-01-29 14:39 | 351K | |
![[ ]](/icons/layout.gif) | puz-wz80vaa-tm65.pdf | 2024-01-29 15:17 | 344K | |
![[ ]](/icons/layout.gif) | pv-content-list-toolcase-re-11003459.pdf | 2023-09-27 11:04 | 308K | |
![[ ]](/icons/layout.gif) | pv-ezrack-solarterrace-a.pdf | 2021-02-08 13:51 | 425K | |
![[ ]](/icons/layout.gif) | pv-isolation-low-countermeasure.pdf | 2017-05-19 17:23 | 413K | |
![[ ]](/icons/layout.gif) | pv-ma267-en.pdf | 2023-09-27 11:48 | 2.6M | |
![[ ]](/icons/layout.gif) | pv-ma270-en.pdf | 2023-09-27 11:55 | 899K | |
![[ ]](/icons/layout.gif) | pv-ma293-en.pdf | 2024-05-28 11:01 | 3.1M | |
![[ ]](/icons/layout.gif) | pv-ultra-datasheet.pdf | 2023-12-11 16:51 | 922K | |
![[ ]](/icons/layout.gif) | pvl68w-solar-panel-kit-instructions.pdf | 2016-09-12 11:31 | 34K | |
![[ ]](/icons/layout.gif) | pvm-cc-batt.pdf | 2017-05-19 17:23 | 581K | |
![[ ]](/icons/layout.gif) | pylon-datasheet.pdf | 2019-04-15 09:20 | 401K | |
![[ ]](/icons/layout.gif) | pylon-fault-form.pdf | 2018-04-09 09:53 | 77K | |
![[ ]](/icons/layout.gif) | pylon-installation-manual.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/layout.gif) | pylon-link-basic-cabinet.pdf | 2018-02-13 17:08 | 1.4M | |
![[ ]](/icons/layout.gif) | pylon-mixing-models.pdf | 2021-06-02 09:41 | 410K | |
![[ ]](/icons/layout.gif) | pylon-mixing.pdf | 2017-09-05 15:10 | 614K | |
![[ ]](/icons/layout.gif) | pylon-phantom-h48050.pdf | 2018-02-01 15:03 | 313K | |
![[ ]](/icons/layout.gif) | pylon-phantom-hv-manual.pdf | 2018-04-27 16:08 | 1.3M | |
![[ ]](/icons/layout.gif) | pylon-phantom-hv-operation-manual.pdf | 2018-04-27 16:08 | 1.6M | |
![[ ]](/icons/layout.gif) | pylon-phantom-s.pdf | 2018-07-11 14:47 | 300K | |
![[ ]](/icons/layout.gif) | pylon-phantom-silver-datasheet.pdf | 2019-09-02 10:58 | 49K | |
![[ ]](/icons/layout.gif) | pylon-plus-datasheet.pdf | 2017-09-05 15:09 | 296K | |
![[ ]](/icons/layout.gif) | pylon-plus-manual.pdf | 2017-09-05 15:10 | 1.4M | |
![[ ]](/icons/layout.gif) | pylon-plus-warranty.pdf | 2017-09-05 17:27 | 72K | |
![[ ]](/icons/unknown.gif) | pylon-tech-batteries-fault-check-guide.docx | 2022-12-08 11:48 | 8.4K | |
![[ ]](/icons/layout.gif) | pylon-updated-datasheet.pdf | 2020-02-28 15:39 | 595K | |
![[ ]](/icons/layout.gif) | pylon-us2000-v2-datasheet.pdf | 2021-06-02 09:41 | 778K | |
![[ ]](/icons/layout.gif) | pylon-us2000b-bracket.pdf | 2017-05-19 17:23 | 645K | |
![[ ]](/icons/layout.gif) | pylon-us2000b-manual.pdf | 2017-05-19 17:23 | 1.4M | |
![[ ]](/icons/layout.gif) | pylon-us2000b-plus-v2-manual.pdf | 2021-06-02 09:46 | 4.7M | |
![[ ]](/icons/layout.gif) | pylon-us2000c-manual-240221.pdf | 2021-03-26 11:57 | 2.2M | |
![[ ]](/icons/layout.gif) | pylon-us3000c-manual-240221.pdf | 2021-02-24 17:05 | 1.7M | |
![[ ]](/icons/layout.gif) | pylon-version-change-note.pdf | 2021-06-02 09:42 | 4.7M | |
![[ ]](/icons/layout.gif) | pylon-wall-bracket-datasheet.pdf | 2017-09-28 12:49 | 118K | |
![[ ]](/icons/layout.gif) | pylon-wall-bracket-diagram.pdf | 2017-09-28 12:49 | 825K | |
![[ ]](/icons/layout.gif) | pylon-wall-bracket-manual.pdf | 2017-09-28 12:49 | 147K | |
![[ ]](/icons/layout.gif) | pylon-warranty.pdf | 2017-05-19 17:23 | 90K | |
![[ ]](/icons/layout.gif) | pylon-wiring-schematic.pdf | 2017-05-19 17:23 | 336K | |
![[ ]](/icons/layout.gif) | pylontech-battery-us2000b.pdf | 2017-05-19 17:23 | 134K | |
![[ ]](/icons/layout.gif) | pylontech-bluetooth-app-manual-hr.pdf | 2023-12-05 16:22 | 2.2M | |
![[ ]](/icons/layout.gif) | pylontech-intercompatability-guide.pdf | 2019-04-15 09:33 | 410K | |
![[ ]](/icons/layout.gif) | pylontech-intercompatibility-guide.pdf | 2019-04-15 09:37 | 410K | |
![[ ]](/icons/layout.gif) | pylontech-official-statement-for-us2000c-us3000c-1210.pdf | 2021-03-26 11:59 | 184K | |
![[ ]](/icons/layout.gif) | pylontech-official-statement-for-us2000c-us3000c.pdf | 2021-02-04 16:21 | 184K | |
![[ ]](/icons/layout.gif) | pylontech-product-warranty-us-serie-v1.2-eu22wuss100302--europe--1-.pdf | 2023-03-30 12:27 | 475K | |
![[ ]](/icons/layout.gif) | pylontech-product-warranty-us3000b.pdf | 2019-04-15 09:23 | 142K | |
![[ ]](/icons/layout.gif) | pylontech-product-warranty.pdf | 2020-03-03 15:58 | 445K | |
![[ ]](/icons/layout.gif) | pylontech-us2000-material-safety-datasheet.pdf | 2021-06-07 18:09 | 212K | |
![[ ]](/icons/layout.gif) | pylontech-us2000b-datasheet.pdf | 2017-05-19 17:23 | 556K | |
![[ ]](/icons/layout.gif) | pylontech-us5000-manual.pdf | 2022-10-12 09:21 | 2.2M | |
![[ ]](/icons/layout.gif) | q-cells-335w-black-datasheet.pdf | 2019-08-13 15:21 | 771K | |
![[ ]](/icons/layout.gif) | q-cells-blk-g9-qd-325-345-datasheet-2020-08.pdf | 2021-01-12 16:40 | 1.5M | |
![[ ]](/icons/layout.gif) | q-cells-brochure-q.antum-neo-2021-12-rev01-en.pdf | 2023-10-12 12:32 | 1.1M | |
![[ ]](/icons/layout.gif) | q-cells-brochure-q.home-core-h4-a4-2021-11-rev01-en.pdf | 2022-02-09 15:56 | 1.9M | |
![[ ]](/icons/layout.gif) | q-cells-certificate-mcs-uk-pv0062-no23-2021-11-en.pdf | 2022-04-26 16:52 | 600K | |
![[ ]](/icons/layout.gif) | q-cells-certificate-salt-mist-g9-modules-2020-10-en.pdf | 2021-12-22 15:04 | 545K | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-315w.pdf | 2018-02-19 10:28 | 198K | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-blk-g8-335-350.pdf | 2020-05-05 16:12 | 1.3M | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.home-core-h4-2021-11-rev01-en.pdf | 2022-02-09 15:55 | 3.1M | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-blk-g8-335-350.pdf | 2020-03-23 14:24 | 1.3M | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-blk-g9--qd-325-345-2020-08-rev01-en.pdf | 2021-09-13 16:34 | 1.6M | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-blk-g9--qd-335-350-2021-07-rev01-en--1-.pdf | 2022-07-25 08:33 | 691K | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-blk-g9-qd-325-345-2020-08-rev01-en--1---1-.pdf | 2021-10-04 08:50 | 1.5M | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-blk-g9-qd-325-345-2020-08-rev01-en--1-.pdf | 2021-06-29 13:18 | 1.5M | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-blk-g9-qd-335-350-2021-07-rev01-en.pdf | 2022-07-22 15:33 | 685K | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-blk-ml-g9-365-385-2020-08-rec03-en.pdf | 2022-05-26 16:59 | 1.5M | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-g6-340-355-2019-03-rev01-en--3-.pdf | 2019-07-22 18:20 | 805K | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-g8-345-360.pdf | 2020-03-02 14:54 | 912K | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-g9-qd-335-355-2021-01-rev01-en--1-.pdf | 2022-01-28 16:03 | 621K | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-g9-qd-335-355-2021-01-rev01-en.pdf | 2021-09-13 16:39 | 621K | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-ml-g9-qd-375-395-2020-08-rev01-en--1-.pdf | 2022-03-25 16:23 | 1.6M | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-ml-g9-qd-375-395-2020-08-rev01-en.pdf | 2021-08-05 09:06 | 1.6M | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-duo-xl-g11.3-qd-570-590-2021-08-rev03-en--1-.pdf | 2022-02-08 16:30 | 566K | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet-q.peak-g4.4-295-315-2019-04-rev02-en.pdf | 2020-01-16 11:53 | 831K | |
![[ ]](/icons/layout.gif) | q-cells-data-sheet.pdf | 2018-02-19 10:29 | 198K | |
![[ ]](/icons/layout.gif) | q-cells-g8-plus-335-350-global-2019-11.pdf | 2020-07-13 10:56 | 1.3M | |
![[ ]](/icons/layout.gif) | q-cells-g9-370.pdf | 2021-07-05 10:17 | 619K | |
![[ ]](/icons/layout.gif) | q-cells-g9-blk-datasheet-q421.pdf | 2021-11-19 12:37 | 1.6M | |
![[ ]](/icons/layout.gif) | q-cells-hqcmys-warranty-terms-modules-q.peak-duo-g5-g8-series-2021-04-rev04-en.pdf | 2021-06-30 13:26 | 60K | |
![[ ]](/icons/layout.gif) | q-cells-hqcmys-warranty-terms-modules-q.peak-duo-ml-g9.4-series-2021-04-rev02-en.pdf | 2022-12-01 10:09 | 59K | |
![[ ]](/icons/layout.gif) | q-cells-hqcqdc-warranty-terms-modules-q.peak-duo-g9-series-2020-08-rev01-en.pdf | 2022-03-25 16:23 | 67K | |
![[ ]](/icons/layout.gif) | q-cells-hsc-warranty-terms-modules-q.peak-duo-g9-g11-series-global-2021-02-rev01-en--1-.pdf | 2023-05-11 12:27 | 61K | |
![[ ]](/icons/layout.gif) | q-cells-hsc-warranty-terms-modules-q.peak-duo-g9-g11-series-global-2021-02-rev01-en--2-.pdf | 2023-08-04 09:52 | 61K | |
![[ ]](/icons/layout.gif) | q-cells-hsc-warranty-terms-modules-q.peak-duo-g9-g11-series-global-2021-02-rev01-en.pdf | 2022-01-28 16:04 | 61K | |
![[ ]](/icons/layout.gif) | q-cells-hsc-warranty-terms-modules-q.peak-duo-g9-series-2020-08-rev02-en.pdf | 2021-10-04 08:50 | 0 | |
![[ ]](/icons/layout.gif) | q-cells-hsc-warranty-terms-modules-q.tron-g1--series-global-2022-01-rev02-en.pdf | 2023-12-11 13:25 | 66K | |
![[ ]](/icons/layout.gif) | q-cells-installation-manual-q.mount-corrugated-sheet-metal-bridge-tbb-2021-01-rev02-en.pdf | 2022-08-18 08:41 | 3.5M | |
![[ ]](/icons/layout.gif) | q-cells-installation-manual-q.mount-tiled-roofs-2020-12-rev01-en.pdf | 2023-06-02 14:49 | 4.7M | |
![[ ]](/icons/layout.gif) | q-cells-installation-manual-q.peak-duo-g8.x--modules-series-2021-05-rev03-en.pdf | 2021-06-30 13:17 | 2.5M | |
![[ ]](/icons/layout.gif) | q-cells-installation-manual-q.peak-duo-g9.x-modules-series-2020-09-rev01-en.pdf | 2021-09-13 16:40 | 2.5M | |
![[ ]](/icons/layout.gif) | q-cells-installation-manual-q.peak-duo-ml-g9.4-modules-series-2020-10-rev01-en.pdf | 2022-01-28 15:54 | 4.8M | |
![[ ]](/icons/layout.gif) | q-cells-installation-manual-q.peak-duo-ml-g9.x-modules-series-2020-07-rev02-en.pdf | 2021-10-04 08:51 | 0 | |
![[ ]](/icons/layout.gif) | q-cells-manual.pdf | 2018-02-19 10:56 | 4.8M | |
![[ ]](/icons/layout.gif) | q-cells-qpeak-duo-blk-g8-qd-335-350-2020-05-datasheet.pdf | 2021-06-30 13:17 | 759K | |
![[ ]](/icons/layout.gif) | q-cells-reflectivity.pdf | 2019-02-19 11:58 | 79K | |
![[ ]](/icons/layout.gif) | q-cells-warranty-g5-g8-2020-01-rev02.pdf | 2020-12-15 09:55 | 56K | |
![[ ]](/icons/layout.gif) | q-cells-warranty-q.peak-duo-g6--g8-plus-2020-01-rev01-en.pdf | 2020-12-15 09:57 | 56K | |
![[ ]](/icons/layout.gif) | q-cells-warranty.pdf | 2018-02-19 10:57 | 85K | |
![[ ]](/icons/layout.gif) | q.mount-20004774-400mm-trap-bridge--1-.pdf | 2021-08-11 16:02 | 422K | |
![[ ]](/icons/layout.gif) | q.peak-duo-l-g8-415-430-datasheet.pdf | 2021-04-27 08:39 | 2.4M | |
![[ ]](/icons/layout.gif) | q_cells_data_sheet_q.peak_duo_blk-g9__qd_325-345_2020-08_rev01_en.pdf | 2020-12-10 12:09 | 1.6M | |
![[ ]](/icons/layout.gif) | q_cells_data_sheet_q.peak_duo_blk-g9_qd_325-345_2020-08_rev01_en%20(1).pdf | 2021-03-15 11:34 | 0 | |
![[ ]](/icons/layout.gif) | q_cells_data_sheet_q.peak_duo_blk-g9_qd_325-345_2020-08_rev01_en.pdf | 2021-03-11 12:18 | 0 | |
![[ ]](/icons/layout.gif) | q_cells_hqcqdc_warranty_terms_modules_q.peak_duo-g9_series_2020-08_rev01_en.pdf | 2020-11-05 13:18 | 0 | |
![[ ]](/icons/layout.gif) | q_cells_installation_manual_q.peak_duo_ml-g9.x_modules_series_2020-07_rev02_en.pdf | 2021-03-11 15:32 | 0 | |
![[ ]](/icons/layout.gif) | qcell-300w-datasheet.pdf | 2017-07-05 16:21 | 795K | |
![[ ]](/icons/unknown.gif) | qcell-340-g8-datasheet | 2020-06-05 15:58 | 870K | |
![[ ]](/icons/unknown.gif) | qcell-340w-g8-datasheet | 2020-06-05 15:54 | 912K | |
![[ ]](/icons/unknown.gif) | qcell-370-390w-ml-g9plus-datasheet-250321 | 2021-03-25 15:43 | 1.8M | |
![[ ]](/icons/layout.gif) | qcell-duo-blk-g9plus-325-345w-datasheet-250321.pdf | 2021-03-25 15:24 | 1.6M | |
![[ ]](/icons/layout.gif) | qcell-g5-310-320-black-mono-datasheet.pdf | 2020-06-02 11:49 | 799K | |
![[ ]](/icons/layout.gif) | qcell-g5-manual-min.pdf | 2020-06-02 11:50 | 1.8M | |
![[ ]](/icons/layout.gif) | qcell-g5-mcs-cert.pdf | 2020-06-02 11:51 | 1.5M | |
![[ ]](/icons/layout.gif) | qcell-g5-warranty.pdf | 2020-06-02 11:50 | 56K | |
![[ ]](/icons/layout.gif) | qcell-g6-plus-blk-datasheet.pdf.pdf | 2020-06-11 15:17 | 1.7M | |
![[ ]](/icons/layout.gif) | qcell-g6-plus-datasheet.pdf | 2020-06-11 15:15 | 1.6M | |
![[ ]](/icons/unknown.gif) | qcell-g8-350-datasheet | 2020-06-05 15:33 | 912K | |
![[ ]](/icons/layout.gif) | qcell-g8-manual.pdf | 2020-06-01 15:04 | 2.0M | |
![[ ]](/icons/unknown.gif) | qcell-g9plus-warranty-250321 | 2021-03-25 15:41 | 53K | |
![[ ]](/icons/layout.gif) | qcell-g9plus-warranty-250321.pdf | 2021-09-13 16:34 | 58K | |
![[ ]](/icons/layout.gif) | qcell-mcs-cert-120121.pdf | 2021-01-12 16:50 | 4.3M | |
![[ ]](/icons/layout.gif) | qcell-mcs-cert.pdf | 2020-06-01 16:14 | 937K | |
![[ ]](/icons/layout.gif) | qcells-285w-poly-datasheet.pdf | 2019-01-10 15:04 | 910K | |
![[ ]](/icons/layout.gif) | qcells-data-sheet-q.home-core-h4-a4-2023-03-rev03-en-print.pdf | 2023-05-05 15:16 | 860K | |
![[ ]](/icons/layout.gif) | qcells-data-sheet-q.peak-duo-blk-m-g11--series-380-400-30t-2022-07-rev04-en.pdf | 2022-09-28 12:24 | 1.0M | |
![[ ]](/icons/layout.gif) | qcells-data-sheet-q.peak-duo-blk-m-g11a-series-380-400-2022-09-rev01-en--1-.pdf | 2023-01-27 16:26 | 1.0M | |
![[ ]](/icons/layout.gif) | qcells-data-sheet-q.peak-duo-blk-m-g11s-series-390-410-2022-12-rev02-en.pdf | 2023-08-22 10:57 | 1.0M | |
![[ ]](/icons/layout.gif) | qcells-data-sheet-q.peak-duo-m-g11-series-390-410-30t-2022-06-rev02-en.pdf | 2022-09-27 10:04 | 1.8M | |
![[ ]](/icons/layout.gif) | qcells-data-sheet-q.tron-blk-m-g2--series-415-440-2023-09-rev01-en--1-.pdf | 2023-10-12 12:31 | 1.9M | |
![[ ]](/icons/layout.gif) | qcells-data-sheet-q.tron-blk-m-g2--series-415-440-2023-09-rev01-en.pdf | 2023-10-12 08:31 | 1.9M | |
![[ ]](/icons/layout.gif) | qcells-data-sheet-q.tron-m-g2--series-410-435-2023-09-rev01-en--1-.pdf | 2024-04-18 12:41 | 2.0M | |
![[ ]](/icons/layout.gif) | qcells-duo-ab-datasheet.pdf | 2018-03-29 09:43 | 1.5M | |
![[ ]](/icons/layout.gif) | qcells-g9-370w-installation-manual.pdf | 2021-07-05 10:54 | 2.5M | |
![[ ]](/icons/layout.gif) | qcells-g9-warranty.pdf | 2021-07-05 11:01 | 61K | |
![[ ]](/icons/layout.gif) | qcells-g10-datasheet.pdf | 2022-07-11 16:23 | 1.3M | |
![[ ]](/icons/layout.gif) | qcells-g10-manual.pdf | 2022-07-11 16:24 | 4.4M | |
![[ ]](/icons/layout.gif) | qcells-g10-ml-datasheet.pdf | 2022-03-24 12:17 | 1.6M | |
![[ ]](/icons/layout.gif) | qcells-g10-ml-manual.pdf | 2022-03-24 12:17 | 4.5M | |
![[ ]](/icons/layout.gif) | qcells-hqca-warranty-terms-modules-q.tron-g1-g2--series-2022-10-rev01-na.pdf | 2023-12-12 09:43 | 94K | |
![[ ]](/icons/layout.gif) | qcells-hqcqdc-warranty-terms-modules-q.peak-duo-g9-g11-series-2022-09-rev05-en.pdf | 2023-08-04 09:54 | 85K | |
![[ ]](/icons/layout.gif) | qcells-hqcqdc-warranty-terms-modules-q.peak-duo-xl-g9.3-bfg-xl-g11.7-bfg-series-roa-2022-07-rev01-en.pdf | 2022-08-16 16:49 | 90K | |
![[ ]](/icons/layout.gif) | qcells-hqcqdc-warranty-terms-modules-q.tron-g2.x--series-2023-11-rev01-en.pdf | 2023-12-12 11:07 | 96K | |
![[ ]](/icons/layout.gif) | qcells-installation-manual-q.peak-duo-m-g11.x-modules-series-30t-2022-07-rev04-en.pdf | 2022-09-28 12:27 | 4.4M | |
![[ ]](/icons/layout.gif) | qcells-mcs.pdf | 2019-04-04 09:56 | 1.1M | |
![[ ]](/icons/layout.gif) | qg0021-asw3000-5000-s-en-540-30130-01-0722-1.pdf | 2024-01-26 12:26 | 3.9M | |
![[ ]](/icons/layout.gif) | qg0041-asw3k-20k-lt-g2-pro-eu-540-300035-00-0922.pdf | 2022-12-08 15:13 | 2.5M | |
![[ ]](/icons/layout.gif) | qg0047-asw45-60k-lt-g3-en-v03-0224.pdf | 2024-06-27 16:00 | 11M | |
![[ ]](/icons/layout.gif) | quantum-ev-ftu-superfast-data-sheet---03.pdf | 2020-02-24 08:57 | 1.6M | |
![[ ]](/icons/layout.gif) | quantumevdatasheet.pdf | 2019-10-07 10:48 | 2.8M | |
![[ ]](/icons/layout.gif) | quick-gudie-merc-1300w-1100w-v06-2023-09-11-en.pdf | 2024-06-07 14:06 | 1.1M | |
![[ ]](/icons/layout.gif) | quick-guide-cleaning-en.pdf | 2022-10-12 10:36 | 548K | |
![[ ]](/icons/layout.gif) | quick-install-guide-mppt-wire-box-m.pdf | 2020-05-12 10:47 | 1.3M | |
![[ ]](/icons/layout.gif) | quick-install-guide-mppt-wirebox-l-tr-en.pdf | 2020-05-12 10:48 | 6.2M | |
![[ ]](/icons/layout.gif) | quick-install-guide-mppt-wirebox-s-100-20-en.pdf | 2020-05-12 10:47 | 1.3M | |
![[ ]](/icons/layout.gif) | quick-start---pre-plumbed.pdf | 2023-03-01 16:07 | 5.5M | |
![[ ]](/icons/layout.gif) | quick-start-guide-a5-compressed.pdf | 2024-03-26 11:09 | 2.8M | |
![[ ]](/icons/layout.gif) | quick-start-guide-samsung-gen-6-kits.pdf | 2022-05-04 16:47 | 4.8M | |
![[ ]](/icons/layout.gif) | quickguide-pnp-v1.02-en-d.pdf | 2024-02-06 13:39 | 489K | |
![[ ]](/icons/layout.gif) | quickguide-sun2000-12-25k-mb0-v03-2023-09-20-en.pdf | 2024-05-16 15:53 | 1.9M | |
![[ ]](/icons/layout.gif) | quickguide-sun2000-12ktl-25ktl-m5-v03-2023-02-15-en.pdf | 2023-03-07 14:54 | 1.0M | |
![[ ]](/icons/layout.gif) | quickinstallsheet-victron-energy-bmv-700-702-712.pdf | 2020-04-02 15:05 | 3.2M | |
![[ ]](/icons/layout.gif) | r60dbmg-6m4cxx-se-smart-module-d-all-black-datasheet-row--1-.pdf | 2022-02-01 13:02 | 1.6M | |
![[ ]](/icons/layout.gif) | r290-packaged-cylinder-pi-sheet.pdf | 2024-01-30 09:00 | 714K | |
![[ ]](/icons/layout.gif) | r290-puz-wz50vaa--bs-.pdf | 2024-01-29 09:25 | 706K | |
![[ ]](/icons/layout.gif) | r290-puz-wz60vaa--bs---2-.pdf | 2024-01-29 15:29 | 706K | |
![[ ]](/icons/layout.gif) | r290-puz-wz80vaa--bs-.pdf | 2024-01-29 15:17 | 706K | |
![[ ]](/icons/layout.gif) | r420180-data-sheet.pdf | 2024-01-29 11:55 | 103K | |
![[ ]](/icons/layout.gif) | r520501-datasheet.pdf | 2020-06-15 09:13 | 122K | |
![[ ]](/icons/layout.gif) | rapid-shutdown-catalogue-beny-2024-2-1.pdf | 2024-07-19 14:22 | 5.6M | |
![[ ]](/icons/unknown.gif) | rayleigh-rihxe12r-manual | 2017-09-22 09:48 | 548K | |
![[ ]](/icons/layout.gif) | rayleigh-rihxe12r-manual.pdf | 2017-09-22 09:50 | 548K | |
![[ ]](/icons/layout.gif) | rc-a-type-rcd---datasheet---cudis--2-.pdf | 2024-05-10 15:07 | 368K | |
![[ ]](/icons/layout.gif) | rcbo-6ka---datasheet---cudis-v2.pdf | 2024-01-17 10:26 | 212K | |
![[ ]](/icons/layout.gif) | rea-hd108n-420---eu--2-.pdf | 2024-02-16 14:14 | 1.1M | |
![[ ]](/icons/layout.gif) | rea-hd108n-series-dc-440.pdf | 2024-04-22 11:16 | 1.1M | |
![[ ]](/icons/unknown.gif) | rea-power-440w-acm-datasheet | 2024-06-19 16:37 | 839K | |
![[ ]](/icons/layout.gif) | reach-community-solar-farm---as-laid--original.pdf | 2016-08-18 16:04 | 1.9M | |
![[ ]](/icons/layout.gif) | rec-60cell-manual.pdf | 2019-01-11 15:57 | 5.7M | |
![[ ]](/icons/layout.gif) | rec-mcs.pdf | 2019-01-11 15:58 | 54K | |
![[ ]](/icons/layout.gif) | rec-n-peak-datasheet.pdf | 2019-01-11 16:00 | 619K | |
![[ ]](/icons/layout.gif) | rec-n-peak-warranty.pdf | 2019-01-11 16:00 | 665K | |
![[ ]](/icons/layout.gif) | rec-warranty-factsheet.pdf | 2019-01-11 15:57 | 955K | |
![[ ]](/icons/layout.gif) | redarc-bcdc-dual-input-instruction-manual.pdf | 2019-01-15 13:24 | 599K | |
![[ ]](/icons/layout.gif) | redarc-parallel-bcdcs-rev4.pdf | 2019-01-15 13:27 | 856K | |
![[ ]](/icons/layout.gif) | rei-2402-dyer--1-.pdf | 2024-02-16 11:50 | 5.8M | |
![[ ]](/icons/layout.gif) | relion-data-sheet-rb300-noru.pdf | 2020-09-21 15:49 | 553K | |
![[ ]](/icons/layout.gif) | reliondata-6-100ah.pdf | 2020-10-20 15:35 | 694K | |
![[ ]](/icons/layout.gif) | reliondata-7-200ah.pdf | 2020-10-20 15:36 | 1.2M | |
![[ ]](/icons/layout.gif) | rensuol-console-installation-instructions-elongation-rail.pdf | 2021-06-18 14:20 | 1.5M | |
![[ ]](/icons/layout.gif) | rensusol-bolt-900007.pdf | 2021-09-23 10:51 | 58K | |
![[ ]](/icons/layout.gif) | rensusol-metasole-datasheet.pdf | 2018-07-20 16:16 | 196K | |
![[ ]](/icons/layout.gif) | renusol-3300-rail.pdf | 2020-09-07 10:23 | 166K | |
![[ ]](/icons/layout.gif) | renusol-consol-plus-manual.pdf | 2022-03-08 10:31 | 13M | |
![[ ]](/icons/layout.gif) | renusol-console-manual-old.pdf | 2017-05-19 17:23 | 1.5M | |
![[ ]](/icons/layout.gif) | renusol-console-manual.pdf | 2017-05-19 17:23 | 4.1M | |
![[ ]](/icons/layout.gif) | renusol-console-plus-datasheet.pdf | 2020-05-05 11:25 | 234K | |
![[ ]](/icons/layout.gif) | renusol-flat-roof-datasheet.pdf | 2018-03-08 16:52 | 125K | |
![[ ]](/icons/layout.gif) | renusol-flat-roof-manual.pdf | 2018-03-08 16:51 | 7.4M | |
![[ ]](/icons/layout.gif) | renusol-flat-tile-420181-datasheet.pdf | 2019-10-21 13:33 | 100K | |
![[ ]](/icons/layout.gif) | renusol-fs10-manual.pdf | 2020-01-10 12:56 | 3.1M | |
![[ ]](/icons/layout.gif) | renusol-hook-concrete.pdf | 2018-06-01 12:23 | 108K | |
![[ ]](/icons/layout.gif) | renusol-large-rail-datasheet.pdf | 2020-10-23 10:59 | 137K | |
![[ ]](/icons/layout.gif) | renusol-mcs012-bre-140623-01.pdf | 2018-07-20 16:17 | 490K | |
![[ ]](/icons/layout.gif) | renusol-metasol-landscape-manual.pdf | 2018-10-16 09:22 | 1.8M | |
![[ ]](/icons/layout.gif) | renusol-metasole-landscape-datasheet.pdf | 2018-07-20 16:32 | 265K | |
![[ ]](/icons/layout.gif) | renusol-metasole-manual.pdf | 2018-07-20 16:17 | 3.6M | |
![[ ]](/icons/layout.gif) | renusol-metasole-warranty.pdf | 2018-07-20 16:18 | 246K | |
![[ ]](/icons/layout.gif) | renusol-no-fixings.pdf | 2019-02-26 10:41 | 115K | |
![[ ]](/icons/layout.gif) | renusol-rail-datasheet.pdf | 2019-10-21 10:48 | 255K | |
![[ ]](/icons/layout.gif) | renusol-slate-hook-datasheet.pdf | 2021-09-24 10:31 | 96K | |
![[ ]](/icons/layout.gif) | renusol-solar-fastener-reisser-steel.pdf | 2018-03-26 11:01 | 1.2M | |
![[ ]](/icons/layout.gif) | renusol-triangle-datasheet.pdf | 2019-07-17 10:34 | 123K | |
![[ ]](/icons/layout.gif) | renusol-triangle-manual.pdf | 2019-07-17 10:34 | 4.6M | |
![[ ]](/icons/layout.gif) | renusol-vs-datasheet.pdf | 2018-03-07 16:33 | 216K | |
![[ ]](/icons/layout.gif) | renusol-vs-manual.pdf | 2018-03-07 16:34 | 8.4M | |
![[ ]](/icons/layout.gif) | renusol-vs-mcs.pdf | 2018-03-07 16:32 | 490K | |
![[ ]](/icons/layout.gif) | renusol-vs-pitched-installation-manual-20200114-comp.pdf | 2021-03-19 11:50 | 3.9M | |
![[ ]](/icons/layout.gif) | renusol-vs-pitched-installation-manual-20200114.pdf | 2021-03-19 11:49 | 7.4M | |
![[ ]](/icons/layout.gif) | renusol-warranty-conditions--1-.pdf | 2022-01-14 12:01 | 752K | |
![[ ]](/icons/layout.gif) | renusol-warranty-conditions.pdf | 2020-01-29 12:21 | 752K | |
![[ ]](/icons/layout.gif) | residential-catalogue-eng-uk.pdf | 2019-10-18 11:41 | 3.3M | |
![[ ]](/icons/layout.gif) | residential-s-series-installer-brochure.pdf | 2022-08-03 12:39 | 1.1M | |
![[ ]](/icons/layout.gif) | resistance-list-polual-xt.pdf | 2023-05-04 12:43 | 67K | |
![[ ]](/icons/layout.gif) | retrofit-tamper-instructions-rev-1.4-november-2022-online-copy-1.pdf | 2023-05-03 16:53 | 2.5M | |
![[ ]](/icons/layout.gif) | retrofit-tamper-instructions-rev-1.4-november-2022-online.pdf | 2023-05-03 17:01 | 2.5M | |
![[ ]](/icons/layout.gif) | retrofitting-5p-to-iq-series-microinverters---tips.pdf | 2024-04-23 15:03 | 1.4M | |
![[ ]](/icons/layout.gif) | retrofitting-5p-to-m-series---tips.pdf | 2024-04-23 15:06 | 1.5M | |
![[ ]](/icons/layout.gif) | retrofitting-5p-to-string---tips.pdf | 2024-04-23 15:03 | 1.2M | |
![[ ]](/icons/layout.gif) | riello-nxhm-3ph-datasheet.pdf | 2023-11-20 12:32 | 350K | |
![[ ]](/icons/layout.gif) | riello-nxhm-brochure-.pdf | 2023-11-17 10:23 | 9.3M | |
![[ ]](/icons/layout.gif) | riello-nxhm-datasheet.pdf | 2023-11-17 10:31 | 501K | |
![[ ]](/icons/layout.gif) | riello-nxhm-installation-manual-compressed.pdf | 2023-09-12 13:53 | 8.8M | |
![[ ]](/icons/unknown.gif) | ring-rscdc30-dc-dc-smart-battery-charger-30a | 2018-02-14 10:04 | 41K | |
![[ ]](/icons/layout.gif) | ring-terminal-datasheet.pdf | 2023-08-24 12:41 | 538K | |
![[ ]](/icons/unknown.gif) | river 2 max manual | 2024-06-18 16:04 | 5.7M | |
![[ ]](/icons/layout.gif) | rj-etfe-120w-datasheet.pdf | 2021-11-30 11:49 | 350K | |
![[ ]](/icons/layout.gif) | rolec-autocharge-coin-token-payg-datasheet.pdf | 2017-09-29 11:18 | 951K | |
![[ ]](/icons/layout.gif) | rolec-autocharge-data-sheet.pdf | 2017-09-29 10:50 | 1.7M | |
![[ ]](/icons/layout.gif) | rolec-autocharge-payg-instructions.pdf | 2017-05-19 17:23 | 232K | |
![[ ]](/icons/layout.gif) | rolec-basiccharge-ev-pedestal-superfast.pdf | 2017-05-19 17:23 | 527K | |
![[ ]](/icons/layout.gif) | rolec-basiccharge-ev-pedestal.pdf | 2018-01-10 09:29 | 585K | |
![[ ]](/icons/layout.gif) | rolec-ev-charge-online-installers-guide.pdf | 2020-09-16 09:31 | 54K | |
![[ ]](/icons/layout.gif) | rolec-ev-charge.pdf | 2020-07-24 17:51 | 2.8M | |
![[ ]](/icons/layout.gif) | rolec-ev-load-management.pdf | 2020-07-24 17:46 | 1.0M | |
![[ ]](/icons/layout.gif) | rolec-ev-pedestal-3-phase-datasheet.pdf | 2018-01-09 16:28 | 2.0M | |
![[ ]](/icons/layout.gif) | rolec-evwpd0012-wallpod-multimode.pdf | 2017-11-28 15:34 | 1.2M | |
![[ ]](/icons/layout.gif) | rolec-evwpd003-wallpod-ev-homecharge-j1772-tethered-type-1-mode-3.pdf | 2017-05-19 17:23 | 619K | |
![[ ]](/icons/layout.gif) | rolec-quantum-base-datasheet.pdf | 2020-09-09 13:28 | 83K | |
![[ ]](/icons/layout.gif) | rolec-quantum-base-manual.pdf | 2020-09-09 13:28 | 1.4M | |
![[ ]](/icons/layout.gif) | rolec-quantum-ev-gprs-datasheet-22kw.pdf | 2020-07-24 17:47 | 1.1M | |
![[ ]](/icons/layout.gif) | rolec-quantum-manual.pdf | 2020-09-10 10:32 | 34K | |
![[ ]](/icons/layout.gif) | rolec-tester.pdf | 2019-07-10 11:11 | 2.3M | |
![[ ]](/icons/layout.gif) | rolec-tokenmaster-manual.pdf | 2017-05-19 17:23 | 649K | |
![[ ]](/icons/layout.gif) | rolec-wallpod-commercial-charge.pdf | 2017-05-19 17:23 | 746K | |
![[ ]](/icons/layout.gif) | rolec-wallpod-commercialcharge-j1772-tethered-type-1-mode-3.pdf | 2018-01-10 12:39 | 1.0M | |
![[ ]](/icons/layout.gif) | rolec-wallpod-ev-homecharge-instructions.pdf | 2017-05-19 17:23 | 437K | |
![[ ]](/icons/layout.gif) | rolec-wallpod-ev-homecharge.pdf | 2017-05-19 17:23 | 593K | |
![[ ]](/icons/layout.gif) | rolec-wallpod-tethered-datasheet.pdf | 2017-05-19 17:23 | 544K | |
![[ ]](/icons/layout.gif) | rolls-12v-24ht80_techsheet.pdf | 2016-09-12 11:31 | 332K | |
![[ ]](/icons/layout.gif) | rolls-12v-31ht120_techsheet.pdf | 2016-09-12 11:31 | 475K | |
![[ ]](/icons/layout.gif) | rolls-s2-1275_techsheet.pdf | 2016-09-12 11:31 | 555K | |
![[ ]](/icons/layout.gif) | rolls-s6-275_techsheet.pdf | 2016-09-12 11:31 | 412K | |
![[ ]](/icons/layout.gif) | rolls-s6-370_techsheet.pdf | 2016-09-12 11:31 | 408K | |
![[ ]](/icons/layout.gif) | rolls-s6-460_techsheet.pdf | 2016-09-12 11:31 | 603K | |
![[ ]](/icons/layout.gif) | rolls-s12-290_techsheet.pdf | 2016-09-12 11:31 | 269K | |
![[ ]](/icons/layout.gif) | ronius-symo-5.0-3-m-en50438.pdf | 2019-05-22 15:06 | 34K | |
![[ ]](/icons/layout.gif) | roof-tingle-198x140-leaflet.pdf | 2024-06-24 15:25 | 1.3M | |
![[ ]](/icons/unknown.gif) | roof-toof-a4-leaflet--1 | 2023-11-28 12:18 | 1.3M | |
![[ ]](/icons/layout.gif) | roof-toof-a4-leaflet.pdf | 2023-04-12 15:22 | 1.3M | |
![[ ]](/icons/layout.gif) | rooftrak-ifp-250-for-grp-roofing-systems.pdf | 2024-07-10 15:30 | 266K | |
![[ ]](/icons/layout.gif) | rooftrak-ifp-250-for-liquid-applied-roofing-systems.pdf | 2024-07-10 15:50 | 352K | |
![[ ]](/icons/layout.gif) | rooftrak-ifp-250-for-membrane-roofing-systems--2-.pdf | 2024-07-10 15:27 | 349K | |
![[ ]](/icons/layout.gif) | rooftrak-ifp250-brochure-uk--2-.pdf | 2024-07-10 15:22 | 2.1M | |
![[ ]](/icons/layout.gif) | rosn---datasheet---cudis.pdf | 2024-01-17 10:25 | 323K | |
![[ ]](/icons/layout.gif) | rowena-testing.pdf | 2023-01-12 12:15 | 1.9M | |
![[ ]](/icons/layout.gif) | rs-steamliner-datasheet.pdf | 2020-12-16 11:23 | 120K | |
![[ ]](/icons/layout.gif) | rs485_port_expansion_datasheet_row.pdf | 2019-01-02 17:40 | 2.5M | |
![[ ]](/icons/layout.gif) | rt-800-3.pdf | 2024-04-18 09:29 | 209K | |
![[ ]](/icons/layout.gif) | rt800-2.pdf | 2024-04-18 09:28 | 478K | |
![[ ]](/icons/layout.gif) | rt800.pdf | 2024-04-18 09:28 | 1.6M | |
![[ ]](/icons/layout.gif) | rt12100g31.pdf | 2024-01-25 11:42 | 0 | |
![[ ]](/icons/layout.gif) | rutland-504-wind-turbine-datasheet.pdf | 2016-09-12 11:31 | 194K | |
![[ ]](/icons/layout.gif) | rutland-504-wind-turbine-efurl-manual.pdf | 2018-10-04 15:52 | 931K | |
![[ ]](/icons/layout.gif) | rutland-914i-manual-windcharger.pdf | 2018-10-04 16:07 | 1.1M | |
![[ ]](/icons/layout.gif) | rutland-1200-manual-controller.pdf | 2018-10-04 13:55 | 566K | |
![[ ]](/icons/layout.gif) | rutland-1200-manual-wind-turbine.pdf | 2018-10-04 13:56 | 596K | |
![[ ]](/icons/layout.gif) | rutland503.pdf | 2016-09-12 11:31 | 137K | |
![[ ]](/icons/layout.gif) | s-5-install-t-z-q-h-3.pdf | 2020-03-10 10:25 | 2.3M | |
![[ ]](/icons/layout.gif) | s-5-k-grip-mini-scale-drawing.pdf | 2020-09-29 09:46 | 473K | |
![[ ]](/icons/layout.gif) | s-5-n-brochure.pdf | 2021-04-13 09:41 | 347K | |
![[ ]](/icons/layout.gif) | s-5-r465-and-mini-installation.pdf | 2021-07-15 15:59 | 2.0M | |
![[ ]](/icons/layout.gif) | s-5-r465-clamps-brochure.pdf | 2021-07-15 16:00 | 414K | |
![[ ]](/icons/layout.gif) | s-5-s-mini-install-manual.pdf | 2020-03-10 09:59 | 2.6M | |
![[ ]](/icons/layout.gif) | s-1860.pdf | 2016-09-12 11:31 | 96K | |
![[ ]](/icons/layout.gif) | s-dome-6-xpress-assembly-en--1-.pdf | 2023-06-08 13:31 | 5.9M | |
![[ ]](/icons/layout.gif) | s-dome-6-xpress-assembly-en.pdf | 2023-07-24 10:20 | 5.9M | |
![[ ]](/icons/layout.gif) | s-pm21-006-factory-quality-warranty-terms-for-overseas-territory-of-aiswei-v1.7.pdf | 2023-02-03 13:43 | 132K | |
![[ ]](/icons/layout.gif) | s5-gr3p(15-20)k_dw_eur_v1.0.pdf | 2022-05-27 10:13 | 19M | |
![[ ]](/icons/layout.gif) | s5-product-sheet-s5e-r2.pdf | 2020-03-10 10:11 | 384K | |
![[ ]](/icons/layout.gif) | s5-product-sheet-s5s-r2.pdf | 2020-03-10 09:58 | 412K | |
![[ ]](/icons/layout.gif) | s5-product-sheet-s5z-r2.pdf | 2020-03-10 10:25 | 337K | |
![[ ]](/icons/layout.gif) | s440-s-500-power-optimizer-datasheet--1-.pdf | 2022-06-20 12:05 | 483K | |
![[ ]](/icons/layout.gif) | s440-s-500-power-optimizer-datasheet.pdf | 2022-02-02 14:03 | 483K | |
![[ ]](/icons/layout.gif) | safety-installer-leaflet-ehs-mono-r290-v02.pdf | 2024-04-18 12:57 | 2.2M | |
![[ ]](/icons/layout.gif) | samsung-5kw-mono-kiwa-mcs-certificate.pdf | 2021-02-15 21:09 | 121K | |
![[ ]](/icons/layout.gif) | samsung-8kw-mono-kiwa-260-MCS-certificate.pdf | 2021-02-15 21:33 | 121K | |
![[ ]](/icons/layout.gif) | samsung-9kw-split-installation-manual.pdf | 2023-08-10 10:38 | 10M | |
![[ ]](/icons/layout.gif) | samsung-12-and-16-kw-mono-kiwa-200-mcs-certificate.pdf | 2021-02-15 21:37 | 121K | |
![[ ]](/icons/layout.gif) | samsung-ae050rxydeg-eu-manual.pdf | 2021-02-15 21:07 | 11M | |
![[ ]](/icons/layout.gif) | samsung-ae200rnwmeg-manual.pdf | 2021-02-17 16:55 | 6.8M | |
![[ ]](/icons/layout.gif) | samsung-and-sunamp-midsummer-guide.pdf | 2021-04-14 14:32 | 3.1M | |
![[ ]](/icons/layout.gif) | samsung-gen-7-r290-datasheet.pdf | 2024-03-21 17:19 | 340K | |
![[ ]](/icons/layout.gif) | samsung-gen-7-r290-integrated-datasheet.pdf | 2024-04-18 10:09 | 160K | |
![[ ]](/icons/layout.gif) | samsung-installation-8-12-16.pdf | 2021-02-15 21:56 | 9.7M | |
![[ ]](/icons/layout.gif) | samsung-mono-controller-kit-manual.pdf | 2021-02-17 17:21 | 3.4M | |
![[ ]](/icons/layout.gif) | samsung-mw-wired-user-manual.pdf | 2021-02-16 12:02 | 282K | |
![[ ]](/icons/layout.gif) | samsung-new-homely-installation-manual.pdf | 2023-10-10 10:40 | 2.8M | |
![[ ]](/icons/layout.gif) | samsung-pre-plumbed-slimline-with-50l-buffer-feb24.pdf | 2024-03-21 12:54 | 408K | |
![[ ]](/icons/layout.gif) | samsung-pre-plumbed-with-50l-buffer-feb24.pdf | 2024-03-21 12:52 | 420K | |
![[ ]](/icons/layout.gif) | samsung-r290-capacity-table.pdf | 2024-04-18 10:29 | 313K | |
![[ ]](/icons/layout.gif) | samsung-r290-integrated-capacity-table.pdf | 2024-04-18 10:20 | 313K | |
![[ ]](/icons/layout.gif) | samsung-r290-integrated-schematics.pdf | 2024-05-30 10:59 | 5.2M | |
![[ ]](/icons/layout.gif) | samsung-sunamp-quick-guide.pdf | 2022-06-22 16:16 | 4.5M | |
![[ ]](/icons/layout.gif) | samsung-sunamp-quick-start-rev-2.pdf | 2022-06-24 09:47 | 4.5M | |
![[ ]](/icons/layout.gif) | samsung-sunamp-quick-start.pdf | 2022-06-13 11:23 | 4.5M | |
![[ ]](/icons/layout.gif) | samsung-training-modules.pdf | 2023-11-09 09:27 | 125K | |
![[ ]](/icons/layout.gif) | samsung-wi-fi-kit-controller-manual.pdf | 2021-02-16 12:13 | 11M | |
![[ ]](/icons/layout.gif) | sapphire-25yr-warranty.pdf | 2017-06-23 09:37 | 284K | |
![[ ]](/icons/layout.gif) | sapphire-260w-datsheet.pdf | 2017-05-19 17:23 | 692K | |
![[ ]](/icons/layout.gif) | sapphire-270w-datasheet.pdf | 2017-09-05 12:25 | 829K | |
![[ ]](/icons/layout.gif) | sapphire-285-datasheet.pdf | 2017-05-19 17:23 | 715K | |
![[ ]](/icons/layout.gif) | sapphire-285-mono-smart-datasheet.pdf | 2018-04-09 15:40 | 796K | |
![[ ]](/icons/layout.gif) | sapphire-285bm-datasheet-2017.pdf | 2017-06-23 09:36 | 639K | |
![[ ]](/icons/layout.gif) | sapphire-datasheet-270p-black.pdf | 2017-11-15 16:40 | 727K | |
![[ ]](/icons/layout.gif) | sapphire-solar-installation-manual.pdf | 2017-05-19 17:23 | 616K | |
![[ ]](/icons/layout.gif) | sapphire-solar-mcs-certificate-2017.pdf | 2017-05-19 17:23 | 416K | |
![[ ]](/icons/layout.gif) | sapphire-solar-warranty-uk.pdf | 2017-05-19 17:23 | 263K | |
![[ ]](/icons/layout.gif) | sapphire-solar.pdf | 2017-05-19 17:23 | 134K | |
![[ ]](/icons/layout.gif) | sappire-vde-cert.pdf | 2017-11-13 14:32 | 133K | |
![[ ]](/icons/layout.gif) | sb10---sp4000-datasheet-nov20.pdf | 2020-12-07 13:39 | 157K | |
![[ ]](/icons/layout.gif) | sbb-301---technical-datasheet.pdf | 2021-11-09 12:14 | 192K | |
![[ ]](/icons/layout.gif) | sbb-301-wp---installation-manual.pdf | 2021-11-09 12:14 | 2.4M | |
![[ ]](/icons/layout.gif) | sbb-401---installation-manual.pdf | 2021-11-08 10:50 | 2.4M | |
![[ ]](/icons/layout.gif) | sbb-401---technical-datasheet.pdf | 2021-11-08 10:50 | 194K | |
![[ ]](/icons/layout.gif) | sbb_302_wp_gb_set.product.pdf | 2022-01-27 11:10 | 191K | |
![[ ]](/icons/layout.gif) | sbp-100---installation-manual.pdf | 2021-11-09 12:15 | 8.9M | |
![[ ]](/icons/layout.gif) | sbp-100---techincal-datasheet.pdf | 2021-11-09 12:15 | 237K | |
![[ ]](/icons/layout.gif) | sbr064-256-qimul-ver18-202301.pdf | 2023-12-14 15:35 | 12M | |
![[ ]](/icons/layout.gif) | sbr064-256-uen-ver19-202302.pdf | 2023-12-14 15:31 | 12M | |
![[ ]](/icons/unknown.gif) | scame-datasheet | 2022-08-15 16:05 | 0 | |
![[ ]](/icons/layout.gif) | scame-datasheet.pdf | 2022-08-15 16:07 | 36K | |
![[ ]](/icons/layout.gif) | scame-drawing.pdf | 2022-08-15 16:45 | 126K | |
![[ ]](/icons/unknown.gif) | scame-isolator-datasheet | 2022-08-15 16:06 | 0 | |
![[ ]](/icons/layout.gif) | scheda-wrm15-dual-b.pdf | 2019-01-25 15:16 | 1.7M | |
![[ ]](/icons/layout.gif) | schematic-book-202302.pdf | 2023-02-28 10:46 | 7.0M | |
![[ ]](/icons/layout.gif) | sdm630mct-series-datasheet-may22--1-.pdf | 2023-07-25 11:40 | 277K | |
![[ ]](/icons/layout.gif) | sds-us2000-english-.pdf | 2021-06-08 09:00 | 1.2M | |
![[ ]](/icons/layout.gif) | se-2-3-68kw-ev-g98-cert.pdf | 2021-02-24 15:40 | 657K | |
![[ ]](/icons/layout.gif) | se-3-and-5kw-hot-water-datasheet.pdf | 2020-05-20 09:21 | 843K | |
![[ ]](/icons/layout.gif) | se-3ph-20k.pdf | 2022-05-16 17:23 | 441K | |
![[ ]](/icons/layout.gif) | se-3ph-inverter-installation-guide-2019.pdf | 2019-01-03 10:36 | 3.4M | |
![[ ]](/icons/layout.gif) | se-8-10kw-hd-wave-inverter-setapp-datasheet-eng.pdf | 2019-05-17 15:54 | 204K | |
![[ ]](/icons/layout.gif) | se-15-27-3ph-datasheet-2017.pdf | 2017-09-29 11:42 | 297K | |
![[ ]](/icons/layout.gif) | se-25-27-g59.pdf | 2017-09-29 11:42 | 393K | |
![[ ]](/icons/layout.gif) | se-25kw-3ph-g99-cert.pdf | 2021-03-04 14:45 | 898K | |
![[ ]](/icons/layout.gif) | se-360w-mono-s440-datasheet.pdf | 2021-12-10 09:40 | 1.6M | |
![[ ]](/icons/layout.gif) | se-12500-three-phase-inverter-datasheet2019.pdf | 2019-01-03 10:46 | 426K | |
![[ ]](/icons/layout.gif) | se-application-fixed-string-voltage.pdf | 2019-10-18 09:17 | 430K | |
![[ ]](/icons/layout.gif) | se-bro-smart-meter-overview-en-uk--1-.pdf | 2022-03-21 10:38 | 462K | |
![[ ]](/icons/layout.gif) | se-case-study-photon-summary.pdf | 2017-05-19 17:23 | 672K | |
![[ ]](/icons/layout.gif) | se-case-study-photon.pdf | 2017-05-19 17:23 | 2.6M | |
![[ ]](/icons/layout.gif) | se-cer-conformity-en-50549-1-rfg-fronius-primo-en--1-.pdf | 2023-07-27 10:24 | 168K | |
![[ ]](/icons/layout.gif) | se-cer-conformity-en-50549-1-rfg-fronius-tauro-eco-en.pdf | 2023-11-07 12:20 | 164K | |
![[ ]](/icons/layout.gif) | se-cer-conformity-i.s.-en50549-ireland-en--1-.pdf | 2022-06-08 15:37 | 118K | |
![[ ]](/icons/layout.gif) | se-cer-conformity-i.s.-en50549-ireland-en.pdf | 2021-07-12 12:49 | 118K | |
![[ ]](/icons/layout.gif) | se-cer-noise-emissions-fronius-tauro-en.pdf | 2023-11-07 12:21 | 138K | |
![[ ]](/icons/layout.gif) | se-cer-type-test-result-sheet-cer-06-190-fronius-primo-5.0-1-en--1-.pdf | 2022-10-06 16:29 | 131K | |
![[ ]](/icons/layout.gif) | se-commercial-power-optimizer-datasheet.pdf | 2019-04-16 12:54 | 542K | |
![[ ]](/icons/layout.gif) | se-commercial-presentation.pdf | 2017-05-19 17:23 | 3.0M | |
![[ ]](/icons/layout.gif) | se-commercial-three-phase-inverters.pdf | 2019-10-18 11:53 | 523K | |
![[ ]](/icons/layout.gif) | se-compact-extended-q4-21.pdf | 2021-11-12 10:57 | 283K | |
![[ ]](/icons/layout.gif) | se-compact-g83.pdf | 2018-10-10 14:27 | 210 | |
![[ ]](/icons/layout.gif) | se-compact-install-manual-v1-2.pdf | 2018-10-10 14:26 | 210 | |
![[ ]](/icons/layout.gif) | se-compact-install-manual.pdf | 2018-03-01 12:19 | 2.9M | |
![[ ]](/icons/layout.gif) | se-compact-resi-solution-installation-guide.pdf | 2019-10-18 09:52 | 2.3M | |
![[ ]](/icons/layout.gif) | se-compact-residential-solution-dsmarch19.pdf | 2019-04-16 14:18 | 367K | |
![[ ]](/icons/layout.gif) | se-compact-technology-g98certificate.pdf | 2019-04-16 14:35 | 605K | |
![[ ]](/icons/layout.gif) | se-dc-fuse-replacement-in-three-phase-inverters.pdf | 2023-10-13 11:30 | 532K | |
![[ ]](/icons/layout.gif) | se-device-control-load-switching-devices-datasheet-uk.pdf | 2019-04-16 15:04 | 529K | |
![[ ]](/icons/layout.gif) | se-device-control-plugin-socket-installation-guide.pdf | 2019-10-17 16:05 | 1.3M | |
![[ ]](/icons/layout.gif) | se-device-control-zigbee-module-datasheet.pdf | 2018-06-11 09:13 | 469K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-eco-en.pdf | 2024-02-29 11:27 | 512K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-primo-en--1-.pdf | 2024-02-28 16:41 | 542K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-primo-en--2-.pdf | 2024-05-13 09:32 | 542K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-primo-en--3-.pdf | 2024-02-28 16:55 | 542K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-primo-en.pdf | 2024-02-28 14:41 | 542K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-primo-gen24-gen24plus-3-to-6-kw-en.pdf | 2024-01-18 11:01 | 262K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-primo-gen24-gen24plus-3-to-10-kw-en-uk--1-.pdf | 2024-05-16 09:42 | 553K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-smartmeter-en-uk-uk.pdf | 2024-03-01 15:04 | 87K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-smartmeter-en.pdf | 2023-08-23 11:05 | 97K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-symo-advanced-en--2-.pdf | 2024-05-13 09:53 | 166K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-symo-advanced-en.pdf | 2024-02-28 16:47 | 166K | |
![[ ]](/icons/layout.gif) | se-ds-fronius-tauro-d-en.pdf | 2024-02-29 11:48 | 304K | |
![[ ]](/icons/layout.gif) | se-energy-bank-battery-datasheet-eu.pdf | 2021-10-14 13:21 | 332K | |
![[ ]](/icons/layout.gif) | se-energy-bank-battery-warranty.pdf | 2021-10-14 13:22 | 187K | |
![[ ]](/icons/layout.gif) | se-energy-bank-emergency-response-guide.pdf | 2021-10-14 13:22 | 343K | |
![[ ]](/icons/layout.gif) | se-energy-bank-fire-extinguisher-user-guide_0.pdf | 2021-10-14 13:24 | 187K | |
![[ ]](/icons/layout.gif) | se-energy-bank-installation-guide.pdf | 2021-10-14 13:22 | 495K | |
![[ ]](/icons/layout.gif) | se-energy-bank-safety-datasheet.pdf | 2021-10-14 13:22 | 206K | |
![[ ]](/icons/layout.gif) | se-energy-net-plug-in-datasheet.pdf | 2022-07-27 16:50 | 286K | |
![[ ]](/icons/layout.gif) | se-environmental-sensors-installationsheet.pdf | 2019-10-21 13:02 | 756K | |
![[ ]](/icons/layout.gif) | se-ev-charger-datasheet-uk.pdf | 2024-01-04 16:14 | 197K | |
![[ ]](/icons/layout.gif) | se-ev-charger-quick-installation-guide-en.pdf | 2024-04-09 16:15 | 515K | |
![[ ]](/icons/layout.gif) | se-ev-flyer.pdf | 2019-07-08 12:31 | 727K | |
![[ ]](/icons/layout.gif) | se-ev-inverters-brochure.pdf | 2019-07-08 12:31 | 1.3M | |
![[ ]](/icons/layout.gif) | se-ev-inverters-datasheet.pdf | 2019-07-08 12:30 | 329K | |
![[ ]](/icons/layout.gif) | se-ev-inverters-manual.pdf | 2019-07-08 12:44 | 949K | |
![[ ]](/icons/layout.gif) | se-ev-inverters-quick-guide.pdf | 2019-07-08 12:30 | 1.0M | |
![[ ]](/icons/layout.gif) | se-extended-power-commercial-3ph-inverter-installation-guide.pdf | 2019-10-18 11:54 | 5.2M | |
![[ ]](/icons/layout.gif) | se-fire-safety-white-paper_march19.pdf | 2019-04-16 12:42 | 1.0M | |
![[ ]](/icons/layout.gif) | se-firefighter-gateway.pdf | 2019-10-21 13:43 | 547K | |
![[ ]](/icons/layout.gif) | se-frame-mounted-power-optimizer-2019datasheet.pdf | 2019-01-03 10:33 | 395K | |
![[ ]](/icons/layout.gif) | se-g100.pdf | 2018-11-05 14:18 | 210 | |
![[ ]](/icons/layout.gif) | se-gsm-datasheet.pdf | 2017-12-18 10:18 | 489K | |
![[ ]](/icons/layout.gif) | se-gsm-manual.pdf | 2017-12-18 10:19 | 6.9M | |
![[ ]](/icons/layout.gif) | se-hd-wave-and-setapp-quick-installation-guide.pdf | 2019-04-04 13:52 | 2.2M | |
![[ ]](/icons/layout.gif) | se-hd-wave-g59.pdf | 2017-10-23 09:07 | 524K | |
![[ ]](/icons/layout.gif) | se-hd-wave-inverter-setapp-installation-guide--2-.pdf | 2020-02-14 16:56 | 6.5M | |
![[ ]](/icons/layout.gif) | se-home-backup-interface-single-phase-quick-installation-guide.pdf | 2024-02-06 12:39 | 789K | |
![[ ]](/icons/layout.gif) | se-home-backup-interface-three-phase-quick-installation-guide.pdf | 2024-02-06 12:48 | 671K | |
![[ ]](/icons/layout.gif) | se-home-ev-charger-configuration-manual-eng.pdf | 2024-01-04 16:38 | 2.0M | |
![[ ]](/icons/layout.gif) | se-home-ev-charger-installation-manual-eng.pdf | 2024-01-04 16:36 | 7.3M | |
![[ ]](/icons/layout.gif) | se-home-hot-water-controller-datasheet-eu.pdf | 2023-08-09 11:04 | 179K | |
![[ ]](/icons/layout.gif) | se-home-hub-inverter-3ph-installation-guide-eu.pdf | 2022-10-06 12:16 | 9.8M | |
![[ ]](/icons/layout.gif) | se-home-hub-inverter-single-phase-quick-installation-guide-eu.pdf | 2023-03-22 09:44 | 1.5M | |
![[ ]](/icons/layout.gif) | se-home-hub-inverter-three-phase-configurations.pdf | 2022-10-06 12:16 | 870K | |
![[ ]](/icons/layout.gif) | se-home-hub-inverter-three-phase-with-backup-quick-installation-guide-eng.pdf | 2022-10-06 12:15 | 2.5M | |
![[ ]](/icons/layout.gif) | se-home-hub-single-phase-inverter-datasheet-eu.pdf | 2023-11-14 15:49 | 798K | |
![[ ]](/icons/layout.gif) | se-home-load-controller-datasheet-row.pdf | 2024-02-02 11:46 | 150K | |
![[ ]](/icons/layout.gif) | se-home-smart-socket-datasheet-eu.pdf | 2024-02-02 12:01 | 144K | |
![[ ]](/icons/layout.gif) | se-home-smart-switch-datasheet-row.pdf | 2024-02-02 11:53 | 133K | |
![[ ]](/icons/layout.gif) | se-home-wave-inverter-single-phase-setapp-datasheet-eur.pdf | 2023-03-23 11:11 | 170K | |
![[ ]](/icons/layout.gif) | se-immersion-heater-controller-installation-guide.pdf | 2020-01-21 10:44 | 1.6M | |
![[ ]](/icons/layout.gif) | se-installer-starter-guide-eng.pdf | 2020-05-19 17:05 | 2.2M | |
![[ ]](/icons/layout.gif) | se-inverter-datasheet.pdf | 2017-05-19 17:23 | 189K | |
![[ ]](/icons/layout.gif) | se-limited-product-warranty-april-2022.pdf | 2022-08-03 12:38 | 198K | |
![[ ]](/icons/layout.gif) | se-lte-cellular-datasheet.pdf | 2022-04-19 12:51 | 474K | |
![[ ]](/icons/layout.gif) | se-manual-three-phase-inverters.pdf | 2017-05-19 17:23 | 2.9M | |
![[ ]](/icons/layout.gif) | se-optimiser-install-manual.pdf | 2020-08-19 17:17 | 458K | |
![[ ]](/icons/layout.gif) | se-p-series-add-on-power-optimizer-datasheet.pdf | 2020-05-19 17:04 | 1.2M | |
![[ ]](/icons/layout.gif) | se-p-series-commercial-add-on-power-optimizer-datasheet-170820.pdf | 2020-08-17 10:01 | 2.6M | |
![[ ]](/icons/layout.gif) | se-p-series-commercial-add-on-power-optimizer-datasheet.pdf | 2023-04-18 16:14 | 837K | |
![[ ]](/icons/layout.gif) | se-p-series-commercial-optimizer-datasheet.pdf | 2020-08-19 17:25 | 2.6M | |
![[ ]](/icons/layout.gif) | se-p-series-power-optimizer-datasheet-2019.pdf | 2019-01-03 10:26 | 424K | |
![[ ]](/icons/layout.gif) | se-p-series-power-optimizer-datasheet.pdf | 2020-08-19 17:18 | 172K | |
![[ ]](/icons/layout.gif) | se-p600-800-power-optimizer-datasheet2019.pdf | 2019-01-03 11:28 | 562K | |
![[ ]](/icons/layout.gif) | se-p650-p1100-datasheet-300321.pdf | 2021-03-30 16:59 | 805K | |
![[ ]](/icons/layout.gif) | se-p1100-datasheet.pdf | 2021-07-14 11:14 | 1.3M | |
![[ ]](/icons/layout.gif) | se-power-optimizer-datasheet-march19.pdf | 2019-04-16 12:30 | 139K | |
![[ ]](/icons/layout.gif) | se-power-optimizer-s-series-datasheet.pdf | 2024-07-03 13:52 | 201K | |
![[ ]](/icons/layout.gif) | se-power-optimizer-s-series-ip68-certificate-eu-0.pdf | 2022-08-03 12:42 | 302K | |
![[ ]](/icons/layout.gif) | se-power-optimizers-itercompatibility-170820.pdf | 2020-08-17 10:46 | 286K | |
![[ ]](/icons/layout.gif) | se-product-warranty-040321.pdf | 2021-03-04 14:47 | 374K | |
![[ ]](/icons/layout.gif) | se-s-series-commercial-power-optimizer-datasheet-eng-row.pdf | 2023-06-06 13:49 | 846K | |
![[ ]](/icons/layout.gif) | se-sensor-datasheet.pdf | 2019-10-21 13:01 | 449K | |
![[ ]](/icons/layout.gif) | se-single-phase-hd-wave-2019-datasheet.pdf | 2019-01-03 10:10 | 364K | |
![[ ]](/icons/layout.gif) | se-single-phase-hd-wave-inverter-2200-6000w-datasheet.pdf | 2020-04-06 11:18 | 304K | |
![[ ]](/icons/layout.gif) | se-single-phase-hd-wave-inverter-datasheet-march2019.pdf | 2019-04-16 14:03 | 210K | |
![[ ]](/icons/layout.gif) | se-smart-energy-hot-water-ce-declaration.pdf | 2020-01-28 10:50 | 687K | |
![[ ]](/icons/layout.gif) | se-smart-energy-hot-water-datasheet.pdf | 2020-01-28 10:48 | 671K | |
![[ ]](/icons/layout.gif) | se-smart-energy-hot-water-installation-guide.pdf | 2020-01-28 10:49 | 4.0M | |
![[ ]](/icons/layout.gif) | se-smartenergy-socket-datasheet.pdf | 2019-01-02 17:41 | 663K | |
![[ ]](/icons/layout.gif) | se-solaredge-home-backup-interface-three-phase-datasheet-eng.pdf | 2022-10-27 10:23 | 247K | |
![[ ]](/icons/layout.gif) | se-solaredge-home-battery-400v-datasheet-eng.pdf | 2024-07-17 16:53 | 140K | |
![[ ]](/icons/layout.gif) | se-solaredge-home-battery-high-voltage-datasheet-eng.pdf | 2023-03-23 11:12 | 151K | |
![[ ]](/icons/layout.gif) | se-solaredge-home-battery-low-voltage-datasheet-eng-row.pdf | 2022-10-21 11:04 | 139K | |
![[ ]](/icons/layout.gif) | se-solaredge-home-hub-inverter-three-phase-backup-datasheet-eng-row--1-.pdf | 2023-10-13 10:58 | 745K | |
![[ ]](/icons/layout.gif) | se-solaredge-home-hub-inverter-three-phase-backup-datasheet-eng-row.pdf | 2022-10-06 12:13 | 200K | |
![[ ]](/icons/layout.gif) | se-synergy-3ph-datasheet-march19.pdf | 2019-04-16 14:55 | 532K | |
![[ ]](/icons/layout.gif) | se-temperature-sensor-installation-guide.pdf | 2020-02-21 14:52 | 2.7M | |
![[ ]](/icons/layout.gif) | se-three-phase-certificate-of-compliance-g593.pdf | 2017-05-19 17:23 | 308K | |
![[ ]](/icons/layout.gif) | se-three-phase-hybrid-inverter-datasheet-8kw.pdf | 2022-05-13 12:04 | 195K | |
![[ ]](/icons/layout.gif) | se-three-phase-hybrid-inverter-datasheet-10k.pdf | 2022-05-13 12:10 | 195K | |
![[ ]](/icons/layout.gif) | se-three-phase-hybrid-inverter-datasheet.pdf | 2022-05-13 11:53 | 195K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-datasheet-march19.pdf | 2019-04-16 14:46 | 195K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-datasheet.pdf | 2017-07-04 11:46 | 251K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-datasheet2019.pdf | 2019-01-03 10:35 | 261K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-setapp-datasheet--1-.pdf | 2019-10-18 11:47 | 420K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-setapp-datasheet.pdf | 2019-10-18 11:41 | 420K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-setapp-ds--1-.pdf | 2022-06-20 12:17 | 291K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-setapp-ds.pdf | 2019-10-18 11:31 | 291K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-with-setapp-configuration-datasheet.pdf | 2022-02-04 14:17 | 368K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-with-synergy-400v-480v-datasheet-eu---uk-2.pdf | 2022-11-07 10:28 | 246K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-with-synergy-400v-480v-datasheet-eu--1-.pdf | 2022-10-28 09:52 | 854K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverter-with-synergy-technology-se50k-se100k-en50549-1-certificate-ireland.pdf | 2023-03-27 17:05 | 345K | |
![[ ]](/icons/layout.gif) | se-three-phase-inverters-with-setapp-installation-guide--1-.pdf | 2019-10-18 11:51 | 2.6M | |
![[ ]](/icons/layout.gif) | se-three-phase-inverters-with-setapp-installation-guide--2-.pdf | 2019-10-18 11:49 | 2.6M | |
![[ ]](/icons/layout.gif) | se-three-phase-inverters-with-setapp-installation-guide.pdf | 2019-10-18 11:33 | 2.6M | |
![[ ]](/icons/layout.gif) | se-tow-en-st.pdf | 2024-02-29 12:48 | 514K | |
![[ ]](/icons/layout.gif) | se-ukca-declaration-of-conformity-fronius-smart-meter-en.pdf | 2023-08-23 11:07 | 128K | |
![[ ]](/icons/layout.gif) | se-warranty-may-2020--1-.pdf | 2022-02-02 14:02 | 374K | |
![[ ]](/icons/layout.gif) | se-warranty-may-2020--2-.pdf | 2022-06-20 12:05 | 374K | |
![[ ]](/icons/layout.gif) | se-warranty-may-2020.pdf | 2020-08-19 17:18 | 374K | |
![[ ]](/icons/layout.gif) | se-wifi-plugin-datasheet.pdf | 2019-01-02 17:25 | 562K | |
![[ ]](/icons/layout.gif) | se-wifi-zigbee-antenna-datasheet.pdf | 2019-04-16 15:08 | 212K | |
![[ ]](/icons/layout.gif) | se-wifi-zigbee-antenna-installation-guide-eng.pdf | 2019-10-17 16:08 | 254K | |
![[ ]](/icons/layout.gif) | se-wifi-zigbee-antenna-installation-guide.pdf | 2022-01-28 14:00 | 2.0M | |
![[ ]](/icons/layout.gif) | se-wireless-gateway-datasheet.pdf | 2022-02-02 13:46 | 462K | |
![[ ]](/icons/layout.gif) | se-wireless-gateway-installation-guide.pdf | 2022-02-02 13:47 | 1.2M | |
![[ ]](/icons/layout.gif) | se-wireless-gateway.pdf | 2022-02-02 13:47 | 339K | |
![[ ]](/icons/layout.gif) | se-zigbee-plug-in-wireless-communication-for-setapp-datasheet.pdf | 2023-06-12 10:14 | 628K | |
![[ ]](/icons/layout.gif) | se25-33k-g99-cert.pdf | 2021-03-19 13:12 | 1.2M | |
![[ ]](/icons/layout.gif) | se8000h-g100.pdf | 2023-11-14 16:10 | 436K | |
![[ ]](/icons/layout.gif) | se10000h-g100.pdf | 2023-11-14 16:09 | 436K | |
![[ ]](/icons/layout.gif) | se_compact_datasheet.pdf | 2019-01-02 17:14 | 463K | |
![[ ]](/icons/layout.gif) | se_compact_installation_guide.pdf | 2019-01-02 17:15 | 3.3M | |
![[ ]](/icons/layout.gif) | se_hd_wave_inverter_installation_guide.pdf | 2019-01-03 10:11 | 2.8M | |
![[ ]](/icons/layout.gif) | se_hd_wave_single_phase_g83_2_certificate_uk.pdf | 2019-01-03 10:10 | 708K | |
![[ ]](/icons/layout.gif) | se_modbus_ct_selector.pdf | 2019-01-02 17:30 | 363K | |
![[ ]](/icons/layout.gif) | seam-clamps-overview---05-08-2019.pdf | 2022-09-26 09:21 | 120K | |
![[ ]](/icons/layout.gif) | seam-clamps-overview.pdf | 2024-06-07 16:34 | 89K | |
![[ ]](/icons/layout.gif) | secuk-hfta200-12----le-completed.pdf | 2022-11-01 17:00 | 5.0M | |
![[ ]](/icons/layout.gif) | semi-flexible-flx-120w-solar-panel-midsummer-energy.pdf | 2019-03-15 12:25 | 76K | |
![[ ]](/icons/layout.gif) | semi-flexible-solar-panel-back-contact-cells-flx-150w-midsummer.pdf | 2019-03-15 12:27 | 77K | |
![[ ]](/icons/layout.gif) | semi-flexible-solar-panels-handling-and-installation-manual.pdf | 2019-08-21 16:45 | 1.5M | |
![[ ]](/icons/layout.gif) | sensocomfort-datasheet.pdf | 2021-06-23 12:51 | 765K | |
![[ ]](/icons/layout.gif) | sensocomfort-manual.pdf | 2021-06-23 12:51 | 3.4M | |
![[ ]](/icons/layout.gif) | sensocoomfort-rf-manual.pdf | 2021-06-23 14:04 | 3.8M | |
![[ ]](/icons/layout.gif) | sentinel-pfs-x800-uk-v4-jan-2019.pdf | 2024-05-17 09:55 | 645K | |
![[ ]](/icons/layout.gif) | service-support-uk-ireland-.pdf | 2023-03-31 16:38 | 512K | |
![[ ]](/icons/layout.gif) | sg3.0-20rt-uen-ver17-202204.pdf | 2022-07-29 13:26 | 22M | |
![[ ]](/icons/layout.gif) | sg25-30-33-36-40-50cx-p2-uen-ver16-202310-compressed.pdf | 2023-12-14 15:05 | 2.3M | |
![[VID]](/icons/movie.gif) | sg110cx%20installation%20video-en-201911.mp4 | 2022-09-21 13:37 | 34M | |
![[ ]](/icons/layout.gif) | sg110cx-quick-installation-guide.pdf.pdf | 2022-09-21 13:35 | 4.6M | |
![[ ]](/icons/layout.gif) | sg125-110-75cx-p2-uen-ver15-202308-compressed.pdf | 2023-12-14 15:13 | 2.9M | |
![[ ]](/icons/layout.gif) | sgs0083-em-lite-emx1-r1-issue-1.pdf | 2023-07-26 16:13 | 592K | |
![[ ]](/icons/layout.gif) | sgs0103-em-lite-eca2-issue-6.pdf | 2018-02-20 16:47 | 330K | |
![[ ]](/icons/layout.gif) | sgs0103-em-lite-eca2-r1-issue-2--1-.pdf | 2022-10-25 14:37 | 4.7M | |
![[ ]](/icons/layout.gif) | sgs0103-em-lite-eca2-r1-issue-3.pdf | 2023-07-26 16:15 | 1.0M | |
![[ ]](/icons/layout.gif) | sgs0461-em-lite-emp1-issue-7.pdf | 2023-07-26 16:11 | 1.1M | |
![[ ]](/icons/layout.gif) | sh-3ph-datasheet.pdf | 2024-04-19 08:36 | 161K | |
![[ ]](/icons/layout.gif) | sh3.0-3.6-4.0-5.0-6.0rs-2-.pdf | 2024-04-24 14:58 | 1.9M | |
![[ ]](/icons/unknown.gif) | sh3.0-3.6-4.0-5.0-6.0rs-2-new | 2024-04-19 08:47 | 1.9M | |
![[ ]](/icons/layout.gif) | sh3.0-3.6-4.0-5.0-6.0rs-uen-ver17-202305-compressed.pdf | 2023-12-14 15:20 | 2.9M | |
![[ ]](/icons/layout.gif) | sh3.0-6.0rs-en50549-1-certificate.pdf | 2023-01-26 11:47 | 79K | |
![[ ]](/icons/layout.gif) | sh3.0_3.6_4.0_5.0_6.0rs%20user%20manual.pdf | 2022-10-03 11:18 | 18M | |
![[ ]](/icons/layout.gif) | sh3.0rs-sh6.0rs---------en-v1.1.pdf | 2023-12-14 15:23 | 494K | |
![[ ]](/icons/layout.gif) | sh5.0-10rt-5.0-10rt-20-uen-ver21-202308--1-.pdf | 2023-12-14 15:49 | 2.9M | |
![[ ]](/icons/unknown.gif) | sh_sungrow_updated data sheet | 2024-04-18 16:55 | 1.9M | |
![[ ]](/icons/layout.gif) | shield-12v-battery-spec-sheet.pdf | 2017-11-30 16:10 | 1.0M | |
![[ ]](/icons/layout.gif) | shield_crown_m.pdf | 2016-09-12 11:31 | 3.6M | |
![[ ]](/icons/layout.gif) | shine-wifix-datasheet.pdf | 2020-11-12 10:52 | 504K | |
![[ ]](/icons/layout.gif) | shine-wifix-quick-install.pdf | 2020-11-12 10:52 | 5.1M | |
![[ ]](/icons/layout.gif) | shinegprs-f-datasheet.pdf | 2023-05-18 12:24 | 3.6M | |
![[ ]](/icons/layout.gif) | shinelan-setup-guide.pdf | 2017-05-19 17:23 | 763K | |
![[ ]](/icons/layout.gif) | shinelan-x-configuration-guide-en-202211.pdf | 2024-02-01 14:40 | 2.1M | |
![[ ]](/icons/layout.gif) | shinelan-x-datasheet-en-202108.pdf | 2024-02-01 14:35 | 781K | |
![[ ]](/icons/layout.gif) | shinelan-x-quick-guide-en-202206.pdf | 2024-02-01 14:39 | 1.5M | |
![[ ]](/icons/layout.gif) | shinelink-x-configuration-guide-en202212.pdf | 2023-11-09 17:23 | 855K | |
![[ ]](/icons/layout.gif) | shinelink-x-datasheet-en.pdf | 2023-11-09 17:23 | 2.7M | |
![[ ]](/icons/layout.gif) | shinelink-x-quick-guide-en.pdf | 2023-11-09 17:23 | 2.1M | |
![[ ]](/icons/layout.gif) | shinephone-app-battery-control-instruction.pdf | 2023-04-13 11:30 | 132K | |
![[ ]](/icons/layout.gif) | shinesem-x-rm-datasheet-en-202403--1-.pdf | 2024-07-17 16:41 | 537K | |
![[ ]](/icons/layout.gif) | shinesem-x-user-manual-en-202310.pdf | 2024-07-17 16:42 | 10M | |
![[ ]](/icons/layout.gif) | shinevision-user-manual.pdf | 2017-05-19 17:23 | 1.7M | |
![[ ]](/icons/layout.gif) | shinewifi-f-datasheet.pdf | 2023-05-18 12:17 | 3.1M | |
![[ ]](/icons/layout.gif) | shinewifi-x-datasheet-en-202108.pdf | 2024-02-01 14:40 | 3.2M | |
![[ ]](/icons/layout.gif) | shinewifi-x-quick-guide-en-202206.pdf | 2024-02-01 14:41 | 2.2M | |
![[ ]](/icons/layout.gif) | single-phase-inverter-with-compact-technology-certificate-en50438.pdf | 2019-05-20 16:49 | 584K | |
![[ ]](/icons/layout.gif) | singlerail-roof-hook-assembly-en--1-.pdf | 2022-12-14 16:49 | 3.5M | |
![[ ]](/icons/layout.gif) | singlerail-roof-hook-assembly-en.pdf | 2023-07-24 14:25 | 3.8M | |
![[ ]](/icons/layout.gif) | sinlion-installation.pdf | 2018-06-05 13:58 | 156K | |
![[ ]](/icons/layout.gif) | sk2---installation-manual.pdf | 2021-11-10 13:29 | 727K | |
![[ ]](/icons/layout.gif) | skecustomernotificationpoweroptimizer-2-removed.pdf | 2023-03-17 14:45 | 262K | |
![[ ]](/icons/layout.gif) | sl-rack-dachhaken-sl-alu-vario-produktblatt-de.pdf | 2022-06-29 11:22 | 3.6M | |
![[ ]](/icons/layout.gif) | sl-rack-drilling-screws-en-1.pdf | 2022-06-29 14:36 | 1.0M | |
![[ ]](/icons/layout.gif) | sl-rack-haltbarkeitsgarantie-de-en.pdf | 2022-06-29 15:34 | 852K | |
![[ ]](/icons/layout.gif) | sl-rack-module-clamps-vario-product-sheet-en.pdf | 2024-04-04 12:24 | 1.7M | |
![[ ]](/icons/layout.gif) | sl-rack-pitched-roof-system-en-14.pdf | 2022-06-29 10:06 | 12M | |
![[ ]](/icons/layout.gif) | sl-rack-pitched-roof-system-en.pdf | 2023-08-30 15:07 | 14M | |
![[ ]](/icons/layout.gif) | sl-rack-rails-product-sheet-en--1-.pdf | 2022-06-29 14:19 | 2.2M | |
![[ ]](/icons/layout.gif) | sl-rack-rails-product-sheet-en.pdf | 2022-06-29 09:37 | 2.2M | |
![[ ]](/icons/layout.gif) | sl-rack-roof-hook-sl-a2-product-sheet-en.pdf | 2022-06-29 13:44 | 2.5M | |
![[ ]](/icons/layout.gif) | sl-rack-trapez-iii-product-sheet-en.pdf | 2022-06-29 13:21 | 2.5M | |
![[ ]](/icons/layout.gif) | sl-rack-trapez-v-product-sheet-en.pdf | 2022-06-29 12:05 | 2.6M | |
![[ ]](/icons/layout.gif) | slrackclip.pdf | 2022-06-29 15:14 | 811K | |
![[ ]](/icons/layout.gif) | smart-battery-sense-manual-en--1-.pdf | 2021-07-13 16:24 | 769K | |
![[ ]](/icons/layout.gif) | smart-bms-12-100-manual-en.pdf | 2021-04-21 15:58 | 1.7M | |
![[ ]](/icons/layout.gif) | smart-charger-datasheet-short.pdf | 2023-07-28 11:30 | 578K | |
![[ ]](/icons/layout.gif) | smart-home-panel.pdf | 2024-01-11 10:43 | 2.7M | |
![[ ]](/icons/layout.gif) | smart-lan-datasheet-3.23.pdf | 2024-06-28 11:55 | 568K | |
![[ ]](/icons/layout.gif) | smart-meter--spm-ct-e-tpm-ct-e--datasheet-en-202305.pdf | 2024-03-06 15:25 | 592K | |
![[ ]](/icons/layout.gif) | smart-meter--spm-e-tpm-e--datasheet-en-202305.pdf | 2023-11-10 09:08 | 535K | |
![[ ]](/icons/layout.gif) | smart-meter-iskraemeco-am550.pdf | 2021-09-30 12:24 | 2.0M | |
![[ ]](/icons/layout.gif) | smart-module-brochure.pdf | 2021-08-23 15:25 | 1.6M | |
![[ ]](/icons/layout.gif) | smart-module-installation-guide.pdf | 2021-08-23 15:26 | 1.0M | |
![[ ]](/icons/layout.gif) | smart-module-mcs-certificate.pdf | 2021-08-23 15:25 | 1.7M | |
![[ ]](/icons/layout.gif) | smart-plug-flyer-v4.pdf | 2022-10-27 13:15 | 4.0M | |
![[ ]](/icons/layout.gif) | smart-plug-user-guide-2023.pdf | 2023-10-16 16:25 | 172K | |
![[ ]](/icons/layout.gif) | smart-wifi-datasheet-3.23.pdf | 2024-06-28 11:49 | 1.1M | |
![[ ]](/icons/layout.gif) | smartdongle-sdonglea-03-eu.pdf | 2023-10-31 10:58 | 217K | |
![[ ]](/icons/layout.gif) | smartsolar-control-display-manual-en.pdf | 2021-06-29 12:37 | 1.2M | |
![[ ]](/icons/layout.gif) | smartsolar-mppt-rs-en.pdf | 2021-07-13 16:20 | 4.8M | |
![[ ]](/icons/layout.gif) | smartsolar15035.pdf | 2024-01-15 14:06 | 9.9M | |
![[ ]](/icons/unknown.gif) | smartsolarmpptRS | 2021-01-12 13:47 | 4.3M | |
![[ ]](/icons/layout.gif) | smatr-4g-datasheet-3.23.pdf | 2024-06-28 11:59 | 635K | |
![[ ]](/icons/layout.gif) | sme-276kwh-schematic.pdf | 2024-03-13 17:06 | 36K | |
![[ ]](/icons/layout.gif) | sme-battery-cabinet-installation-manual-v1.0.pdf | 2024-05-13 13:09 | 929K | |
![[ ]](/icons/layout.gif) | soalredge-se50k---se82.8k-g99.pdf | 2019-03-26 16:54 | 902K | |
![[ ]](/icons/layout.gif) | sofar-05231-221016062830.pdf | 2022-11-02 15:35 | 246K | |
![[ ]](/icons/layout.gif) | sofar-1-3-ktl-g3-datasheet.pdf | 2020-06-04 15:22 | 663K | |
![[ ]](/icons/layout.gif) | sofar-1-3-ktl-g3-user-manual20200305.pdf | 2020-06-04 15:19 | 8.2M | |
![[ ]](/icons/layout.gif) | sofar-1-3ktl-g3-user-manual-20200305.pdf | 2020-06-04 15:21 | 1.7M | |
![[ ]](/icons/layout.gif) | sofar-1-3ktl-user-manual-20200506.pdf | 2020-05-13 11:25 | 1.6M | |
![[ ]](/icons/layout.gif) | sofar-1-3kw-g3-g98-cert.pdf | 2020-06-04 15:22 | 222K | |
![[ ]](/icons/layout.gif) | sofar-3-6ktlm-g2-user-manual20200506.pdf | 2020-05-13 15:39 | 1.6M | |
![[ ]](/icons/layout.gif) | sofar-3.0-ktlm-g98.pdf | 2019-04-23 11:26 | 210K | |
![[ ]](/icons/layout.gif) | sofar-3.6-6-ktlm-g99.pdf | 2019-04-23 11:26 | 214K | |
![[ ]](/icons/layout.gif) | sofar-3ktlm-g2-sofar-3.6ktlm-g2-voc-g98-1.pdf | 2019-04-23 15:54 | 254K | |
![[ ]](/icons/layout.gif) | sofar-7k-10.5ktlm-g3-user-manual-20220304-au.pdf | 2022-09-21 10:52 | 4.0M | |
![[ ]](/icons/layout.gif) | sofar-10-15-17-20-tl-manual.pdf | 2017-10-10 10:44 | 13M | |
![[ ]](/icons/layout.gif) | sofar-10-15-17-20kw-tl-datasheet.pdf | 2017-07-04 10:40 | 1.9M | |
![[ ]](/icons/layout.gif) | sofar-10-20kw-uk-report-g83-z2.pdf | 2018-03-02 09:33 | 37K | |
![[ ]](/icons/layout.gif) | sofar-10k.pdf | 2018-02-23 09:49 | 406K | |
![[ ]](/icons/layout.gif) | sofar-30-33-40-tl-datasheet.pdf | 2017-09-07 10:59 | 1.6M | |
![[ ]](/icons/layout.gif) | sofar-30-40kw-uk-report-g59-z1.pdf | 2018-03-02 09:32 | 1.1M | |
![[ ]](/icons/layout.gif) | sofar-1100-3000-tl-datasheet.pdf | 2017-06-22 11:23 | 1.8M | |
![[ ]](/icons/unknown.gif) | sofar-1100-3000-tl-g83-2 | 2017-06-22 11:30 | 501K | |
![[ ]](/icons/unknown.gif) | sofar-3000-3680-tlm-g83-2 | 2017-06-23 09:05 | 498K | |
![[ ]](/icons/layout.gif) | sofar-3000-3680-tlm-g83-2.pdf | 2017-06-23 09:12 | 498K | |
![[ ]](/icons/layout.gif) | sofar-3000-6000-tlm-datasheet.pdf | 2017-06-22 12:14 | 1.9M | |
![[ ]](/icons/layout.gif) | sofar-3680-g83.pdf | 2018-06-06 15:30 | 344K | |
![[ ]](/icons/layout.gif) | sofar-4000-5000-tlm-g59-3.pdf | 2017-06-23 09:08 | 492K | |
![[ ]](/icons/layout.gif) | sofar-10000tl-g83-2.pdf | 2017-07-04 10:42 | 312K | |
![[ ]](/icons/layout.gif) | sofar-20000tl-g2.pdf | 2020-03-05 10:38 | 199K | |
![[ ]](/icons/layout.gif) | sofar-50000-70000tl-datasheet.pdf | 2018-10-26 11:53 | 1.8M | |
![[ ]](/icons/layout.gif) | sofar-amass-battery-datasheet.pdf | 2019-09-23 10:41 | 958K | |
![[ ]](/icons/layout.gif) | sofar-amass-battery-warranty--gtx2500gtx5000-20201210.pdf | 2021-03-09 13:30 | 328K | |
![[ ]](/icons/layout.gif) | sofar-amass-gtx2000-datasheet-080321.pdf | 2021-03-08 10:14 | 769K | |
![[ ]](/icons/layout.gif) | sofar-amass-gtx5000-datasheet-080321.pdf | 2021-03-08 16:28 | 679K | |
![[ ]](/icons/layout.gif) | sofar-amass-gtx5000-manual-080321.pdf | 2021-03-08 16:38 | 2.2M | |
![[ ]](/icons/unknown.gif) | sofar-amass-quick-guide | 2019-09-24 09:14 | 1.0M | |
![[ ]](/icons/layout.gif) | sofar-amass-user-manual-20190531.pdf | 2020-06-19 14:07 | 1.0M | |
![[ ]](/icons/layout.gif) | sofar-amass-user-manual.pdf | 2019-09-24 09:13 | 1.9M | |
![[ ]](/icons/layout.gif) | sofar-chint-contactor-cert.pdf | 2017-09-29 13:58 | 637K | |
![[ ]](/icons/layout.gif) | sofar-chint-contactor-datasheet.pdf | 2017-09-29 13:58 | 415K | |
![[ ]](/icons/layout.gif) | sofar-country-code.pdf | 2019-11-27 14:01 | 135K | |
![[ ]](/icons/layout.gif) | sofar-datasheet-sofar3ktlm-g2-7.5ktlm.pdf | 2018-12-06 09:29 | 2.0M | |
![[ ]](/icons/layout.gif) | sofar-eps-critical-load-connection.pdf | 2017-11-08 15:39 | 30K | |
![[ ]](/icons/unknown.gif) | sofar-eps-critical-load-connection.xlsx | 2017-09-29 13:59 | 11K | |
![[ ]](/icons/layout.gif) | sofar-export-limitaiton-manual.pdf | 2019-01-10 10:33 | 4.4M | |
![[ ]](/icons/layout.gif) | sofar-g3-ktlm---user-manual.docx---google-docs.pdf | 2022-09-21 10:54 | 3.3M | |
![[ ]](/icons/layout.gif) | sofar-g3-ktlm.pdf | 2022-06-27 10:12 | 636K | |
![[ ]](/icons/layout.gif) | sofar-g59-30000-33000-40000.pdf | 2018-02-23 09:55 | 522K | |
![[ ]](/icons/layout.gif) | sofar-g100-20-33ktl-g2.pdf | 2020-05-12 09:06 | 2.1M | |
![[ ]](/icons/layout.gif) | sofar-g100-cert-3-7k.pdf | 2020-06-09 11:07 | 1.0M | |
![[ ]](/icons/layout.gif) | sofar-g100-declaration.pdf | 2018-10-09 09:19 | 137K | |
![[ ]](/icons/layout.gif) | sofar-g100-hybrid.pdf | 2019-11-18 12:55 | 851K | |
![[ ]](/icons/layout.gif) | sofar-gtx5000-ce-cert.pdf | 2021-03-09 13:31 | 157K | |
![[ ]](/icons/layout.gif) | sofar-hyd-3-6k-es-datasheet-20210303.pdf | 2021-05-05 09:23 | 176K | |
![[ ]](/icons/layout.gif) | sofar-hyd-3-6kw-datasheet202104v1-20.pdf | 2021-04-26 11:05 | 903K | |
![[ ]](/icons/layout.gif) | sofar-hyd-es-user-manual-20200330.pdf | 2020-05-12 16:47 | 2.0M | |
![[ ]](/icons/layout.gif) | sofar-hyd-user-manual-191101-v1.2.pdf | 2019-11-04 10:32 | 4.3M | |
![[ ]](/icons/layout.gif) | sofar-hyd-user-manual.pdf | 2020-05-12 16:46 | 2.0M | |
![[ ]](/icons/layout.gif) | sofar-hyd3-6k-en50438-european-coc.pdf | 2019-05-17 11:00 | 275K | |
![[ ]](/icons/layout.gif) | sofar-hyd3-6kw-coc-g83.pdf | 2018-11-29 17:28 | 150K | |
![[ ]](/icons/layout.gif) | sofar-hyd3-6kw-g59.pdf | 2018-11-29 17:28 | 170K | |
![[ ]](/icons/layout.gif) | sofar-inverter-10yr-warranty.pdf | 2017-06-22 11:27 | 168K | |
![[ ]](/icons/layout.gif) | sofar-ktl-datasheet.pdf | 2018-02-12 17:00 | 2.2M | |
![[ ]](/icons/layout.gif) | sofar-ktlm-g2-datasheet.pdf | 2018-06-05 16:35 | 1.5M | |
![[ ]](/icons/layout.gif) | sofar-ktlm-g83.pdf | 2018-07-27 09:04 | 98K | |
![[ ]](/icons/layout.gif) | sofar-lan-manual.pdf | 2019-11-18 10:30 | 871K | |
![[ ]](/icons/layout.gif) | sofar-lan-stick-datasheet.pdf | 2019-08-14 09:48 | 1.5M | |
![[ ]](/icons/layout.gif) | sofar-me-3000sp-user-manual20200522.pdf | 2020-06-29 14:38 | 1.4M | |
![[ ]](/icons/layout.gif) | sofar-me3000-EN50438.pdf | 2019-10-15 08:30 | 191K | |
![[ ]](/icons/layout.gif) | sofar-me3000-datasheet-picture.pdf | 2019-04-18 12:15 | 1.4M | |
![[ ]](/icons/layout.gif) | sofar-me3000-monitoring-quick-midsummer.pdf | 2018-04-12 11:00 | 310K | |
![[ ]](/icons/layout.gif) | sofar-me3000sp-common-errors.pdf | 2019-11-04 10:13 | 133K | |
![[ ]](/icons/layout.gif) | sofar-me3000sp-datasheet.pdf | 2019-06-12 09:20 | 1.7M | |
![[ ]](/icons/layout.gif) | sofar-me3000sp-install-manual-2017.pdf | 2017-06-26 14:49 | 1.9M | |
![[ ]](/icons/layout.gif) | sofar-me3000sp-manual-v1-5-4.pdf | 2022-12-19 09:35 | 283K | |
![[ ]](/icons/layout.gif) | sofar-me3000sp-manual-v1-5.pdf | 2017-08-04 16:34 | 2.2M | |
![[ ]](/icons/layout.gif) | sofar-me3000sp-manual-v1-6.pdf | 2018-10-25 09:14 | 1.2M | |
![[ ]](/icons/layout.gif) | sofar-me3000sp-warranty.pdf | 2017-08-24 17:15 | 51K | |
![[ ]](/icons/layout.gif) | sofar-quick-install-guide-v2.pdf | 2020-06-24 10:18 | 731K | |
![[ ]](/icons/layout.gif) | sofar-quick-install-guide-v3.pdf | 2020-06-24 10:20 | 731K | |
![[ ]](/icons/layout.gif) | sofar-storafe-web-wifi.pdf | 2018-02-13 12:22 | 1.5M | |
![[ ]](/icons/layout.gif) | sofar-storage-android-manual.pdf | 2017-10-18 11:17 | 1.6M | |
![[ ]](/icons/layout.gif) | sofar-storage-ios-manual.pdf | 2017-10-18 11:17 | 1.2M | |
![[ ]](/icons/layout.gif) | sofar-storage-manual.pdf | 2017-05-19 17:23 | 1.8M | |
![[ ]](/icons/layout.gif) | sofar-storage-quick-install.pdf | 2018-02-22 10:21 | 796K | |
![[ ]](/icons/layout.gif) | sofar-storage-wifi-setup.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/layout.gif) | sofar-tlm-manual.pdf | 2017-10-05 16:24 | 18M | |
![[ ]](/icons/layout.gif) | sofar-warranty-extension-process.pdf | 2024-01-04 15:17 | 1.3M | |
![[ ]](/icons/layout.gif) | sofar-warranty-hybrid--1-.pdf | 2019-11-04 10:09 | 171K | |
![[ ]](/icons/layout.gif) | sofar-warranty-hybrid-.pdf | 2019-11-04 10:10 | 171K | |
![[ ]](/icons/layout.gif) | sofar-warranty-hybrid.pdf | 2019-10-28 10:55 | 171K | |
![[ ]](/icons/layout.gif) | sofar-wifi-kits-user-manual-mobile.pdf | 2019-12-06 11:39 | 515K | |
![[ ]](/icons/layout.gif) | sofar013_01.pdf | 2018-02-23 09:50 | 406K | |
![[ ]](/icons/layout.gif) | sofar1.1k-3ktl-user-manual.pdf | 2020-01-16 09:48 | 1.6M | |
![[ ]](/icons/layout.gif) | sofar1.1k-3ktl-user-manual20190904.pdf | 2019-11-04 10:35 | 6.5M | |
![[ ]](/icons/layout.gif) | sofar3-6ktlm-usermanual.pdf | 2019-11-04 10:45 | 2.1M | |
![[ ]](/icons/layout.gif) | sofar7.5ktlm-user-manual.pdf | 2019-11-04 10:45 | 2.2M | |
![[ ]](/icons/layout.gif) | sofar1100tl-3000tl-g98-1.pdf | 2019-04-23 10:49 | 171K | |
![[ ]](/icons/layout.gif) | sofarsolar-datasheet-3-7.5ktlm-g2-en-20200812.pdf | 2020-11-03 11:19 | 556K | |
![[ ]](/icons/layout.gif) | sofarsolar-hyd-1ph-datasheet-en-202012-v1-20201216.pdf | 2021-04-26 11:30 | 572K | |
![[ ]](/icons/layout.gif) | sofarsolar-manual-sofar-3000-5000tlm.pdf | 2018-06-07 11:53 | 5.4M | |
![[ ]](/icons/layout.gif) | sofarsolar-manual-sofar10000tl-20000tl.pdf | 2019-10-30 10:15 | 14M | |
![[ ]](/icons/layout.gif) | sofarsolar10-20kw--en-50438-2013.pdf | 2019-05-22 14:59 | 304K | |
![[ ]](/icons/layout.gif) | software-business-development-officer-pack.pdf | 2021-11-26 15:33 | 2.2M | |
![[ ]](/icons/layout.gif) | sol-mc4-evo-2-ilf-y-spl-11014106-en--1-.pdf | 2024-06-04 12:43 | 1.8M | |
![[ ]](/icons/unknown.gif) | sol-mc4-evo-2-ilf-y-spl-11014106-en.pdf#page=6 | 2024-06-04 12:42 | 1.8M | |
![[ ]](/icons/layout.gif) | sol-mc4-evo-ready-11014099-en.pdf | 2024-05-28 10:47 | 702K | |
![[ ]](/icons/layout.gif) | sol-pvtools-11014090-en.pdf | 2023-09-27 11:45 | 5.6M | |
![[ ]](/icons/layout.gif) | sola-x-hybrid-datasheet.pdf | 2017-05-19 17:23 | 1.0M | |
![[IMG]](/icons/image2.gif) | solar-PV-parallel-connection-positive-negative-simple-diagram.jpg | 2019-02-14 08:54 | 15K | |
![[ ]](/icons/layout.gif) | solar-cable-h1z2z2-k--1-.pdf | 2021-09-27 15:10 | 222K | |
![[ ]](/icons/layout.gif) | solar-cable-h1z2z2-k--3-.pdf | 2021-12-09 12:32 | 222K | |
![[ ]](/icons/layout.gif) | solar-cable-h1z2z2-k.pdf | 2021-09-27 14:54 | 222K | |
![[ ]](/icons/layout.gif) | solar-controller-tracer-a-series-manual.pdf | 2017-12-14 10:04 | 1.1M | |
![[ ]](/icons/layout.gif) | solar-edge-hd-wave-inverter-datasheet.pdf | 2017-05-19 17:23 | 277K | |
![[ ]](/icons/layout.gif) | solar-edge-meter-datasheet.pdf | 2017-05-19 17:23 | 582K | |
![[ ]](/icons/layout.gif) | solar-edge-performance-v-string-inverters.pdf | 2017-05-19 17:23 | 1.2M | |
![[ ]](/icons/layout.gif) | solar-edge-v-micro-inverters.pdf | 2017-07-04 10:49 | 173K | |
![[ ]](/icons/layout.gif) | solar-iboost-brochure.pdf | 2021-06-09 11:26 | 411K | |
![[ ]](/icons/layout.gif) | solar-iboost-user-manual.pdf | 2021-11-25 10:48 | 1.0M | |
![[ ]](/icons/layout.gif) | solar-limpet-bracket-datasheet.pdf | 2020-06-29 16:36 | 117K | |
![[ ]](/icons/layout.gif) | solar-limpet-mcs-certificate.pdf | 2020-06-29 16:36 | 321K | |
![[ ]](/icons/layout.gif) | solar-limpet-pmj-screw-fixing-datasheet.pdf | 2020-06-29 16:33 | 216K | |
![[ ]](/icons/layout.gif) | solar-limpet-slate-install-guide-2015.pdf | 2020-06-29 16:37 | 394K | |
![[ ]](/icons/layout.gif) | solar-limpet-tile-install-guide-2018.pdf | 2020-06-29 16:37 | 427K | |
![[IMG]](/icons/image2.gif) | solar-panel-wiring-parallel-2-12V-panels-connection.jpg | 2019-02-14 08:53 | 15K | |
![[ ]](/icons/layout.gif) | solar-speed-clip-overview--1-.pdf | 2024-06-26 10:35 | 237K | |
![[ ]](/icons/layout.gif) | solar-terminals-and-tools.pdf | 2022-10-06 10:34 | 1.1M | |
![[ ]](/icons/layout.gif) | solar_mount_installation_manual.pdf | 2017-05-19 17:23 | 2.0M | |
![[ ]](/icons/layout.gif) | solarcache-gateway-manual.pdf | 2017-05-19 17:23 | 331K | |
![[ ]](/icons/layout.gif) | solarcache-remote-manual.pdf | 2017-05-19 17:23 | 331K | |
![[ ]](/icons/layout.gif) | solarcache-switch-manual.pdf | 2017-05-19 17:23 | 655K | |
![[ ]](/icons/layout.gif) | solarcache-warranty.pdf | 2017-05-19 17:23 | 20K | |
![[ ]](/icons/layout.gif) | solaredge-3ph-synergy-datasheet.pdf | 2019-02-11 16:56 | 531K | |
![[ ]](/icons/layout.gif) | solaredge-3ph-synergy-manual.pdf | 2019-02-11 16:56 | 2.5M | |
![[ ]](/icons/layout.gif) | solaredge-25-33kw-3ph-datasheet-080321.pdf | 2021-03-08 10:42 | 329K | |
![[ ]](/icons/layout.gif) | solaredge-25-33kw-3ph-manual-040321.pdf | 2021-03-04 14:33 | 2.2M | |
![[ ]](/icons/layout.gif) | solaredge-25-33kw-3ph-quick-guide-040321.pdf | 2021-03-04 14:34 | 2.1M | |
![[ ]](/icons/layout.gif) | solaredge-25kw-3ph-datasheet-040321.pdf | 2021-03-04 14:28 | 304K | |
![[ ]](/icons/layout.gif) | solaredge-50k+g99.pdf | 2019-03-26 16:55 | 902K | |
![[ ]](/icons/layout.gif) | solaredge-compact-brochure.pdf | 2018-03-01 12:24 | 5.4M | |
![[ ]](/icons/layout.gif) | solaredge-compact-datasheet.pdf | 2018-04-17 10:14 | 459K | |
![[ ]](/icons/layout.gif) | solaredge-control-communication-gateway.pdf | 2017-11-15 11:05 | 518K | |
![[ ]](/icons/layout.gif) | solaredge-ct-selector.pdf | 2018-03-01 15:43 | 301K | |
![[ ]](/icons/layout.gif) | solaredge-device-config-app.pdf | 2018-03-01 16:03 | 1.0M | |
![[ ]](/icons/layout.gif) | solaredge-energy-meter-flyer-29.10.18.pdf | 2019-01-02 17:32 | 418K | |
![[ ]](/icons/layout.gif) | solaredge-enet-manual.pdf | 2021-11-05 16:24 | 621K | |
![[ ]](/icons/layout.gif) | solaredge-fire-safety.pdf | 2017-05-19 17:23 | 760K | |
![[ ]](/icons/layout.gif) | solaredge-g59-2-test-report-se-7-17k.pdf | 2017-11-01 15:55 | 240K | |
![[ ]](/icons/layout.gif) | solaredge-g98-se3k--se17k-2.pdf | 2019-05-22 10:42 | 1.0M | |
![[ ]](/icons/layout.gif) | solaredge-g98-se1000m-se2500m-2.pdf | 2019-05-22 10:39 | 606K | |
![[ ]](/icons/layout.gif) | solaredge-g98-se2200h-se3680h-2.pdf | 2019-05-22 10:30 | 734K | |
![[ ]](/icons/layout.gif) | solaredge-g99-se3k-se17k-2.pdf | 2019-05-22 10:45 | 902K | |
![[ ]](/icons/unknown.gif) | solaredge-g99-se25k-se27.6k-2pdf | 2019-05-22 10:49 | 898K | |
![[ ]](/icons/layout.gif) | solaredge-g99-se50k-se82.8k-2.pdf | 2019-05-22 10:52 | 902K | |
![[ ]](/icons/layout.gif) | solaredge-g99-se4000h-se10000h.pdf | 2019-05-22 10:32 | 754K | |
![[ ]](/icons/layout.gif) | solaredge-g100-cert.pdf | 2018-11-05 14:19 | 361K | |
![[ ]](/icons/layout.gif) | solaredge-gateway-installation-guide.pdf | 2019-10-21 13:02 | 1.9M | |
![[ ]](/icons/layout.gif) | solaredge-hd-wave-datasheet-2017.pdf | 2017-08-08 17:19 | 275K | |
![[ ]](/icons/layout.gif) | solaredge-hd-wave-g83-certificate.pdf | 2017-05-19 17:23 | 475K | |
![[ ]](/icons/layout.gif) | solaredge-hd-wave-inverter-certificate--ireland-EN50438.pdf | 2019-05-20 16:43 | 672K | |
![[ ]](/icons/layout.gif) | solaredge-hdwave-g98.pdf | 2019-03-26 16:48 | 735K | |
![[ ]](/icons/layout.gif) | solaredge-hdwave-g99.pdf | 2019-03-26 16:50 | 754K | |
![[ ]](/icons/layout.gif) | solaredge-hdwave-screenless-datasheet.pdf | 2019-04-04 13:47 | 182K | |
![[ ]](/icons/layout.gif) | solaredge-home-backup-interface-single-phase-for-europe-ds-000209-eu.pdf | 2023-04-19 17:33 | 127K | |
![[ ]](/icons/layout.gif) | solaredge-home-ev-charger-ds-preliminary.pdf | 2021-11-29 14:45 | 244K | |
![[ ]](/icons/layout.gif) | solaredge-home-hub-inverter-three-phase.pdf | 2022-10-28 10:41 | 200K | |
![[ ]](/icons/layout.gif) | solaredge-home-management-guide.pdf | 2018-03-01 16:02 | 838K | |
![[ ]](/icons/layout.gif) | solaredge-immersion-cases.pdf | 2018-03-01 15:30 | 519K | |
![[ ]](/icons/layout.gif) | solaredge-immersion-datasheet.pdf | 2018-03-01 14:33 | 415K | |
![[ ]](/icons/layout.gif) | solaredge-immersion-manual.pdf | 2018-03-01 14:34 | 2.8M | |
![[ ]](/icons/layout.gif) | solaredge-inline-energy-meter.pdf | 2022-06-16 11:05 | 1.3M | |
![[ ]](/icons/layout.gif) | solaredge-meter-application-note.pdf | 2017-05-19 17:23 | 1.0M | |
![[ ]](/icons/layout.gif) | solaredge-meter-installation-guide.pdf | 2017-05-19 17:23 | 6.3M | |
![[ ]](/icons/layout.gif) | solaredge-mixing-optimisers.pdf | 2017-06-30 09:34 | 180K | |
![[ ]](/icons/layout.gif) | solaredge-modbus-meter-installation-guide2019.pdf | 2019-01-02 17:29 | 4.2M | |
![[ ]](/icons/layout.gif) | solaredge-optimiser-inter-compatibility-2019.pdf | 2019-02-13 17:27 | 211K | |
![[ ]](/icons/layout.gif) | solaredge-optimisers-datasheet-aug17.pdf | 2017-08-15 13:47 | 247K | |
![[ ]](/icons/layout.gif) | solaredge-optimizer-intercompatibility.pdf | 2022-02-02 14:08 | 246K | |
![[ ]](/icons/layout.gif) | solaredge-power-optimizer-p370-p601-ds-000047-2.1-eng---valid-from-2021-08-30.pdf | 2022-02-02 14:08 | 201K | |
![[ ]](/icons/layout.gif) | solaredge-rs485-expansion-datasheet.pdf | 2017-11-15 10:45 | 2.4M | |
![[ ]](/icons/layout.gif) | solaredge-rs485-installation-manual.pdf | 2017-11-15 12:37 | 1.1M | |
![[ ]](/icons/layout.gif) | solaredge-se3k---se17k-g98.pdf | 2019-04-04 14:49 | 897K | |
![[ ]](/icons/layout.gif) | solaredge-se3k-se17k-g99.pdf | 2019-04-04 14:36 | 900K | |
![[ ]](/icons/layout.gif) | solaredge-se25k--27.6k-g99.pdf | 2019-03-26 16:53 | 884K | |
![[ ]](/icons/layout.gif) | solaredge-self-consump-brochure.pdf | 2018-03-01 14:34 | 1.2M | |
![[ ]](/icons/layout.gif) | solaredge-short-commercial-presentation.pdf | 2020-05-06 09:52 | 2.4M | |
![[ ]](/icons/layout.gif) | solaredge-single-phase-certificate--1-.pdf | 2022-01-25 17:24 | 393K | |
![[ ]](/icons/layout.gif) | solaredge-smart-module-datasheet.pdf | 2021-08-23 15:26 | 733K | |
![[ ]](/icons/layout.gif) | solaredge-socket-datasheet.pdf | 2018-03-01 16:02 | 356K | |
![[ ]](/icons/layout.gif) | solaredge-socket-manual.pdf | 2018-03-01 16:04 | 1.8M | |
![[ ]](/icons/unknown.gif) | solaredge-socket-quick-manual | 2018-03-01 16:04 | 795K | |
![[ ]](/icons/layout.gif) | solaredge-upgrade-best-practice.pdf | 2018-01-10 11:18 | 687K | |
![[ ]](/icons/layout.gif) | solaredge-warranty-2016.pdf | 2017-05-19 17:23 | 394K | |
![[ ]](/icons/layout.gif) | solaredge-warranty-april-2019--1---1-.pdf | 2022-02-02 14:07 | 170K | |
![[ ]](/icons/layout.gif) | solaredge-warranty-april-2019--1---2-.pdf | 2022-06-20 11:49 | 170K | |
![[ ]](/icons/layout.gif) | solaredge-warranty-april-2019--1---3-.pdf | 2022-06-20 12:17 | 170K | |
![[ ]](/icons/layout.gif) | solaredge-warranty-april-2019--1-.pdf | 2019-10-21 13:44 | 170K | |
![[ ]](/icons/layout.gif) | solaredge-warranty-april-2019.pdf | 2019-10-17 15:39 | 170K | |
![[ ]](/icons/layout.gif) | solaredge-warranty-december-2019.pdf | 2020-01-28 10:51 | 392K | |
![[ ]](/icons/layout.gif) | solaredge-warranty-july-2018.pdf | 2019-01-02 17:42 | 610K | |
![[ ]](/icons/layout.gif) | solaredge-wifi-manual.pdf | 2017-05-19 17:23 | 1.1M | |
![[ ]](/icons/layout.gif) | solaredge-wifi-zigbee-antenna-datasheet.pdf | 2019-10-17 16:08 | 211K | |
![[ ]](/icons/layout.gif) | solaredge-wireless-gateway-and-wireless-repeater-datasheet-uk.pdf | 2022-06-20 11:42 | 462K | |
![[ ]](/icons/layout.gif) | solaredge-wnd-modbus-meter-datasheet-march19.pdf | 2019-04-16 15:02 | 626K | |
![[ ]](/icons/layout.gif) | solaredge-zigbee-manual.pdf | 2018-03-05 12:28 | 4.6M | |
![[ ]](/icons/layout.gif) | solaredge__modbus_meter_datasheet2019.pdf | 2019-01-02 17:28 | 712K | |
![[ ]](/icons/unknown.gif) | solaredgecatalogue | 2019-10-17 15:33 | 3.3M | |
![[ ]](/icons/unknown.gif) | solaredgewifizigbeebrochure | 2019-10-17 15:44 | 2.6M | |
![[ ]](/icons/layout.gif) | solarflash-instruction-booklet-july-2021.pdf | 2023-07-26 12:58 | 2.1M | |
![[ ]](/icons/layout.gif) | solarflash-instruction-genius.pdf | 2017-05-19 17:23 | 649K | |
![[ ]](/icons/layout.gif) | solarfox-product-catalogue.pdf | 2024-03-06 14:50 | 9.3M | |
![[ ]](/icons/layout.gif) | solarfox-quick-guide---multilingual.pdf | 2024-03-25 08:37 | 2.3M | |
![[ ]](/icons/layout.gif) | solarfox-sf100-series-datasheet-en.pdf | 2024-03-06 16:10 | 117K | |
![[ ]](/icons/layout.gif) | solarfox-sf300-series-datasheet-en.pdf | 2024-07-18 11:00 | 284K | |
![[ ]](/icons/layout.gif) | solarfox-warranty-policy.pdf | 2024-05-16 14:07 | 103K | |
![[ ]](/icons/layout.gif) | solarguard-130-product-overview.pdf | 2024-06-26 13:11 | 241K | |
![[ ]](/icons/layout.gif) | solarman-app-user-manual--storage-.pdf | 2022-02-04 11:46 | 7.5M | |
![[ ]](/icons/layout.gif) | solarport-modular-datasheet.pdf | 2023-05-03 10:37 | 369K | |
![[ ]](/icons/layout.gif) | solarport-modular-system-installation-guide.pdf | 2023-11-15 09:50 | 2.7M | |
![[ ]](/icons/unknown.gif) | solarport_2x4 | 2024-02-26 13:35 | 396K | |
![[ ]](/icons/unknown.gif) | solarport_2x11 | 2024-02-26 13:34 | 446K | |
![[ ]](/icons/unknown.gif) | solarport_6x2 | 2024-02-26 13:36 | 418K | |
![[ ]](/icons/unknown.gif) | solarport_8x2 | 2024-02-26 13:37 | 421K | |
![[ ]](/icons/unknown.gif) | solarport_9x2 | 2024-02-26 13:38 | 434K | |
![[ ]](/icons/layout.gif) | solarworld-mono-solar-cell-datasheet.pdf | 2018-02-08 15:10 | 280K | |
![[ ]](/icons/layout.gif) | solax-03839-211009025735.pdf | 2022-11-02 15:30 | 260K | |
![[ ]](/icons/layout.gif) | solax-5000-g59-3.pdf | 2017-05-19 17:23 | 181K | |
![[ ]](/icons/layout.gif) | solax-ac-charger.pdf | 2017-10-25 14:49 | 661K | |
![[ ]](/icons/layout.gif) | solax-ac-connections.pdf | 2017-11-14 13:57 | 1.6M | |
![[ ]](/icons/layout.gif) | solax-ac-quick.pdf | 2018-02-14 09:41 | 11M | |
![[ ]](/icons/layout.gif) | solax-ac-user-manual.pdf | 2018-02-14 09:40 | 15M | |
![[ ]](/icons/layout.gif) | solax-all-hybrid-datasheet2017.pdf | 2017-08-09 15:19 | 2.6M | |
![[ ]](/icons/layout.gif) | solax-battery.pdf | 2017-05-19 17:23 | 473K | |
![[ ]](/icons/layout.gif) | solax-boost-inverter-overview.pdf | 2022-06-24 14:57 | 567K | |
![[ ]](/icons/layout.gif) | solax-chint-ddsu666-80a-installation-guide.pdf | 2023-01-24 09:35 | 670K | |
![[ ]](/icons/layout.gif) | solax-chint-ddsu666-ct-1.56a-installation-guide.pdf | 2023-05-26 12:51 | 695K | |
![[ ]](/icons/layout.gif) | solax-chint-meter-manual.pdf | 2018-05-16 13:54 | 556K | |
![[ ]](/icons/layout.gif) | solax-datasheets.pdf | 2017-06-06 10:34 | 2.4M | |
![[ ]](/icons/layout.gif) | solax-energy-controller-nfi.pdf | 2018-05-16 12:23 | 1.2M | |
![[ ]](/icons/layout.gif) | solax-g59-3.pdf | 2017-05-19 17:23 | 378K | |
![[ ]](/icons/layout.gif) | solax-g83.pdf | 2017-05-19 17:23 | 71K | |
![[ ]](/icons/layout.gif) | solax-hybrid-x1-x3-datasheet.pdf | 2017-05-19 17:23 | 1.6M | |
![[ ]](/icons/layout.gif) | solax-lg-battery-datasheet.pdf | 2017-08-09 15:38 | 1.6M | |
![[ ]](/icons/layout.gif) | solax-lg-wiring.pdf | 2017-08-09 15:31 | 2.6M | |
![[ ]](/icons/layout.gif) | solax-meter-SDM630MCT.pdf | 2019-04-17 11:34 | 533K | |
![[ ]](/icons/layout.gif) | solax-mic-3ph-datasheet.pdf | 2019-08-23 16:58 | 1.4M | |
![[ ]](/icons/layout.gif) | solax-mic-3ph-install-manual-quick.pdf | 2019-08-23 16:58 | 2.5M | |
![[ ]](/icons/layout.gif) | solax-monitoring.compressed.pdf | 2017-05-19 17:23 | 350K | |
![[ ]](/icons/layout.gif) | solax-power-warranty-policy-2015.pdf | 2019-08-22 14:24 | 98K | |
![[ ]](/icons/layout.gif) | solax-power-warranty-policy-2017-uk.pdf | 2022-08-04 15:45 | 98K | |
![[ ]](/icons/layout.gif) | solax-pylon-wiring.pdf | 2017-08-09 15:23 | 2.1M | |
![[ ]](/icons/layout.gif) | solax-rma-form-2020.pdf | 2020-01-15 14:20 | 131K | |
![[ ]](/icons/layout.gif) | solax-sinlion-datasheet.pdf | 2018-03-13 17:24 | 357K | |
![[ ]](/icons/layout.gif) | solax-triple-3kwh-conform.pdf | 2022-06-20 14:38 | 273K | |
![[ ]](/icons/layout.gif) | solax-triple-3kwh-datasheet.pdf | 2024-03-19 11:44 | 2.2M | |
![[ ]](/icons/layout.gif) | solax-triple-3kwh-manual.pdf | 2023-01-12 10:54 | 12M | |
![[ ]](/icons/layout.gif) | solax-triple-3kwh-quick-guide.pdf | 2023-01-12 10:55 | 7.4M | |
![[ ]](/icons/layout.gif) | solax-triple-power-battery.pdf | 2019-03-06 13:48 | 116K | |
![[ ]](/icons/layout.gif) | solax-triple-power-consumer-warranty.pdf | 2019-03-06 14:15 | 1.3M | |
![[ ]](/icons/layout.gif) | solax-uk-warranty.pdf | 2017-11-16 15:51 | 98K | |
![[ ]](/icons/layout.gif) | solax-warranty-terms-conditions-uk-update.pdf | 2023-11-30 11:38 | 606K | |
![[ ]](/icons/layout.gif) | solax-warranty-terms-conditions-uk.pdf | 2023-11-30 11:30 | 606K | |
![[ ]](/icons/layout.gif) | solax-wifi---4g--product-code-104006000000----brief-guide--1-.pdf | 2024-03-07 17:19 | 295K | |
![[ ]](/icons/layout.gif) | solax-wifi-guide.pdf | 2017-05-19 17:23 | 641K | |
![[ ]](/icons/layout.gif) | solax-x1-ac-3.0-3.6-g98.pdf | 2019-05-09 16:44 | 304K | |
![[ ]](/icons/layout.gif) | solax-x1-ac-datasheet-080121.pdf | 2021-01-08 10:58 | 1.0M | |
![[ ]](/icons/layout.gif) | solax-x1-ac-datasheet-100820.pdf | 2020-08-10 16:22 | 157K | |
![[ ]](/icons/layout.gif) | solax-x1-ac-datasheet.pdf | 2020-08-10 16:22 | 157K | |
![[ ]](/icons/layout.gif) | solax-x1-ac-user-manual.pdf | 2019-01-21 11:18 | 6.2M | |
![[ ]](/icons/layout.gif) | solax-x1-fit-datasheet.pdf | 2022-06-20 14:46 | 818K | |
![[ ]](/icons/layout.gif) | solax-x1-fit-manual.pdf | 2019-06-24 11:42 | 14M | |
![[ ]](/icons/layout.gif) | solax-x1-fit-quick.pdf | 2019-06-24 11:42 | 11M | |
![[ ]](/icons/layout.gif) | solax-x1-g4-fit-3-7-user-manual.pdf | 2022-08-30 17:37 | 14M | |
![[ ]](/icons/layout.gif) | solax-x1-g83.pdf | 2017-06-06 10:34 | 169K | |
![[ ]](/icons/layout.gif) | solax-x1-hybrid-3-3.7-g98.pdf | 2019-05-09 16:42 | 330K | |
![[ ]](/icons/layout.gif) | solax-x1-hybrid-4-6-g99.pdf | 2019-05-09 16:44 | 346K | |
![[ ]](/icons/layout.gif) | solax-x1-hybrid-en50549-d-085769-0059-rev.00-1.pdf | 2022-02-25 15:31 | 2.6M | |
![[ ]](/icons/layout.gif) | solax-x1-hybrid-g4-en50549-ak-50496160-0001.pdf | 2022-08-31 17:12 | 564K | |
![[ ]](/icons/layout.gif) | solax-x1-hybrid-g4-x1-fit-g4-ena-engineering-recommendation-g100-issue-2-20230628--2---1-.pdf | 2023-11-06 10:53 | 114K | |
![[ ]](/icons/layout.gif) | solax-x1-hybrid-g100.pdf | 2020-10-30 14:15 | 208K | |
![[ ]](/icons/layout.gif) | solax-x1-hybrid.pdf | 2022-04-12 11:19 | 916K | |
![[ ]](/icons/layout.gif) | solax-x1-retro-fit-datasheet-080121.pdf | 2021-01-08 11:43 | 1.2M | |
![[ ]](/icons/layout.gif) | solax-x3-30-36kw-datasheet.pdf | 2019-09-30 12:50 | 925K | |
![[ ]](/icons/layout.gif) | solax-x3-30-36kw-user-manual.pdf | 2019-09-30 12:51 | 3.1M | |
![[ ]](/icons/layout.gif) | solax-x3-hybrid-en50549-6065844.01-aoc-v1.2.pdf | 2022-06-24 15:58 | 895K | |
![[ ]](/icons/layout.gif) | solax-x3-hybrid-g4-en50549-ak50496764-0001--1-.pdf | 2023-01-24 14:53 | 568K | |
![[ ]](/icons/layout.gif) | solax-x3-hybrid-g4-en50549-ak50496764-0001.pdf | 2022-08-31 17:15 | 568K | |
![[ ]](/icons/layout.gif) | solax-x3-hybrid-g4-rd1699-ak50524854-0001.pdf | 2023-01-24 13:45 | 856K | |
![[ ]](/icons/layout.gif) | solax-x3-hybrid-g99.pdf | 2021-09-21 13:13 | 670K | |
![[ ]](/icons/layout.gif) | solax-x3-hybrid-user-manual.pdf | 2018-02-01 15:21 | 7.3M | |
![[ ]](/icons/layout.gif) | solax-x3-hybrid.pdf | 2018-02-06 09:45 | 109K | |
![[ ]](/icons/layout.gif) | solax-x3-mic-en50549-u20-0213--1-.pdf | 2022-02-08 16:42 | 500K | |
![[ ]](/icons/layout.gif) | solax-x3-pro-en50549-d-085769-0058-rev.00.pdf | 2022-06-28 17:23 | 696K | |
![[ ]](/icons/layout.gif) | solax-x3-retrofit-datasheet.pdf | 2020-01-22 11:47 | 4.5M | |
![[ ]](/icons/layout.gif) | solax1-hybrid-g100-declaration-20181227.pdf | 2022-10-03 14:45 | 208K | |
![[ ]](/icons/layout.gif) | solaxx3hybridv2.3datasheet.pdf | 2023-05-19 12:44 | 1.9M | |
![[ ]](/icons/layout.gif) | solfit-370w-dimensioned.pdf | 2021-06-11 16:07 | 242K | |
![[ ]](/icons/layout.gif) | solfit-370wp--installation-manual-compressed--1-.pdf | 2021-11-23 10:21 | 2.5M | |
![[ ]](/icons/layout.gif) | solfit-370wp--installation-manual.pdf | 2021-11-17 13:34 | 2.5M | |
![[ ]](/icons/layout.gif) | solfit-a--landscape-.pdf | 2024-03-06 13:00 | 1.4M | |
![[ ]](/icons/layout.gif) | solfit-bisol-pv-datasheet-270-300w.pdf | 2017-07-31 12:34 | 1.4M | |
![[ ]](/icons/layout.gif) | solfit-data-sheet-370W.pdf | 2021-11-17 13:31 | 2.0M | |
![[ ]](/icons/layout.gif) | solfit-instruction-manual-v6.pdf | 2020-02-04 14:03 | 5.0M | |
![[ ]](/icons/layout.gif) | solfit-instruction-manual-v8.1.pdf | 2020-11-20 15:51 | 1.2M | |
![[ ]](/icons/layout.gif) | solfit-jetion-380wp--datasheet--2-.pdf | 2023-01-06 11:40 | 1.8M | |
![[ ]](/icons/layout.gif) | solfit-manual-375wp-compressed.pdf | 2023-03-31 16:50 | 1.2M | |
![[ ]](/icons/layout.gif) | solfit-manual-nov2021.pdf | 2021-11-11 13:49 | 16M | |
![[ ]](/icons/layout.gif) | solfit-manual-oct21.pdf | 2021-10-19 08:51 | 1.9M | |
![[ ]](/icons/layout.gif) | solfit-mcs-certificate.pdf | 2018-08-23 09:53 | 438K | |
![[ ]](/icons/layout.gif) | solfit-product-sheet.pdf | 2019-09-10 10:05 | 419K | |
![[ ]](/icons/layout.gif) | solfit-usps-sheet.pdf | 2021-11-17 13:35 | 3.6M | |
![[ ]](/icons/layout.gif) | solfitinstructionmanual.pdf | 2017-11-02 09:56 | 4.5M | |
![[ ]](/icons/layout.gif) | solic-200-datasheet-new.pdf | 2018-08-06 15:31 | 393K | |
![[ ]](/icons/layout.gif) | solic-200-install-manual-new.pdf | 2018-08-06 15:32 | 513K | |
![[ ]](/icons/layout.gif) | solic-200-online-brochure.pdf | 2017-06-01 17:12 | 573K | |
![[ ]](/icons/layout.gif) | solic-datasheet.pdf | 2017-06-01 17:09 | 573K | |
![[ ]](/icons/layout.gif) | solic-user-guide-inc-quick-fit1.pdf | 2017-05-19 17:23 | 683K | |
![[ ]](/icons/layout.gif) | solic-wireless-datasheet-06082020.pdf | 2020-08-06 13:55 | 273K | |
![[ ]](/icons/layout.gif) | solic-wireless-features-04082020.pdf | 2020-08-06 13:55 | 268K | |
![[ ]](/icons/layout.gif) | solic-wireless-user-and-fitting-guide.pdf | 2020-08-06 13:54 | 173K | |
![[ ]](/icons/layout.gif) | solidrail-infos-en.pdf | 2021-11-29 15:18 | 412K | |
![[ ]](/icons/layout.gif) | solidrail-solarfastener-assembly-en.pdf | 2022-12-16 10:25 | 1.4M | |
![[ ]](/icons/layout.gif) | solion-installation-manual.pdf | 2018-10-12 13:43 | 2.2M | |
![[ ]](/icons/layout.gif) | solion-roof-planner-instructions.pdf | 2017-05-19 17:23 | 172K | |
![[ ]](/icons/layout.gif) | solion-sunmount-datasheet.pdf | 2017-05-19 17:23 | 530K | |
![[ ]](/icons/layout.gif) | solis-0-7-to-3-6kw-g5-g98-cert.pdf | 2021-05-04 11:00 | 2.0M | |
![[ ]](/icons/layout.gif) | solis-1-6k-4g-selfdeclaration-g100.pdf | 2019-04-15 12:03 | 746K | |
![[ ]](/icons/layout.gif) | solis-1kw-g98-andg990-cert.pdf | 2021-02-22 13:05 | 204K | |
![[ ]](/icons/layout.gif) | solis-1p-8kw-5g-g100-cert.pdf | 2020-11-24 09:34 | 1.8M | |
![[ ]](/icons/unknown.gif) | solis-1p1-6k-4g-en50438-ir | 2020-06-23 11:35 | 810K | |
![[ ]](/icons/layout.gif) | solis-1p4g-2.5-6k-manual.pdf | 2019-06-21 11:11 | 2.5M | |
![[ ]](/icons/layout.gif) | solis-3-5kw-hybrid.pdf | 2019-07-18 11:10 | 1.4M | |
![[ ]](/icons/layout.gif) | solis-3-phase-5kw-datasheet.pdf | 2018-11-06 11:00 | 1.8M | |
![[ ]](/icons/layout.gif) | solis-3-phase-6kw-datasheet.pdf | 2018-11-07 10:45 | 1.8M | |
![[ ]](/icons/layout.gif) | solis-3-phase-8kw-datasheet.pdf | 2018-11-06 11:20 | 1.8M | |
![[ ]](/icons/layout.gif) | solis-3-phase-10kw-datashee.pdf | 2018-11-06 11:25 | 1.8M | |
![[ ]](/icons/layout.gif) | solis-3-phase-15kw-datasheet.pdf | 2018-11-06 11:26 | 1.8M | |
![[ ]](/icons/layout.gif) | solis-3-phase-20kw-datasheet.pdf | 2018-11-06 11:27 | 1.8M | |
![[ ]](/icons/layout.gif) | solis-3-phase-manual.pdf | 2018-11-06 11:02 | 1.7M | |
![[ ]](/icons/layout.gif) | solis-3-phase-warranty.pdf | 2018-11-06 11:03 | 537K | |
![[ ]](/icons/layout.gif) | solis-3ph-4g-12-20k-datasheet.pdf | 2020-06-04 14:07 | 1.1M | |
![[ ]](/icons/layout.gif) | solis-3ph-25-50k-5g.pdf | 2020-02-17 11:18 | 416K | |
![[ ]](/icons/layout.gif) | solis-3ph-25-50kw-5g.pdf | 2020-02-17 11:23 | 463K | |
![[ ]](/icons/layout.gif) | solis-3ph-30kw-g99.pdf | 2020-02-17 12:36 | 591K | |
![[ ]](/icons/layout.gif) | solis-3ph-36kw-g99.pdf.pdf | 2020-02-17 12:37 | 591K | |
![[ ]](/icons/layout.gif) | solis-3ph-40kw-g99.pdf.pdf.pdf | 2020-02-17 12:39 | 591K | |
![[ ]](/icons/layout.gif) | solis-3ph-quad-20kw-datasheet.pdf | 2018-11-06 11:38 | 1.2M | |
![[ ]](/icons/layout.gif) | solis-3ph-quad-25kw-datasheet.pdf | 2018-11-06 11:40 | 1.2M | |
![[ ]](/icons/layout.gif) | solis-3ph-quad-30kw-dashasheet.pdf | 2018-11-06 11:40 | 1.2M | |
![[ ]](/icons/layout.gif) | solis-3ph-quad-40-70kw-manual.pdf | 2018-11-06 14:04 | 4.1M | |
![[ ]](/icons/layout.gif) | solis-3ph-quad-40kw-datasheet.pdf | 2018-11-06 11:41 | 1.4M | |
![[ ]](/icons/layout.gif) | solis-3ph-quad-50kw-datasheet.pdf | 2018-11-06 11:42 | 1.4M | |
![[ ]](/icons/layout.gif) | solis-3ph-quad-60kw-datasheet.pdf | 2018-11-06 11:43 | 1.3M | |
![[ ]](/icons/layout.gif) | solis-3ph-quad-warranty.pdf | 2018-11-06 11:46 | 537K | |
![[ ]](/icons/layout.gif) | solis-3phase-quad-20-30kw-manual.pdf | 2018-11-07 10:55 | 2.3M | |
![[ ]](/icons/layout.gif) | solis-4-6kw-g5-g99-cert.pdf | 2021-05-04 11:07 | 2.1M | |
![[ ]](/icons/layout.gif) | solis-4g-1kw-g98-cert.pdf | 2021-02-22 13:14 | 606K | |
![[ ]](/icons/layout.gif) | solis-5g-dual-g98-cert.pdf | 2021-04-26 16:20 | 1.9M | |
![[ ]](/icons/layout.gif) | solis-5g-dual-manual240221-min.pdf | 2021-04-19 16:03 | 13M | |
![[ ]](/icons/layout.gif) | solis-15kw-g99.pdf | 2020-11-05 12:00 | 117K | |
![[ ]](/icons/layout.gif) | solis-25-50k-hv-5g--1-.pdf | 2020-02-17 12:12 | 416K | |
![[ ]](/icons/layout.gif) | solis-25-50k-hv-5g-datasheet.pdf | 2020-02-17 12:13 | 416K | |
![[ ]](/icons/layout.gif) | solis-25k-5g-G99.pdf | 2020-02-17 11:45 | 201K | |
![[ ]](/icons/layout.gif) | solis-25kw-g99.pdf | 2020-02-17 10:21 | 201K | |
![[ ]](/icons/layout.gif) | solis-80k-5g-datasheet-191120.pdf | 2020-11-19 13:48 | 489K | |
![[ ]](/icons/layout.gif) | solis-80k-5g-datasheet.pdf | 2020-03-02 17:35 | 443K | |
![[ ]](/icons/layout.gif) | solis-100k-5g-g99-type-a-certificate.pdf | 2020-10-22 10:59 | 2.2M | |
![[ ]](/icons/layout.gif) | solis-110k-5g-g99-type-a-certificate.pdf | 2020-10-22 11:27 | 2.3M | |
![[ ]](/icons/layout.gif) | solis-G99certificate.pdf | 2021-10-05 10:24 | 2.1M | |
![[ ]](/icons/layout.gif) | solis-LAN-installation-manual.pdf | 2019-11-13 10:59 | 5.5M | |
![[ ]](/icons/layout.gif) | solis-ce-certificate.pdf | 2020-03-02 17:36 | 243K | |
![[ ]](/icons/layout.gif) | solis-certificate-en-50549-1-mini--700-3600--4g-s5-gr1p-0.7-3.6-k-m-europe-v01.pdf | 2021-02-23 18:42 | 243K | |
![[ ]](/icons/layout.gif) | solis-certificate-en-50549-1-mini--700-3600--4g-s5-gr1p-0.7-3.6-k-m-europe.pdf | 2021-07-08 10:05 | 319K | |
![[ ]](/icons/layout.gif) | solis-certificate-en-50549-1-rhi--3-5-k-48es-rhi--3-6-k-48es-5g-s5-eh1p-3-6-k-l-eur-v01.pdf | 2021-07-07 13:52 | 254K | |
![[ ]](/icons/layout.gif) | solis-certificate-en-62109-1-iec-62109-1--2--v01.pdf | 2021-02-24 09:21 | 376K | |
![[ ]](/icons/layout.gif) | solis-certificate-g99-3p-3-20-k-4g-uk-v01.pdf | 2022-01-20 10:02 | 228K | |
![[ ]](/icons/layout.gif) | solis-certificate-nrs-097-1-2-mini--700-3600--4g-s5-gr1p-0.7-3.6-k-m-zar-v01.pdf | 2021-02-23 18:43 | 807K | |
![[ ]](/icons/layout.gif) | solis-datasheet-7kw-8kw.pdf | 2019-10-21 10:27 | 377K | |
![[ ]](/icons/layout.gif) | solis-datasheet-s5-gr1p-0.7-3.6-k-m-eur-v6.8-2020.pdf | 2021-04-28 16:32 | 591K | |
![[ ]](/icons/layout.gif) | solis-drm-manual.pdf | 2019-06-19 12:28 | 746K | |
![[ ]](/icons/layout.gif) | solis-dual-2.5-6-datasheet.pdf | 2018-07-09 15:41 | 1.4M | |
![[ ]](/icons/layout.gif) | solis-dual-5g-datasheet-240221.pdf | 2021-04-19 16:00 | 610K | |
![[ ]](/icons/layout.gif) | solis-dual-s6-datasheet.pdf | 2022-02-02 13:39 | 580K | |
![[ ]](/icons/layout.gif) | solis-dual-s6-manual.pdf | 2022-02-02 13:38 | 1.8M | |
![[ ]](/icons/layout.gif) | solis-en50549-conformity-75-110k-5g.pdf | 2020-10-22 11:00 | 437K | |
![[ ]](/icons/layout.gif) | solis-epm3-5g-plus-self-declaration-of-g100.pdf | 2020-02-21 10:21 | 971K | |
![[ ]](/icons/layout.gif) | solis-export-manager-5g-plus-manual.pdf | 2020-02-20 17:12 | 6.3M | |
![[ ]](/icons/layout.gif) | solis-export-power-manager-datasheet.pdf | 2020-02-20 17:13 | 114K | |
![[ ]](/icons/layout.gif) | solis-export-power-manager-manual-.pdf | 2019-06-21 11:12 | 237K | |
![[ ]](/icons/layout.gif) | solis-export-troubleshooting.pdf | 2019-04-23 12:19 | 159K | |
![[ ]](/icons/layout.gif) | solis-g99-8kw.pdf | 2019-10-21 10:28 | 200K | |
![[ ]](/icons/layout.gif) | solis-g99-25k.pdf | 2020-02-17 10:21 | 201K | |
![[ ]](/icons/layout.gif) | solis-g99-form-a2-3p6k-4g.pdf | 2020-09-21 09:08 | 381K | |
![[ ]](/icons/layout.gif) | solis-g100-1ph.pdf | 2021-04-23 16:17 | 127K | |
![[ ]](/icons/layout.gif) | solis-g100.pdf | 2019-04-23 12:20 | 1.3M | |
![[ ]](/icons/layout.gif) | solis-hybrid-en50438-irl.pdf | 2019-07-25 16:13 | 2.1M | |
![[ ]](/icons/layout.gif) | solis-hybrid.pdf | 2019-07-25 16:12 | 1.4M | |
![[ ]](/icons/layout.gif) | solis-inverter-warranty---4g-models.pdf | 2019-07-25 16:07 | 534K | |
![[ ]](/icons/layout.gif) | solis-inverter-warranty---rhi-hybrid-uk.pdf | 2019-07-25 16:13 | 59K | |
![[ ]](/icons/layout.gif) | solis-inverter-warranty-5g.pdf | 2021-09-13 11:31 | 55K | |
![[ ]](/icons/layout.gif) | solis-inverter-warranty-2013.pdf | 2017-06-05 17:04 | 533K | |
![[ ]](/icons/layout.gif) | solis-inverter-warranty-240221.pdf | 2021-04-19 16:05 | 55K | |
![[ ]](/icons/layout.gif) | solis-land-manual.pdf | 2019-03-14 11:29 | 868K | |
![[ ]](/icons/layout.gif) | solis-manual-3-wifi.pdf | 2022-07-14 14:06 | 2.3M | |
![[ ]](/icons/layout.gif) | solis-manual-3p-100-125-k-5g-enx-v1-1.pdf | 2020-10-22 10:59 | 13M | |
![[ ]](/icons/layout.gif) | solis-manual-drm-uk-v1.3-20200819.pdf | 2020-09-23 09:08 | 1.7M | |
![[ ]](/icons/layout.gif) | solis-manual-mini-5g-180821.pdf | 2021-08-18 17:01 | 13M | |
![[ ]](/icons/layout.gif) | solis-manual-s5-gc-25-50-k-eur-v1-1.pdf | 2022-03-10 10:44 | 22M | |
![[ ]](/icons/layout.gif) | solis-manual-s5-gc-50-70-k-eur-v1-2.pdf | 2022-03-10 15:02 | 26M | |
![[ ]](/icons/layout.gif) | solis-mini-4g-datasheet.pdf | 2019-07-18 10:47 | 1.0M | |
![[ ]](/icons/layout.gif) | solis-mini-4g-manual.pdf | 2017-06-27 09:35 | 2.7M | |
![[ ]](/icons/layout.gif) | solis-mini-4g-warranty.pdf | 2017-06-27 09:35 | 534K | |
![[ ]](/icons/layout.gif) | solis-mini-6s-datasheet.pdf | 2022-02-02 13:11 | 555K | |
![[ ]](/icons/layout.gif) | solis-mini-700-4g-g59-3.pdf | 2017-06-27 09:34 | 1.3M | |
![[ ]](/icons/layout.gif) | solis-mini-700-2000-g59-3.pdf | 2017-06-05 17:04 | 5.4M | |
![[ ]](/icons/layout.gif) | solis-mini-700-3600--4g---s5-gr1p-0.7-3.pdf | 2021-02-23 18:42 | 594K | |
![[ ]](/icons/layout.gif) | solis-mini-700-3600-4g-en50438-ir.pdf | 2019-07-25 10:57 | 809K | |
![[ ]](/icons/layout.gif) | solis-mini-700-3600-4g-selfdeclaration-g100.pdf | 2019-04-15 11:59 | 746K | |
![[ ]](/icons/layout.gif) | solis-mini-3600-datasheet.pdf | 2019-09-30 15:42 | 224K | |
![[ ]](/icons/layout.gif) | solis-mini-datasheet.pdf | 2017-06-05 17:04 | 1.0M | |
![[ ]](/icons/layout.gif) | solis-mini-inverter-manual.pdf | 2017-06-05 17:04 | 1.6M | |
![[ ]](/icons/layout.gif) | solis-mini-s6-g98.pdf | 2022-02-02 13:12 | 3.7M | |
![[ ]](/icons/layout.gif) | solis-mini-s6-g99.pdf | 2022-02-02 13:12 | 7.3M | |
![[ ]](/icons/layout.gif) | solis-mini-s6-manual.pdf | 2022-02-02 13:12 | 1.8M | |
![[ ]](/icons/layout.gif) | solis-mini4g-700-3600w-manual.pdf | 2019-07-25 10:56 | 2.5M | |
![[ ]](/icons/layout.gif) | solis-mini4g-3600w-manual-181220.pdf | 2020-12-18 09:48 | 1.9M | |
![[ ]](/icons/layout.gif) | solis-monitoring-guide.pdf | 2020-04-27 10:20 | 1.4M | |
![[ ]](/icons/layout.gif) | solis-monitoring-platform-instructions.pdf | 2020-08-24 12:58 | 1.5M | |
![[ ]](/icons/layout.gif) | solis-monitoring-wifi-box-manual.pdf | 2020-08-24 12:57 | 7.9M | |
![[ ]](/icons/layout.gif) | solis-power-manager-datasheet.pdf | 2019-04-23 12:18 | 1.4M | |
![[ ]](/icons/layout.gif) | solis-s5-gc-25-40k-g99.pdf | 2022-03-10 14:04 | 7.4M | |
![[ ]](/icons/layout.gif) | solis-s5-gc-50-60k-g99.pdf | 2022-03-10 14:55 | 7.0M | |
![[ ]](/icons/layout.gif) | solis-warranty---europe-2020.pdf | 2020-10-22 11:00 | 227K | |
![[ ]](/icons/layout.gif) | solis-wifi-datasheet.pdf | 2019-11-19 13:53 | 2.1M | |
![[ ]](/icons/layout.gif) | solis-wifi-manual.pdf | 2018-11-19 13:53 | 3.9M | |
![[ ]](/icons/layout.gif) | solis_certificate_en%2050549-1_(25-50)k-5g_europe_v01_tur.pdf | 2022-01-04 09:04 | 386K | |
![[ ]](/icons/layout.gif) | solis_datasheet_w3-wifi.pdf | 2022-06-21 10:35 | 243K | |
![[ ]](/icons/layout.gif) | solis_s5_3ph_03-13k_manual.pdf | 2022-05-26 15:53 | 22M | |
![[ ]](/icons/layout.gif) | solis_warranty-europe_202021.pdf | 2022-05-26 15:55 | 135K | |
![[ ]](/icons/layout.gif) | solo-ii-led-user-manual.pdf | 2018-03-06 14:46 | 1.7M | |
![[ ]](/icons/layout.gif) | solo-ii-pv-datasheet.pdf | 2016-09-12 11:31 | 400K | |
![[ ]](/icons/layout.gif) | solplanet-app-en-0622-3.pdf | 2023-09-14 11:10 | 735K | |
![[ ]](/icons/unknown.gif) | solplanet-communication-solutions-v1-1-en--1-.pptx | 2023-02-02 11:49 | 7.6M | |
![[ ]](/icons/layout.gif) | solplanet-uk-brochure-solplanet-2023--2-.pdf | 2024-01-26 09:47 | 1.1M | |
![[ ]](/icons/layout.gif) | solplanet2datasheet-asw-3k-6k-s-g2-series-global-en-0524-web.pdf | 2024-07-04 11:10 | 178K | |
![[ ]](/icons/layout.gif) | solplanetdatasheet-asw-3k-6k-s-g2-series-global-en-0524-web.pdf | 2024-07-04 11:04 | 178K | |
![[ ]](/icons/layout.gif) | solplanetum0023-asw3000-6000-s-g2-en-v02-0124.pdf | 2024-07-04 11:10 | 4.7M | |
![[ ]](/icons/unknown.gif) | soltaro-aio-lite-5kw | 2022-05-16 14:21 | 519K | |
![[ ]](/icons/layout.gif) | soltaro-aio1-lite-10kwh-batt-datasheet.pdf | 2022-05-16 15:07 | 519K | |
![[ ]](/icons/layout.gif) | soltaro-aio2-ess-datasheet-v5.0.pdf | 2021-05-20 10:24 | 1.3M | |
![[ ]](/icons/layout.gif) | soltaro-aio2-ess-g99-cert.pdf | 2021-06-07 13:37 | 3.3M | |
![[ ]](/icons/layout.gif) | soltaro-aio2-warranty-v1.0.pdf | 2021-05-20 10:24 | 313K | |
![[ ]](/icons/layout.gif) | soltaro-g100-declaration.pdf | 2021-09-15 13:59 | 420K | |
![[ ]](/icons/layout.gif) | soluna-10k-pack-hv-l-e-user-manual-20220507a0.pdf | 2022-07-18 16:57 | 1.1M | |
![[ ]](/icons/layout.gif) | soluna-compatible-inverter--draft-.pdf | 2022-11-28 15:50 | 5.9M | |
![[ ]](/icons/layout.gif) | soluna-user-manual--eos-5k-pack--2021.pdf | 2021-11-17 10:20 | 1.2M | |
![[VID]](/icons/movie.gif) | soluna-video--eos-5k-installation.mp4 | 2021-11-23 14:45 | 10M | |
![[ ]](/icons/layout.gif) | soluna-warranty-general.pdf | 2023-01-12 09:31 | 571K | |
![[ ]](/icons/layout.gif) | solvis-datasheet.pdf | 2016-08-18 15:58 | 1.2K | |
![[ ]](/icons/layout.gif) | solvis2.pdf | 2016-08-18 16:02 | 1.2K | |
![[ ]](/icons/layout.gif) | sonnen--datasheet-eco-8-3ph.pdf | 2020-08-24 16:09 | 147K | |
![[ ]](/icons/layout.gif) | sonnen-9-g100.pdf | 2019-11-05 10:41 | 875K | |
![[ ]](/icons/layout.gif) | sonnen-943-datasheet.pdf | 2019-11-05 10:40 | 160K | |
![[ ]](/icons/layout.gif) | sonnen-943-g99.pdf | 2019-11-05 10:42 | 452K | |
![[ ]](/icons/layout.gif) | sonnen-943-install.pdf | 2019-11-05 10:40 | 3.5M | |
![[ ]](/icons/layout.gif) | sonnen-943-user-manual.pdf | 2019-11-05 10:41 | 1.4M | |
![[ ]](/icons/layout.gif) | sonnen-953-datasheet.pdf | 2019-11-05 11:40 | 160K | |
![[ ]](/icons/layout.gif) | sonnen-953-g99.pdf | 2019-11-05 11:41 | 458K | |
![[ ]](/icons/layout.gif) | sonnen-953-install.pdf | 2019-11-05 11:40 | 3.8M | |
![[ ]](/icons/layout.gif) | sonnen-953-user-manual.pdf | 2019-11-05 11:41 | 1.4M | |
![[ ]](/icons/layout.gif) | sonnen-brochure.pdf | 2019-11-27 14:14 | 2.3M | |
![[ ]](/icons/unknown.gif) | sonnen-datasheet-8-3ph | 2020-08-24 16:08 | 147K | |
![[ ]](/icons/layout.gif) | sonnen-net-metering-technical-note.pdf | 2020-03-09 11:42 | 133K | |
![[ ]](/icons/layout.gif) | sonnen-pro-overview.pdf | 2020-08-24 16:46 | 456K | |
![[ ]](/icons/layout.gif) | sonnen-protect-1300-datasheet.pdf | 2019-11-05 12:29 | 447K | |
![[ ]](/icons/layout.gif) | sonnen-protect-1300-install.pdf | 2019-11-05 12:29 | 776K | |
![[ ]](/icons/layout.gif) | sonnen-protect-1300-user-manual.pdf | 2019-11-05 12:30 | 361K | |
![[ ]](/icons/layout.gif) | sonnen-protect-2500-install.pdf | 2019-11-05 12:34 | 2.7M | |
![[ ]](/icons/layout.gif) | sonnen-protect-2500-user-manual.pdf | 2019-11-05 12:34 | 2.3M | |
![[ ]](/icons/layout.gif) | sonnen-uk-datasheet-pro-2.0-row-v2.pdf | 2020-08-24 16:46 | 52K | |
![[ ]](/icons/layout.gif) | sonnen-warranty.pdf | 2019-11-05 10:44 | 210K | |
![[ ]](/icons/layout.gif) | sonnenbatterie-eco-8.03--ac-coupled--installation-instructions---kd435---feb20.pdf | 2021-07-20 13:42 | 7.0M | |
![[ ]](/icons/layout.gif) | sonnenbatterie-eco-8.03--ac-coupled--operating-instructions---feb20.pdf | 2021-07-20 13:42 | 4.8M | |
![[ ]](/icons/layout.gif) | sp2000-growatt-battery-installation-guide.pdf | 2017-05-19 17:23 | 4.1M | |
![[ ]](/icons/layout.gif) | sp5000esusermanualen202109--2---1-.pdf | 2023-06-30 16:47 | 4.8M | |
![[ ]](/icons/layout.gif) | sp5000esusermanualen202109.pdf | 2023-05-04 16:29 | 4.8M | |
![[ ]](/icons/layout.gif) | spa1-3kw-datasheet.pdf | 2020-11-11 17:17 | 667K | |
![[ ]](/icons/layout.gif) | spdac200enc-summary-sheet--1---1-.pdf | 2022-10-21 10:13 | 224K | |
![[ ]](/icons/layout.gif) | spdpv.pdf | 2023-08-23 11:36 | 269K | |
![[ ]](/icons/layout.gif) | spdpv600-installation-instructions.pdf | 2024-04-29 11:25 | 954K | |
![[ ]](/icons/layout.gif) | spdpv1000-installation-instructions.pdf | 2024-04-29 11:24 | 780K | |
![[ ]](/icons/layout.gif) | spec-4000s2v_s-1450.pdf | 2016-09-12 11:31 | 804K | |
![[ ]](/icons/layout.gif) | spec-4000s2v_s-1660.pdf | 2016-09-12 11:31 | 805K | |
![[ ]](/icons/layout.gif) | spec-4000s6v_s-290.pdf | 2016-09-12 11:31 | 765K | |
![[ ]](/icons/layout.gif) | spec-4000s6v_s-480.pdf | 2016-09-12 11:31 | 946K | |
![[ ]](/icons/layout.gif) | spec-4000s6v_s-550.pdf | 2016-09-12 11:31 | 323K | |
![[ ]](/icons/layout.gif) | spec-4000s6v_s-605.pdf | 2016-09-12 11:31 | 4.9M | |
![[ ]](/icons/layout.gif) | spf5000esdatasheet.pdf | 2023-05-04 14:37 | 8.0M | |
![[ ]](/icons/layout.gif) | spf5000esdatasheet2.pdf | 2023-05-04 16:29 | 1.8M | |
![[ ]](/icons/layout.gif) | spf5000esmanual-en.pdf | 2023-05-04 14:38 | 4.8M | |
![[ ]](/icons/layout.gif) | sph-3-6ktl-bl-up-user-manual-en-202212.pdf | 2023-07-13 11:41 | 5.1M | |
![[ ]](/icons/layout.gif) | sph-3000-6000tl-bl-up-datasheet-202303.pdf | 2023-12-01 14:58 | 3.9M | |
![[ ]](/icons/layout.gif) | sph-3000-6000tl-bl-up-datasheet.pdf | 2023-01-31 11:51 | 3.0M | |
![[ ]](/icons/layout.gif) | sph-3000-6000tl-bl-up-en50549-1.pdf | 2023-01-31 11:48 | 212K | |
![[ ]](/icons/layout.gif) | sph-3000-6000tl-bl-up-quick-guide-en-202205.pdf | 2023-07-13 11:41 | 3.0M | |
![[ ]](/icons/layout.gif) | sph-3000-6000tl-bl-up-vde0126.pdf | 2023-01-31 11:51 | 217K | |
![[ ]](/icons/layout.gif) | spirafix-document-cc.pdf | 2023-10-12 15:10 | 82K | |
![[ ]](/icons/layout.gif) | spirafix-document.pdf | 2023-10-12 13:56 | 82K | |
![[ ]](/icons/layout.gif) | split-charge-relay-wiring-diagram.pdf | 2016-09-12 11:31 | 25K | |
![[IMG]](/icons/image2.gif) | splitchargingsystemdiagram-durite-VSR.gif | 2019-09-18 11:15 | 14K | |
![[ ]](/icons/layout.gif) | spm-ct-e-quick-guide-en-202305.pdf | 2024-03-06 15:26 | 2.1M | |
![[ ]](/icons/layout.gif) | spm-e-quik-guide-en-202305.pdf | 2024-05-08 11:03 | 2.5M | |
![[IMG]](/icons/image2.gif) | sps---buff.png | 2023-11-17 10:12 | 66K | |
![[ ]](/icons/layout.gif) | ss250p.pdf | 2016-09-12 11:31 | 822K | |
![[ ]](/icons/layout.gif) | ss1024r-2fss2024rmanual.pdf | 2016-09-12 11:31 | 526K | |
![[ ]](/icons/layout.gif) | st-wrm15dualb-e-15A-dual-mppt-solar-charge-controller.pdf | 2019-03-18 09:54 | 957K | |
![[ ]](/icons/layout.gif) | stag-brochure.pdf | 2022-08-15 10:05 | 3.7M | |
![[ ]](/icons/layout.gif) | stag-enclosed-isolators-datasheet-03032023.pdf | 2023-10-16 11:59 | 571K | |
![[ ]](/icons/layout.gif) | stagis4pdatasheet.pdf | 2024-02-26 13:19 | 523K | |
![[ ]](/icons/layout.gif) | stainlesslite-plus-heat-pump-duo-spec-sheet.pdf | 2022-12-21 12:35 | 226K | |
![[ ]](/icons/layout.gif) | stainlesslite-plus-heat-pump-duo.pdf | 2022-12-21 12:35 | 3.9M | |
![[ ]](/icons/layout.gif) | stainlesslite-plus-hp-iss-06-wb--2-.pdf | 2022-12-21 12:43 | 1.4M | |
![[ ]](/icons/layout.gif) | standard-perlight-warranty-terms.pdf | 2023-04-20 09:26 | 266K | |
![[ ]](/icons/layout.gif) | standing-seam-roof-fixing-datasheet.pdf | 2017-05-19 17:23 | 215K | |
![[ ]](/icons/layout.gif) | statement-of-compliance---ev-charger--.pdf | 2023-10-16 12:17 | 99K | |
![[ ]](/icons/layout.gif) | staubli-in-line-fuse-10A-datasheet.pdf | 2020-10-19 10:21 | 189K | |
![[ ]](/icons/layout.gif) | staubli-mc4-datasheet.pdf | 2022-08-03 09:41 | 548K | |
![[ ]](/icons/layout.gif) | steca-solarix-2525-4040-datasheet-en.pdf | 2018-10-10 15:47 | 277K | |
![[ ]](/icons/layout.gif) | steca-solsum-6f-6A-solar-controller-datasheet.pdf | 2016-09-12 11:31 | 230K | |
![[ ]](/icons/layout.gif) | steca-solsum-6f-6A-solar-manual.pdf | 2016-09-12 11:31 | 83K | |
![[ ]](/icons/layout.gif) | stick-logger--wifi--quick-guide-2018.pdf | 2018-11-29 17:27 | 2.7M | |
![[ ]](/icons/layout.gif) | storage-tank-fiche-2021--1-.pdf | 2023-05-18 10:26 | 238K | |
![[ ]](/icons/layout.gif) | storedge-profile-programming.pdf | 2018-03-02 10:12 | 496K | |
![[ ]](/icons/layout.gif) | storedge-sti-datasheet.pdf | 2018-03-02 10:10 | 475K | |
![[ ]](/icons/layout.gif) | storedge-sti4-lg-manual.pdf | 2018-03-02 10:12 | 11M | |
![[ ]](/icons/layout.gif) | storedge-system-configs.pdf | 2018-03-02 10:11 | 1.1M | |
![[ ]](/icons/layout.gif) | storedge-wiring-checklist.pdf | 2018-03-02 10:11 | 1.1M | |
![[ ]](/icons/layout.gif) | sun2000--50ktl--60ktl--65ktl--m0-user-manual.pdf | 2021-10-19 16:06 | 7.7M | |
![[ ]](/icons/layout.gif) | sun2000--100ktl--110ktl--115ktl--m2-user-manual.pdf | 2024-07-24 17:29 | 6.9M | |
![[ ]](/icons/layout.gif) | sun2000-2-6-l1-declaration-of-conformity.pdf | 2022-05-13 12:45 | 121K | |
![[ ]](/icons/layout.gif) | sun2000-3-10-m0-m1-en50549-1-en.pdf | 2021-07-09 16:17 | 258K | |
![[ ]](/icons/layout.gif) | sun2000-8-20-m0-m2-g99-en.pdf | 2021-04-20 11:02 | 834K | |
![[ ]](/icons/layout.gif) | sun2000-8-20ktl-m2-usermanual.pdf | 2021-12-02 09:56 | 5.2M | |
![[ ]](/icons/layout.gif) | sun2000-8-20m0-m2-en50549-1-en.pdf | 2022-02-09 08:38 | 664K | |
![[ ]](/icons/layout.gif) | sun2000-8-30-g99-cert.pdf | 2019-12-13 09:40 | 1.7M | |
![[ ]](/icons/layout.gif) | sun2000-8ktl-20ktl-m2-quick-guide.pdf | 2021-04-20 11:02 | 3.0M | |
![[ ]](/icons/layout.gif) | sun2000-8ktl-20ktl-m2-user-manual.pdf | 2021-04-20 11:02 | 6.1M | |
![[ ]](/icons/layout.gif) | sun2000-12-15-17-20-25ktl-m5.pdf | 2024-02-27 09:04 | 1.5M | |
![[ ]](/icons/layout.gif) | sun2000-12-20KTL-user-manual.pdf | 2019-12-11 16:39 | 4.3M | |
![[ ]](/icons/layout.gif) | sun2000-12-20ktl-m2.pdf | 2022-02-09 08:01 | 341K | |
![[ ]](/icons/layout.gif) | sun2000-12-25ktl-m5-datasheet--1-.pdf | 2023-10-04 11:35 | 202K | |
![[ ]](/icons/layout.gif) | sun2000-12-25ktl-m5-datasheet.pdf | 2023-03-07 14:53 | 202K | |
![[ ]](/icons/unknown.gif) | sun2000-20ktl-40ktl-m3-manual | 2021-07-01 11:31 | 3.7M | |
![[ ]](/icons/unknown.gif) | sun2000-30-40ktl-datasheet | 2021-07-01 11:08 | 114K | |
![[ ]](/icons/layout.gif) | sun2000-30-40ktl-m3--1-.pdf | 2022-07-18 15:19 | 231K | |
![[ ]](/icons/layout.gif) | sun2000-30-40ktl-m3--2-.pdf | 2024-05-15 13:13 | 227K | |
![[ ]](/icons/layout.gif) | sun2000-30-40ktl-m3-en50549--1-.pdf | 2022-07-18 15:19 | 373K | |
![[ ]](/icons/layout.gif) | sun2000-30-40ktl-m3-en50549.pdf | 2022-01-28 13:35 | 373K | |
![[ ]](/icons/layout.gif) | sun2000-30-40ktl-m3.pdf | 2021-09-27 15:42 | 231K | |
![[ ]](/icons/layout.gif) | sun2000-33-36-g99.pdf | 2019-12-13 09:48 | 927K | |
![[ ]](/icons/layout.gif) | sun2000-33ktl-a-datasheet.pdf | 2019-12-12 10:43 | 264K | |
![[ ]](/icons/layout.gif) | sun2000-33ktl-a-quick-guide.pdf.pdf | 2019-12-12 10:45 | 2.4M | |
![[ ]](/icons/layout.gif) | sun2000-33ktl-user-manual.pdf | 2019-12-12 10:43 | 5.9M | |
![[ ]](/icons/layout.gif) | sun2000-36ktl.pdf | 2019-12-12 11:01 | 266K | |
![[ ]](/icons/layout.gif) | sun2000-50ktl-m0.pdf | 2021-10-19 16:01 | 256K | |
![[ ]](/icons/layout.gif) | sun2000-50ktl-m3-datasheet.pdf | 2023-02-15 17:25 | 388K | |
![[ ]](/icons/layout.gif) | sun2000-50ktl-m3-en-huawei-sun2000-m3-user-manual.pdf | 2023-05-05 15:50 | 4.1M | |
![[ ]](/icons/layout.gif) | sun2000-50ktl-m3cedochuawei-radioequipmentdirective2014-53-eu-rohsdirective2011-65-eu-2015-863.pdf | 2024-05-15 12:58 | 119K | |
![[ ]](/icons/layout.gif) | sun2000-50ktl-m3certificateintertek-en50549-2.pdf | 2024-05-15 12:56 | 230K | |
![[ ]](/icons/layout.gif) | sun2000-50ktl-m3certificatetuv-dinvde0126-1-1-utec15-712-1c-20220922-en.pdf | 2024-05-15 12:57 | 280K | |
![[ ]](/icons/layout.gif) | sun2000-60-g99.pdf | 2019-12-13 09:50 | 888K | |
![[ ]](/icons/layout.gif) | sun2000-60ktl-datasheet.pdf | 2019-12-12 11:19 | 306K | |
![[ ]](/icons/layout.gif) | sun2000-60ktl-installer.pdf | 2019-12-12 11:19 | 3.1M | |
![[ ]](/icons/layout.gif) | sun2000-60ktl-m0.pdf | 2021-09-27 15:49 | 328K | |
![[ ]](/icons/layout.gif) | sun2000-60ktl-user-manual.pdf | 2019-12-12 11:19 | 5.7M | |
![[ ]](/icons/layout.gif) | sun2000-100-h-g99.pdf | 2019-12-13 09:51 | 952K | |
![[ ]](/icons/layout.gif) | sun2000-100ktl-h1-datasheet.pdf | 2019-12-12 13:41 | 488K | |
![[ ]](/icons/layout.gif) | sun2000-100ktl-h1-installer.pdf | 2019-12-12 13:41 | 2.2M | |
![[ ]](/icons/layout.gif) | sun2000-100ktl-m1--installer.pdf | 2019-12-12 12:10 | 2.7M | |
![[ ]](/icons/layout.gif) | sun2000-100ktl-m1-datasheet.pdf | 2019-12-12 12:09 | 194K | |
![[ ]](/icons/layout.gif) | sun2000-100ktl-m2-datasheet-20230210.pdf | 2024-07-24 17:29 | 346K | |
![[ ]](/icons/layout.gif) | sun2000-100ktl-user-manual.pdf | 2019-12-12 13:41 | 5.6M | |
![[ ]](/icons/layout.gif) | sun2000-100ktl115ktl-m2-datasheet20221012.pdf | 2023-09-15 15:56 | 507K | |
![[ ]](/icons/layout.gif) | sun2000-100m2-115m2-en50549-1-cert-dekra-20221025.pdf | 2024-03-25 09:52 | 458K | |
![[ ]](/icons/layout.gif) | sun2000-450w-p-datasheet.pdf | 2021-11-10 11:05 | 203K | |
![[ ]](/icons/layout.gif) | sun2000-450w-p-quick-guide.pdf | 2021-11-10 11:05 | 907K | |
![[ ]](/icons/layout.gif) | sun2000-optimiser-user-manual.pdf | 2021-11-10 11:06 | 729K | |
![[ ]](/icons/layout.gif) | sun2000p-375-w-smart-pv-optimizer-quick-guide.pdf | 2021-07-30 08:36 | 749K | |
![[ ]](/icons/layout.gif) | sun2000p-375w-smart-pv-optimizer-user-manual.pdf | 2021-07-30 08:37 | 895K | |
![[ ]](/icons/layout.gif) | sunamp-2020-warranty.pdf | 2020-11-17 16:58 | 217K | |
![[ ]](/icons/unknown.gif) | sunamp-power-diverter-compatibility | 2020-12-07 13:09 | 130K | |
![[ ]](/icons/layout.gif) | sunamp-pv-brochure.pdf | 2021-08-31 12:37 | 327K | |
![[ ]](/icons/layout.gif) | sunamp-pv1.pdf | 2021-08-31 12:12 | 327K | |
![[ ]](/icons/layout.gif) | sunamp-samsung-quickstart-2024.pdf | 2024-03-21 15:10 | 7.1M | |
![[ ]](/icons/layout.gif) | sunamp-technical-manual.pdf | 2019-06-27 09:07 | 725K | |
![[ ]](/icons/layout.gif) | sunamp-thermino-brochure.pdf | 2023-06-12 11:02 | 8.5M | |
![[ ]](/icons/layout.gif) | sunamp-thermino-hp-vt-installation-manual.pdf | 2023-06-08 16:12 | 1.4M | |
![[ ]](/icons/layout.gif) | sunamp-uniq-ehw-heat-batteries-datasheet.pdf | 2021-10-01 14:52 | 230K | |
![[ ]](/icons/unknown.gif) | sunamp-uniq-ehw-heat-batteries-installation-and-user-manual | 2020-12-15 15:42 | 1.1M | |
![[ ]](/icons/layout.gif) | sunamp-uniq-ehw-heat-batteries-installation-and-user-manual.pdf | 2020-08-20 16:40 | 1.3M | |
![[ ]](/icons/layout.gif) | sunamp-uniq-ehw-ipv-heat-batteries-installation-and-user-manual.pdf | 2020-08-20 16:51 | 1.4M | |
![[ ]](/icons/unknown.gif) | sunamp-uniq-ehw-ipv-hw-ipv-heat-batteries-installation-and-user-manual | 2020-12-15 15:56 | 1.4M | |
![[ ]](/icons/unknown.gif) | sunamp-uniq-ehw12-heat-batteries-installation-and-user-manual | 2020-12-15 15:43 | 1.0M | |
![[ ]](/icons/layout.gif) | sunamp-uniq-heat-battery-brochure.pdf | 2021-10-01 14:54 | 1.8M | |
![[ ]](/icons/layout.gif) | sunamp-uniq-hw---hw--i-heat-batteries-datasheet.pdf | 2021-02-17 20:05 | 300K | |
![[ ]](/icons/layout.gif) | sunamp-uniq-hw--ilthp-samsung---daikin-heat-batteries-datasheet.pdf | 2021-02-17 20:07 | 286K | |
![[ ]](/icons/layout.gif) | sunamp-uniq-hw--ipv---ehw--ipv-heat-batteries-datasheet.pdf | 2021-02-17 20:06 | 313K | |
![[ ]](/icons/unknown.gif) | sunamp-uniq-hw-i-heat-batteries-installation-and-user-manual | 2020-12-15 16:03 | 1.0M | |
![[ ]](/icons/layout.gif) | sunamp-uniq-hw-i-heat-batteries-installation-and-user-manual.pdf | 2020-08-20 17:09 | 1.1M | |
![[ ]](/icons/unknown.gif) | sunamp-uniq-hw-i-vt-hw-ipv-vt-heat-batteries-addendum-manual | 2021-04-20 17:23 | 636K | |
![[ ]](/icons/unknown.gif) | sunamp-uniq-hw-ilthp-heat-batteries-installation-and-user-manual | 2020-12-15 15:57 | 1.1M | |
![[ ]](/icons/layout.gif) | sunamp-uniq-hw-ilthp-heat-batteries-installation-and-user-manual.pdf | 2020-08-26 13:34 | 1.2M | |
![[ ]](/icons/layout.gif) | sunfixings-auger-adapter-datasheet.pdf | 2021-05-07 09:11 | 64K | |
![[ ]](/icons/unknown.gif) | sunfixings-checklist-ground-mounted-v042018.xlsx | 2021-11-30 15:34 | 186K | |
![[ ]](/icons/layout.gif) | sunfixings-park-tegra-ground-anchor-datasheet.pdf | 2020-06-12 14:54 | 76K | |
![[ ]](/icons/layout.gif) | sunfixings-park-tegra-ground-anchor-mounting-instructions.pdf | 2020-06-12 15:11 | 370K | |
![[ ]](/icons/layout.gif) | sunfixings-park-tegra-single-structure-datasheet.pdf | 2021-05-07 09:13 | 60K | |
![[ ]](/icons/layout.gif) | sunfixings-standard-technical-instructions.pdf | 2020-06-12 15:16 | 415K | |
![[ ]](/icons/layout.gif) | sungrow-1-ph-meter-quick-installation-quide.pdf | 2022-07-29 13:58 | 12M | |
![[ ]](/icons/layout.gif) | sungrow-s100-meter-datasheet-en.pdf | 2023-03-22 11:58 | 105K | |
![[ ]](/icons/layout.gif) | sunpower-back-contact-gen3-solar-cell-ds-en-a4-m3.pdf | 2017-10-02 09:19 | 1.2M | |
![[ ]](/icons/layout.gif) | sunpower-flexible-panel-170w-6x8.pdf | 2019-02-21 15:06 | 920K | |
![[ ]](/icons/layout.gif) | sunpower-spr-e-flex-110-and-spr-e-flex-100-datasheet-rev-a.pdf | 2019-08-07 10:39 | 767K | |
![[ ]](/icons/layout.gif) | sunsaver-duo-datasheet.pdf | 2016-09-12 11:31 | 450K | |
![[ ]](/icons/layout.gif) | sunsaver-duo-manual.pdf | 2016-09-12 11:31 | 813K | |
![[ ]](/icons/layout.gif) | superfast-wallpod.pdf | 2017-05-19 17:23 | 556K | |
![[ ]](/icons/layout.gif) | swapvc-tape--2-.pdf | 2024-01-29 14:42 | 441K | |
![[ ]](/icons/layout.gif) | swgl-christmas-schedules-2019-20.pdf | 2019-12-02 17:25 | 161K | |
![[ ]](/icons/layout.gif) | t-bat-sys-hv-5.8-user-manual-en.pdf | 2023-10-02 15:51 | 4.5M | |
![[ ]](/icons/layout.gif) | tacosetter-inline-100-dn20-datasheet.pdf | 2023-06-15 15:40 | 544K | |
![[ ]](/icons/layout.gif) | tacosetter-inline-130-dn25-datasheet.pdf | 2023-06-16 16:39 | 680K | |
![[ ]](/icons/layout.gif) | talesun-brochure.pdf | 2018-07-27 10:33 | 3.3M | |
![[ ]](/icons/layout.gif) | talesun-datasheet.pdf | 2018-05-16 16:56 | 885K | |
![[ ]](/icons/layout.gif) | talesun-mcs-2018.pdf | 2018-06-07 10:36 | 4.8M | |
![[ ]](/icons/layout.gif) | talesun-warranty.pdf | 2018-07-27 10:32 | 1.8M | |
![[ ]](/icons/layout.gif) | td-460196--1-.pdf | 2023-12-21 16:11 | 239K | |
![[ ]](/icons/layout.gif) | te24-pack.pdf | 2024-06-05 10:16 | 5.1M | |
![[ ]](/icons/layout.gif) | technical-data-sheet---ikhpmf28---intaklean-heat-pump-filter.pdf | 2022-05-19 09:14 | 1.2M | |
![[ ]](/icons/layout.gif) | technical-data-sheet--1-.pdf | 2024-01-19 10:58 | 182K | |
![[ ]](/icons/layout.gif) | technical-data-sheet-potable-expansion-vessels.pdf | 2022-05-19 16:43 | 1.5M | |
![[ ]](/icons/layout.gif) | technical-data-sheet.pdf | 2024-01-19 11:05 | 166K | |
![[ ]](/icons/layout.gif) | technical-data.product.pdf | 2022-01-19 16:15 | 118K | |
![[ ]](/icons/layout.gif) | technical-datasheet-anti-freeze-valve-3.pdf | 2024-02-28 16:41 | 1.8M | |
![[ ]](/icons/layout.gif) | technical-datasheet-anti-freeze-valve.pdf | 2023-11-23 10:54 | 2.6M | |
![[ ]](/icons/layout.gif) | technical-datasheet-cal-pro-heating-vessels.pdf | 2022-10-27 11:51 | 1.3M | |
![[ ]](/icons/layout.gif) | technical-datasheet-hphose750-hphose750b-heat-pump-hoses.pdf | 2022-12-02 13:28 | 2.6M | |
![[ ]](/icons/layout.gif) | technical-datasheet-infaf22-infaf28-fill-flush-valves-1.pdf | 2023-02-22 15:37 | 2.2M | |
![[ ]](/icons/layout.gif) | technical-datasheet-insulated-buffer-vessel.pdf | 2023-08-11 12:55 | 1.6M | |
![[ ]](/icons/layout.gif) | technical-engineer.pdf | 2023-07-20 16:37 | 5.0M | |
![[ ]](/icons/layout.gif) | technical-information-data-communication-with-victron-energy-products-en.pdf | 2023-06-28 13:23 | 401K | |
![[ ]](/icons/layout.gif) | technical-parameters-givbat26.pdf | 2021-03-16 11:10 | 681K | |
![[ ]](/icons/layout.gif) | technical-parameters-givbat52.pdf | 2021-03-16 11:11 | 686K | |
![[ ]](/icons/layout.gif) | technical-parameters-givbat82.pdf | 2021-03-16 11:11 | 683K | |
![[IMG]](/icons/image2.gif) | technical-specs.png | 2023-08-27 13:08 | 56K | |
![[IMG]](/icons/image2.gif) | telford-buffers.png | 2023-08-09 15:58 | 89K | |
![[ ]](/icons/layout.gif) | telford-tempest-air-source-heat-pump-data-sheet-.pdf | 2024-05-14 11:12 | 841K | |
![[ ]](/icons/layout.gif) | telford-tempest-air-source-heat-pump-data-sheet-riello-.pdf | 2023-10-05 17:29 | 841K | |
![[ ]](/icons/layout.gif) | telford-tempest-air-source-heat-pump-technical-data.pdf | 2023-01-23 15:40 | 576K | |
![[ ]](/icons/layout.gif) | tempest-heat-pump-data-sheet-r1.pdf | 2023-06-14 09:53 | 149K | |
![[ ]](/icons/layout.gif) | tempest-heat-pump-data-sheet.pdf | 2023-06-13 12:26 | 149K | |
![[ ]](/icons/layout.gif) | tempest-heat-pump-slim-line-data-sheet--2-.pdf | 2023-04-24 16:51 | 140K | |
![[ ]](/icons/layout.gif) | tempest-heat-pump-technical-details-new-spec.pdf | 2023-04-28 12:33 | 587K | |
![[ ]](/icons/layout.gif) | tempest-heat-pump-with-50l-int-buffer-data-sheet.pdf | 2023-07-07 13:05 | 143K | |
![[ ]](/icons/layout.gif) | tempest-indirect-data-sheet-website-product-data-revised--1-.pdf | 2023-01-23 14:43 | 75K | |
![[ ]](/icons/layout.gif) | tempest-indirect-slimline-datasheet---product-data.pdf | 2023-04-04 12:26 | 76K | |
![[ ]](/icons/layout.gif) | tempest-stainless-heat-pump-with-integral-installation-guide.pdf | 2023-10-06 09:09 | 1.7M | |
![[ ]](/icons/layout.gif) | terms-and-conditions-of-valk-solar-systems-uk-ltd-20200301.pdf | 2020-10-09 09:58 | 199K | |
![[ ]](/icons/layout.gif) | test-pdf.pdf | 2020-09-29 15:53 | 93K | |
![[ ]](/icons/layout.gif) | thermino-customer-warranty.pdf | 2024-04-30 11:23 | 891K | |
![[ ]](/icons/layout.gif) | thermino-e-data-sheet-v2.2.pdf | 2022-10-26 12:07 | 1.0M | |
![[ ]](/icons/layout.gif) | thermino-e-datasheet.pdf | 2023-06-12 10:45 | 1.0M | |
![[ ]](/icons/layout.gif) | thermino-e-installation-manual.pdf | 2023-06-09 10:53 | 4.1M | |
![[ ]](/icons/layout.gif) | thermino-eplus-data-sheet.pdf | 2024-04-30 11:23 | 855K | |
![[ ]](/icons/layout.gif) | thermino-epv---ipv-installation-manual.pdf | 2023-06-09 11:25 | 5.3M | |
![[ ]](/icons/layout.gif) | thermino-epv-datasheet.pdf | 2023-06-08 16:22 | 923K | |
![[ ]](/icons/layout.gif) | thermino-hp----datasheet.pdf | 2023-06-08 16:12 | 787K | |
![[ ]](/icons/layout.gif) | thermino-hp-SG-datasheet.pdf | 2023-06-08 12:09 | 787K | |
![[ ]](/icons/layout.gif) | thermino-hp-sg-installation-and-user-manual.pdf | 2023-06-08 12:10 | 4.9M | |
![[ ]](/icons/layout.gif) | thermino-hppv-data-sheet-v2.2.pdf | 2023-07-17 16:14 | 916K | |
![[ ]](/icons/layout.gif) | thermino-i-datasheet.pdf | 2023-06-12 11:02 | 902K | |
![[ ]](/icons/layout.gif) | thermino-i-installation-manual.pdf | 2023-06-12 11:02 | 4.1M | |
![[ ]](/icons/layout.gif) | thermino-ipv-datasheet.pdf | 2023-06-09 11:24 | 492K | |
![[ ]](/icons/layout.gif) | thermino-plus-brochure.pdf | 2024-05-02 15:08 | 1.3M | |
![[ ]](/icons/layout.gif) | thermino-xplus-data-sheet.pdf | 2023-11-30 15:31 | 902K | |
![[ ]](/icons/layout.gif) | thermostatic-mixing-valve-datasheet.pdf | 2021-01-04 11:24 | 142K | |
![[ ]](/icons/layout.gif) | thermox-glycol-antifreeze-datasheet.pdf | 2021-03-10 17:18 | 1.4M | |
![[ ]](/icons/layout.gif) | thinkwe-cataloguev7.0.pdf | 2024-03-20 10:29 | 2.3M | |
![[ ]](/icons/layout.gif) | three-phase-inverter-se25k-se33.3k-eu.pdf | 2023-09-07 16:49 | 180K | |
![[ ]](/icons/layout.gif) | three-phase-inverter-with-setapp-multilanguage-quick-installation-guide--1-.pdf | 2019-10-18 11:51 | 2.9M | |
![[ ]](/icons/layout.gif) | three-phase-inverter-with-setapp-multilanguage-quick-installation-guide.pdf | 2019-10-18 11:36 | 2.9M | |
![[ ]](/icons/layout.gif) | three-phase-inverter-with-synergy-technology-se50k-se120k-eu.pdf | 2023-09-07 12:58 | 784K | |
![[ ]](/icons/layout.gif) | tiger-brochure-en-p.pdf | 2022-08-04 17:23 | 3.0M | |
![[ ]](/icons/layout.gif) | tigo-cca-quick-install.pdf | 2018-07-09 16:40 | 1.5M | |
![[ ]](/icons/layout.gif) | tigo-cca-tap-quick-guide.pdf | 2019-02-11 10:45 | 462K | |
![[ ]](/icons/layout.gif) | tigo-cloud-advanced-datasheet.pdf | 2018-07-09 15:59 | 487K | |
![[ ]](/icons/layout.gif) | tigo-cloud-connect-datasheet.pdf | 2017-05-19 17:23 | 957K | |
![[ ]](/icons/layout.gif) | tigo-cloud-connect-installation-quick-start-guide-manual.pdf | 2018-01-17 13:40 | 485K | |
![[ ]](/icons/layout.gif) | tigo-gateway-datasheet.pdf | 2017-05-19 17:23 | 135K | |
![[ ]](/icons/layout.gif) | tigo-installation-manual.pdf | 2021-03-03 10:05 | 1.1M | |
![[ ]](/icons/layout.gif) | tigo-jb-optimisers-datasheet-2018.pdf | 2018-05-02 16:19 | 1.1M | |
![[ ]](/icons/layout.gif) | tigo-manual-cca-tap-ts4.pdf | 2019-02-11 10:45 | 2.5M | |
![[ ]](/icons/layout.gif) | tigo-optimiser-gateway-cloud-connect-installation-manual.pdf | 2017-08-04 16:54 | 2.3M | |
![[ ]](/icons/layout.gif) | tigo-quick-start-guide---ts4-a-o.pdf | 2021-03-03 10:04 | 229K | |
![[ ]](/icons/layout.gif) | tigo-retro-optimiser-datasheet-2018.pdf | 2018-05-01 09:43 | 1.8M | |
![[ ]](/icons/layout.gif) | tigo-retrofit-duo-datasheet.pdf | 2018-03-07 12:33 | 1.6M | |
![[ ]](/icons/layout.gif) | tigo-retrofit-optimiser-datasheet.pdf | 2017-06-07 16:43 | 1.7M | |
![[ ]](/icons/layout.gif) | tigo-ts4-a-o-datasheet.pdf | 2019-05-10 15:40 | 1.2M | |
![[ ]](/icons/layout.gif) | tigo-ts4-o-optimizer-datasheet.pdf | 2017-05-19 17:23 | 269K | |
![[ ]](/icons/layout.gif) | tigo-warranty.pdf | 2017-06-22 13:54 | 305K | |
![[ ]](/icons/layout.gif) | tm31-110-data-sheet--june-21-.pdf | 2022-01-31 16:42 | 260K | |
![[ ]](/icons/layout.gif) | tolerance-table-gse-in-roof-system-en-v12.0.pdf | 2023-07-24 12:46 | 350K | |
![[ ]](/icons/layout.gif) | tpm-e-quik-guide-en-202305.pdf | 2023-11-10 09:06 | 2.1M | |
![[ ]](/icons/layout.gif) | tr-jkm360-380m-6rl3-b-a1.1-en.pdf | 2022-08-03 14:19 | 1.2M | |
![[ ]](/icons/layout.gif) | tr28bbv-datasheet.pdf | 2023-11-21 12:49 | 158K | |
![[ ]](/icons/layout.gif) | tracer-an-50-100a--manual-en-v3.1.pdf | 2021-06-23 10:37 | 2.1M | |
![[ ]](/icons/layout.gif) | tracer-an-sms-el-v1.0.pdf | 2019-08-14 13:29 | 1.9M | |
![[ ]](/icons/layout.gif) | tracer-bn-datasheet.pdf | 2016-09-12 11:31 | 650K | |
![[ ]](/icons/layout.gif) | trees-for-cities.pdf | 2022-12-14 15:42 | 188K | |
![[ ]](/icons/layout.gif) | trees-for-life.pdf | 2022-12-07 12:27 | 41K | |
![[ ]](/icons/layout.gif) | tri-rated--1-.pdf | 2023-06-01 10:15 | 431K | |
![[ ]](/icons/layout.gif) | tribe-brochure.pdf | 2021-04-14 16:08 | 1.5M | |
![[ ]](/icons/layout.gif) | tribe-datasheet.pdf | 2021-12-20 16:02 | 4.2M | |
![[ ]](/icons/layout.gif) | tribe-manual.pdf | 2021-12-20 16:02 | 2.7M | |
![[ ]](/icons/layout.gif) | tribe-warranty.pdf | 2021-12-20 16:01 | 145K | |
![[ ]](/icons/layout.gif) | tric-f-landscape.pdf | 2024-07-05 16:31 | 798K | |
![[ ]](/icons/layout.gif) | trina-270w-poly-pd05-datasheet.pdf | 2017-06-22 12:51 | 865K | |
![[ ]](/icons/layout.gif) | trina-275w-pd05.pdf | 2019-07-05 16:11 | 937K | |
![[ ]](/icons/layout.gif) | trina-285-datasheet-2020.pdf | 2020-05-27 16:06 | 1.1M | |
![[ ]](/icons/layout.gif) | trina-285-user-manual.pdf | 2020-05-27 16:06 | 1.6M | |
![[ ]](/icons/layout.gif) | trina-315-mono.pdf | 2019-12-17 10:40 | 335K | |
![[ ]](/icons/unknown.gif) | trina-320-340w-honey-datasheet | 2019-06-21 16:49 | 396K | |
![[ ]](/icons/layout.gif) | trina-320-340w-honey-datasheet.pdf.pdf | 2019-06-21 16:51 | 396K | |
![[ ]](/icons/layout.gif) | trina-400w-vertex-de0908-datasheet-220121.pdf | 2021-06-02 11:11 | 516K | |
![[ ]](/icons/layout.gif) | trina-brochure-400w.pdf | 2022-07-27 10:03 | 1.7M | |
![[ ]](/icons/layout.gif) | trina-duomax-warranty-en-20201106-min.pdf | 2022-07-27 10:03 | 351K | |
![[ ]](/icons/layout.gif) | trina-duomax-warranty-en-20201106.pdf | 2021-01-08 16:19 | 8.0M | |
![[ ]](/icons/layout.gif) | trina-eu-warranty-2020-11.pdf | 2021-01-22 16:25 | 5.4M | |
![[ ]](/icons/layout.gif) | trina-honey-275w-poly.pdf | 2018-10-25 09:41 | 3.3M | |
![[ ]](/icons/layout.gif) | trina-honey-280w-datasheet.pdf | 2020-08-11 13:43 | 443K | |
![[ ]](/icons/layout.gif) | trina-honey-320-340-bw-mono-datasheet.pdf | 2020-07-24 11:07 | 361K | |
![[ ]](/icons/layout.gif) | trina-honey-360-380w-de0808-220121.pdf | 2021-01-22 11:31 | 1.6M | |
![[ ]](/icons/layout.gif) | trina-honey-360-385w-bw-datasheet-230821.pdf | 2021-08-23 11:38 | 1.8M | |
![[ ]](/icons/layout.gif) | trina-honey-all-black-datasheet.pdf | 2017-10-02 16:43 | 1.0M | |
![[ ]](/icons/layout.gif) | trina-honey-eu-warranty-2021-01.pdf | 2021-08-23 11:39 | 651K | |
![[ ]](/icons/layout.gif) | trina-honey-installation-manual.pdf | 2020-04-17 11:15 | 1.9M | |
![[ ]](/icons/layout.gif) | trina-honey-m-166series-usermanual-frame-en-20200414-v1.pdf | 2021-08-23 11:42 | 1.6M | |
![[ ]](/icons/layout.gif) | trina-honey-warranty-en-20200601-v1.pdf | 2020-07-24 11:08 | 765K | |
![[ ]](/icons/layout.gif) | trina-honeyblack-315-335-dd06m05ii-datasheet-011120.pdf | 2021-01-25 11:13 | 302K | |
![[ ]](/icons/layout.gif) | trina-honeyblack-m-datasheet.pdf | 2019-08-14 17:15 | 767K | |
![[ ]](/icons/layout.gif) | trina-installation-manual.pdf | 2017-06-22 12:51 | 898K | |
![[ ]](/icons/layout.gif) | trina-manual.pdf | 2019-04-15 11:14 | 1.0M | |
![[ ]](/icons/layout.gif) | trina-mcs-cert--2016.pdf | 2020-05-27 16:08 | 6.4M | |
![[ ]](/icons/layout.gif) | trina-mcs-certificate.pdf | 2017-06-22 12:51 | 5.3M | |
![[ ]](/icons/layout.gif) | trina-mcs-certs-021220.pdf | 2021-01-25 11:06 | 244K | |
![[ ]](/icons/layout.gif) | trina-policy.pdf | 2021-04-27 14:01 | 1.8M | |
![[ ]](/icons/layout.gif) | trina-solar-mcs-certificate.pdf | 2019-12-23 13:39 | 1.0M | |
![[ ]](/icons/layout.gif) | trina-splitmax-datasheet.pdf | 2019-04-11 17:06 | 323K | |
![[ ]](/icons/unknown.gif) | trina-user-manual-17032020 | 2020-07-24 11:06 | 1.6M | |
![[ ]](/icons/layout.gif) | trina-vertex-400w-datasheet-de09.05-080121.pdf | 2021-01-08 15:48 | 2.3M | |
![[ ]](/icons/layout.gif) | trina-vertex-de09-05-datasheet.pdf | 2022-07-27 10:01 | 538K | |
![[ ]](/icons/layout.gif) | trina-vertex-s-380--mcs-certificate.pdf | 2021-07-09 14:13 | 262K | |
![[ ]](/icons/layout.gif) | trina-vertex-s-380-400-manual.pdf | 2022-07-27 10:01 | 1.5M | |
![[ ]](/icons/layout.gif) | trina-warranty-2020.pdf | 2020-05-27 16:07 | 1.0M | |
![[ ]](/icons/layout.gif) | trina-warranty-161220.pdf | 2020-12-16 10:42 | 568K | |
![[ ]](/icons/layout.gif) | trina-warranty.pdf | 2017-06-22 12:51 | 264K | |
![[ ]](/icons/layout.gif) | trinasolar_honey_tsm-pd05_255-270w.pdf | 2017-10-11 09:40 | 852K | |
![[ ]](/icons/layout.gif) | trinavertex-.pdf | 2023-06-29 13:22 | 1.0M | |
![[ ]](/icons/layout.gif) | triple-power-5.8kwh-datasheet.pdf | 2020-01-23 09:28 | 2.3M | |
![[ ]](/icons/layout.gif) | triple-power-quick-installation-guide.pdf | 2019-03-06 13:19 | 1.8M | |
![[ ]](/icons/layout.gif) | triple-power-user-manual.pdf | 2019-01-04 17:10 | 3.9M | |
![[ ]](/icons/layout.gif) | triple-power5.8kwh-blue-cover-user-manual.pdf | 2021-08-05 15:26 | 5.0M | |
![[ ]](/icons/layout.gif) | triron-sms-el-v1.2-manual.pdf | 2019-04-09 11:47 | 2.4M | |
![[ ]](/icons/layout.gif) | triron-sms-el-v1.2.pdf | 2019-08-14 13:21 | 2.4M | |
![[ ]](/icons/layout.gif) | ts-56A-3-operating instructions.pdf | 2021-07-08 09:57 | 1.2M | |
![[ ]](/icons/layout.gif) | ts-65A-3-quick-guide.pdf | 2021-07-08 09:57 | 849K | |
![[ ]](/icons/unknown.gif) | ts4-a-and-r-x-duo-compatibility-checker-final.xlsx | 2020-01-24 16:39 | 651K | |
![[ ]](/icons/layout.gif) | ts4-a-o--700w---optimization-add-on-.pdf | 2022-05-09 09:33 | 1.7M | |
![[ ]](/icons/layout.gif) | ts4-a-o-duo-datasheet.pdf | 2020-01-27 15:36 | 1.3M | |
![[ ]](/icons/layout.gif) | tsmi170h-hp-2-x-dn32-5m.pdf | 2023-04-28 15:30 | 125K | |
![[ ]](/icons/layout.gif) | tsmi250hhp.pdf | 2023-05-19 15:29 | 131K | |
![[ ]](/icons/layout.gif) | tsmi300hhp.pdf | 2023-05-19 15:31 | 133K | |
![[ ]](/icons/layout.gif) | tum-ev-gprs-datasheet-7kw.pdf | 2020-07-27 09:07 | 3.1M | |
![[ ]](/icons/layout.gif) | tuv-manual-iec-2016-2022-04.pdf | 2022-11-10 17:20 | 8.3M | |
![[ ]](/icons/layout.gif) | tuv-sud-ammonia-certificate-1500v-new-standard--20230109-.pdf | 2023-09-08 13:55 | 517K | |
![[ ]](/icons/layout.gif) | tuv-sud-ce-certificate-1000v-new-standard--20220830----70.406.18.020.22-13-rev.02--1---1-.pdf | 2023-05-11 09:13 | 317K | |
![[ ]](/icons/layout.gif) | tuv-sud-ce-certificate-1000v-new-standard--20220830----70.406.18.020.22-13-rev.02--1---2-.pdf | 2023-05-11 09:15 | 317K | |
![[ ]](/icons/layout.gif) | tuv-sud-ce-certificate-1000v-new-standard--20220830----70.406.18.020.22-13-rev.02--1-.pdf | 2023-07-28 11:55 | 317K | |
![[ ]](/icons/layout.gif) | tuv-sud-ce-certificate-1500v-new-standard--20230109-.pdf | 2023-09-08 13:54 | 392K | |
![[ ]](/icons/layout.gif) | tuv-sud-certificate-.pdf | 2020-01-14 08:19 | 639K | |
![[ ]](/icons/layout.gif) | tuv-sud-certificate-1500v-new-standard--20230109-.pdf | 2023-09-08 13:57 | 409K | |
![[ ]](/icons/layout.gif) | tuv-sud-slat-mist-certificate--1500v-new-standard---20230109-.pdf | 2023-09-08 13:54 | 517K | |
![[ ]](/icons/layout.gif) | tuvattestationtrina.pdf | 2024-03-19 10:23 | 1.2M | |
![[ ]](/icons/layout.gif) | type-2-brackets-amended-july-2015.pdf | 2021-02-18 14:47 | 3.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-1-for-fronius-primo-3.0-1-tr28367-amd3....pdf | 2019-04-23 11:36 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-1-for-fronius-primo-3.5-1-tr28368-amd3....pdf | 2019-04-23 11:36 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-1-for-fronius-primo-3.6-1-tr28369-amd3....pdf | 2019-04-23 11:37 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-for-fronius-symo-3.0-3-m-tr28350-issue1-amd3--1-.pdf | 2019-04-23 11:28 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-for-fronius-symo-3.7-3-m-tr28351-issue1-amd3.pdf | 2019-04-23 11:31 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-for-fronius-symo-4.5-3-m-tr28352-issue1-amd3.pdf | 2019-04-23 11:31 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-for-fronius-symo-5.0-3-m-tr28353-issue1-amd3.pdf | 2019-04-23 11:31 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-for-fronius-symo-6.0-3-m-tr28355-issue1-amd3.pdf | 2019-04-23 11:32 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-for-fronius-symo-7.0-3-m-tr28357-issue1-amd3.pdf | 2019-04-23 11:34 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-for-fronius-symo-8.2-3-m-tr28359-issue1-amd3.pdf | 2019-04-23 11:35 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g98-for-fronius-symo-10.0-3-m-tr28362-amd3....pdf | 2019-04-23 11:35 | 1.0M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g99-1-for-fronius-primo-4.0-1-tr28370-amd4....pdf | 2019-04-23 11:37 | 812K | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g99-1-for-fronius-primo-4.6-1-tr28371-amd4....pdf | 2019-05-14 11:30 | 3.8M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g99-1-for-fronius-primo-5.0-1-tr28372-amd4....pdf | 2019-04-23 11:39 | 809K | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g99-1-for-fronius-primo-8.2-1-tr28374-amd4....pdf | 2019-04-23 11:39 | 810K | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g99-for-fronius-eco-25.0-3-s-tr28360-amd4.pdf | 2019-04-23 11:40 | 804K | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g99-for-fronius-eco-27.0-3-s-tr28361-amd4.pdf | 2019-04-23 11:40 | 804K | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g99-for-fronius-symo-12.5-3-m-tr28363-amd4....pdf | 2019-04-23 11:41 | 805K | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g99-for-fronius-symo-15.0-3-m-tr28364-amd4....pdf | 2019-05-14 11:30 | 3.8M | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g99-for-fronius-symo-17.5-3-m-tr28365-amd4....pdf | 2019-04-23 11:41 | 586K | |
![[ ]](/icons/layout.gif) | type-verification-test-report-g99-for-fronius-symo-20.0-3-m-tr28366-amd4....pdf | 2019-04-23 11:42 | 584K | |
![[ ]](/icons/layout.gif) | u3a1-50p-a-msds.pdf | 2019-08-27 16:32 | 146K | |
![[ ]](/icons/layout.gif) | ufr1001e-om-ziehl-2021-11-29.pdf | 2022-02-04 12:47 | 2.6M | |
![[ ]](/icons/layout.gif) | uk-cylinders-ltd-flowcyl-heat-pump-cylinders---buffers--1-.pdf | 2023-12-19 10:37 | 2.7M | |
![[ ]](/icons/layout.gif) | uk-cylinders-ltd-flowcyl-heat-pump-cylinders---buffers.pdf | 2023-12-15 10:59 | 2.7M | |
![[ ]](/icons/unknown.gif) | uk-cylinders-standard-datasheet | 2022-10-12 10:41 | 2.7M | |
![[ ]](/icons/layout.gif) | uk-datasheet-all-in-one-3.6.pdf | 2024-07-17 17:00 | 616K | |
![[ ]](/icons/layout.gif) | uk-datasheet-all-in-one.pdf | 2024-03-14 12:08 | 582K | |
![[ ]](/icons/layout.gif) | uk-equalizer-three-phase-guide.pdf | 2023-07-25 14:55 | 110K | |
![[ ]](/icons/layout.gif) | uk-installation-manual-all-in-one--1-.pdf | 2024-05-09 13:17 | 7.0M | |
![[ ]](/icons/layout.gif) | uk-installation-manual-all-in-one.pdf | 2024-03-15 14:00 | 1.5M | |
![[ ]](/icons/layout.gif) | uk-only-solaredge-backup-interface-single-phase-quick-installation-guide-v4--002-.pdf | 2024-05-10 10:35 | 1.1M | |
![[ ]](/icons/layout.gif) | uk-warranty-extension-order-form-growatt-15-25.pdf | 2017-10-03 12:49 | 414K | |
![[ ]](/icons/layout.gif) | uk-warranty.pdf | 2023-11-03 10:16 | 290K | |
![[ ]](/icons/layout.gif) | ultra-pro-white-vessels.pdf | 2023-11-07 16:45 | 1.1M | |
![[ ]](/icons/layout.gif) | ultra-slim-unvented-cylinder1.pdf | 2021-05-26 11:18 | 699K | |
![[ ]](/icons/layout.gif) | ultra-slim-unvented-cylinder2--1-.pdf | 2021-05-26 11:17 | 3.1M | |
![[ ]](/icons/layout.gif) | um-33-50cx.pdf | 2023-05-25 16:05 | 2.0M | |
![[ ]](/icons/layout.gif) | um-125cx.pdf | 2023-03-17 10:06 | 2.3M | |
![[ ]](/icons/layout.gif) | um-rs.pdf | 2023-03-17 10:16 | 1.9M | |
![[ ]](/icons/layout.gif) | um-rt.pdf | 2023-03-17 10:21 | 2.8M | |
![[ ]](/icons/layout.gif) | um0009-asw3000-5000-s-en-v05-0223.pdf | 2024-01-26 12:26 | 2.2M | |
![[ ]](/icons/layout.gif) | um0014-asw-3k-20k-lt-g2-pro-en-v02-0622.pdf | 2022-12-08 16:05 | 1.6M | |
![[ ]](/icons/layout.gif) | um0014-asw-3k-20k-lt-g2-pro-en-v03-0722-1--1-.pdf | 2024-01-26 12:30 | 1.6M | |
![[ ]](/icons/layout.gif) | um0016-asw-25k-40k-lt-g3-en-v03-0722.pdf | 2023-05-10 14:54 | 2.0M | |
![[ ]](/icons/layout.gif) | un38.3-u3a1-50p-a.pdf | 2019-08-27 16:30 | 269K | |
![[ ]](/icons/layout.gif) | uniq-hw--i-heat-batteries-installation-and-user-manual-v1-2.pdf | 2020-08-24 10:57 | 1.1M | |
![[ ]](/icons/layout.gif) | unirac_solar_panel_mounting_feet.pdf | 2016-09-12 11:31 | 99K | |
![[ ]](/icons/unknown.gif) | unisolar-68w-datasheet | 2017-05-31 10:01 | 99K | |
![[ ]](/icons/layout.gif) | unisolar-136w-flexible-solar-panel-datasheet.pdf | 2017-05-31 09:19 | 99K | |
![[ ]](/icons/layout.gif) | unisolar_pvl68_peel_n_stick_solar_panel_datasheet.pdf | 2016-09-12 11:31 | 1.3M | |
![[ ]](/icons/layout.gif) | unisolar_pvl136_peel_n_stick_solar_panel_datasheet.pdf | 2016-09-12 11:31 | 1.3M | |
![[ ]](/icons/layout.gif) | unistor-datasheet.pdf | 2021-06-22 12:30 | 1.9M | |
![[ ]](/icons/layout.gif) | unistor-installation-manual.pdf | 2021-06-22 12:30 | 626K | |
![[ ]](/icons/layout.gif) | unistor-operating-instructions.pdf | 2021-06-22 12:30 | 525K | |
![[ ]](/icons/layout.gif) | universal-clamp-for-tilt-mounts.pdf | 2020-07-31 12:57 | 116K | |
![[ ]](/icons/layout.gif) | universal-clamp.pdf | 2020-03-06 10:06 | 116K | |
![[ ]](/icons/layout.gif) | universal-life04-lite-batteryinverter-warranty.pdf | 2021-11-16 11:13 | 331K | |
![[ ]](/icons/layout.gif) | unvented-group-sets-technical-data-sheet.pdf | 2024-03-28 11:47 | 2.4M | |
![[ ]](/icons/layout.gif) | updated-quick-start-guide-ss.pdf | 2024-03-27 09:59 | 7.3M | |
![[ ]](/icons/layout.gif) | updated-samsung-world-heat-pre-plumbed-quick-start-guide.pdf | 2024-03-21 12:37 | 6.1M | |
![[ ]](/icons/layout.gif) | upm4%20data%20booklet%20-%20final%20(1).pdf | 2023-03-15 09:50 | 0 | |
![[ ]](/icons/layout.gif) | upm4%20data%20booklet%20-%20final.pdf | 2022-10-19 11:03 | 0 | |
![[ ]](/icons/layout.gif) | upm4-quick-guide.pdf | 2022-10-18 08:57 | 4.1M | |
![[ ]](/icons/layout.gif) | us2000c-sds-------1-.pdf | 2021-06-08 08:59 | 13M | |
![[ ]](/icons/layout.gif) | us3000-sds---.pdf | 2021-06-08 09:00 | 3.5M | |
![[ ]](/icons/layout.gif) | us3000b-plus-product-manual.pdf | 2019-04-15 09:32 | 4.1M | |
![[ ]](/icons/layout.gif) | us3000c-sds-------1-.pdf | 2021-06-08 09:01 | 13M | |
![[ ]](/icons/layout.gif) | us5000-datasheet.pdf | 2022-04-11 17:18 | 2.5M | |
![[ ]](/icons/layout.gif) | us5000-intro.pdf | 2022-04-11 17:18 | 1.4M | |
![[ ]](/icons/layout.gif) | user-manual-en-hpt-series-3phase-grid-tied-photovoltaic-inverter-4.pdf | 2021-04-09 09:21 | 2.3M | |
![[ ]](/icons/layout.gif) | user-manual-hpk-10003000-series-single-phase-grid-tied-photovoltaic-inverter.pdf | 2022-06-29 14:44 | 1.9M | |
![[ ]](/icons/layout.gif) | user-manual-merc-1100w-p-1300w-p-smart-pv-optimizer-v05-2023-03-31-en.pdf | 2024-06-07 14:07 | 1.3M | |
![[ ]](/icons/layout.gif) | user-manual-sun2000-50ktl-m3-v08-2023-10-17-en.pdf | 2024-05-15 12:55 | 5.1M | |
![[ ]](/icons/layout.gif) | user-manual-sun2000-100ktl-115ktl-m2-v10-2023-11-20-en.pdf | 2024-03-25 09:20 | 5.9M | |
![[ ]](/icons/layout.gif) | user-manual.pdf | 2023-11-06 12:18 | 4.4M | |
![[ ]](/icons/layout.gif) | usermanual-sun2000-12ktl-25ktl-m5-v08-2024-01-15-en.pdf | 2024-03-19 14:52 | 2.4M | |
![[ ]](/icons/layout.gif) | usual-manual-string-level-rapid-shutdown--p2-.pdf | 2024-07-17 15:55 | 1.2M | |
![[IMG]](/icons/image2.gif) | v2-zappi-is-a-smart-charger.png | 2019-04-17 10:40 | 442K | |
![[ ]](/icons/layout.gif) | vaillant-arostor-brochure.pdf | 2021-12-01 10:04 | 1.3M | |
![[ ]](/icons/layout.gif) | vaillant-arotherm-split-datasheet.pdf | 2021-06-22 09:53 | 1.7M | |
![[ ]](/icons/layout.gif) | vaillantheatexchangermodule.pdf | 2024-02-24 10:01 | 1.8M | |
![[ ]](/icons/layout.gif) | valk-datasheet-valkpro.pdf | 2024-01-11 17:22 | 259K | |
![[ ]](/icons/layout.gif) | valk-drawing.pdf | 2021-10-14 13:47 | 385K | |
![[ ]](/icons/layout.gif) | valk-manual.pdf | 2023-03-31 17:28 | 2.5M | |
![[ ]](/icons/layout.gif) | valkbox-datasheet.pdf | 2019-10-11 13:22 | 699K | |
![[ ]](/icons/layout.gif) | valkbox-manual.pdf | 2019-10-11 13:22 | 1.0M | |
![[ ]](/icons/layout.gif) | valkpro-l10-south-manual-v1-1-0.pdf | 2021-05-28 14:55 | 3.7M | |
![[ ]](/icons/layout.gif) | valkpro-p10-south-plan.pdf | 2022-01-31 17:01 | 530K | |
![[ ]](/icons/layout.gif) | van-der-valk-auger-adapter.pdf | 2021-02-15 17:28 | 558K | |
![[ ]](/icons/layout.gif) | van-der-valk-quote-necessary-information---1-.pdf | 2020-10-12 16:35 | 47K | |
![[ ]](/icons/layout.gif) | van-der-valk-quote-necessary-information-.pdf | 2020-10-12 11:03 | 47K | |
![[ ]](/icons/layout.gif) | variodatasheet.pdf | 2022-06-29 11:42 | 1.3M | |
![[ ]](/icons/layout.gif) | vdv-datasheet-roof-hooks---tiles.pdf | 2018-07-13 09:19 | 204K | |
![[ ]](/icons/layout.gif) | vdv-reinforced-bird-blocker-manual.pdf | 2020-08-05 13:27 | 6.5M | |
![[ ]](/icons/layout.gif) | vdv-valkpro-datasheet-20190814.pdf | 2020-10-09 09:57 | 476K | |
![[ ]](/icons/layout.gif) | vdv-windtunnel-test-cert.pdf | 2020-10-09 09:58 | 95K | |
![[ ]](/icons/layout.gif) | ve-bus-configuration-guide-en.pdf | 2021-07-13 16:52 | 5.0M | |
![[ ]](/icons/layout.gif) | ve-direct-bluetooth-smart-dongle-en.pdf | 2021-09-17 15:27 | 1.2M | |
![[ ]](/icons/layout.gif) | ve.can-to-can-bus-bms-cables-manual.pdf | 2020-05-11 10:33 | 36K | |
![[ ]](/icons/unknown.gif) | vebus_smart_dongle_manual | 2018-11-01 12:02 | 28K | |
![[ ]](/icons/layout.gif) | velux-gse-information.pdf | 2021-05-26 12:55 | 203K | |
![[ ]](/icons/layout.gif) | velux-gse-install-details.pdf | 2021-05-26 12:57 | 282K | |
![[ ]](/icons/layout.gif) | velux-gse-installation-manual.pdf | 2021-05-26 12:54 | 5.5M | |
![[ ]](/icons/layout.gif) | velux-gse-mk08-h1710-frame.pdf | 2021-05-26 12:52 | 282K | |
![[ ]](/icons/unknown.gif) | venus-os:start | 2020-02-18 14:29 | 46K | |
![[ ]](/icons/layout.gif) | vertexs-de09r.08.pdf | 2022-07-27 09:59 | 582K | |
![[ ]](/icons/layout.gif) | vertexs-neg9rc.27-en-2023-b-web.pdf | 2024-03-19 10:21 | 359K | |
![[ ]](/icons/unknown.gif) | victron-batprot-48-datasheet | 2016-09-12 11:31 | 216K | |
![[ ]](/icons/unknown.gif) | victron-batprot-48-manual | 2016-09-12 11:31 | 513K | |
![[ ]](/icons/unknown.gif) | victron-batprot-datasheet | 2016-09-12 11:31 | 262K | |
![[ ]](/icons/unknown.gif) | victron-batprot-manual | 2016-09-12 11:31 | 541K | |
![[ ]](/icons/layout.gif) | victron-easysolar-1600-data-sheet.pdf | 2016-09-12 11:31 | 530K | |
![[ ]](/icons/layout.gif) | victron-energy-datasheet-lead-carbon-battery-en.pdf | 2018-11-22 09:40 | 72K | |
![[ ]](/icons/layout.gif) | victron-energy-easysolar-ii-gx-en-manual.pdf | 2022-02-03 13:13 | 7.7M | |
![[ ]](/icons/layout.gif) | victron-energy-limited-warranty-policy-rev-03-en.pdf | 2021-03-02 17:03 | 108K | |
![[ ]](/icons/layout.gif) | victron-energy-multi-rs-solar-en-manual.pdf | 2022-02-03 13:26 | 0 | |
![[ ]](/icons/layout.gif) | victron-g100-declaration-multi.pdf | 2018-08-10 16:13 | 1.3M | |
![[ ]](/icons/layout.gif) | victron-gx-product-range--1-.pdf | 2020-05-11 15:31 | 134K | |
![[ ]](/icons/layout.gif) | victron-gx-product-range--2-.pdf | 2020-05-11 15:41 | 134K | |
![[ ]](/icons/layout.gif) | victron-gx-product-range.pdf | 2020-05-11 15:11 | 134K | |
![[ ]](/icons/unknown.gif) | victron-mppt-smart-85a-100a-datasheet | 2016-09-12 11:31 | 160K | |
![[ ]](/icons/unknown.gif) | victron-mppt-smart-85a-100a-dims | 2016-09-12 11:31 | 560K | |
![[ ]](/icons/unknown.gif) | victron-mppt-smart-85a-100a-manual | 2016-09-12 11:31 | 1.1M | |
![[ ]](/icons/layout.gif) | victron-multiplus-datasheet.pdf | 2016-09-12 11:31 | 331K | |
![[ ]](/icons/unknown.gif) | victron-orion-5-12-17-manual | 2016-09-12 11:31 | 83K | |
![[ ]](/icons/unknown.gif) | victron-orion-datasheet | 2016-09-12 11:31 | 209K | |
![[ ]](/icons/unknown.gif) | victron-orion-tr-datasheet | 2016-09-12 11:31 | 77K | |
![[ ]](/icons/layout.gif) | victron-self-consumption-manual.pdf | 2016-09-12 11:31 | 2.0M | |
![[TXT]](/icons/text.gif) | victron-smart_battery_sense_manual.html | 2018-10-31 16:44 | 23K | |
![[ ]](/icons/layout.gif) | victron-solar-panel-installation-manual.pdf | 2022-02-10 10:26 | 1.2M | |
![[ ]](/icons/layout.gif) | victron-solar-panel-user-manual.pdf | 2022-02-10 10:24 | 1.2M | |
![[ ]](/icons/layout.gif) | victron800-1200-inverter.pdf | 2016-09-12 11:31 | 490K | |
![[ ]](/icons/layout.gif) | victron_quattro_3kva-10kva.pdf | 2016-09-12 11:31 | 553K | |
![[ ]](/icons/layout.gif) | victronconnect-vebus.pdf | 2020-05-11 11:23 | 2.8M | |
![[ ]](/icons/unknown.gif) | view | 2024-03-25 11:17 | 87K | |
![[ ]](/icons/unknown.gif) | view?usp=sharing | 2023-08-09 09:07 | 78K | |
![[ ]](/icons/layout.gif) | voltage-on-frame-white-paper-v03.pdf | 2023-12-07 11:05 | 304K | |
![[ ]](/icons/layout.gif) | vrc-700-installation-instructions.pdf | 2021-06-23 10:44 | 1.0M | |
![[ ]](/icons/layout.gif) | vrc-700-operating-instructions.pdf | 2021-06-23 10:44 | 809K | |
![[ ]](/icons/layout.gif) | vrla-1-.pdf | 2022-02-02 17:11 | 154K | |
![[ ]](/icons/layout.gif) | waiver-letter-rfw-001246c.pdf | 2023-05-19 11:31 | 96K | |
![[ ]](/icons/layout.gif) | waiver-letter-rfw-002163d---europe-and-carribeans-68b8eba03a3356723ef7f86d656d3b94--2---1-.pdf | 2024-06-14 10:46 | 91K | |
![[ ]](/icons/layout.gif) | wall-mounting-cabinets.pdf | 2019-08-13 11:09 | 157K | |
![[ ]](/icons/layout.gif) | wall-pod-ev-ready-installation-sheets.pdf | 2019-05-21 12:50 | 32K | |
![[ ]](/icons/layout.gif) | wallbox-energy-meters-installation-guide.pdf | 2023-07-14 15:43 | 177K | |
![[ ]](/icons/layout.gif) | wallbox-power-boost-manual.pdf | 2020-08-06 10:46 | 702K | |
![[ ]](/icons/layout.gif) | wallbox-pulsar-plus-uk-datasheet-190421.pdf | 2021-04-19 09:53 | 383K | |
![[ ]](/icons/layout.gif) | wallbox-quasar-datasheet.pdf | 2019-12-09 16:35 | 286K | |
![[ ]](/icons/layout.gif) | wallbox-statement-pulsar-plus-uk-25062020-.pdf | 2020-06-25 14:29 | 74K | |
![[ ]](/icons/layout.gif) | wallbox-warranty.pdf | 2022-11-29 16:10 | 111K | |
![[ ]](/icons/layout.gif) | wallboxdatasheet.pdf | 2021-07-21 12:04 | 383K | |
![[ ]](/icons/layout.gif) | wallboxdrilltemplate.pdf | 2021-07-21 12:02 | 1.5M | |
![[ ]](/icons/layout.gif) | wallboxinstallermanual.pdf | 2021-07-21 12:01 | 1.3M | |
![[ ]](/icons/layout.gif) | wallboxusermanual.pdf | 2021-07-21 12:00 | 564K | |
![[ ]](/icons/layout.gif) | wallpod-ev-comm-superfast-installation-sheet.pdf | 2019-05-21 12:49 | 32K | |
![[ ]](/icons/layout.gif) | wallpod-ev-homesmart-socketed--ev-energy--data-sheet---01.pdf | 2019-10-04 12:15 | 2.1M | |
![[ ]](/icons/layout.gif) | wallpod-ev-installation-sheet.pdf | 2019-05-21 12:49 | 40K | |
![[ ]](/icons/layout.gif) | wallpod-ev-multimode-installation-sheet.pdf | 2019-05-21 12:52 | 34K | |
![[ ]](/icons/layout.gif) | wallpod-ev-ready-data-sheet---02.pdf | 2019-05-21 12:08 | 2.8M | |
![[ ]](/icons/layout.gif) | wallpod-ev-superfast-socketed-data-sheet---02-compressed.pdf | 2019-05-21 12:21 | 5.6M | |
![[ ]](/icons/layout.gif) | wallpod-ev-superfast-tethered-data-sheet---02-compressed.pdf | 2019-05-21 12:37 | 5.6M | |
![[ ]](/icons/layout.gif) | wallpod-ev-tethered-data-sheet---02.pdf | 2019-05-21 12:31 | 3.6M | |
![[ ]](/icons/layout.gif) | wamrine-10A-buck-boost-solar-controller-user-manual.pdf | 2018-02-12 10:01 | 7.9M | |
![[ ]](/icons/unknown.gif) | warranty | 2019-10-18 09:56 | 170K | |
![[ ]](/icons/layout.gif) | warranty---birdblocker-v2.pdf | 2023-11-03 15:27 | 2.4M | |
![[ ]](/icons/layout.gif) | warranty---ev-charger.pdf | 2023-10-16 12:17 | 119K | |
![[ ]](/icons/layout.gif) | warranty-alpha-rev-a5--1-.pdf | 2022-10-12 10:38 | 666K | |
![[ ]](/icons/layout.gif) | warranty-alpha-rev-a5.pdf | 2021-11-19 14:13 | 666K | |
![[ ]](/icons/layout.gif) | warranty-certificate-longi--210x285-midsummer-energy-stamped--1-.pdf | 2024-05-02 14:18 | 2.7M | |
![[ ]](/icons/layout.gif) | warranty-certificate-longi--210x285-midsummer-energy-stamped-modified-v01.pdf | 2024-05-20 13:01 | 3.0M | |
![[ ]](/icons/layout.gif) | warranty-rec-twinpeak-rev-c-web.pdf | 2021-11-23 16:31 | 0 | |
![[ ]](/icons/layout.gif) | warranty-terms-2018.pdf | 2022-08-10 11:55 | 170K | |
![[ ]](/icons/layout.gif) | warranty-terms-en--1-.pdf | 2023-11-23 10:33 | 59K | |
![[ ]](/icons/layout.gif) | warranty-terms-en.pdf | 2021-09-03 15:29 | 42K | |
![[ ]](/icons/layout.gif) | warranty.pdf | 2023-06-29 13:22 | 0 | |
![[ ]](/icons/unknown.gif) | warranty_rec_twinpeak_rev_c_web.pdf?t=1622018592 | 2021-05-26 09:53 | 1.2M | |
![[ ]](/icons/unknown.gif) | warranty_rec_twinpeak_rev_c_web.pdf?t=1624891201 | 2021-06-28 16:20 | 1.2M | |
![[ ]](/icons/unknown.gif) | warranty certificate | 2024-06-05 11:37 | 3.0M | |
![[ ]](/icons/layout.gif) | warrenty.pdf | 2022-06-29 17:15 | 918K | |
![[ ]](/icons/unknown.gif) | watch?v=0vo2u-d5fjc | 2021-06-14 12:08 | 479K | |
![[ ]](/icons/unknown.gif) | watch?v=sy9tuvivvjc&list=plsf6nurmjafbzeutteo7dhn22mhymp_kc | 2021-03-11 09:18 | 505K | |
![[ ]](/icons/layout.gif) | waterproof-10A-solar-controller-IP67.pdf | 2017-10-10 11:32 | 361K | |
![[ ]](/icons/layout.gif) | wattpilot-datasheet.pdf | 2021-09-14 12:41 | 206K | |
![[ ]](/icons/unknown.gif) | wced-3-way-metal-enclosure--2- | 2023-10-12 09:47 | 1.1M | |
![[ ]](/icons/layout.gif) | web-developer-pack.pdf | 2024-03-07 21:27 | 5.1M | |
![[ ]](/icons/layout.gif) | wec44100.pdf | 2024-04-22 15:00 | 885K | |
![[ ]](/icons/layout.gif) | weee-info-v1.pdf | 2021-03-10 12:50 | 113K | |
![[ ]](/icons/layout.gif) | western-15A-dual-mppt-solar-controller-user-manual.pdf | 2018-02-12 09:59 | 8.1M | |
![[ ]](/icons/layout.gif) | wet-battery-2-.pdf | 2022-02-02 17:11 | 510K | |
![[IMG]](/icons/image2.gif) | wh-inline-volumiser-25litre-dims.png | 2024-06-24 11:02 | 107K | |
![[IMG]](/icons/image2.gif) | whatsapp-image-2024-03-18-at-17.23.55-d0f5ae82.jpg | 2024-03-19 12:17 | 190K | |
![[ ]](/icons/layout.gif) | wi-br-quick-installation-guide.pdf | 2024-01-09 16:16 | 632K | |
![[ ]](/icons/layout.gif) | wifi-comms-guide-22.pdf | 2024-07-04 11:00 | 5.3M | |
![[ ]](/icons/layout.gif) | wild-entrust.pdf | 2022-12-14 15:50 | 281K | |
![[ ]](/icons/layout.gif) | winch-solar-battery-lifter.pdf | 2022-03-11 16:58 | 460K | |
![[ ]](/icons/layout.gif) | wind-load-information-from-grace-solar-fold-triangle.pdf | 2017-05-30 11:03 | 862K | |
![[ ]](/icons/unknown.gif) | wind-pressure-evaluation.xlsx | 2023-11-28 08:32 | 274K | |
![[ ]](/icons/layout.gif) | wind-zone-map-solion.pdf | 2017-11-02 12:49 | 145K | |
![[ ]](/icons/layout.gif) | wireless-bridge.pdf | 2024-01-09 16:16 | 2.7M | |
![[ ]](/icons/layout.gif) | wiringforshunt.pdf | 2022-05-26 14:27 | 103K | |
![[ ]](/icons/unknown.gif) | wiska-6-way-ip65-enclosure-data-sheet--2- | 2023-10-12 09:24 | 147K | |
![[ ]](/icons/layout.gif) | wiska-glp20-black.pdf | 2024-01-19 15:01 | 216K | |
![[ ]](/icons/layout.gif) | wiska-glp20-white.pdf | 2024-01-19 15:10 | 153K | |
![[ ]](/icons/layout.gif) | wiska-glp25-black.pdf | 2024-01-19 15:17 | 216K | |
![[ ]](/icons/layout.gif) | wiska-glp25-white.pdf | 2024-01-19 15:17 | 153K | |
![[ ]](/icons/layout.gif) | wit-50-100k-hu-eu-datasheet-en-202309--1-.pdf | 2024-07-24 10:52 | 2.2M | |
![[ ]](/icons/layout.gif) | wk-1---wall-mount.pdf | 2021-11-10 13:03 | 91K | |
![[ ]](/icons/layout.gif) | wmarine10-buck-boost-mppt-datasheet.pdf | 2017-09-06 13:38 | 848K | |
![[ ]](/icons/layout.gif) | wmarine10-buck-boost-mppt-manual.pdf | 2017-09-06 13:39 | 1.6M | |
![[ ]](/icons/layout.gif) | wmarine10_datasheet.pdf | 2019-09-26 14:06 | 4.4M | |
![[ ]](/icons/layout.gif) | wmarine_usermanual.pdf | 2019-09-26 14:05 | 6.0M | |
![[ ]](/icons/layout.gif) | wme-consumer-unit.pdf | 2023-10-12 10:57 | 308K | |
![[ ]](/icons/layout.gif) | workingfromhome.pdf | 2020-03-20 09:32 | 281K | |
![[ ]](/icons/layout.gif) | world-heat-pre-plumbed-datasheet-june-23.pdf | 2023-06-22 13:54 | 357K | |
![[ ]](/icons/layout.gif) | world-heat-pre-plumbed-datatsheet-2023.pdf | 2023-06-09 09:32 | 487K | |
![[ ]](/icons/layout.gif) | world-heat-slimline-datasheet-2023.pdf | 2023-06-26 15:52 | 356K | |
![[ ]](/icons/layout.gif) | wpe-i_04-15_h_k__230_premium__bfa55db9-0ee0-4cf5-9516-edb19cc87ffd.pdf | 2022-01-19 15:26 | 9.5M | |
![[ ]](/icons/layout.gif) | wpe-i_4-15_hw_230_gb_premium__d62e2d33-84de-4148-9c97-7ceb93739e43.pdf | 2022-01-19 15:43 | 14M | |
![[ ]](/icons/layout.gif) | wpki-hk-e---technical-datasheet.pdf | 2021-11-10 12:21 | 272K | |
![[ ]](/icons/layout.gif) | wpki-hk-e-installation-manual.pdf | 2021-11-10 12:20 | 842K | |
![[ ]](/icons/layout.gif) | wpl-17-acs---datasheet.pdf | 2021-11-09 12:13 | 1.8M | |
![[ ]](/icons/layout.gif) | wpl-17-acs---installation-manual.pdf | 2021-11-09 12:13 | 6.0M | |
![[ ]](/icons/layout.gif) | wpl-25-acs---installation-manual.pdf | 2021-11-08 10:49 | 13M | |
![[ ]](/icons/layout.gif) | wpl-25-acs---technical-datasheet.pdf | 2021-11-08 10:49 | 359K | |
![[ ]](/icons/layout.gif) | wpl-25-as---installation-manual.pdf | 2021-11-08 10:11 | 13M | |
![[ ]](/icons/layout.gif) | wpl-25-as---technical-datasheet.pdf | 2021-11-08 10:11 | 358K | |
![[ ]](/icons/layout.gif) | wpl-25-as-data.pdf | 2021-11-04 12:18 | 94K | |
![[ ]](/icons/layout.gif) | wpl_a_hk_premium.pdf | 2022-01-24 11:22 | 195K | |
![[ ]](/icons/layout.gif) | wr-updating-notice---x1-x3-hybrid-fit-g4-QRupdate-.pdf | 2024-04-16 13:09 | 150K | |
![[ ]](/icons/layout.gif) | wr-updating-notice-x1-x3-hybrid-fit-g4.pdf | 2024-03-26 11:34 | 116K | |
![[ ]](/icons/layout.gif) | wras-certificate---2011049---aav07911500b-aavs.pdf | 2023-07-12 12:40 | 110K | |
![[ ]](/icons/layout.gif) | wrm15_dualb_user_manual.pdf | 2019-01-25 15:15 | 8.1M | |
![[ ]](/icons/layout.gif) | x-anchor--no-cs--cc.pdf | 2023-10-12 15:11 | 89K | |
![[ ]](/icons/layout.gif) | x-anchor--no-cs-.pdf | 2024-02-16 08:40 | 89K | |
![[ ]](/icons/layout.gif) | x-hybrid-install-manual.pdf | 2017-05-19 17:23 | 2.9M | |
![[ ]](/icons/layout.gif) | x1-ac-1.pdf | 2022-08-30 16:00 | 4.3M | |
![[ ]](/icons/layout.gif) | x1-ac-3.0-3.6kw-g99-issue-1-amendment-6-2020-form-a2-3-20200409--1-.pdf | 2022-09-01 13:35 | 348K | |
![[ ]](/icons/layout.gif) | x1-ac-3.0-3.6kw-uk-g98-form-c.pdf | 2022-09-01 13:35 | 318K | |
![[ ]](/icons/layout.gif) | x1-boost-3-3.6-g98.pdf | 2019-05-09 16:41 | 733K | |
![[ ]](/icons/layout.gif) | x1-boost-datasheet.pdf | 2022-09-23 14:28 | 1.8M | |
![[ ]](/icons/layout.gif) | x1-boost-g3-datasheet-en--2-.pdf | 2024-03-27 13:05 | 167K | |
![[ ]](/icons/layout.gif) | x1-boost-g3-quick-installation-guide-en.pdf | 2024-03-27 13:05 | 1.9M | |
![[ ]](/icons/layout.gif) | x1-boost-g3-user-manual-en.pdf | 2024-03-27 13:05 | 4.7M | |
![[ ]](/icons/layout.gif) | x1-boost-g4-datasheet-en--.pdf | 2024-05-13 15:26 | 171K | |
![[ ]](/icons/layout.gif) | x1-boost-g4-datasheet-en--1-.pdf | 2024-03-27 12:45 | 171K | |
![[ ]](/icons/layout.gif) | x1-boost-g4-datasheet-en.pdf | 2024-04-02 11:58 | 171K | |
![[ ]](/icons/layout.gif) | x1-boost-g4-quick-installation-guide-en.pdf | 2024-05-13 15:25 | 4.0M | |
![[ ]](/icons/layout.gif) | x1-boost-g4-user-manual-en-.pdf | 2024-05-13 15:25 | 11M | |
![[ ]](/icons/layout.gif) | x1-boost-g4-user-manual-en.pdf | 2024-04-02 11:59 | 11M | |
![[ ]](/icons/layout.gif) | x1-boost-install-manual.pdf | 2017-06-06 10:34 | 2.9M | |
![[ ]](/icons/layout.gif) | x1-boost-new.pdf | 2021-02-25 10:59 | 922K | |
![[ ]](/icons/layout.gif) | x1-boost-user-manual.pdf | 2020-12-09 11:34 | 3.5M | |
![[ ]](/icons/layout.gif) | x1-boost3.0-installation-guide.pdf | 2021-02-25 11:01 | 1.7M | |
![[ ]](/icons/layout.gif) | x1-eps-box-uk.pdf | 2021-07-21 14:01 | 1.0M | |
![[ ]](/icons/layout.gif) | x1-fit-g4-v2.4.pdf | 2022-10-07 15:30 | 669K | |
![[ ]](/icons/layout.gif) | x1-fit-user-manual.pdf | 2020-08-10 16:18 | 9.3M | |
![[ ]](/icons/layout.gif) | x1-hybrid-1.pdf | 2022-02-18 14:14 | 570K | |
![[ ]](/icons/layout.gif) | x1-hybrid-4.6-5.0kw-g99-form-a2-3-issue-1-amd-3-20190626--1-.pdf | 2022-08-31 17:09 | 346K | |
![[ ]](/icons/layout.gif) | x1-hybrid-4.6-5.0kw-g99-form-a2-3-issue-1-amd-3-20190626.pdf | 2022-08-30 16:26 | 346K | |
![[ ]](/icons/layout.gif) | x1-hybrid-datasheet.pdf | 2021-06-29 11:28 | 882K | |
![[ ]](/icons/layout.gif) | x1-hybrid-g4-quick-installation-guide-1.pdf | 2022-02-18 11:53 | 5.5M | |
![[ ]](/icons/layout.gif) | x1-hybrid-g4-user-manual--1-.pdf | 2022-06-30 10:52 | 11M | |
![[ ]](/icons/layout.gif) | x1-hybrid-g4-user-manual-614.00495.00.pdf | 2022-04-12 11:22 | 11M | |
![[ ]](/icons/layout.gif) | x1-hybrid-g4-user-manual.pdf | 2022-02-18 11:53 | 11M | |
![[ ]](/icons/layout.gif) | x1-hybrid-g4-v2.0-datasheet.pdf | 2022-02-18 14:14 | 1.6M | |
![[ ]](/icons/layout.gif) | x1-hybrid-g4-v2.1.pdf | 2022-06-30 10:48 | 1.6M | |
![[ ]](/icons/layout.gif) | x1-hybrid-hv-user-manual.pdf | 2020-03-24 11:17 | 12M | |
![[ ]](/icons/layout.gif) | x1-hybrid-single-phase-gen3-user-manual.pdf | 2020-05-20 11:04 | 9.4M | |
![[ ]](/icons/layout.gif) | x1-mini-datasheetnl.pdf | 2021-02-25 13:05 | 850K | |
![[ ]](/icons/layout.gif) | x1-mini-g3-datesheet-en--1-.pdf | 2024-03-27 11:26 | 187K | |
![[ ]](/icons/layout.gif) | x1-mini-g3-quick-installation-en--1-.pdf | 2024-03-27 11:26 | 1.6M | |
![[ ]](/icons/layout.gif) | x1-mini-g3-user-manual-en--1-.pdf | 2024-03-27 11:26 | 3.3M | |
![[ ]](/icons/layout.gif) | x1-mini-g4-datasheets-en.pdf | 2024-04-02 11:53 | 170K | |
![[ ]](/icons/layout.gif) | x1-mini-g4-quick-installation-guide-en.pdf | 2024-04-02 11:54 | 3.9M | |
![[ ]](/icons/layout.gif) | x1-mini-g4-user-manual-en.pdf | 2024-04-02 11:54 | 10M | |
![[ ]](/icons/layout.gif) | x1-retro-fit.pdf | 2020-04-23 14:19 | 3.9M | |
![[ ]](/icons/layout.gif) | x1-smart-datasheet-en.pdf | 2024-06-14 10:15 | 414K | |
![[ ]](/icons/layout.gif) | x1-smart-technical-datasheet.pdf | 2022-06-24 15:08 | 744K | |
![[ ]](/icons/layout.gif) | x1-x3-hybrid-hv.pdf | 2019-01-04 15:49 | 1.4M | |
![[ ]](/icons/layout.gif) | x3-3ph-retrofit-user-manual.pdf | 2020-01-22 11:48 | 8.0M | |
![[ ]](/icons/layout.gif) | x3-10kw-fit-user-manual.pdf | 2020-02-18 12:20 | 8.0M | |
![[ ]](/icons/layout.gif) | x3-fit-g4-v2.4--1-.pdf | 2022-12-01 12:25 | 3.4M | |
![[ ]](/icons/layout.gif) | x3-forth-datasheet-en.pdf | 2024-04-04 16:10 | 229K | |
![[ ]](/icons/layout.gif) | x3-forth-quick-installation-guide-en.pdf | 2024-04-04 16:11 | 7.7M | |
![[ ]](/icons/layout.gif) | x3-forth-user-manual-en.pdf | 2024-04-04 16:10 | 3.7M | |
![[ ]](/icons/layout.gif) | x3-hybrid-5.0-10.0kw-uk-g98-form-c-type-test-verification-report-20190628.pdf | 2022-09-01 13:25 | 379K | |
![[ ]](/icons/layout.gif) | x3-hybrid-and-x3-fit-g98.pdf | 2019-05-09 16:45 | 379K | |
![[ ]](/icons/layout.gif) | x3-hybrid-datasheet.pdf | 2021-06-29 11:45 | 609K | |
![[ ]](/icons/layout.gif) | x3-hybrid-g1.0-user-manul.pdf | 2022-06-24 15:57 | 9.0M | |
![[ ]](/icons/layout.gif) | x3-hybrid-g4-datasheet-en.pdf | 2024-05-22 12:45 | 748K | |
![[ ]](/icons/layout.gif) | x3-hybrid-g4-manufacturers-g100-product-declaration.pdf | 2022-09-01 13:28 | 757K | |
![[ ]](/icons/layout.gif) | x3-hybrid-g4-v2.1-datasheet.pdf | 2022-08-30 15:52 | 1.8M | |
![[ ]](/icons/layout.gif) | x3-hybrid-g4.pdf | 2022-06-24 15:58 | 740K | |
![[ ]](/icons/layout.gif) | x3-hybrid2.0-5-10kw-uk-g99-form-a2-3-issue-1-amd-3-20190904.pdf | 2022-09-01 13:25 | 670K | |
![[ ]](/icons/layout.gif) | x3-mic-4-10kw-data-sheet-v3.pdf | 2022-02-08 16:42 | 1.3M | |
![[ ]](/icons/layout.gif) | x3-pro-technical-datasheet.pdf | 2022-06-28 17:18 | 664K | |
![[ ]](/icons/layout.gif) | x3-pro-user-manual.pdf | 2022-06-28 17:17 | 4.0M | |
![[ ]](/icons/layout.gif) | x3-retro-fit-ac-coupled-datasheet.pdf | 2021-02-08 09:09 | 263K | |
![[ ]](/icons/layout.gif) | x3-ultra-datasheet-en.pdf | 2024-04-17 10:19 | 2.0M | |
![[ ]](/icons/layout.gif) | x3fitusermanual-compressed-compressed--1-.pdf | 2023-09-07 11:05 | 7.5M | |
![[ ]](/icons/layout.gif) | x3fitusermanual-compressed.pdf | 2023-04-12 13:36 | 9.1M | |
![[ ]](/icons/layout.gif) | xplus---samsung-quick-start.pdf | 2024-02-28 16:52 | 7.7M | |
![[ ]](/icons/layout.gif) | xplus-installation-manual.pdf | 2023-12-13 10:56 | 4.0M | |
![[ ]](/icons/layout.gif) | zappi--2-declaration-of-conformity.pdf | 2021-08-31 10:56 | 712K | |
![[ ]](/icons/layout.gif) | zappi-brochure.pdf | 2018-05-18 16:22 | 2.0M | |
![[ ]](/icons/layout.gif) | zappi-datasheet.pdf | 2018-05-18 16:20 | 423K | |
![[ ]](/icons/layout.gif) | zappi-double-post.pdf | 2021-04-22 12:11 | 275K | |
![[ ]](/icons/layout.gif) | zappi-manual-v1-2.pdf | 2018-05-18 16:23 | 751K | |
![[ ]](/icons/layout.gif) | zappi-pedestal-datasheet-rev-1.0-june-2022--1-.pdf | 2022-08-15 11:51 | 412K | |
![[ ]](/icons/layout.gif) | zappi-pedestal-installation-manual-rev-1.2.pdf | 2022-08-15 11:53 | 417K | |
![[ ]](/icons/layout.gif) | zappi-single-post.pdf | 2021-04-22 12:38 | 336K | |
![[ ]](/icons/layout.gif) | zappi-v2-1-smart-ev-charger-datasheet.pdf | 2022-04-28 14:31 | 399K | |
![[ ]](/icons/layout.gif) | zappi-v2-data-sheet.pdf | 2018-12-21 11:17 | 419K | |
![[ ]](/icons/layout.gif) | zappi-v2-manual-100920-comp.pdf | 2020-09-10 11:39 | 1.1M | |
![[ ]](/icons/layout.gif) | zappi-v2-manual-100920.pdf | 2020-09-10 11:37 | 12M | |
![[ ]](/icons/layout.gif) | zappi-v2-manual.pdf | 2019-07-09 09:11 | 768K | |
![[ ]](/icons/layout.gif) | zappi-v2.1-datasheet-rev-2.1.6-english-march-2023.pdf | 2023-05-04 10:16 | 198K | |
![[ ]](/icons/layout.gif) | zappi-v2.1-full-manual-v2-1-3-h-english-1.pdf | 2022-06-23 16:30 | 3.9M | |
![[ ]](/icons/layout.gif) | zappi-v2.1-g-user-manual-rev-1.7-july-2023.pdf | 2023-12-07 12:19 | 2.1M | |
![[ ]](/icons/layout.gif) | zappi-v2.1-install-manual-rev-2.2-march-2023.pdf | 2023-05-04 10:17 | 4.4M | |
![[ ]](/icons/layout.gif) | zertifikat-ce-fuer-huawei-sun2000-20ktl-m2-wechselrichter.pdf | 2021-12-02 10:00 | 2.1M | |
![[ ]](/icons/layout.gif) | zertifikat-en50549-1-huawei-sun2000-3-10ktl-m1-bosnien.pdf | 2024-03-25 11:16 | 267K | |
![[ ]](/icons/layout.gif) | zestec-webinar-pres.pdf | 2020-05-01 17:15 | 4.6M | |
![[ ]](/icons/layout.gif) | zestecmidsummer-ppa.pdf | 2020-05-04 10:42 | 1.2M | |
![[ ]](/icons/layout.gif) | ziehl-UFR1001E-manual.pdf | 2022-02-04 12:46 | 0 | |
![[ ]](/icons/layout.gif) | ziehl-voltage-&-frequency-relay-ufr1001e.pdf | 2022-02-04 12:46 | 0 | |
![[ ]](/icons/unknown.gif) | zigbeedatasheet | 2019-10-17 15:45 | 809K | |
![[ ]](/icons/layout.gif) | zmd410--ofgem-certificate.pdf | 2019-03-27 10:34 | 326K | |
![[ ]](/icons/layout.gif) | zmd410-brochure.pdf | 2019-03-27 10:34 | 428K | |
![[ ]](/icons/layout.gif) | zmd410-manual.pdf | 2019-03-27 10:36 | 2.1M | |
![[ ]](/icons/layout.gif) | zmd410-meter-datasheet.pdf | 2019-03-27 10:34 | 191K | |
![[ ]](/icons/layout.gif) | zmd410-warranty.pdf | 2017-05-19 17:23 | 238K | |
![[ ]](/icons/layout.gif) | ztelithium-datasheet.pdf | 2017-05-19 17:23 | 367K | |
![[ ]](/icons/layout.gif) | zypho-midsummer-flyer-sep2022.pdf | 2022-09-27 08:58 | 1.4M | |
|